@Preamble{
"\input bibnames.sty " #
"\input path.sty " #
"\def \TM {${}^{\sc TM}$} " #
"\hyphenation{
al-pha-mer-ic
Balz-er
Blom-quist
Bo-ta-fo-go
Bran-din
Brans-comb
Bu-tera
Chris-tina
Christ-o-fi-des
Col-lins
Cor-dell
data-base
econ-omies
Fletch-er
flow-chart
flow-charts
Fry-styk
ge-dank-en
Gar-fink-el
Ge-ha-ni
Glush-ko
Goud-reau
Gua-dan-go
Hari-di
Haw-thorn
Hem-men-ding-er
Hor-o-witz
Hour-vitz
Hirsch-berg
Ike-da
Ka-chi-tvi-chyan-u-kul
Kat-ze-nel-son
Kitz-miller
Ko-ba-yashi
Le-Me-tay-er
Ken-ne-dy
Law-rence
Mac-kay
Mai-net-ti
Mar-sa-glia
Max-well
Mer-ner
Mo-ran-di
Na-ray-an
New-ell
Nich-ols
para-digm
pat-ent-ed
Phi-lo-kyp-rou
Prep-a-ra-ta
pseu-do-chain-ing
QUIK-SCRIPT
Rad-e-mach-er
re-eval-u-a-tion
re-wind
Ros-witha
Scheu-er-mann
Schwach-heim
Schob-bens
Schon-berg
Sho-sha-ni
Si-tha-ra-ma
Skwa-rec-ki
Streck-er
Strin-gi-ni
Tes-ler
Te-zu-ka
Teu-ho-la
Till-quist
Town-send
Tsi-chri-tzis
Tur-ski
Vuille-min
Wald-ing-er
Za-bo-row-ski
Za-mora
}"}
@String{ack-nhfb = "Nelson H. F. Beebe,
University of Utah,
Department of Mathematics, 110 LCB,
155 S 1400 E RM 233,
Salt Lake City, UT 84112-0090, USA,
Tel: +1 801 581 5254,
e-mail: \path|beebe@math.utah.edu|,
\path|beebe@acm.org|,
\path|beebe@computer.org| (Internet),
URL: \path|https://www.math.utah.edu/~beebe/|"}
@String{ack-nj = "Norbert Juffa,
2445 Mission College Blvd.
Santa Clara, CA 95054
USA
email: \path=norbert@iit.com="}
@String{j-CACM = "Communications of the ACM"}
@String{j-COMP-SURV = "Computing Surveys"}
@String{j-J-ACM = "Journal of the ACM"}
@String{j-MANAGEMENT-SCIENCE = "Management Science"}
@String{j-SIAM-J-COMPUT = "SIAM Journal on Computing"}
@String{j-SPE = "Software --- Practice and Experience"}
@String{j-TOMS = "ACM Transactions on Mathematical Software"}
@String{pub-ANSI = "American National Standards Institute"}
@String{pub-ANSI:adr = "1430 Broadway, New York, NY 10018, USA"}
@String{pub-AW = "Ad{\-d}i{\-s}on-Wes{\-l}ey"}
@String{pub-AW:adr = "Reading, MA, USA"}
@String{pub-MORGAN-KAUFMANN = "Morgan Kaufmann Publishers"}
@String{pub-MORGAN-KAUFMANN:adr = "Los Altos, CA 94022, USA"}
@String{pub-SUCSLI = "Stanford University Center for the Study of
Language and Information"}
@String{pub-SUCSLI:adr = "Stanford, CA, USA"}
@Article{Herndon:1961:AASa,
author = "J. R. Herndon",
title = "{ACM Algorithm 49}: Spherical {Neumann} Function",
journal = j-CACM,
volume = "4",
number = "4",
pages = "179",
month = apr,
year = "1961",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:50 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Coleman:1978:RAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Merner:1962:AAC,
author = "J. N. Merner",
title = "{ACM Algorithm 149}: Complete Elliptic Integral",
journal = j-CACM,
volume = "5",
number = "12",
pages = "605",
month = dec,
year = "1962",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:50 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Skovgaard:1978:RCE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Arthurs:1963:AAL,
author = "T. D. Arthurs",
title = "{ACM Algorithm 176}: Least Squares Surface Fit",
journal = j-CACM,
volume = "6",
number = "6",
pages = "313",
month = jun,
year = "1963",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:31:33 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Schuegraf:1972:RAL}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Ludwig:1963:AAI,
author = "O. G. Ludwig",
title = "{ACM Algorithm 179}: Incomplete Beta Ratio",
journal = j-CACM,
volume = "6",
number = "6",
pages = "314",
month = jun,
year = "1963",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:50 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Pike:1976:RIB,Bosten:1974:RAI}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Relph:1963:AAH,
author = "A. P. Relph",
title = "{ACM Algorithm 191}: Hypergeometric",
journal = j-CACM,
volume = "6",
number = "7",
pages = "388--389",
month = jul,
year = "1963",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:02 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Koppelaar:1974:CRA}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Thurnau:1963:AAB,
author = "D. H. Thurnau",
title = "{ACM Algorithm 195}: {BANDSOLVE}",
journal = j-CACM,
volume = "6",
number = "8",
pages = "441",
month = aug,
year = "1963",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:11 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Schuegraf:1972:RAB}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Kase:1963:AAT,
author = "R. H. Kase",
title = "{ACM Algorithm 219}: Topological Ordering for {Pert}
Networks",
journal = j-CACM,
volume = "6",
number = "12",
pages = "738--739",
month = dec,
year = "1963",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:51 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Tenney:1977:RAT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gautschi:1964:AAI,
author = "W. Gautschi",
title = "{ACM Algorithm 222}: Incomplete Beta Function Ratios",
journal = j-CACM,
volume = "7",
number = "3",
pages = "143--144",
month = mar,
year = "1964",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:19 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Kolm:1971:MAL,Ellis:1974:RAHb}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gautschi:1964:AAB,
author = "W. Gautschi",
title = "{ACM Algorithm 236}: {Bessel} Functions of the First
Kind [{S17}]",
journal = j-CACM,
volume = "7",
number = "8",
pages = "479--480",
month = aug,
year = "1964",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/355586.355587",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Nov 25 18:19:55 MST 2005",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1960.bib;
http://portal.acm.org/;
http://www.acm.org/pubs/contents/journals/cacm/;
https://www.math.utah.edu/pub/tex/bib/cacm1960.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Skovgaard:1975:RBF}.",
acknowledgement = ack-nhfb,
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "$J_n(x)$; Bessel functions of the first kind; special
functions",
}
@Article{Boothroyd:1964:AAG,
author = "J. Boothroyd",
title = "{ACM Algorithm 246}: Graycode",
journal = j-CACM,
volume = "7",
number = "12",
pages = "701",
month = dec,
year = "1964",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:54 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Misra:1975:RG,Er:1985:RG}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Floyd:1964:AAT,
author = "R. W. Floyd",
title = "{ACM Algorithm 245}: Treesort 3",
journal = j-CACM,
volume = "7",
number = "12",
pages = "701",
month = dec,
year = "1964",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:18 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{London:1970:CAM}.",
acknowledgement = ack-nhfb,
author-dates = "Robert W. Floyd (8 June 1936--25 September 2001)",
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gautschi:1965:AAL,
author = "W. Gautschi",
title = "{ACM Algorithm 259}: {Legendre} Functions for
Arguments Larger than One",
journal = j-CACM,
volume = "8",
number = "8",
pages = "488--492",
month = aug,
year = "1965",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:54 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Jansen:1977:RLF}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Pike:1965:AAP,
author = "M. C. Pike and I. D. Hill",
title = "{ACM Algorithm 266}: Pseudo-Random Numbers",
journal = j-CACM,
volume = "8",
number = "10",
pages = "605--606",
month = oct,
year = "1965",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:34 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Sullins:1972:CAP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gautschi:1966:AD,
author = "Walter Gautschi",
title = "{Algorithm 282}: {Derivatives} of $e^x/x$,
$\cos(x)/x$, and $\sin(x)/x$",
journal = j-CACM,
volume = "9",
number = "4",
pages = "272--272",
month = apr,
year = "1966",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Nov 25 18:20:05 MST 2005",
bibsource = "ftp://ftp.math.utah.edu/pub/tex/bib/cacm1960.bib;
http://www.acm.org/pubs/contents/journals/cacm/;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Gautschi:1970:RAD}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "$\cos(x)/x$; $\sin(x)/x$; $e^x/x$; elementary
functions",
}
@Article{Fletcher:1966:AAI,
author = "W. Fletcher",
title = "{ACM Algorithm 284}: Interchange of Two Blocks of
Data",
journal = j-CACM,
volume = "9",
number = "5",
pages = "326",
month = may,
year = "1966",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:54 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Ito:1976:RIT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Hill:1967:AAC,
author = "I. D. Hill and M. C. Pike",
title = "{ACM Algorithm 299}: Chi-Squared Integral",
journal = j-CACM,
volume = "10",
number = "4",
pages = "243--244",
month = apr,
year = "1967",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:47:54 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Lozy:1976:RCS,Hill:1985:RCS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gunn:1967:AAC,
author = "J. H. Gunn",
title = "{ACM Algorithm 300}: {Coulomb} Wave Functions",
journal = j-CACM,
volume = "10",
number = "4",
pages = "244--245",
month = apr,
year = "1967",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:53 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Vos:1973:RAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Brown:1967:AAS,
author = "K. M. Brown",
title = "{ACM Algorithm 316}: Solution of Simultaneous
Nonlinear Equations",
journal = j-CACM,
volume = "10",
number = "11",
pages = "728--729",
month = nov,
year = "1967",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:50 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Raduchel:1971:RAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Ord-Smith:1968:AAG,
author = "R. J. Ord-Smith",
title = "{ACM Algorithm 323}: Generation of Permutations in
Lexicographic Order",
journal = j-CACM,
volume = "11",
number = "2",
pages = "117",
month = feb,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:33:05 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Leitch:1969:CGP} and remark
\cite{Roy:1973:RAG}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Bayer:1968:AAM,
author = "G. Bayer",
title = "{ACM Algorithm 324}: Maxflow",
journal = j-CACM,
volume = "11",
number = "2",
pages = "117--118",
month = feb,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:32:59 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Bayer:1973:RAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Dijkstra:1968:GSC,
author = "Edsger Wybe Dijkstra",
title = "Go to statement considered harmful",
journal = j-CACM,
volume = "11",
number = "3",
pages = "147--148",
month = mar,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "This paper inspired scores of others, published mainly
in SIGPLAN Notices up to the mid-1980s. The best-known
is \cite{Knuth:1974:SPG}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Witte:1968:AAJ,
author = "B. F. W. Witte",
title = "{ACM Algorithm 332}: {Jacobi} Polynomials",
journal = j-CACM,
volume = "11",
number = "6",
pages = "436--437",
month = jun,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:33:08 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Skovgaard:1975:RAJ}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Salazar:1968:AAM,
author = "R. C. Salazar and S. K. Sen",
title = "{ACM Algorithm 333}: Minit Algorithm For Linear
Programming",
journal = j-CACM,
volume = "11",
number = "6",
pages = "437--440",
month = jun,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:33:06 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark
\cite{Holmgren:1973:RAM,Obradovic:1973:RAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Grad:1968:AAE,
author = "J. Grad and M. A. Brebner",
title = "{ACM Algorithm 343}: Eigenvalues and Eigenvectors of a
Real Generator Matrix",
journal = j-CACM,
volume = "11",
number = "12",
pages = "820--826",
month = dec,
year = "1968",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Mar 24 21:38:51 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Niessner:1972:RAE}.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Computer Services, Univ. Birmingham, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "eigenvalues and eigenfunctions; matrix algebra",
}
@Article{Singleton:1969:AAEa,
author = "R. C. Singleton",
title = "{ACM Algorithm 347}: An Efficient Algorithm for
Sorting with Minimal Storage",
journal = j-CACM,
volume = "12",
number = "3",
pages = "185--187",
month = mar,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Mar 24 21:38:51 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks \cite{Griffin:1970:RME,Peto:1970:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "C6150E (General utility programs)",
corpsource = "Stanford Research Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computer sorting; minimal storage sorting;
sorting; subroutines",
}
@Article{ANSI:1969:CFS,
author = "{ANSI Subcommittee X3J3}",
title = "Clarification of {Fortran} Standards --- Initial
Progress",
journal = j-CACM,
volume = "12",
number = "5",
pages = "289--294",
month = may,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Aug 29 18:26:25 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{ANSI:1966:AF}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Clemm:1969:AAC,
author = "D. S. Clemm",
title = "{ACM Algorithm 352}: Characteristic Values and
Associated Solutions of {Mathieu}'s Differential
Equation",
journal = j-CACM,
volume = "12",
number = "7",
pages = "399--407 (or 399--406??)",
month = jul,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Mar 24 21:38:51 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Frisch:1972:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations); C7300 (Natural
sciences computing)",
corpsource = "Wright-Patterson Air Force Base, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "differential equations; function evaluation;
subroutines",
}
@Article{Wirth:1969:MMC,
author = "N. Wirth",
title = "On Multiprogramming, Machine Coding, and Computer
Organization",
journal = j-CACM,
volume = "12",
number = "9",
pages = "489--498",
month = sep,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:23:22 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Wirth:1970:CMM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Leitch:1969:CGP,
author = "I. M. Leitch",
title = "Certification of {ACM Algorithm 323 [G6]}: Generation
of Permutations in Lexicographic Order",
journal = j-CACM,
volume = "12",
number = "9",
pages = "512--512",
month = sep,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Feb 01 07:26:28 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ord-Smith:1968:AAG,Roy:1973:RAG}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "direct lexicographic order; lexicographic generation;
permutations; reverse lexicographic order",
}
@Article{Singleton:1969:AAEb,
author = "R. C. Singleton",
title = "{ACM Algorithm 357}: An Efficient Prime Number
Generator",
journal = j-CACM,
volume = "12",
number = "10",
pages = "563--564",
month = oct,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Mar 24 21:38:51 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{DeMorgan:1973:RAE}.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Stanford Research Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; number theory; subroutines",
}
@Article{Gautschi:1969:AAC,
author = "W. Gautschi",
title = "{ACM Algorithm 363}: Complex Error Function",
journal = j-CACM,
volume = "12",
number = "11",
pages = "635",
month = nov,
year = "1969",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:33:14 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Kolbig:1972:CAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Lowe:1970:ASC,
author = "T. C. Lowe",
title = "Automatic segmentation of cyclic program structures
based on connectivity and processor timing",
journal = j-CACM,
volume = "13",
number = "1",
pages = "3--6",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
corpsource = "Informatics Inc., Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "input-output programs; multiprogramming; program
processors; time-sharing programs",
}
@Article{Gautschi:1970:RCC,
author = "Walter Gautschi and Bruce J. Klein",
title = "Recursive computation of certain derivatives --- {A}
study of error propagation",
journal = j-CACM,
volume = "13",
number = "1",
pages = "7--9",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65Q05",
MRnumber = "46 1115",
MRreviewer = "D. F. Mayers",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A brief study is made of the propagation of errors in
linear first-order difference equations. The recursive
computation of successive derivatives of $(e^x)/x$ and
$(\cos x)/x$ is considered as an illustration.",
acknowledgement = ack-nhfb,
classcodes = "C4110 (Error analysis in numerical methods)",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "difference equations; error analysis; error
propagation; recursive computation; successive
derivatives",
}
@Article{Mullery:1970:PAM,
author = "A. P. Mullery and G. C. Driscoll",
title = "A processor allocation method for time-sharing",
journal = j-CACM,
volume = "13",
number = "1",
pages = "10--14",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "IBM, Thomas J. Watson Res. Center Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "storage allocation; time-sharing programs",
}
@Article{Simmons:1970:NLQ,
author = "R. F. Simmons",
title = "Natural Language Question-Answering Systems: 1969",
journal = j-CACM,
volume = "13",
number = "1",
pages = "15--30",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; computational linguistics;
language; translation and linguistics",
}
@Article{Irons:1970:EEL,
author = "E. T. Irons",
title = "Experience with an extensible language",
journal = j-CACM,
volume = "13",
number = "1",
pages = "31--40",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Inst. Defense Analyses Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "procedure oriented languages",
}
@Article{Montanari:1970:NML,
author = "Ugo Montanari",
title = "A note on minimal length polygonal approximation to a
digitized contour",
journal = j-CACM,
volume = "13",
number = "1",
pages = "41--47",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.20",
MRnumber = "44\#2311",
bibdate = "Mon Jan 22 07:05:22 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Montanari70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method for extracting a smooth polygonal contour
from a digitized image is illustrated. The ordered
sequence of contour points and the connection graph of
the image are first obtained by a modified Ledley
algorithm in one image scan. A minimal perimeter
polygon subjected to specified constraints is then
chosen as the approximating contour. The determination
of the minimal polygon can be reduced to a nonlinear
programming problem, solved by an algorithm which takes
into account the weak bonds between variables. Some
examples are presented, and the corresponding computing
times are listed.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Consiglio Nazionale delle Richerche, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "connection tree; digitized image; minimal polygon;
nonlinear programming; optimal approximation; pattern
recognition",
oldlabel = "Montanari70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Montanari70",
}
@Article{Stehfest:1970:AAN,
author = "Harald Stehfest",
title = "{ACM Algorithm 368}: Numerical Inversion of {Laplace}
Transforms",
journal = j-CACM,
volume = "13",
number = "1",
pages = "47--49",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "J. W. Goethe Univ. Frankfurt am Main, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Laplace transforms; subroutines",
}
@Article{Schaffer:1970:AAG,
author = "H. E. Schaffer",
title = "{ACM Algorithm 369}: Generator of Random Numbers
Satisfying the {Poisson} Distribution",
journal = j-CACM,
volume = "13",
number = "1",
pages = "49--49",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "North Carolina State Univ., Raleigh, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "random number generation; subroutines",
}
@Article{Butler:1970:AAG,
author = "E. L. Butler",
title = "{ACM Algorithm 370}: General Random Number Generator",
journal = j-CACM,
volume = "13",
number = "1",
pages = "49--52",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Proll:1972:RAA}.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Texas A and M Univ., College Station, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "random number generation; subroutines",
}
@Article{McKay:1970:AAP,
author = "J. K. S. McKay",
title = "{ACM Algorithm 371}: Partitions in Natural Order",
journal = j-CACM,
volume = "13",
number = "1",
pages = "52--52",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "California Inst. Technol. Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "number theory; subroutines",
}
@Article{Dunham:1970:AAA,
author = "K. B. Dunham",
title = "{ACM Algorithm 372}: An Algorithm to Produce Complex
Primes {CSIEVE}",
journal = j-CACM,
volume = "13",
number = "1",
pages = "52--54",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Georgia Inst. Technol., Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "number theory; subroutines",
xxnote = "Check pages??",
}
@Article{Gautschi:1970:RAD,
author = "Walter Gautschi and Bruce J. Klein",
title = "Remark on {Algorithm 282, Derivatives of $e^x / x$,
$\cos(x) / x$, and $\sin(x) / x$}",
journal = j-CACM,
volume = "13",
number = "1",
pages = "53--54",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Oct 30 07:27:17 2010",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gautschi:1966:AD}.",
acknowledgement = ack-nhfb,
citedby = "Fullerton:1980:BEM",
journal-URL = "https://dl.acm.org/loi/cacm",
remark = "Fullerton: Corrections are given for several Algol
procedures.",
}
@Article{Griffin:1970:RME,
author = "R. Griffin and K. A. Redich",
title = "Remark on ``{Algorithm 347}: {An Efficient Algorithm
for Sorting with Minimal Storage [{M1}]}, by {R. C.
Singleton}''",
journal = j-CACM,
volume = "13",
number = "1",
pages = "54--54",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:26:41 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Singleton:1969:AAEa,Peto:1970:RAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computer sorting; minimal storage sorting;
sorting",
}
@Article{Anonymous:1970:RCD,
author = "Anonymous",
title = "Representation for calendar date for
machine-to-machine data interchange",
journal = j-CACM,
volume = "13",
number = "1",
pages = "55--55",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "codes; standards",
}
@Article{Anonymous:1970:IRP,
author = "Anonymous",
title = "Interchange rolls of perforated tape for information
interchange",
journal = j-CACM,
volume = "13",
number = "1",
pages = "56--56",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5320Z (Other digital storage); C5560 (Data
preparation equipment); C7250 (Information storage and
retrieval)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital storage; equipment; information retrieval;
punched tape; standards",
}
@Article{Payne:1970:FTP,
author = "W. H. Payne",
title = "{Fortran Tausworthe} pseudorandom number generator",
journal = j-CACM,
volume = "13",
number = "1",
pages = "57--57",
month = jan,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Washington State Univ. Pullman, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "random number generation",
}
@Article{Hsiao:1970:FSI,
author = "David K. Hsiao and Frank D. Harary",
title = "A Formal System for Information Retrieval from Files",
journal = j-CACM,
volume = "13",
number = "2",
pages = "67--73",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigenda \cite{Hsiao:1970:CFS}.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
corpsource = "Univ. Pennsylvania, Philadelphia, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "file organisation; information retrieval",
}
@Article{vonGlaserfeld:1970:MPH,
author = "E. {von Glaserfeld} and P. P. Pisani",
title = "The multistore parser for hierarchical syntactic
structures",
journal = j-CACM,
volume = "13",
number = "2",
pages = "74--82",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. Georgia, Athens, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computational linguistics",
}
@Article{Vere:1970:TE,
author = "Steven Vere",
title = "Translation equations",
journal = j-CACM,
volume = "13",
number = "2",
pages = "83--89",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "45 4925",
MRreviewer = "H. Maurer",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See errata \cite{Vere:1970:TEE}.",
abstract = "Input limited transduction expressions, or translation
equations, are used to describe the syntax and
left-context sensitive semantics for context-free
languages. A formal procedure is given for deriving
from a set of translation equations the specifications
for a pushdown translator. The translator consists of
Mealy form finite-state automata interacting by means
of a pushdown stack. Within the framework described
string recognition and parsing may be treated as
special cases of the translation problem.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automata; computational linguistics; context-free
languages; finite state automata; formal languages;
meta-compilers; parsing; pushdown transducer;
recognizers; regular expression; syntax directed
compilers; transduction expression; translation; Turing
machines",
}
@Article{Morgan:1970:SCS,
author = "H. L. Morgan",
title = "Spelling correction in systems programs",
journal = j-CACM,
volume = "13",
number = "2",
pages = "90--94",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:33:52 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Several specialized techniques are shown for
efficiently incorporating spelling correction
algorithms in to compilers and operating systems. These
include the use of syntax and semantics information,
the organization of restricted keyword and symbol
tables, and the consideration of a limited class of
spelling errors. Sample 360 coding for performing
spelling correction is presented. By using systems
which perform spelling correction, the number of
debugging runs per program has been decreased, saving
both programmer and machine time.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compilers; computer science and automata; debugging;
diagnostics; error correction; error detection; lexical
analysis systems programming; misspelling; operating
systems; program debugging; spelling correction;
subroutines",
}
@Article{Earley:1970:ECF,
author = "Jay Earley",
title = "An Efficient Context-Free Parsing Algorithm",
journal = j-CACM,
volume = "13",
number = "2",
pages = "94--102",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:10 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Earley70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A parsing algorithm which seems to be the most
efficient general context-free algorithm known is
described. It is similar to both Knuth's LR(k)
algorithm and the familiar top-down algorithm. It has a
time bound proportional to $n^3$ (where $n$ is the
length of the string being parsed) in general; it has a
$n^2$ bound for unambiguous grammars; and it runs in
linear time on a large class of grammars, which seems
to include most practical context-free programming
language grammars. In an empirical comparison it
appears to be superior to the top-down and bottom-up
algorithms studied by Griffiths and Petrick.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6150C (Compilers, interpreters
and other processors)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compilers; computational complexity; computational
linguistics; context-free grammar; parsing; program
compilers; syntax analysis",
oldlabel = "Earley70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Earley70",
}
@Article{Radke:1970:UQR,
author = "C. E. Radke",
title = "The Use of Quadratic Residue Research",
journal = j-CACM,
volume = "13",
number = "2",
pages = "103--105",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "IBM, Endicott, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data handling; programming",
}
@Article{Jones:1970:VSA,
author = "B. Jones",
title = "A Variation on Sorting by Address Calculation",
journal = j-CACM,
volume = "13",
number = "2",
pages = "105--107",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Martin Marietta Corp., Orlando, FL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "sorting",
}
@Article{Bell:1970:QQM,
author = "James R. Bell",
title = "The Quadratic Quotient Method: {A} Hash Code
Eliminating Secondary Clustering",
journal = j-CACM,
volume = "13",
number = "2",
pages = "107--109",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:21 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Bell70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/hash.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computers; programming; table lookup",
oldlabel = "Bell70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bell70",
}
@Article{Ness:1970:CEG,
author = "D. N. Ness and R. S. Green and W. A. Martin and G. A.
Moulton",
title = "Computer education in a graduate school of
management",
journal = j-CACM,
volume = "13",
number = "2",
pages = "110--114, 19",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "M.I.T., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "education; management; simulation",
}
@Article{Robbins:1970:ICS,
author = "M. F. Robbins and J. D. Beyer",
title = "An interactive computer system using graphical
flowchart input",
journal = j-CACM,
volume = "13",
number = "2",
pages = "115--119",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7400 (Engineering computing); C5540 (Terminals and
graphic displays)",
corpsource = "Bell Telephone Labs. Inc., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "applications of computers; computers; control system
synthesis; electrical engineering; engineering
applications of; online operation; sampled data
systems; simulation",
}
@Article{White:1970:AAN,
author = "J. S. White",
title = "{ACM Algorithm 373}: Number of Doubly Restricted
Partitions",
journal = j-CACM,
volume = "13",
number = "2",
pages = "120--120",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Univ. Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combinatorial mathematics; subroutines",
}
@Article{White:1970:AAR,
author = "J. S. White",
title = "{ACM Algorithm 374}: Restricted Partition Generator",
journal = j-CACM,
volume = "13",
number = "2",
pages = "120--120",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Univ. Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combinatorial mathematics; subroutines",
}
@Article{Spath:1970:AAF,
author = "H. Sp{\"{a}}th",
title = "{ACM Algorithm 375}: Fitting Data to One Exponential",
journal = j-CACM,
volume = "13",
number = "2",
pages = "120--121",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4150 (Nonlinear and functional equations); C7300
(Natural sciences computing)",
corpsource = "Inst. Neutronenphysik Reaktortechnik, Karlsruhe, West
Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "least squares approximations; nonlinear equations;
subroutines",
}
@Article{Spath:1970:AAL,
author = "H. Sp{\"{a}}th",
title = "{ACM Algorithm 376}: Least Squares Fit by
{$f(x)=A\cos(Bx+C)$}",
journal = j-CACM,
volume = "13",
number = "2",
pages = "121--122",
month = feb,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4150 (Nonlinear and functional equations); C7300
(Natural sciences computing)",
corpsource = "Inst. Neutronenphysik, Reaktortechnik, Karlsruhe, West
Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "least squares approximations; nonlinear equations;
subroutines",
}
@Article{Fenichel:1970:PTP,
author = "R. R. Fenichel and J. Weizenbaum and J. C. Yochelson",
title = "A Program to Teach Programming",
journal = j-CACM,
volume = "13",
number = "3",
pages = "141--146",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The TEACH system was developed at MIT to ease the cost
and improve the results of elementary instruction in
programming. To the student, TEACH offers loosely
guided experience with a conversational language which
was designed with teaching in mind. Faculty involvement
is limited. At the heart of the TEACH system is an
interactive language which somewhat resembles Joss, but
is somewhat more amenable to rational explanation.
Surrounding the language processor is a teaching system
which presents lessons to the student, supervises his
progress, and permits him to exercise his skills. A
term of experience with TEACH is discussed.
Pedagogically, the system appears to be successful;
straightforward reimplementation will make it
economically successful as well.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C6150Z (Other systems
operation programs)",
corpsource = "Massachusetts Inst. Technol., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer applications; computer-assisted learning;
computers, programming; education; elementary
programming; engineering education; programming; TEACH;
UNCL; utility programs",
}
@Article{Slagle:1970:EMT,
author = "J. R. Slagle and J. K. Dixon",
title = "Experiments with the {M \& N} Tree-Searching Program",
journal = j-CACM,
volume = "13",
number = "3",
pages = "147--154, 159",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The M \& N procedure is an improvement to the mini-max
backing-up procedure widely used in computer programs
for game-playing and other purposes. It is based on the
principle that it is desirable to have many options
when making decisions in the face of uncertainty. The
mini-max procedure assigns to a MAX (MIN) node the
value of the highest (lowest) valued successor to that
node. The M \& N procedure assigns to a MAX (MIN) node
some function of the M (N) highest (lowest) valued
successors. An M \& N procedure was written in LISP to
play the game of kalah, and it was demonstrated that
the M \& Nprocedure is significantly superior to the
mini-max procedure. The statistical significance of
important conclusions is given. Since information on
statistical significance has often been lacking in
papers on computer experiments in the artificial
intelligence field, these experiments can perhaps serve
as a model for future work.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
corpsource = "Education Welfare, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arg; artificial intelligence; automata theory;
computers; game theory; heuristic programming;
optimisation; programming; trees (mathematics)",
}
@Article{Batson:1970:MSS,
author = "A. Batson and Shy-Ming M. Ju and D. C. Wood",
title = "Measurements of Segment Size",
journal = j-CACM,
volume = "13",
number = "3",
pages = "155--159",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Distributions of segment sizes measured under routine
operating conditions on a computer system which
utilizes variable sized segments (the Burroughs B5500)
are discussed. The most striking feature of the
measurements is the large number of small
segments-about 60\% of the segments in use contain less
than 40 words. Although the results are certainly not
installation independent, and although they are
particularly influenced by features of the B5500 ALGOL
system, they should be relevant to the design of new
computer systems, especially with respect to the
organization of paging schemes.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Univ. Virginia, Charlottesville, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; dynamic memory management; operating
systems; storage allocation",
}
@Article{Watson:1970:ANM,
author = "G. A. Watson",
title = "On an Algorithm for Nonlinear Minimax Approximation",
journal = j-CACM,
volume = "13",
number = "3",
pages = "160--162",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90.50 (65.00)",
MRnumber = "44\#3694",
MRreviewer = "R. W. Cottle",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Certain nonlinear minimax approximation problems are
characterized by properties which permit the
application of special algorithms, mainly, based on the
exchange algorithms of E. Y. Remes (1934, 1935), for
their solution. The application to problems of this
type of a general nonlinear algorithm due to M. R.
Osborne and G. A. Watson (1969) is considered. Examples
are given to illustrate that this algorithm can give
satisfactory results and, in particular, can
successfully solve problems which lead to difficulties
with the more conventional specialist methods.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
corpsource = "Australian Nat. Univ., Canberra, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "linear programming; mathematics; minimax
approximation; nonlinear approximation; numerical
methods; optimisation; THO",
}
@Article{Schweikert:1970:CEI,
author = "D. G. Schweikert",
title = "A Comparison of Error Improvement Estimates for
Adaptive Trapezoid Integration",
journal = j-CACM,
volume = "13",
number = "3",
pages = "163--166",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.55",
MRnumber = "44\#7751",
MRreviewer = "R. E. Barnhill",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Various simple choices of error improvement estimates
for the trapezoid rule are studied to demonstrate a
comparison procedure which is relatively independent of
the profusion of adaptive search and stopping
strategies. Comparisons are based on $x^r1$; the
inclusion of the noninteger powers makes this more
realistic than the usual polynomial based comparison.
Behavior near the singularity was found to be the
dominant factor, and a new estimate, based on a
constant curvature assumption and parametric
differences, was considered slightly better than the
other choices considered.",
acknowledgement = ack-nhfb,
classcodes = "C4110 (Error analysis in numerical methods); C4160
(Numerical integration and differentiation)",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "adaptive integration; error analysis; error
improvement estimate; integration; mathematics;
nonpolynomial error criteria; numerical methods; re;
trapezoid rule",
}
@Article{Schwarcz:1970:DQA,
author = "Robert M. Schwarcz and John F. Burger and Robert F.
Simmons",
title = "A Deductive Question Answerer for Natural Language
Inference",
journal = j-CACM,
volume = "13",
number = "3",
pages = "167--183",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The question-answering aspects of the Protosynthex III
prototype language processing system are described and
exemplified in detail. The system is written in LISP 1.
5 and operates on the Q-32 time-sharing system. The
system's data structures and their semantic
organization, the deductive question-answering
formalism of relational properties and
complex-relation-forming operators, and the
question-answering procedures which employ these
features in their operation are all described and
illustrated. Examples of the system's performance and
of the limitations of its question-answering capability
are presented and discussed. It is shown that the use
of semantic information in deductive question answering
greatly facilitates the process, and that a top-down
procedure which works from question to answer enables
effective use to be made of this information.",
acknowledgement = ack-nhfb,
annote = "Deductive inference driven by English: PROTOSYNTHEX
III",
classcodes = "C7820 (Humanities computing)",
corpsource = "System Dev. Corp., Santa Monica, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; automata theory;
computational linguistics; information retrieval;
language translation and linguistics",
}
@Article{Cardenas:1970:PLP,
author = "A. F. Cardenas and W. J. Karplus",
title = "{PDEL} --- a Language for Partial Differential
Equations",
journal = j-CACM,
volume = "13",
number = "3",
pages = "184--191",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:33:36 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Conventional computer methods available to solve
continuous system problems characterized by partial
differential equations are very time-consuming and
cumbersome. A convenient, easy to learn and to use,
high level problem oriented language to solve and study
partial differential equation problems has been
designed; a practical translator for the language has
also been designed, and a working version of it has
been constructed for a significant portion of the
language. This Partial Differential Equation Language,
PDEL, is outlined, and the highlights of the translator
are briefly summarized. PDEL can handle a large variety
of fields. Time-dependent and time-independent fields
can be defined. Any size of grid can be used to
approximate regular and irregular geometries. Linear,
nonlinear, uniform and nonuniform fields can be
treated.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; differential equations; mathematics;
problem oriented languages",
}
@Article{Levine:1970:AAS,
author = "Michael J. Levine and Stanley M. Swanson",
title = "{ACM Algorithm 377}: Symbolic Expansion of Algebraic
Expressions",
journal = j-CACM,
volume = "13",
number = "3",
pages = "191--192",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:35:50 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/acm.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; subroutines",
}
@Article{Kailas:1970:AMC,
author = "M. V. Kailas",
title = "Another method of converting from hexadecimal to
decimal",
journal = j-CACM,
volume = "13",
number = "3",
pages = "193--193",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital arithmetic",
}
@Article{Pager:1970:NSP,
author = "D. Pager",
title = "A number system for the permutations",
journal = j-CACM,
volume = "13",
number = "3",
pages = "193--193",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "number theory",
}
@Article{Dempster:1970:CPA,
author = "J. R. H. Dempster",
title = "Comment on a Paging Anomaly",
journal = j-CACM,
volume = "13",
number = "3",
pages = "193--194",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Univ. British Columbia, Vancouver, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation theory; demand paging; paging machines;
replacement algorithm; storage allocation",
}
@Article{Maurer:1970:NCI,
author = "H. A. Maurer",
title = "A Note on the Complement of Inherently Ambiguous
Context-Free Languages",
journal = j-CACM,
volume = "13",
number = "3",
pages = "194--194",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ambiguity; bounded language; Chomsky-language;
complement; context-free language; formal languages;
inherent ambiguity; phrase structure language;
production system; type 2 language",
}
@Article{Hsiao:1970:CFS,
author = "D. K. Hsiao and F. D. Harary",
title = "Corrigenda: {``A Formal System for Information
Retrieval from Files''}",
journal = j-CACM,
volume = "13",
number = "3",
pages = "266--266",
month = mar,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Dec 26 18:33:42 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Hsiao:1970:FSI}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{DeSalvio:1970:CCI,
author = "A. J. DeSalvio and J. G. Purdy and J. Rau",
title = "Creation and Control of Internal Data Bases Under a
{Fortran} Programming Environment",
journal = j-CACM,
volume = "13",
number = "4",
pages = "211--215",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is described for the definition of a user's
COMMON structure and the automatic generation of the
necessary COMMON, DIMENSION, EQUIVALENCE, and type
declarations for each of the user's routines. The
definition for the COMMON is contained in an easy to
modify form, thus allowing the control of general
communications of data between routines. The described
system has been implemented on the IBM 7094, CDC 6000
series, and the IBM 360. The method has proved to be
invaluable for the definition and control of COMMON in
many large-scale programs.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
corpsource = "TRW Systems, Redondo Beach and Sunnyvale, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; data handling; data structures; FORTRAN",
}
@Article{Mills:1970:SDP,
author = "H. D. Mills",
title = "Syntax-Directed Documentation for {PL360}",
journal = j-CACM,
volume = "13",
number = "4",
pages = "216--222",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The language PL360, together with its phrase structure
grammar, is used as a concrete basis for illustrating
an idea called syntax-directed documentation. This idea
is-to use the phrase structure of a program to define
the structure of a formal documentation for that
program; to use the syntactic types and identifiers in
the resulting structure to trigger the automatic
formation of questions to the programmer, whose answers
will become part of that documentation; and to provide
automatic storage and retrieval facilities so that
other programmers who want to understand or modify the
index in various ways by syntactic types and objects. A
small PL360 program, already found in the literature,
is worked out as an example.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
corpsource = "IBM, Gaithersburg, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; computers, programming; documentation;
procedure oriented languages; Program and system",
}
@Article{Bayer:1970:SCC,
author = "Rudolf Bayer and Christoph Witzgall",
title = "Some Complete Calculi for Matrices",
journal = j-CACM,
volume = "13",
number = "4",
pages = "223--237",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A matrix calculus is introduced with the intention of
developing data structures suitable for a high level
algorithmic language for mathematical programming. It
is shown how the special structure of matrices can be
described and utilized for efficient computing by
saving memory space and superfluous operations.
Sequences of matrices (and sequences of sequences of
matrices) are considered, and matrix operators are
extended to sequence operators and cumulative
operators. Algorithms are given which use symbol
manipulation of matrix expressions so as to find the
forms best suited for computation. These forms are
called normalforms. Several completeness results are
obtained in the sense that for each expression an
equivalent expression in normal form can be found
within a specified calculus.",
acknowledgement = ack-nhfb,
checked = "29 June 1993",
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
corpsource = "Boeing Sci. Res. Labs., Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithmic languages; computers; computers,
programming; data structures; mathematical;
mathematics; matrix algebra; programming",
}
@Article{BrinchHansen:1970:NMS,
author = "P. {Brinch Hansen}",
title = "The Nucleus of a Multiprogramming System",
journal = j-CACM,
volume = "13",
number = "4",
pages = "238--241, 250",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The philosophy and structure is described of a
multiprogramming system that can be extended with a
hierarchy of operating systems to suit diverse
requirements of program scheduling and resource
allocation. The system nucleus simulates an environment
in which program execution and input\slash output are
handled uniformly as parallel, cooperating processes. A
fundamental set of primitives allows the dynamic
creation and control of a hierarchy of processes as
well as the communication among them.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "A/S Regnecentralen, Copenhagen, Denmark",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; computers, time sharing; multiprogramming;
operating systems",
}
@Article{Eastman:1970:RSP,
author = "C. M. Eastman",
title = "Representations for Space Planning",
journal = j-CACM,
volume = "13",
number = "4",
pages = "242--250",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Problems involving the arrangement of objects in
two-or three-space where the objective function
primarily consists of derivatives of the distance
between objects or their arrangement are called space
planning problems. The representational requirements
for this problem area are defined and compared with
current computer graphic languages. Four alternative
data structures that allow automated space planning are
described and compared.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer-aided design; computers; computers, language;
data structures; design automation; graphic methods;
graphics",
}
@Article{Pomeranz:1970:CMP,
author = "J. E. Pomeranz and R. L. {Weil, Jr.}",
title = "The cyclical majority problem",
journal = j-CACM,
volume = "13",
number = "4",
pages = "251--254",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The unsolved combinational problem of the cyclical
majority is presented and some mew, simulated results
for 3, 4, 5,\ldots{}, 40 issues and 3, 5, 7,\ldots{},
37 judges are reported. The method devised for
simulating the voting process to estimate the
probabilities does not solve the problem, but appears
much more efficient than one previous simulation and
more accurate than another.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial mathematics; computers, simulation;
simulation; statistical methods",
}
@Article{Nilson:1970:CSU,
author = "E. N. Nilson",
title = "Cubic Splines on Uniform Meshes",
journal = j-CACM,
volume = "13",
number = "4",
pages = "255--258",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.20",
MRnumber = "44\#1189",
MRreviewer = "C. A. Hall",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A very simple procedure is presented for constructing
cubic splines, periodic or nonperiodic, on uniform
meshes. Arcs of two cubics suffice to construct a basis
of cardinal splines. An algorithm is given which
requires only minimal storage and computation and
permits easy trade-off of one against the other. The
application of these devices is of fundamental
importance in the area of computer graphics where
substantial savings in computing time and storage
requirements have special significance.",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Pratt and Whitney Aircraft, East Hartford, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cardinal splines; computers; mathematics; numerical
methods; polynomials; simple spline representation;
uniform mesh splines",
}
@Article{Pankiewicz:1970:AAD,
author = "W. Pankiewicz",
title = "{ACM Algorithm 378}: Discretized {Newton}-like Method
for Solving a System of Simultaneous Nonlinear
Equations",
journal = j-CACM,
volume = "13",
number = "4",
pages = "259--260",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4150 (Nonlinear and functional equations); C7300
(Natural sciences computing)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "nonlinear equations; numerical methods; subroutines",
}
@Article{Lyness:1970:AAS,
author = "J. N. Lyness",
title = "{ACM Algorithm 379}: {SQUANK (Simpson Quadrature Used
Adaptively-Noise Killed)}",
journal = j-CACM,
volume = "13",
number = "4",
pages = "260--263",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:37:51 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Hallet:1972:CAS}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7300 (Natural sciences computing)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "integration; subroutines",
}
@Article{Heess:1970:CPW,
author = "W. F. {Heess, Jr.}",
title = "Comments on a paper by {Wallace} and {Mason}",
journal = j-CACM,
volume = "13",
number = "4",
pages = "264--265",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "multiprogramming; storage allocation",
}
@Article{Smith:1970:CMU,
author = "J. L. Smith",
title = "Comment on multiprogramming under a page on demand
strategy",
journal = j-CACM,
volume = "13",
number = "4",
pages = "265--265",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "CSIRO, Canberra City, ACT, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "multiprogramming",
}
@Article{deVries:1970:CLM,
author = "Ronald C. {de Vries}",
title = "Comment on {Lawler}'s Multilevel {Boolean}
minimization",
journal = j-CACM,
volume = "13",
number = "4",
pages = "265--266",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68.00 (94.00)",
MRnumber = "44\#7801",
MRreviewer = "E. Maliszewski",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4230 (Switching theory)",
corpsource = "Univ. New Mexico, Albuquerque, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "generalized prime implicants; incompletely specified
functions; minimal forms; minimisation of switching
nets; minimization; multilevel logic design",
}
@Article{Knight:1970:ACP,
author = "K. R. Knight",
title = "An {Algol} construction for procedures as parameters
of procedures",
journal = j-CACM,
volume = "13",
number = "4",
pages = "266--266",
month = apr,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. Surrey, Guildford, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; programming",
}
@Article{Wirth:1970:CMM,
author = "N. Wirth",
title = "Corrigenda: {``On Multiprogramming, Machine Coding,
and Computer Organization''}",
journal = j-CACM,
volume = "13",
number = "4",
pages = "266--266",
month = apr,
year = "1970",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/362258.362301",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Jan 06 09:47:03 1998",
bibsource = "https://www.math.utah.edu/pub/bibnet/authors/w/wirth-niklaus.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1960.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Wirth:1969:MMC}.",
acknowledgement = ack-nhfb,
author-dates = "Niklaus Wirth (15 February 1934--1 January 2024)",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Hodes:1970:PSO,
author = "L. Hodes",
title = "Programming System for the On-Line Analysis of
Biomedical Images",
journal = j-CACM,
volume = "13",
number = "5",
pages = "279--283, 286",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A preliminary description of the software for a
computer-display system is given with special emphasis
on the man-machine interaction. This system is intended
for a wide variety of biomedical applications. As an
example, the methods are applied to the karyotyping of
chromosomes. The system is separated into four
programming tasks-picture transformations, file
maintenance, picture structuring, and display
management. Picture structuring is considered as the
vehicle for man-machine communication. A prototype data
format for pictures, called a picture-form, is
developed. Structure operators are defined which
manipulate picture-forms to produce new picture-forms.
Many of the ideas are taken from the symbolic
mathematical laboratory at MIT conceived by M.
Minsky.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Dept. Health, Education Welfare, Bethasda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bioengineering, computer applications; biology;
computers; computers, programming; data handling; data
reduction and analysis; graphics; image processing;
machine systems; man-; medicine; pattern recognition",
}
@Article{Sitton:1970:OGA,
author = "G. A. Sitton",
title = "Operations on Generalized Arrays with the {Genie}
Compiler",
journal = j-CACM,
volume = "13",
number = "5",
pages = "284--286",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Operations on vectors, matrices, and higher
dimensional storage arrays are standard features of
most compilers today. The elements of such structures
are usually restricted to be scalars For many
sophisticated applications this restriction can impose
cumbersome data representations. An efficient system
has been devised and implemented which allows the
elements of multidimensional arrays to themselves be
multidimensional arrays. This system was developed from
a storage structure in which the location, length, and
content of each array is described by a codeword which
can be interpreted by the system. Codewords may
describe arrays containing more codewords, thus
providing all needed descriptive information for
hyperstructures of any form.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150C (Compilers,
interpreters and other processors)",
corpsource = "Rice Univ., Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; computers, operating systems; data
handling; data structures; E P; matrix operations;
multidimensional arrays; program compilers;
programming",
}
@Article{Vere:1970:TEE,
author = "S. Vere",
title = "Translation Equations (Errata)",
journal = j-CACM,
volume = "13",
number = "5",
pages = "286--286",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:28:27 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "See \cite{Vere:1970:TE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Sasser:1970:ASS,
author = "W. E. Sasser and D. S. Burdick and D. A. Graham and T.
H. Naylor",
title = "Application of Sequential Sampling to Simulation. an
Example Inventory Model",
journal = j-CACM,
volume = "13",
number = "5",
pages = "287--296",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Four different sequential sampling procedures are
applied to the analysis of data generated by a computer
simulation experiment with a multi-item inventory
model. For each procedure the cost of computer time
required to achieve given levels of statistical
precision is calculated. Also the cost of computer time
using comparable fixed sample size methods is
calculated. The computer costs of fixed sample size
procedures vs sequential sampling procedures are
compared. Details are given for the inventory model and
sampling procedures.",
acknowledgement = ack-nhfb,
classcodes = "C1220 (Simulation, modelling and identification)",
corpsource = "Duke Univ., Durham, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; control; data reduction and analysis;
industrial management, data processing; inventory
control; modelling; sequential sampling; simulation;
statistical methods; stock",
}
@Article{Loeckx:1970:ACB,
author = "J. Loeckx",
title = "Algorithm for the Construction of Bounded-Context
Parsers",
journal = j-CACM,
volume = "13",
number = "5",
pages = "297--307",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is described which accepts an arbitrary
context-free grammar and constructs a bounded-context
parser for it whenever such a parser exists. The
definition of a context-free grammar and the working of
a bounded-context parser are recalled. The notion of
reduction class for a context-free grammar is then
introduced and its connection with the structure of a
bounded-context parser is indicated. Next, pushdown
automata which generate the different reduction classes
of a context-free grammar are defined. Finally, the
algorithm is described; it essentially carries out an
exhaustive study of all possible runs of the pushdown
automata generating the reduction classes. The utility
of the algorithm is discussed in the light of the
experience gained from its use in compiler design.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "MBLE Res. Lab., Brussels, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; compilers; computational linguistics;
computers, language; context-free grammars; formal
languages; grammars; low",
}
@Article{Reynolds:1970:GST,
author = "John C. Reynolds",
title = "{GEDANKEN} --- {A} Simple Typeless Language Based on
the Principle of Completeness and the Reference
Concept",
journal = j-CACM,
volume = "13",
number = "5",
pages = "308--319",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this experimental programming language, any value
which is permitted in some context of the language is
permissible in any other meaningful context. In
particular, functions and labels are permissible
results of functions and values of variables.
Assignment and indirect addressing are formalized by
introducing values, called references, which in turn
possess other values. The assignment operation always
affects the relation between some reference and its
values. All composed data structures are treated as
functions. Type declarations are not permitted. Any
data structure may be implicit; i.e., it may be
specified by giving an arbitrary algorithm for
computing or accessing its components. The existence of
label variables permits the construction of coroutines,
quasi-parallel processes, and other unorthodox control
mechanisms. A variety of programming examples
illustrates the generality of the language. Limitations
and possible extensions are discussed briefly.",
acknowledgement = ack-nhfb,
checked = "4 September 1990",
classcodes = "C6140D (High level languages)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; data structures; gedanken; procedure
oriented languages; programming languages",
}
@Article{Crespi-Reghizzi:1970:LTG,
author = "S. Crespi-Reghizzi and R. Morpurgo",
title = "A language for treating graphs",
journal = j-CACM,
volume = "13",
number = "5",
pages = "319--323",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A language for the representation of graphs is
described, and the formulation of graph operations such
as node and\slash or link deletion or insertion, union,
intersection, comparison, and traversal of graphs is
given. Graphs are represented by linked lists. The
language is syntactically defined as an extension to
ALGOL 60, and it is translated into ALGOL by means of a
syntax-driven compiler. Application areas for this
language are operation research, network problems,
control theory, traffic problems, etc.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
corpsource = "Politecnico di Milano, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic control, analysis; computers; data handling;
data structures; electric circuits, analysis; graph
theory; operations research; procedure oriented
languages",
}
@Article{Laflin:1970:AAS,
author = "S. Laflin and M. A. Brebner",
title = "{ACM Algorithm 380}: In-situ Transposition of a
Rectangular Matrix",
journal = j-CACM,
volume = "13",
number = "5",
pages = "324--326",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:38:00 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Macleod:1972:STR}.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Univ. Birmingham, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "matrix algebra; subroutines",
}
@Article{Knop:1970:AAR,
author = "R. E. Knop",
title = "{ACM Algorithm 381}: Random Vectors Uniform In Solid
Angle",
journal = j-CACM,
volume = "13",
number = "5",
pages = "326--326",
month = may,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Schrack:1972:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Rutgers Univ., New Brunswick, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "random number generation; subroutines",
}
@Article{Elder:1970:FVI,
author = "H. A. Elder",
title = "On the Feasibility of Voice Input to an On-Line
Computer Processing System",
journal = j-CACM,
volume = "13",
number = "6",
pages = "339--346",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An on-line digital computer processing system is
considered in which an ordinary telephone is the
complete terminal device, input to the computer being
provided as a sequence of spoken words, and output to
the user being audio responses from the machine. The
feasibility of implementing such a system with a
FORTRAN-like algebraic compiler as the object processor
is considered. Details of a specific word recognition
program are given. This technique \ldots{} between each
input word. Experimental results are presented giving
error rates for different experimental conditions as
well as the machine resources required to accommodate
several users at a time. The results show that at this
time it is both economically and logically feasible to
handle at least 40 users at a time with an IBM
360\slash 65 computer.",
acknowledgement = ack-nhfb,
classcodes = "C5590 (Other computer peripheral equipment)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer peripheral equipment; computers; computers,
input-output device; computers, pattern recognition;
data processing; man-machine interfaces; online
operation; recognition; speech; speech, recognition;
telephony; voice input",
}
@Article{Muthukrishnan:1970:CDT,
author = "C. R. Muthukrishnan and V. Rajaraman",
title = "On the Conversion of Decision Tables to Computer
Programs",
journal = j-CACM,
volume = "13",
number = "6",
pages = "347--351",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The use of execution time diagnostics in pinpointing
ambiguities in decision tables is discussed. It is
pointed out that any attempt at resolving ambiguities
at compile time will, in general, be impossible. It is
shown that, as a consequence, three methods of
converting decision tables to programs are inadequate
in regard to ambiguity detection. Two algorithms for
programming decision tables whose merits are simplicity
of implementation and detection of ambiguities at
execution time are presented. The first algorithm is
for limited entry decision tables and clarifies the
importance of proper coding of the information in the
decision table. The second algorithm programs a mixed
entry decision table directly without going through the
intermediate step of conversion to a limited entry
form, thereby resulting in storage economy. A
comparison of the algorithms and others proposed in the
literature is made. Some features of a decision table
to FORTRAN IV translator developed for the IBM 7044 are
given.",
acknowledgement = ack-nhfb,
classcodes = "C6100 (Software techniques and systems)",
corpsource = "Indian Inst. Technol., Kanpur, India",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; decision tables; operations research;
programming",
}
@Article{Grimes:1970:SRC,
author = "J. E. Grimes",
title = "Scheduling to Reduce Conflict in Meetings",
journal = j-CACM,
volume = "13",
number = "6",
pages = "351--352",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Conflicts in scheduling can be treated as defining an
undirected linear graph independently of the relation
of the activities in conflict to additional constraints
of time and space. Each connected component of such a
graph, which can be found by an algorithm described by
S. C. Gotlieb and D. C. Corneil, corresponds to a set
of events that must be scheduled at different times.
Applications are discussed in scheduling the
presentation of papers at meetings and scheduling
examinations.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "co; computers; graph theory; programming; undirected
linear graphs",
}
@Article{Frantz:1970:PPA,
author = "D. G. Frantz",
title = "A {PL\slash} 1 program to assist the comparative
linguist",
journal = j-CACM,
volume = "13",
number = "6",
pages = "353--356",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Univ. Alberta, Arrowwood, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "language translation and linguistics",
}
@Article{Damerau:1970:APC,
author = "F. J. Damerau",
title = "Automatic Parsing for Content Analysis",
journal = j-CACM,
volume = "13",
number = "6",
pages = "356--360",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Although automatic syntactic and semantic analysis is
not yet possible for all of an unrestricted natural
language text, some applications, of which content
analysis is one, do not have such a stringent coverage
requirement. Preliminary studies show that the Harvard
Syntactic Analyzer can produce correct and unambiguous
identification of the subject and object of certain
verbs for approximately half of the relevant
occurrences. This provides a degree of coverage for
content analysis variables which compares favorably to
manual methods, in which only a sample of the total
available text is normally processed.",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "IBM, Yorktown Heights, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers, data processing; content analysis; E L;
information storage and retrie; language translation
and linguistics; linguistics; natural language
processing; syntactic analysis",
}
@Article{Linz:1970:AFP,
author = "Peter Linz",
title = "Accurate Floating-Point Summation",
journal = j-CACM,
volume = "13",
number = "6",
pages = "361--362",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.25",
MRnumber = "44\#3468",
MRreviewer = "R. P. Brent",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes an alternate method for summing a
set of floating-point numbers. Comparison of the error
bound for this method with that of the standard
summation method shows that it is considerably less
sensitive to propagation of round-off error.",
acknowledgement = ack-nhfb # "\slash " # ack-nj,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "New York Univ., NY, USA",
descriptors = "Simulation; statistics; numeric calculation",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accurate floating-point summation; computers, data
processing; digital arithmetic; floating point
arithmetic; floating-point addition; mathematics;
numerical methods; round-off error; round-off errors;
round-off propagation; summation",
}
@Article{Hillstrom:1970:CSA,
author = "K. E. Hillstrom",
title = "Comparison of Several Adaptive {Newton--Cotes}
Quadrature Routines in Evaluating Definite Integrals
with Peaked Integrands",
journal = j-CACM,
volume = "13",
number = "6",
pages = "362--365",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "It is shown, by numerical experiment only, that there
are certain quadratures for which the rate of
convergences increases with the use of higher degree
Newton--Cotes rules, used adaptively. The advantage of
adaptive methods over a nonadaptive rule in
approximating integrals having peaked integrands is
demonstrated. The performance of five different
adaptive quadrature schemes, based on Newton--Cotes (2N
plus 1) point rules (N equals 1, 2, 3, 4, 5), in
approximating a set of definite integrals is
compared.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers, data processing; convergence of numerical
methods; integral evaluation; integration; mathematics;
methods; numerical; numerical integration; numerical
methods; quadrature schemes",
}
@Article{Stewart:1970:IOS,
author = "G. W. Stewart",
title = "Incorporating Origin Shifts into the {QR} Algorithm
for Symmetric Tridiagonal Matrices",
journal = j-CACM,
volume = "13",
number = "6",
pages = "365--367",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/gvl.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The QR iteration for the eigenvalues of a symmetric
tridiagonal matrix can be accelerated by incorporating
a sequence of origin shifts. The origin shift may be
either subtracted directly from the diagonal elements
of the matrix or incorporated by means of an implicit
algorithm. Both methods have drawbacks-the direct
method can unnecessarily degrade small eigenvalues,
while the implicit method can effectively loose the
shift and thereby retard the convergence. A new method
which has neither drawback is presented. Both the
algorithm proposed here and the implicit algorithm are
safer than the explicit algorithm. The implicit
algorithm requires somewhat less computation, but the
new algorithm will give faster convergence in some
cases, an important consideration when eigenvectors are
being calculated.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "Univ. Tex., Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers, data processing; convergence of numerical
methods; eigenfunctions; eigenvalues; eigenvalues and;
eigenvectors; iterative methods; mathematics; matrix
algebra; origin shifts; QR method; symmetric
tridiagonal matrix; tridiagonal matrices",
kwds = "nla, eig, QR algorithm, symmetric matrix, tridiagonal
matrix",
}
@Article{Chase:1970:AAC,
author = "P. J. Chase",
title = "{ACM Algorithm 382}: Combinations of ${M}$ Out of
${N}$ Objects",
journal = j-CACM,
volume = "13",
number = "6",
pages = "368--368",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Dept. Defense, Fort Meade, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; subroutines",
}
@Article{Chase:1970:AAP,
author = "P. J. Chase",
title = "{ACM Algorithm 383}: Permutations of a Set with
Repetitions",
journal = j-CACM,
volume = "13",
number = "6",
pages = "368--369",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Dept. Defense, Fort Meade, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; subroutines",
}
@Article{Stewart:1970:AAE,
author = "G. W. Stewart",
title = "{ACM Algorithm 384}: Eigenvalues and Eigenvectors of a
Real Symmetric Matrix [{F2}]",
journal = j-CACM,
volume = "13",
number = "6",
pages = "369--371",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See errata \cite{Stewart:1970:RAF}.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C7300 (Natural sciences
computing)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "eigenvalues; eigenvalues and eigenfunctions;
eigenvectors; matrix algebra; QR algorithm; real
symmetric matrix; subroutines",
kwds = "nla, eig, QR algorithm, symmetric matrix",
}
@Article{London:1970:CAM,
author = "R. L. London",
title = "Certification of ``{Algorithm 245: Treesort 3
[{M1}]}'': Proof of Algorithms --- {A} New Kind of
Certification",
journal = j-CACM,
volume = "13",
number = "6",
pages = "371--374",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:26:39 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Floyd:1964:AAT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Chandler:1970:RS,
author = "J. P. Chandler and W. C. Harrison",
title = "{R201}--{SHELLSORT}",
journal = j-CACM,
volume = "13",
number = "6",
pages = "373--374",
month = jun,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:28:53 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computer sorting; minimal storage sorting;
sorting",
}
@Article{Codd:1970:RMD,
author = "E. F. Codd",
title = "A Relational Model of Data for Large Shared Data
Banks",
journal = j-CACM,
volume = "13",
number = "6",
pages = "377--387",
month = jun,
year = "1970",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/362384.362685",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/database.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Codd70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Reprinted in \cite[pp.~5--15]{Stonebraker:1988:RDS}.",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Codd70.html",
abstract = "Future users of large data banks must be protected
from having to know how the data is organized in the
machine (the internal representation). A prompting
service which supplies such information is not a
satisfactory solution. Activities of users at terminals
and most application programs would remain unaffected
when the internal representation of data is changed and
even when some aspects of the external representation
are changed. Changes in data representation will often
be needed as a result of changes in query, update, and
report traffic and natural growth in the types of
stored information. Existing noninferential, formatted
data systems provide users with tree-structured files
or slightly more general network models of the data. In
Section 1, inadequacies of these models are discussed.
A model based on $n$-ary relations, a normal form for
data base relations, and the concept of a universal
data sublanguage are introduced. In Section 2, certain
operations on relations (other than logical inference)
are discussed and applied to the problems of redundancy
and consistency in the user's model.",
acknowledgement = ack-nhfb,
annote = "Shows problems of hierarchical data organization,
presents a non-hierarchical `normal' structure, and
discusses languages for describing relations of such
normal structures.",
cdrom = "CACMs1/CACM13/P377.pdf",
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "composition; computers, data storage; consistency;
data bank; data banks; data base; data integrity; data
organization; data structure; data structures;
derivability; file organisation; hierarchies of data;
information retrieval; information storage and retrie;
join; networks of data; NOI; predicate calculus;
redundancy; relations; retrieval language; security;
systems",
oldlabel = "Codd70",
review = "ACM CR 8905-0329",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Codd70",
}
@Article{Grant:1970:ICG,
author = "C. A. Grant",
title = "An interactive command generating facility",
journal = j-CACM,
volume = "13",
number = "7",
pages = "403--406",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A facility to permit conversationally controlled tasks
to be executed in a noninteractive environment is
proposed. A means by which programs can generate
interactive time-sharing commands and receive the
corresponding output response is presented. The
commands will be invoked as if they had been typed at a
console keyboard. It is argued that this facility will
help overcome some of the current limitations in
man-computer communication. A set of functions to
accomplish the above which could be embedded into any
string processing language is suggested, and necessary
information pertinent to implementation of the facility
on existing time-sharing systems is given.",
acknowledgement = ack-nhfb,
classcodes = "C6140B (Machine-oriented languages); C6150J (Operating
systems)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; computers, time sharing; interactive
computing; machine oriented languages; operating
systems; time-sharing systems",
}
@Article{Wilkes:1970:CAM,
author = "M. A. Wilkes",
title = "Conversational Access to a 2048-Word Machine",
journal = j-CACM,
volume = "13",
number = "7",
pages = "407--414",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "LAP6 is an on-line system running on 2048- word LINC
which provides full facilities for text editing,
automatic filing and file maintenance, and program
preparation and assembly. It focuses on the preparation
and editing of continuously displayed 23,040- character
text strings (manuscripts) which can be positioned
anywhere by the user and edited by simply adding and
deleting lines as though working directly on an elastic
scroll. Other features are available through a uniform
command set which itself can be augmented by the user.
The machine, although small, aids program design by
providing display scope and premarked randomly
addressable LINC tapes as standard items, in an
environment similar to that of a sophisticated
terminal. The tapes are logically similar to a disk.
Priority was given to the design of efficient tape
algorithms to minimize the limitations of the small
memory. Techniques developed for handling scroll
editing, filing, and the layered system structure are
outlined.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Washington Univ., St. Louis, MS, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; interactive computing; OD; online
operation; operating systems; operating systems
(computers); text editing",
}
@Article{Waite:1970:MPS,
author = "W. M. Waite",
title = "The mobile programming system: {STAGE} 2",
journal = j-CACM,
volume = "13",
number = "7",
pages = "415--421",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "STAGE 2 is the second level of a bootstrap sequence
which is easily implemented on any computer. It is a
flexible, powerful macro processor designed
specifically as a tool for constructing
machine-independent software. The features provided by
STAGE 2 are summarized, and the implementation
techniques which have made it possible to have STAGE 2
running on a new machine with less than one man-week of
effort are discussed. The approach has been successful
on over 15 machines of widely varying
characteristics.",
acknowledgement = ack-nhfb,
classcodes = "C6140E (Other programming languages)",
corpsource = "Univ. Colorado, Boulder, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bootstrapping; computers; macro processors;
programming languages; system",
}
@Article{Bloom:1970:STT,
author = "Burton H. Bloom",
title = "Space\slash Time Trade-offs in Hash Coding with
Allowable Errors",
journal = j-CACM,
volume = "13",
number = "7",
pages = "422--426",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Bloom70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Bloom70.html",
abstract = "Trade-offs among certain computational factors in hash
coding are analyzed. The paradigm problem considered is
that of testing a series of messages one-by-one for
membership in a given set of messages. Two new
hash-coding methods are examined and compared with a
particular conventional hash-coding method. The
computational factors considered are the size of the
hash area (space), the time required to identify a
message as a nonmember of the given set (reject time),
and an allowable error frequency. The new methods are
intended to reduce the amount of space required to
contain the hash-coded information from that associated
with conventional methods. The reduction in space is
accomplished by exploiting the possibility that a small
fraction of errors of commission may be tolerable in
some applications, in particular, applications in which
a large amount of data is involved and a core resident
hash area is consequently not feasible using
conventional methods. An example is discussed which
illustrates possible areas of application for the new
method.",
acknowledgement = ack-nhfb,
annote = "Phantom use of a direct access list.",
cdrom = "CACMs1/CACM13/P422.pdf",
classcodes = "C6130 (Data handling techniques)",
corpsource = "Computer Usage Co. Newton Upper Falls, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bit vector filter CACM; codes; computers; computers,
errors; hash coding; inf",
oldlabel = "Bloom70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bloom70",
}
@Article{Coffman:1970:FSU,
author = "E. G. {Coffman, Jr.} and J. Eve",
title = "File Structures Using Hashing Functions",
journal = j-CACM,
volume = "13",
number = "7",
pages = "427--432, 436",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A general method of file structuring is proposed which
uses a hashing function to define tree structure. Two
types of such trees are examined, and their relation to
trees studied in the past is explained. Results for the
probability distributions of path lengths are derived
and illustrated.",
acknowledgement = ack-nhfb,
annote = "Tree structure with branching based on bit values of
key code.",
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Newcastle upon Tyne, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; data processing; data structures; file
organization; hash coding; information storage and
retrie; tree structures; trees (mathematics)",
}
@Article{Bradley:1970:ABG,
author = "Gordon H. Bradley",
title = "Algorithm and Bound for the Greatest Common Divisor of
$n$ Integers",
journal = j-CACM,
volume = "13",
number = "7",
pages = "433--436",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "10A30",
MRnumber = "45 3313",
MRreviewer = "A. M. Cohen",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new version of the Euclidean algorithm for finding
the greatest common divisor of $n$ integers $a(i)$ and
multipliers $x(i)$ such that $\mbox{gcd} = x(1)a(1) +
\ldots + x(n)a(n)$ is presented. The number of
arithmetic operations and the number of storage
locations are linear in $n$. A theorem of Lame that
gives a bound for the number of iterations of the
Euclidean algorithm for two integers is extended to the
case of $n$ integers. An algorithm to construct a
minimal set of multipliers is presented. A Fortran
program for the algorithm appears as Comm. ACM
Algorithm 386.",
acknowledgement = ack-nhfb,
classcodes = "C4190 (Other numerical methods)",
corpsource = "Yale Univ., New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers, data processing; diophantine equations;
Euclidean algorithm; greatest common divisor; iterative
methods; mathematics; number theory; numerical
methods",
}
@Article{Woods:1970:CSP,
author = "W. A. Woods",
title = "Context-Sensitive Parsing",
journal = j-CACM,
volume = "13",
number = "7",
pages = "437--445",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a canonical form for
context-sensitive derivations and a parsing algorithm
which finds each context-sensitive analysis once and
only once. The amount of memory required by the
algorithm is essentially no more than the required to
store a single complete derivation. In addition, a
modified version of the basic algorithm is presented
which blocks infinite analyses for grammars which
contain loops. The algorithm is also compared with
several previous parsers for context-sensitive grammars
and general rewriting systems, and the difference
between the two types of analyses is discussed. The
algorithm appears to be complementary to an algorithm
by S. Kuno in several respects, including the
space-time trade-off and the degree of context
dependence involved.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; computational linguistics;
context-sensitive grammars; context-sensitive parsing;
formal grammars; formal language theory; parsing;
parsing algorithms; recognition algorithms",
}
@Article{Paciorek:1970:AAE,
author = "K. A. Paciorek",
title = "{ACM Algorithm 385}: Exponential Integral ${E}_i(x)$",
journal = j-CACM,
volume = "13",
number = "7",
pages = "446--447",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Frisch:1972:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7300 (Natural sciences computing)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "integration; subroutines",
}
@Article{Bradley:1970:AAG,
author = "G. H. Bradley",
title = "{ACM Algorithm 386}: Greatest Common Divisor of $n$
Integers and Multipliers",
journal = j-CACM,
volume = "13",
number = "7",
pages = "447--448",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Ragland:1973:CAG}.",
acknowledgement = ack-nhfb,
classcodes = "C4190 (Other numerical methods); C7300 (Natural
sciences computing)",
corpsource = "Yale Univ. New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "number theory; subroutines",
}
@Article{Bray:1970:CAR,
author = "T. Bray",
title = "Certification of {Algorithm 22, Ricatti--Bessel
Functions of First and Second Kind}",
journal = j-CACM,
volume = "13",
number = "7",
pages = "448--448",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Oct 29 21:49:15 2010",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
citedby = "Fullerton:1980:BEM",
journal-URL = "https://dl.acm.org/loi/cacm",
remark = "Fullerton: An error in an Algol procedure is
reported.",
}
@Article{Ng:1970:CAE,
author = "E. N. Ng",
title = "Certification of {Algorithm 385, Exponential Integral
{${\rm Ei}(x)$}}",
journal = j-CACM,
volume = "13",
number = "7",
pages = "448--449",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Oct 30 09:18:14 2010",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
citedby = "Fullerton:1980:BEM",
journal-URL = "https://dl.acm.org/loi/cacm",
remark = "Fullerton: Comments on a FORTRAN routine.",
}
@Article{Sattley:1970:CPL,
author = "K. Sattley and R. Millstein",
title = "Comments on a paper by {Lowe}",
journal = j-CACM,
volume = "13",
number = "7",
pages = "450--451",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Applied Data Res. Inc., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation theory; graph theory",
}
@Article{Baecker:1970:NDB,
author = "H. D. Baecker",
title = "A note on data base deadlocks",
journal = j-CACM,
volume = "13",
number = "7",
pages = "451--451",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "information retrieval",
}
@Article{Pomeranz:1970:NAP,
author = "J. E. Pomeranz",
title = "Note on an Anomaly in Paging",
journal = j-CACM,
volume = "13",
number = "7",
pages = "451--451",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "demand paging; paging machines; replacement algorithm;
storage allocation",
}
@Article{Hunt:1970:CAA,
author = "B. R. Hunt",
title = "A Comment on Axiomatic Approaches to Programming",
journal = j-CACM,
volume = "13",
number = "7",
pages = "452--452",
month = jul,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Univ. California, Los Alamos, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "axiomatic method; computability and decidability;
homomorphic structure in programming; programming;
proofs of programs",
}
@Article{Nielsen:1970:ACR,
author = "N. R. Nielsen",
title = "Allocation of Computer Resources. is Pricing the
Answer",
journal = j-CACM,
volume = "13",
number = "8",
pages = "467--474",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The extent to which a pricing mechanism fits the mold
is discussed. Inasmuch as pricing must serve as a
rationing mechanism at times, consideration is given to
the means by which prices can be adjusted flexibly in
order to make a dynamic allocation of resources.
Consideration is given to the means by which users can
be insulated from the harmful effects of frequent price
fluctuations. Two illustrative pricing systems are
discussed in order to demonstrate the applicability of
pricing in quite different environments.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers; cost accounting; digital computers;
economics; industrial management; installation
management; resource allocation; resources",
}
@Article{Nagy:1970:NTH,
author = "G. Nagy and N. Tuong",
title = "Normalization Techniques for Handprinted Numerals",
journal = j-CACM,
volume = "13",
number = "8",
pages = "475--481",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A family of pattern standardization techniques based
on geometrical projection is applied to a file of
digitized handprinted numerals obtained from sales
clerks. The principle involves transforming a
quadrilateral specified in terms of the convex hull of
each pattern into a square. The amount of overlap
within each class of characters vs the amount between
classes is used to evaluate the degree of normalization
achieved with respect to other published methods
including size and shear normalization through
moments.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers digital, character R; computers,
digital; pattern recognition; pattern recognition
systems",
}
@Article{Day:1970:FTQ,
author = "A. C. Day",
title = "Full Table Quadratic Searching for Scatter Storage",
journal = j-CACM,
volume = "13",
number = "8",
pages = "481--482",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The quadratic residue search method for hash tables
avoids much of the clustering experienced with a linear
search method. The simple quadratic search only
accesses half the table. It has been shown that when
the length of the table is a prime of the form 4n plus
3, where n is an integer, the whole table may be
accessed by two quadratic searches plus a separate
access for the original entry point. A search method is
presented which is computationally simple, has all the
advantages of the quadratic search, and yet accesses
all the table in one sweep.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. Coll. London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers; computers, data storage; hash
coding; programming; table look-up; table lookup",
}
@Article{Brawn:1970:SPE,
author = "B. S. Brawn and F. G. Gustavson and E. S. Mankin",
title = "Sorting in a Paging Environment",
journal = j-CACM,
volume = "13",
number = "8",
pages = "483--494",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This sorting study was part of an extensive
measurement project undertaken on the M44\slash 44X, an
experimental paging system which was conceived and
implemented at IBM Research in order to explore the
virtual machine concept. The study was concerned with
the implementation of sorting procedures in the context
of the dynamic paging environment characteristic of
virtual memory machines. Descriptions of the
experimental sort programs and analysis of the
performance measurement results obtained for them are
presented. The insight gained from the experimental
effort is used to arrive at a set of broad guidelines
for writing sort programs for a paging environment.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer, memories; computers; computers,
programming; dynamic memory management; External sort
virtual memory CACM; operating systems; sorting;
virtual machines",
}
@Article{Saltzer:1970:IM,
author = "J. H. Saltzer and J. W. Gintell",
title = "The instrumentation of {Multics}",
journal = j-CACM,
volume = "13",
number = "8",
pages = "495--500",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/monitor.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An array of measuring tools devised to aid in the
implementation of a prototype computer utility is
discussed. These tools include special hardware clocks
and data channels, general purpose programmed probing
and recording tools, and specialized measurement
facilities. Some particular measurements of interest in
a system which combines demand paging with
multiprogramming are described in detail. Measuring
techniques described here have been directed primarily
toward understanding what goes on inside the operating
system, rather than on measuring `throughput' system
capacity, or the characteristics of system load.",
acknowledgement = ack-nhfb,
annote = "An array of measuring tools devised to aid in the
implementation of a prototype computer utility is
discussed. These tools include (1) a hardware calendar
clock (52 bit, 1 microsecond resolution) and an
associated match register; (2) a memory reference
counter; (3) an input/output channel which can be used
by an attached processor to read memory; (4) a general
metering package which records time spent executing
selectable supervisor modules while the system is
running; (5) a segment utilization metering facility
which periodically probes for the current segment
number; (6) a facility which records on a per-segment
basis the number of missing pages and segments
encountered during execution in that segment; (7) a
tool which counts the number of times procedures are
called; (8) a software package implemented on a PDP-8
which utilizes the special I/O channel (3); (9) the
CLI, which prints out the time of day, the CPU time,
and the number of times the process had to wait for a
page to be brought in after every `ready message'; (10)
a ring buffer containing the segment, page number, and
time of day of the last 256 missing pages of the
process under measurement; (11) a package to monitor
the effect of the system's multiprogramming effort of
an individual program; (12) a script driver implemented
on a PDP-8; and (13) an internal script driver.",
classcodes = "C6150J (Operating systems)",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers; multiprogramming systems; operating
distributed performance paging CACM; operating systems;
operating systems (computers); performance measurement;
system analysis",
}
@Article{Ichbiah:1970:TGA,
author = "J. D. Ichbiah and S. P. Morse",
title = "A technique for generating almost optimal
{Floyd-Evans} productions for precedence grammars",
journal = j-CACM,
volume = "13",
number = "8",
pages = "501--508",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Co. Internat. l'Informatique, Les Clayes-sous-Bois,
France",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computational linguistics; grammars; optimisation",
}
@Article{Fielding:1970:AAF,
author = "K. Fielding",
title = "{ACM Algorithm 387}: Function Minimization and Linear
Search",
journal = j-CACM,
volume = "13",
number = "8",
pages = "509--510",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Univ. Essex, Wivenhoe Park, Colchester, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "optimisation; subroutines",
}
@Article{Hubner:1970:AAR,
author = "H. H{\"{u}}bner and H. Kremer and K. O. Linn and W.
Schwering",
title = "{ACM Algorithm 388}: {Rademacher} Function",
journal = j-CACM,
volume = "13",
number = "8",
pages = "510--511",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "mathematics; subroutines",
}
@Article{Hubner:1970:AAB,
author = "H. H{\"{u}}bner and H. Kremer and K. O. Linn and W.
Schwering",
title = "{ACM Algorithm 389}: Binary Ordered {Walsh}
Functions",
journal = j-CACM,
volume = "13",
number = "8",
pages = "511--511",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "mathematics; subroutines",
}
@Article{Hubner:1970:AAS,
author = "H. H{\"{u}}bner and H. Kremer and K. O. Linn and W.
Schwering",
title = "{ACM Algorithm 390}: Sequency Ordered {Walsh}
Functions",
journal = j-CACM,
volume = "13",
number = "8",
pages = "511--511",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:38:16 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "mathematics; subroutines",
}
@Article{McKay:1970:AAU,
author = "J. McKay",
title = "{ACM Algorithm 391}: Unitary Symmetric Polynomials",
journal = j-CACM,
volume = "13",
number = "8",
pages = "512--512",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Schrack:1972:RAU}.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "polynomials; subroutines",
}
@Article{Anonymous:1970:ISU,
author = "Anonymous",
title = "Identification of {States of the United States}
(including the {District of Columbia}) for information
interchange",
journal = j-CACM,
volume = "13",
number = "8",
pages = "514--515",
month = aug,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "code standards",
}
@Article{Bouknight:1970:PGT,
author = "W. Jack Bouknight",
title = "A Procedure for Generation of Three-Dimensional
Half-Toned Computer Graphics Presentations",
journal = j-CACM,
volume = "13",
number = "9",
pages = "527--536",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/pre75.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A description is given of an algorithm for producing
computer generated halftone presentations of
three-dimensional polygonal surface structures. The
history leading to the algorithm development and then
the algorithm itself are described. Results are
presented and are compared with computer runs achieved
by the Warnock approach. An extension of the procedure
to variable position illumination sources is also
given.",
acknowledgement = ack-nhfb,
classcodes = "C4190 (Other numerical methods)",
corpsource = "Univ. Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer graphics; computers; half-tone images;
hidden surface; image processing",
}
@Article{Bracchi:1970:ISS,
author = "G. Bracchi and M. Somalvico",
title = "Interactive Software System for Computer-Aided Design.
an Application to Circuit Project",
journal = j-CACM,
volume = "13",
number = "9",
pages = "537--545",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Characteristics of an interactive software system,
intended to constitute an interface between designer
and computer during various steps of the design
process, are presented. Main emphasis is given to the
description of the features of the two high level user
oriented languages, operating at different levels, on
which the interaction is based. The first one is IMOL,
an interactive monitor language, which is designed to
perform the overall and control functions of the
software system. The second one is COIF, a circuit
oriented graphic language, which is designed to
describe, generate, and manipulate graphic problem
specifications. The application to computer-aided
circuit design is in particular examined.",
acknowledgement = ack-nhfb,
classcodes = "B1130B (Computer-aided circuit analysis and design);
C7410D (Electronic engineering computing)",
corpsource = "Politecnico, Milano, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer aided circuit design; computer-aided
circuit design; computers; computers, graphics;
computers, programming; electric circuits, analysis;
language; online operation",
}
@Article{Hirschsohn:1970:AHL,
author = "I. Hirschsohn",
title = "{AMESPLOT}, a Higher Level Data Plotting Software
System",
journal = j-CACM,
volume = "13",
number = "9",
pages = "546--555",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "System described is hardware independent. Elements
common to all types of data plots are outlined and the
way in which these elements may be combined into a
system based on simple modules is demonstrated. Basic
syntax of AMESPLOT is outlined, and a brief description
is given of its current utility software, consisting of
`macros' to produce self-scaled plots, formal tablets
of text, interspersed with subplots, map coastlines and
3-D plots. Structuring of plots from multiple,
independent, self-contained subplots is described.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. California, San Diego, La Jolla, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer graphics; computers; computers,
language; data plotting; graphics; interactive
computing; problem oriented languages",
}
@Article{Moler:1970:ISR,
author = "Cleve B. Moler and Louis P. Solomon",
title = "Integrating Square Roots",
journal = j-CACM,
volume = "13",
number = "9",
pages = "556--557",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.60",
MRnumber = "44\#1223",
MRreviewer = "J. C. Butcher",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Differential equation of the $(y')^2 = f(y)$ are
difficult to integrate numerically because of the
singularity at points where $f(y)$ vanishes. A
technique is described for removing the singularity and
evaluating the expressions through the use of standard
numerical methods for second order ordinary
differential equations.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; differential equations; mathematics; numerical
methods; quadrature; Y F",
}
@Article{Kimble:1970:VGL,
author = "G. W. Kimble",
title = "A Variation of the {Goodman-Lance} Method for the
Solution of Two-Point Boundary Value Problems",
journal = j-CACM,
volume = "13",
number = "9",
pages = "557--558",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.62",
MRnumber = "44\#3500",
MRreviewer = "F. Odeh",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A recently published method for the interpolative
solution of nonlinear equations is improved, and
applied to give a significant variation of the
Goodman-Lance method for the solution of two-point
boundary value problems. The resulting method applies
in particular to the numerical solution of optimal
control problems in the Euler--Lagrange formulation.
Quantitative estimates are presented which indicate
that the variation is nearly twice as fast on some
problems in the latter context.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Univ. Nevada, Reno, NV, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic control; boundary value problems;
boundary-value problems; CACMA; differential equations;
Goodman-Lance; interpolative solution; Newton's method;
nonlinear equations; numerical methods; optimal
control; optimization; ordinary differential equations;
orthogonal matrices; secant method",
}
@Article{Wilson:1970:OSA,
author = "M. Wayne Wilson",
title = "Optimal Starting Approximations for Generating Square
Root for Slow or No Divide",
journal = j-CACM,
volume = "13",
number = "9",
pages = "559--560",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.50",
MRnumber = "44\#2338",
MRreviewer = "J. E. {Dennis, Jr.}",
bibdate = "Tue Apr 08 20:38:30 1997",
bibsource = "Compendex database;
ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "On computing machines with slow or no division, it is
preferable to use an iterative scheme for the square
root different from the classical Heron scheme. The
problem of optimal initial approximants is considered,
and some optimal polynomial initial approximations are
tabulated.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "IBM, Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; digital arithmetic; ele; iterative methods;
mathematics; numerical methods; optimisation",
}
@Article{Ehrlich:1970:CMI,
author = "L. W. Ehrlich",
title = "Complex Matrix Inversion Versus Real",
journal = j-CACM,
volume = "13",
number = "9",
pages = "561--562",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.35",
MRnumber = "44\#1196",
MRreviewer = "C. G. Cullen",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A comparison of complex matrix with real matrix
inversion is made. It is shown that the complex
inversion can be up to twice as fast as the real
inversion. Further, the rounding error bound for
complex inversion is about one-eighth that of real, for
Gaussian elimination. Using extended inner product
accumulation the bound is half of the real system.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "Johns Hopkins Univ., Silver Spring, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; complex matrix inversion; complex rounding
error bounds; error bounds; GUL; inversion;
mathematics; matrix algebra; matrix inversion;
numerical methods; rounding error bound; rounding
errors",
}
@Article{vanEmden:1970:IEQ,
author = "M. H. {van Emden}",
title = "Increasing the Efficiency of Quicksort",
journal = j-CACM,
volume = "13",
number = "9",
pages = "563--567",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:38:44 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The average asymptotic number of comparisons needed is
shown to be $! n log_2 (n)$. A formula is derived
expressing $!$ in terms of the probability distribution
of the `bound' of a partition. Another generalization
of quicksort is presented which uses a bounding
interval instead of a single element as bound. This
generalization turns out to be easy to implement in a
computer program. A numerical approximation shows that
$!$ equals 1.140 for this version of quicksort compared
with 1.386 for the original. This implies a decrease in
number of comparisons of 18\%; actual tests showed
about 15\% saving in computing time.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Math. Centre, Amsterdam, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers; programming; SAL; sorting",
}
@Article{Smith:1970:AAS,
author = "Robert R. Smith and Dennis McCall",
title = "{ACM Algorithm 392}: Systems of Hyperbolic {P.D.E.}",
journal = j-CACM,
volume = "13",
number = "9",
pages = "567--570",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Frisch:1972:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations); C7310 (Mathematics
computing)",
corpsource = "US Naval Electronics Lab. Center, San Diego, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "boundary-value problems; partial differential
equations",
}
@Article{Abdali:1970:AAS,
author = "S. K. Abdali",
title = "{ACM Algorithm 393}: Special Series Summation with
Arbitrary Precision",
journal = j-CACM,
volume = "13",
number = "9",
pages = "570--570",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Sale:1972:RAS}.",
acknowledgement = ack-nhfb,
classcodes = "C4120 (Functional analysis); C7310 (Mathematics
computing)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "function approximation; function evaluation;
subroutines",
}
@Article{Dial:1970:AAD,
author = "R. B. Dial",
title = "{ACM Algorithm 394}: Decision Table Translation",
journal = j-CACM,
volume = "13",
number = "9",
pages = "571--572",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Marshall:1972:RAD}.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
corpsource = "Univ. Washington, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "decision tables; program interpreters; subroutines",
}
@Article{Lamport:1970:CBQ,
author = "Leslie Lamport and J. R. Bell",
title = "Comment on {Bell}'s Quadratic Quotient Method for Hash
Code Searching",
journal = j-CACM,
volume = "13",
number = "9",
pages = "573--574",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "codes; data handling",
}
@Article{Bavel:1970:NAS,
author = "Z. Bavel",
title = "On the Number of Automorphisms of a Singly Generated
Automaton",
journal = j-CACM,
volume = "13",
number = "9",
pages = "574--575",
month = sep,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4220 (Automata theory)",
corpsource = "Univ. Kansas, Lawrence, KS, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automata; automorphisms; finite automata; generators;
length of state; minimal-length generators; orbit;
singly generated automata",
}
@Article{Woods:1970:TNG,
author = "W. A. Woods",
title = "Transition Network Grammars for Natural Language
Analysis",
journal = j-CACM,
volume = "13",
number = "10",
pages = "591--606",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C7820 (Humanities computing)",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "grammars; language translation and linguistics",
}
@Article{Earley:1970:FTI,
author = "J. Earley and H. Sturgis",
title = "A formalism for translator interactions",
journal = j-CACM,
volume = "13",
number = "10",
pages = "607--617",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A formalism is presented for describing the actions of
processors for programming languages-compilers,
interpreters, assemblers-and their interactions in
complex systems such as compiler-compilers or
extendible languages. An algorithm is presented for
deciding whether or not a given system can be produced
from a given set of component processors.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6150C (Compilers, interpreters
and other processors)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; compilers; computational linguistics; computer,
digital; computers, digital, languages; computers,
digital, operating; pre; program; program assemblers;
program interpreters; program processors; programming
languages",
}
@Article{Hill:1970:AASa,
author = "G. W. Hill",
title = "{ACM Algorithm 395}: {Student}'s $t$-Distribution",
journal = j-CACM,
volume = "13",
number = "10",
pages = "617--619",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Lozy:1979:RSD,Hill:1981:RSD}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "CSIRO, Glen Osmond, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "statistics; subroutines",
}
@Article{Hill:1970:AASb,
author = "G. W. Hill",
title = "{ACM Algorithm 396}: {Student}'s $t$-Quantiles",
journal = j-CACM,
volume = "13",
number = "10",
pages = "619--620",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also
\cite{Hill:1981:RSD,Hill:1981:RSQ,Lozy:1979:RSD}.",
acknowledgement = ack-nhfb,
classcodes = "C4120 (Functional analysis); C7310 (Mathematics
computing)",
corpsource = "CSIRO, Glen Osmond, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "function evaluation; statistics; subroutines",
}
@Article{Chang:1970:AAI,
author = "S. K. Chang and A. Gill",
title = "{ACM Algorithm 397}: An Integer Programming Problem",
journal = j-CACM,
volume = "13",
number = "10",
pages = "620--621",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Johnson:1972:RAI}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "integer programming; subroutines",
}
@Article{Stone:1970:AAT,
author = "R. A. Stone",
title = "{ACM Algorithm 398}: Tableless Date Conversion",
journal = j-CACM,
volume = "13",
number = "10",
pages = "621--621",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Robertson:1972:RAT}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Western Electric Co., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "code convertors; subroutines",
}
@Article{Seppanen:1970:AAS,
author = "J. J. Sepp{\"{a}}nen",
title = "{ACM Algorithm 399}: Spanning Tree",
journal = j-CACM,
volume = "13",
number = "10",
pages = "621--622",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Helsinki Univ. Technol., Otaniemi, Finland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "graph theory; subroutines; trees (mathematics)",
}
@Article{Wallick:1970:AAM,
author = "G. C. Wallick",
title = "{ACM Algorithm 400}: Modified {H{\aa}vie}
Integration",
journal = j-CACM,
volume = "13",
number = "10",
pages = "622--624",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Piessens:1974:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Mobil Res. Dev. Corp., Dallas, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "integration; subroutines",
}
@Article{Peto:1970:RAM,
author = "R. Peto",
title = "Remark on ``{Algorithm 347}: {An} Efficient Algorithm
for Sorting with Minimal Storage [{M1}]''",
journal = j-CACM,
volume = "13",
number = "10",
pages = "624",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue May 28 09:23:57 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Griffin:1970:RME,Singleton:1969:AAEa}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computer sorting; minimal storage sorting;
ranking; sorting",
}
@Article{Smith:1970:UIG,
author = "L. B. Smith",
title = "The use of interactive graphics to solve numerical
problems",
journal = j-CACM,
volume = "13",
number = "10",
pages = "625--634",
month = oct,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "CERN, Geneva, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "analysis; computer graphics; least squares
approximations; numerical; online operation",
}
@Article{LaFata:1970:IDA,
author = "P. LaFata and J. B. Rosen",
title = "An interactive display for approximation by linear
programming",
journal = j-CACM,
volume = "13",
number = "11",
pages = "651--659",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68.00 (90.00)",
MRnumber = "42\#2712",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An interactive program with a graphical display has
been developed for the approximation of data by means
of a linear combination of functions (including
splines) selected by the user. The coefficients of the
approximation are determined by linear programming so
as to minimize the error in either the $L_1$ or
$L-\infty$ norm. Auxiliary conditions such as
monotonicity or convexity of the approximation can also
be imposed. This interactive system is described and
several examples of its use are given.",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; data fitting; function approximation;
functional approximation; interactive graphical
display; linear programming; online operation; spline
functions",
}
@Article{Lum:1970:MAR,
author = "Vincent Y. Lum",
title = "Multi-Attribute Retrieval with Combined Indexes",
journal = j-CACM,
volume = "13",
number = "11",
pages = "660--665",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:13 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Lum70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Lum70.html",
acknowledgement = ack-nhfb,
annote = "Construction of combined indexes with formulas for
number needed.",
cdrom = "CACMs1/CACM13/P660.pdf",
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "file organisation; information retrieval",
oldlabel = "Lum70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lum70",
}
@Article{Mifsud:1970:MDA,
author = "C. J. Mifsud",
title = "A multiple-precision division algorithm",
journal = j-CACM,
volume = "13",
number = "11",
pages = "666--668",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
note = "See addendum \cite{Mifsud:1973:AMP}.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Mitre Corp., McLean, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital arithmetic",
}
@Article{Conrow:1970:NPS,
author = "K. Conrow and R. G. Smith",
title = "{NEATER2}: {A PL/I} Source Statement Reformatter",
journal = j-CACM,
volume = "13",
number = "11",
pages = "669--675",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "NEATER2 accepts a PL/I source program and operates on
it to produce a reformatted version. When in the
LOGICAL mode, NEATER2 indicates the logical structure
of the source program in the indentation pattern of its
output. Logic errors discovered through NEATER2 logical
analysis are discovered much more economically than is
possible through compilation and trial runs. A number
of options are available to give the user full control
over the output format and to maximize the utility of
NEATER2 as an aid during the early stages of
development of a PL/I source deck. One option, USAGE,
causes NEATER2 to insert into each logical unit of
coding a statement which will case the number of times
each one is executed to be recorded during execution.
This feature is expected to provide a major aid in
optimization of PL/I programs.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
corpsource = "Kansas State Univ., Manhattan, KS, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "documentation aid; execution time usage data; logical
analysis of PL/I source; optimisation; PL/1;
prettyprinter; program processors; reformatting of PL/I
source",
}
@Article{Bell:1970:LQH,
author = "James R. Bell and Charles H. Kaman",
title = "The Linear Quotient Hash Code",
journal = j-CACM,
volume = "13",
number = "11",
pages = "675--677",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/hash.bib",
note = "Independent discovery of technique of secondary hash
functions first proposed by
\cite{deBalbine:1969:CAR}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "codes",
}
@Article{Cheney:1970:NLC,
author = "C. J. Cheney",
title = "A Nonrecursive List Compacting Algorithm",
journal = j-CACM,
volume = "13",
number = "11",
pages = "677--678",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:46 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm13.html#Cheney70;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Cambridge, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structures; list processing; storage management",
oldlabel = "Cheney70",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cheney70",
}
@Article{Anonymous:1970:PANa,
author = "Anonymous",
title = "Proposed {American National Standard}. Recorded
magnetic tape for information interchange (1600 {CPI},
phase encoded)",
journal = j-CACM,
volume = "13",
number = "11",
pages = "679--685",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5320C (Storage on moving magnetic media)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "magnetic recording; standards",
}
@Article{Anonymous:1970:PANb,
author = "Anonymous",
title = "Proposed {American National Standard}. Unrecorded
magnetic tape for information interchange (9 track-200
and 800 {CPI}, {NRZI} and 1600 {CPI}, {P.E.})",
journal = j-CACM,
volume = "13",
number = "11",
pages = "686--692",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5320C (Storage on moving magnetic media)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "magnetic recording; standards",
}
@Article{Bratley:1970:AAI,
author = "P. Bratley",
title = "{ACM Algorithm 401}: An Improved Algorithm to Produce
Complex Primes",
journal = j-CACM,
volume = "13",
number = "11",
pages = "693--693",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Montreal, Que., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "number theory; subroutines",
}
@Article{vanEmden:1970:AAI,
author = "M. H. {van Emden}",
title = "{ACM Algorithm 402}: Increasing the Efficiency of
{Quicksort}",
journal = j-CACM,
volume = "13",
number = "11",
pages = "693--694",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Wheeler:1973:IEQ}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Math. Centre, Amsterdam, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "sorting; subroutines",
}
@Article{Wilson:1970:GMG,
author = "W. J. Wilson",
title = "A generalized method for generating argument\slash
function values",
journal = j-CACM,
volume = "13",
number = "11",
pages = "696--697",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Univac Div. Sperry Rand, Huntsville, AL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "decision tables; table lookup",
}
@Article{Ehrman:1970:CAC,
author = "J. R. Ehrman",
title = "Correction to 'logical' arithmetic on computers with
two's complement binary arithmetic",
journal = j-CACM,
volume = "13",
number = "11",
pages = "697--698",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Stanford Linear Accelerator Center, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital arithmetic",
}
@Article{Bernstein:1970:CWS,
author = "A. Bernstein",
title = "Comment on the working set model for program
behavior",
journal = j-CACM,
volume = "13",
number = "11",
pages = "698--699",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "State Univ. New York, Stony Brook, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "storage management",
}
@Article{Rokne:1970:CNP,
author = "J. Rokne",
title = "Condition numbers of {Pei} matrices",
journal = j-CACM,
volume = "13",
number = "11",
pages = "699--699",
month = nov,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "matrix algebra",
}
@Article{Mathews:1970:GPC,
author = "M. V. Mathews and F. R. Moore",
title = "{GROOVE} --- a program to compose, store, and edit
functions of time",
journal = j-CACM,
volume = "13",
number = "12",
pages = "715--721",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7420 (Control engineering computing); C7820
(Humanities computing)",
corpsource = "Bell Telephone Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compose store, edit, time functions; computer music;
computers; conductor program; control engineering
applications of computers; digital control; GROOVE;
hybrid; hybrid systems; interactive software;
luminescence; man computer system; man-machine systems;
periodic functions; real-time; real-time control;
sampled data systems; systems",
treatment = "P Practical",
}
@Article{Tiernan:1970:ESA,
author = "James C. Tiernan",
title = "An Efficient Search Algorithm to Find the Elementary
Circuits of a Graph",
journal = j-CACM,
volume = "13",
number = "12",
pages = "722--726",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94.30 (05.00)",
MRnumber = "42\#7427",
MRreviewer = "J. Mor{\'a}vek",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A theoretically most efficient search algorithm is
presented which uses an exhaustive search to find all
of the elementary circuits of a graph. The algorithm
can be easily modified to find all of the elementary
circuits with a particular attribute such as length. A
rigorous proof of the algorithm is given as well as an
example of its application. Empirical bounds are
presented relating the speed of the algorithm to the
number of vertices and the number of arcs. The speed is
also related to the number of circuits in the graph to
give a relation between speed and complexity.
Extensions to undirected and s-graphs are discussed.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics)",
corpsource = "Univ. California, San Diego, La Jolla, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; circuit search algorithm; elementary
circuits; graph theory; path search; path search
algorithm; searching",
treatment = "T Theoretical or Mathematical",
}
@Article{Betourne:1970:PMR,
author = "C. Betourne and J. Boulenger and J. Ferrie and C.
Kaiser and S. Krakowiak and J. Mossiere",
title = "Process management and resource sharing in the
multiaccess system {ESOPE}",
journal = j-CACM,
volume = "13",
number = "12",
pages = "727--733",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ESOPE; multi-access systems; multiprogramming;
parallel processes; parallel processing; primitive
operations; process scheduling; programs; resource
allocation; system; time sharing system; time-sharing",
treatment = "P Practical",
}
@Article{Morgan:1970:IBO,
author = "H. L. Morgan",
title = "An interrupt based organization for management
information systems",
journal = j-CACM,
volume = "13",
number = "12",
pages = "734--739",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data handling; integrated data processing; interrupt
scheduling; management information systems; monitoring;
parallel; parallel processing; processing; supervisory
programs; supervisory systems; systems",
}
@Article{Thompson:1970:IRR,
author = "R. J. Thompson",
title = "Improving round-off in {Runge--Kutta} computations
with {Gill}'s method",
journal = j-CACM,
volume = "13",
number = "12",
pages = "739--740",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Sandia Labs., Albuquerque, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "differential equations; error analysis; methods;
numerical mathematics; ordinary differential equations;
predictor-corrector; round-off error;
Runge--Kutta--Gill methods",
treatment = "T Theoretical or Mathematical",
}
@Article{Shapiro:1970:LSG,
author = "S. C. Shapiro",
title = "The list set generator: a construct for evaluating set
expressions",
journal = j-CACM,
volume = "13",
number = "12",
pages = "741--744",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "construct; file; list processing; processing;
programming; programming techniques; set generation;
set manipulating",
treatment = "T Theoretical or Mathematical",
}
@Article{Black:1970:OMM,
author = "N. A. Black",
title = "Optimum Merging from Mass Storage",
journal = j-CACM,
volume = "13",
number = "12",
pages = "745--749",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Computer Sci. Corp., Huntsville, AL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "access time; drum merging; magnetic storage systems;
mass storage; merging; optimisation; optimum merging;
sort timing; sorting",
treatment = "T Theoretical or Mathematical",
}
@Article{Redish:1970:RAE,
author = "K. A. Redish",
title = "Remark on {Algorithm 385, Exponential Integral ${\rm
Ei}(x)$}",
journal = j-CACM,
volume = "13",
number = "12",
pages = "750--750",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Oct 30 09:56:59 2010",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Paciorek:1970:AAE,Frisch:1972:RAR}",
acknowledgement = ack-nhfb,
citedby = "Fullerton:1980:BEM",
journal-URL = "https://dl.acm.org/loi/cacm",
remark = "Fullerton: Minor corrections to a FORTRAN routine.",
}
@Article{Stewart:1970:RAF,
author = "G. W. Stewart",
title = "Remark on ``{Algorithm 384}: Eigenvalues and
Eigenvectors of a Real Symmetric Matrix [{F2}]''",
journal = j-CACM,
volume = "13",
number = "12",
pages = "750--750",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:40:01 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Stewart:1970:AAE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "eigenvalues; eigenvectors; QR algorithm; real
symmetric matrix",
kwds = "nla, eig, QR algorithm, symmetric matrix",
}
@Article{Fuchs:1970:EDR,
author = "E. A. Fuchs and P. E. Jackson",
title = "Estimates of Distributions of Random Variables for
Certain Computer Communications Traffic Models",
journal = j-CACM,
volume = "13",
number = "12",
pages = "752--757",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/network.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Reproduced in Advances in Computer Commun., Chu, W.
W., (Ed (1974), 2-7; in Computer Commun., Green, P. E.,
and Lucky, R. W. (Eds.), (1975), 577-582).",
abstract = "A study of multiaccess computer communications has
characterized the distributions underlying an
elementary model of the user-computer interactive
process. The model used is elementary in the sense that
many of the random variables that generally are of
interest in computer communications studies can be
decomposed into the elements of this model. Data were
examined from four operational multiaccess systems, and
the model is shown to be robust; that is each of the
variables of the model has the same distribution
independent of which of the four systems is being
examined. It is shown that the gamma distribution can
be used to describe the discrete variables.
Approximations to the gamma distribution by the
exponential distribution are discussed for the systems
studied.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Bell Telephone Labs. Inc., Holmdel, NJ, USA",
descriptors = "Random Process; Computer Communication; Traffic Model;
Distribution; Estimation",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation theory; computer communications;
distribution of random variables; modelling;
multi-access systems; multiaccess systems; operating
systems; operating systems (computers); optimisation
models; optimization models; time-sharing; time-sharing
systems; user computer interactive processes",
treatment = "T Theoretical or Mathematical",
}
@Article{Pinter:1970:DBF,
author = "C. C. Pinter",
title = "On decomposing a {Boolean} function and simplifying
the components separately",
journal = j-CACM,
volume = "13",
number = "12",
pages = "758--758",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4230 (Switching theory)",
corpsource = "Bucknell Univ., Lewisburg, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "basic cells; Boolean functions; minimisation;
minimisation of switching nets; of Boolean functions;
prime implicants; simplification; vertices",
treatment = "T Theoretical or Mathematical",
}
@Article{Raduchel:1970:EHB,
author = "W. J. Raduchel",
title = "Efficient handling of binary data",
journal = j-CACM,
volume = "13",
number = "12",
pages = "758--759",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary variables; bit strings; cross-; data handling;
dummy variables; efficiency; programming; programming
techniques; tabulations",
treatment = "T Theoretical or Mathematical",
}
@Article{Wagner:1970:FAI,
author = "Robert A. Wagner",
title = "Finiteness Assumptions and Intellectual Isolation of
Computer Scientists",
journal = j-CACM,
volume = "13",
number = "12",
pages = "759--760",
month = dec,
year = "1970",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL versus FORTRAN; Algol vs. Fortran; finite;
finite word size; finiteness assumptions; integer
variable range; intellectual; intellectual isolation;
isolation; memory finiteness; personnel; philosophical
aspects; word size",
}
@Article{Hammer:1971:SSC,
author = "Carl Hammer",
title = "Signature Simulation and Certain Cryptographic Codes",
journal = j-CACM,
volume = "14",
number = "1",
pages = "3--14",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hammer71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Three cyphers allegedly authored by Thomas Jefferson
Beale in 1822 have been the subject of intensive study
for over 100 years. Generations of cryptanalysts have
expended untold man-years, thus far without success,
attempting tode code them; vast armies of fortune
hunters and treasure seekers have devoted Herculean
labors to digging up the rolling hills of Virginia
trying to locate the promised bonanza. \par
The history of pertinent activities would fill volumes,
yet serious students of cryptography have always had
nagging doubts about the cyphers' authenticity. It has
been alleged that the ``known solution'' to Cypher
Number Two: 115, 73, 24, 818, 37, 52, 49, \ldots{} (``I
have deposited in the County of Bedford about four
miles from Buford's in an excavation or vault
\ldots{}'') with the aid of an unsanitized version of
the Declaration of Independence was merely a superb,
imaginative, and grandiose hoax perpetrated ages ago
for whatever reasons. Modern computer technology could
obviously perform signature analyses the process of
encoding itself so as to yield new clues and deeper
insights into their construction. For the benefit of
the uninitiated, the encoding method used in the second
cypher employs a specified document whose words are
simply numbered consecutively, and first letters of
these words are sought out at random to match the
letters of these words are sought out at random to
match the letters of the clear text or message.
\par
The sequence of numbers corresponding to these matches
is then written down as the final code. While
primitive, the process has the advantage of relative
security until the source document becomes known; at
that moment the cypher can be decoded even by second
graders. The work now completed with the help of our
UNIVAC 1108 includes numerous analytical studies of the
Beale cyphers and various types of simulations.
\par
For example, we have turned the entire process of
simulated encoding by various schemes over to the
machine and analyzed the signatures of these synthetic
codes; we have also encoded various messages by hand,
using different texts and a variety of methods to
obtain their signatures. These simulations provide
convincing evidence that the signatures are both
process and data dependent; they indicate also very
strongly that Mr. Beale's cyphers are for real and that
it is merely a matter of time before someone finds the
correct source document and locates the right vault in
the common-wealth of Virginia.",
acknowledgement = ack-nhfb,
classcodes = "B6120B (Codes); C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Beale Cyphers codes; codes; computer applications;
computer signature simulation; cryptanalysis; cyphers;
Declaration of Independence; decoding; encoding; Magna
Carta; numerical cryptographic codes; pseudotext;
results analysis; signature; simulation; Thomas
Jefferson Beale; treasure site identification",
oldlabel = "Hammer71",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hammer71",
}
@Article{Klinger:1971:PWG,
author = "Allen Klinger",
title = "Pattern Width at a Given Angle",
journal = j-CACM,
volume = "14",
number = "1",
pages = "15--20",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Klinger71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "extent integral projections; feature extraction;
figure properties; functions; geometrical concept;
integral geometry; linear pattern measures; pattern
recognition; picture processing; width; width at angle;
word description",
oldlabel = "Klinger71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Klinger71",
}
@Article{Chang:1971:RBP,
author = "Shi-Kuo Chang",
title = "The Reconstruction of Binary Patterns from Their
Projections",
journal = j-CACM,
volume = "14",
number = "1",
pages = "21--25",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68.00",
MRnumber = "44\#2379",
MRreviewer = "G. D. Chakerian",
bibdate = "Mon Jan 22 06:30:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Chang71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Given the horizontal and vertical projections of a
finite binary pattern $f$, can we construct the
original pattern $f$? In this paper we give a
characterization of patterns that are reconstructible
from their projection. Three algorithms are developed
to reconstruct both unambiguous and ambiguous patterns.
It is shown that an unambiguous pattern can be
perfectly reconstructed in time $m \times n$ and that a
pattern similar to an ambiguous pattern can also be
constructed in time $m \times n$, where $m$, $n$ are
the dimensions of the pattern frame.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "IBM, Yorktown Heights, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ATI; CACMA; computers, digital; data compression;
finite binary pattern; image reconstruction; integral
geometry; original pattern reconstruction; pattern
frame dimensions; pattern recognition; pattern
recognition systems; pattern reconstruction",
oldlabel = "Chang71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chang71",
}
@Article{Bracchi:1971:LTG,
author = "Giampio Bracchi and Domenico Ferrari",
title = "Language for Treating Geometric Patterns in a
Two-Dimensional Space",
journal = j-CACM,
volume = "14",
number = "1",
pages = "26--32",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:54 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BracchiF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this paper CADEP, a problem-oriented language for
positioning geometric patterns in a two-dimensional
space, is presented. Although the language has been
specifically designed for the automatic generation of
integrated circuit masks, it turns out to be well
suited also for such other placement problems as
architecture design, urban planning, logical and block
diagram representation.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Politecnico Milano, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "2-dimensional space; architecture design; automation;
block diagrams; CACMA; CADEP; computers, digital;
computers, digital, pattern re; Fortran; Fortran
extension; generation; geometric patterns; graphic;
graphic displays; integrated circuit masks; integrated
circuits; language; languages; layout problems; logic
diagrams representation; pattern recognition; pattern
recognition systems; planning; positioning; problem
oriented language; problem oriented languages; urban;
urban planning",
oldlabel = "BracchiF71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BracchiF71",
}
@Article{Broucke:1971:CRN,
author = "R. A. Broucke",
title = "Construction of Rational and Negative Powers of a
Formal Series",
journal = j-CACM,
volume = "14",
number = "1",
pages = "32--35",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Brucke71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binomial; Chebyshev approximation; Chebyshev series;
construction; convergence; convergence of numerical
methods; Fourier series; inversion; iterative methods;
Newton iterations; Poisson's; rational negative power;
root extraction; series; series expansion; theorem",
oldlabel = "Brucke71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brucke71",
xxauthor = "R. A. Brucke",
}
@Article{Holt:1971:CPS,
author = "Richard C. Holt",
title = "Comments on Prevention of System Deadlocks",
journal = j-CACM,
volume = "14",
number = "1",
pages = "36--38",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:41 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Holt71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A. N. Habermann's method of deadlock prevention is
discussed, where deadlock is defined as a system state
from which resource allocations to certain processes
are not possible. It is shown that the scheduler may
introduce `artificial' deadlocks which Habermann's
method does not prevent. Permanent blocking is the
situation where certain processes never receive their
resource requests. It is shown that deadlock prevention
does not necessarily eliminate permanent blocking. A
method of preventing permanent blocking is given.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Cornell Univ. Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers, digital; computers, digital,
operation; deadly embrace; Habermann's method;
interlock; knotting; layout; multiprogramming;
operating systems (computers); permanent blocking
preventions; resource allocation; scheduling; storage
allocation; system deadlock prevention; system
recovery; time sharing",
oldlabel = "Holt71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Holt71",
}
@Article{Hoare:1971:PPF,
author = "C. A. R. Hoare",
title = "Proof of a Program: {FIND}",
journal = j-CACM,
volume = "14",
number = "1",
pages = "39--45",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:22 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/ml.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hoare71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An informal description is given of the purpose of the
program and the method used. A systematic technique is
described for constructing and the program proof during
the process of coding it, in such a way as to prevent
the intrusion of logical errors. The proof of
termination is treated as a separate exercise. Some,
conclusions relating to general programming methodology
are drawn.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Queen's Univ. Belfast, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm correctness; algorithm theory; CACMA;
coding; computers, digital; computers, digital,
programming; documentation; FIND; ITI; languages;
logical errors intrusion; programming methodology;
programming theory; programs proofs",
oldlabel = "Hoare71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hoare71",
}
@Article{Proll:1971:FEA,
author = "L. G. Proll",
title = "Further evidence for the analysis of algorithms for
the zero-one programming problem",
journal = j-CACM,
volume = "14",
number = "1",
pages = "46--47",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Proll71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The purpose of this note is to report computational
experience additional to that recently summarized R. L.
Gue et al, with two algorithms for the zero-one linear
programming problem. An error in Gue's paper is
corrected. The utility of one of the algorithms as a
suboptimizer is indicated.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
corpsource = "Univ. Southampton, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm analysis; algorithm theory; CACMA;
computational; ES,; experience; integer programming;
linear programming; mathematics; operations research;
suboptimisation; zero one variables",
oldlabel = "Proll71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Proll71",
}
@Article{Coleman:1971:AAC,
author = "M. W. Coleman and M. S. Taylor",
title = "{ACM Algorithm 403}: Circular Integer Partitioning
[{A1}]",
journal = j-CACM,
volume = "14",
number = "1",
pages = "48--48",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:14 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/acm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#ColemanT71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Aberdeen Proving Ground, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "circular integer partitioning; combinations; design;
experiments design; number theory; statistical;
subroutines",
oldlabel = "ColemanT71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ColemanT71",
}
@Article{Lucas:1971:AAC,
author = "C. W. {Lucas, Jr.} and C. W. Terrill",
title = "{ACM Algorithm 404}: Complex Gamma Function [{S14}]",
journal = j-CACM,
volume = "14",
number = "1",
pages = "48--49",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:03 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#LucasT71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4120 (Functional analysis); C7310 (Mathematics
computing)",
corpsource = "Coll. William and Mary, Williamsburg, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; CGAMMA; complex gamma function evaluation;
formula; function evaluation; poles of gamma function;
recursion formula; reflection; Stirling's asymptotic
series; subroutine in ALGOL; subroutines",
oldlabel = "LucasT71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LucasT71",
}
@Article{Kolm:1971:MAL,
author = "{\AA}. Kolm and T. Dahlstrand",
title = "Remark on ``{Algorithm 333: Minit Algorithm For Linear
Programming ([H])}''",
journal = j-CACM,
volume = "14",
number = "1",
pages = "50--50",
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:39 MST 2001",
bibsource = "ftp://ftp.math.utah.edu/pub/tex/bib/cacm1960.bib;
ftp://ftp.math.utah.edu/pub/tex/bib/cacm1970.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#KolmD71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gautschi:1964:AAI}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "KolmD71",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KolmD71",
}
@Article{Redish:1971:ACL,
author = "K. A. Redish",
title = "Algorithms: Comment on {London}'s Certification of
{Algorithm 245}",
journal = j-CACM,
volume = "14",
number = "1",
pages = "50--51",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Redish71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "certification; debugging; in-place sorting;
metatheory; proof of algorithms; sorting",
oldlabel = "Redish71",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Redish71",
}
@Article{Pollack:1971:CCD,
author = "S. L. Pollack",
title = "Comment on the conversion of decision tables to
computer programs",
journal = j-CACM,
volume = "14",
number = "1",
pages = "52--52",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Pollack71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "S. D. Leidesdorf and Co., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "aids; application; business; comments; communication;
computer program; conversion; decision tables;
diagnostic; systems analysis",
oldlabel = "Pollack71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pollack71",
}
@Article{Aho:1971:POP,
author = "A. V. Aho and P. J. Denning and J. D. Ullman",
title = "Principles of optimal page replacement",
journal = j-CACM,
volume = "14",
number = "1",
pages = "80--93",
month = jan,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/cache.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Shwayder:1971:CLE,
author = "Keith Shwayder",
title = "Conversion of Limited-Entry Decision Tables to
Computer Programs. a Proposed Modification to
{Pollack}'s Algorithm",
journal = j-CACM,
volume = "14",
number = "2",
pages = "69--73",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Shwayder71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "S. Pollack has proposed an algorithm for converting
decision tables into flowcharts which minimize
subsequent execution time when compiled into a computer
program. Two modifications to this algorithm are
proposed. The first relies on Shannon's noiseless
coding theorem and the communications concept of
entropy but does not completely test the ELSE Rule. The
second modification completely tests the ELSE Rule but
results in more executions than the first modification.
Both modifications result in lower execution time than
Pollack's algorithm. However, neither modification
guarantees a globally optimal solution.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; communication channels; computer; computers,
digital; conversion; decision tables; flow charting;
flowcharting; information theory; modifications;
Pollack's algorithm; programming; programs",
oldlabel = "Shwayder71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shwayder71",
}
@Article{Bernstein:1971:PDS,
author = "Arthur J. Bernstein and J. C. Sharp",
title = "A Policy-Driven Scheduler for a Time-Sharing System",
journal = j-CACM,
volume = "14",
number = "2",
pages = "74--78",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BernsteinS71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A scheduling and swapping algorithm which keeps the
resource count of each process above its policy
function will provide the specified level of service.
Overhead can be reduced by avoiding swaps of processes
which have received at least this level of service. The
algorithm has been implemented in a general purpose
operating system, and it has provided significantly
better service to interactive and to batch jobs than
the previous scheduler.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "General Electric, Schenectady, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computation theory; computers, digital;
computers, digital, operating; operating; operating
systems (computers); policy driven; scheduler;
scheduling algorithm; supervisory and executive
programs; supervisory programs; systems; time sharing;
time sharing systems; time-sharing systems",
oldlabel = "BernsteinS71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BernsteinS71",
}
@Article{Nielsen:1971:AST,
author = "Norman R. Nielsen",
title = "An Analysis of Some Time-Sharing Techniques",
journal = j-CACM,
volume = "14",
number = "2",
pages = "79--90",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Nielsen71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The effectiveness of certain time-sharing techniques
such as program relocation, disk rotational delay
minimization, and swap volume minimization is
investigated. Summary data is presented, and the
findings are discussed. The vehicle for this
investigation was a SI-MULA based simulation model
reflecting an early framework for a planned Burroughs
B6500 time-sharing system. Inasmuch as the B6500 system
is based upon the use of variable sized segments and a
dynamic overlay procedure, data is also presented which
provides some indication of the effectiveness of this
type of organization in a time-sharing environment. The
design characteristics and operational capabilities of
the simulation model are also described.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; capabilities; computers, digital; computers,
digital, operating; design characteristics; disk
rotational delay; minimization; operating systems;
operating systems (computers); operational; program
relocation; simulation; simulation model; swap volume
minimization; systems analysis; techniques; time
sharing; time sharing systems; time-sharing systems",
oldlabel = "Nielsen71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nielsen71",
}
@Article{Slagle:1971:EAL,
author = "James R. Slagle and Carl D. Farrell",
title = "Experiments in Automatic Learning for a Multipurpose
Heuristic Program",
journal = j-CACM,
volume = "14",
number = "2",
pages = "91--99",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#SlagleF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An automatic learning capability has been developed
and implemented for use with the MULTIPLE (MULTIpurpose
Program that LEarns) heuristic tree-searching program,
which is presently being applied to resolution
theorem-proving in predicate calculus. MULTIPLE's
proving program (PP) uses two evaluation functions to
guide its search for a proof of whether or not a
particular goal is achievable. Thirteen general
features of predicate calculus clauses were created for
use in the automatic learning of better evaluation
functions for PP. A multiple regression program was
used to produce optimal coefficients for linear
polynomial functions in terms of the
features.\par
Also, automatic data-handling routines were written for
passing data between the learning program and the
proving program, and for analyzing and summarizing
results. Data was generally collected for learning
(regression analysis) from the experience of PP. A
number of experiments were performed to test the
effectiveness and generality of the learning program.
Results showed that the learning produced dramatic
improvements in the solutions to problems which were in
the same domain as those used for collection learning
data. Learning was also shown to generalize
successfully to domains other than those used for data
collection. Another experiment demonstrated that the
learning program could simultaneously improve
performance on problems in a specific domain and on
problems in a variety of domains. Some variations of
the learning program were also tested.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
corpsource = "Nat. Inst. Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "adaptive; artificial intelligence; automatic learning;
computer aided instruction; computer aided learning;
education; experimental development; heuristic;
heuristic programming; heuristic tree searching
program; learning; learning systems; LISP; multiple
regression; multipurpose heuristic program;
problem-solving; resolution; self-modifying; system;
theorem-providing; tree-searching; trees; trees
(mathematics)",
oldlabel = "SlagleF71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SlagleF71",
}
@Article{Hurwitz:1971:PDV,
author = "H. {Hurwitz, Jr.}",
title = "On the Probability Distribution of the Values of
Binary Trees",
journal = j-CACM,
volume = "14",
number = "2",
pages = "99--102",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hurwitz71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "\ldots{}unction for binary tree values, the values
reflecting sorting effort. The analysis does not assume
uniformly distributed branching ratios, and therefore
is applicable to a family of sorting algorithms
discussed by Hoare, Singleton, and van Emden. \par
The solution to the integral equation indicates that
using more advanced algorithms in the family makes only
minor reductions in the expected sorting effort, but
substantially reduces the variance in sorting effort.
Statistical tests of the values of several thousand
trees containing up to 10,000 points have given first,
second, and third moments of the value distribution
function in satisfactory agreement with the moments
computed from the generating function. The empirical
tests, as well as the analytical results, are in
agreement with previously published results for the
first moment in the cases of uniform and nonuniform
distribution of branching ratio, and for the second
moment in the case of uniform distribution of branching
ratio.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "General Electric, Schenectady, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary tree; binary trees; CACMA; generation; integral
equation: function; integral equations; N T;
probability distribution; sorting; statistical
analysis; statistical tests; statistics; trees; trees
(mathematics); values",
oldlabel = "Hurwitz71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hurwitz71",
}
@Article{Slagle:1971:AGT,
author = "James R. Slagle and Richard C. T. Lee",
title = "Application of Game Tree Searching Techniques to
Sequential Pattern Recognition",
journal = j-CACM,
volume = "14",
number = "2",
pages = "103--110",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#SlagleL71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A sequential pattern recognition (SPR) procedure does
not test all the features of a pattern at once.
Instead, it selects a feature to be tested. After
receiving the result of that test, the procedure either
classifies the unknown pattern or selects another
feature to be tested, etc. Medical diagnosis is an
example of SPR. In this paper the authors suggest that
SPR be viewed as a one-person game played against
nature (chance). Virtually all the powerful techniques
developed for searching two-person, strictly
competitive game trees can easily be incorporated
either directly or by analogy into SPR procedures.
\par
In particular, one can incorporate the ``mini average
backing-up procedure'' and the ``gamma procedure,''
which are the analogues of the ``minimax backing-up
procedure'' and the ``alpha-beta procedure,''
respectively. \par
Some computer simulated experiments in character
recognition are presented. The results indicate that
the approach is promising.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Nat. Inst. Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bioengineering, computer applications;
branch-and-bound approach; CACMA; CAL; computers,
digital, character; dynamic programming; game against
nature; game theory; game theory application; game tree
searching; gamma procedure; mini average backing-up
procedure; optimal solution; pattern; pattern
recognition; pattern recognition systems; recognition;
sequential pattern recognition; techniques; trees;
trees (mathematics)",
oldlabel = "SlagleL71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SlagleL71",
}
@Article{Rokne:1971:CIA,
author = "J. Rokne and P. Lancaster",
title = "Complex Interval Arithmetic",
journal = j-CACM,
volume = "14",
number = "2",
pages = "111--112",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:53 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#RokneL71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Complex interval arithmetic is defined using real
interval arithmetic. Complex interval division is
defined so as to assure smallest possible resulting
intervals.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "complex interval arithmetic; complex intervals;
digital arithmetic; mathematics; numerical mathematics;
numerical methods; on; real interval arithmetic; real
intervals",
oldlabel = "RokneL71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RokneL71",
}
@Article{Dell:1971:AAR,
author = "Alice M. Dell and Roman L. Weil and Gerald L.
Thompson",
title = "{ACM Algorithm 405}: Roots of Matrix Pencils: The
Generalized Eigenvalue Problem [{F2}]",
journal = j-CACM,
volume = "14",
number = "2",
pages = "113--117",
month = feb,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#DellWT71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Heiberger:1972:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C7310 (Mathematics
computing)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; eigenvalues and eigenfunctions; generalised
eigenvalue; linear; matrix algebra; problem; roots of
matrix pencils; subroutines",
oldlabel = "DellWT71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DellWT71",
}
@Article{Noll:1971:SDC,
author = "A. Michael Noll",
title = "Scanned-Display Computer Graphics",
journal = j-CACM,
volume = "14",
number = "3",
pages = "143--150",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Noll71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A television-like scanned-display system has been
successfully implemented on a Honeywell DDP-224
computer installation. The scanned image is stored in
the core memory of the computer, and software scan
conversion is used to convert the rectangular
coordinates of a point to the appropriate work and bit
in an output display array in core storage. Results
thus far indicate that flicker-free displays of large
amounts of data are possible with reasonably fast
graphical interaction. A scanned image of size 240x254
points is displayed at a 30 frame-per-second rate.",
acknowledgement = ack-nhfb,
classcodes = "B7260 (Display technology and systems); C5540
(Terminals and graphic displays)",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer; computer graphics; computers,
digital; core memory; display systems; ed.; graphical
interaction; installation; raster displays; scan
conversion; scanned image; software; stored; television
like scanned display",
oldlabel = "Noll71",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Noll71",
}
@Article{Manna:1971:TAP,
author = "Zohar Manna and Richard J. Waldinger",
title = "Toward Automatic Program Synthesis",
journal = j-CACM,
volume = "14",
number = "3",
pages = "151--165",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#MannaW71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An elementary outline of the theorem-proving approach
to automatic program synthesis is given, without
dwelling on technical details. The method is
illustrated by the automatic construction of both
recursive and iterative programs operating on natural
numbers,lists, and trees, In order to construct a
program satisfying certain specifications a theorem
induced by those specifications is proved, and the
desired program is extracted from the proof. The same
technique is applied to transform recursively defined
functions into iterative programs, frequently with a
major gain inefficiency. It is emphasized that in order
to construct a program with loops or with recursion,
the principle of mathematical induction must be
applied. The relation between the version of the
induction rule used and the form of the program
constructed is explored in some detail.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "answer extraction; artificial; artificial
intelligence; automata theory; automatic program
synthesis; CACMA; computer metatheory; computers,
languages; computers, programming; intelligence; lists;
mathematical induction; mathematical induction
principle; natural numbers; principle; problem solving;
programs; recursive and iterative; theorem proving;
trees",
oldlabel = "MannaW71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MannaW71",
}
@Article{Winters:1971:SAC,
author = "William K. Winters",
title = "Scheduling Algorithm for a Computer Assisted
Registration System",
journal = j-CACM,
volume = "14",
number = "3",
pages = "166--171",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Winters71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents the scheduling algorithm used in
the Computer Assisted Registration System at the
University of Tennessee. Notation is defined and the
logic of the algorithm necessary to implement
educational policy is described. Results from the first
term's implementation are presented.",
acknowledgement = ack-nhfb,
classcodes = "C7110 (Educational administration)",
corpsource = "Univ. Tennessee, Knoxville, TN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative data processing; CACMA; computer
assisted registration system; data processing;
educational administrative data processing; educational
policy; implementation; logic; scheduling algorithm;
timetable",
oldlabel = "Winters71",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Winters71",
}
@Article{Williams:1971:SUM,
author = "John G. Williams",
title = "Storage Utilization in a Memory Hierarchy When Storage
Assignment is Performed by a Hashing Algorithm",
journal = j-CACM,
volume = "14",
number = "3",
pages = "172--175",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:07 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Williams71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The utilization of storage is studied in a two-level
memory hierarchy. The first storage level, which is the
fast store, is divided into a number of storage areas.
When an entry is to be filed in the hierarchy, a
hashing algorithm will attempt to place the entry into
one of these areas. If this particular area is full,
then the entry will be placed into the slower
second-level store, even though other areas in the
first-level store may have space available. Given that
N entries have been filed in the entire hierarchy, an
expression is derived for the expected number of
entries filed in the first-level store. This expression
gives a measure of how effectively the first-level
store is being used. By means of examples, storage
utilization is then studied as a function of the
hashing algorithm, the number of storage areas into
which the first-level store is divided and the total
size of the first-level store.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "RCA Labs., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers, digital; hashing algorithm;
hierarchical systems; memory allocation; memory
hierarchy; storage allocation; storage assignment;
storage units; storage utilization",
oldlabel = "Williams71",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Williams71",
}
@Article{Gear:1971:AIO,
author = "C. William Gear",
title = "The Automatic Integration of Ordinary Differential
Equations",
journal = j-CACM,
volume = "14",
number = "3",
pages = "176--179",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65L05",
MRnumber = "52 9612",
bibdate = "Mon Jan 22 06:43:27 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gear71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A criterion for the selection of the order of
approximation is proposed. The objective of the
criterion is to increase the step size so as to reduce
solution time. An option permits the solution of
`stiff' differential equations. A program embodying the
techniques discussed appears as an algorithm which is
specified.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic; boundary value problems; boundary-value
problems; CACMA; differential equations; initial value;
integration; mathematics; numerical methods; order
control; order of approximation; ordinary differential
equations; problem; selection; step control; stiff
equations",
oldlabel = "Gear71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gear71",
}
@Article{Howell:1971:AAE,
author = "Jo Ann Howell",
title = "{ACM Algorithm 406}: Exact Solution of Linear
Equations Using Residue Arithmetic [{F4}]",
journal = j-CACM,
volume = "14",
number = "3",
pages = "180--184",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Howell71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Howell:1973:RAE}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "adjoint matrix; determinant; Gaussian elimination; ill
condition; inversion; linear equations; matrix; matrix
algebra; modulus; prime number; residue arithmetic;
subroutine; subroutines; symmetric mixed radix
representation; symmetric residue",
oldlabel = "Howell71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Howell71",
}
@Article{Gear:1971:AAD,
author = "C. William Gear",
title = "{ACM Algorithm 407}: {DIFSUB} for Solution of Ordinary
Differential Equations [{D2}]",
journal = j-CACM,
volume = "14",
number = "3",
pages = "185--190",
month = mar,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gear71a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Nikolai:1973:CAD}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "control; differential equations; DIFSUB; estimated
error; method; multistep predictor corrector; ordinary
differential equations; stiff differential equations;
subroutine; subroutines",
oldlabel = "Gear71a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gear71a",
}
@Article{Wirth:1971:PDS,
author = "Niklaus Wirth",
title = "Program Development by Stepwise Refinement",
journal = j-CACM,
volume = "14",
number = "4",
pages = "221--227",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:25 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/conc.scientific.computing.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Wirth71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Eidgenossische Tech. Hochschule, Zurich, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "development; education; programming; programming
techniques; refinement; stepwise",
oldlabel = "Wirth71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wirth71",
}
@Article{Lum:1971:KAT,
author = "Vincent Y. Lum and P. S. T. Yuen and M. Dodd",
title = "Key-to-Address Transform Techniques: {A} Fundamental
Performance Study on Large Existing Formatted Files",
journal = j-CACM,
volume = "14",
number = "4",
pages = "228--239",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:18 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/hash.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#LumYD71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Survey of several hash functions, with performance
results.",
abstract = "The results of a study of eight different
keyto-address transformation methods applied to a set
of existing files are presented. As each method is
applied to a particular file, load factor and bucket
size are varied over a wide range. Appropriate
variables pertinent only to a specific method take on
different values. The performance of each method is
summarized in terms of the number of accesses required
to get to a record and the number of overflow records
created by a transformation. Peculiarities of each
method are discussed. Practical guidelines obtained
from the results are stated. A proposal for further
quantitative fundamental study is outlined.",
acknowledgement = ack-nhfb,
annote = "Measurement of direct access methods",
classcodes = "C6120 (File organisation)",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers, digital; computers, digital codes;
file management; file organisation; file organization;
formatted files; has codes; information retrieval;
information storage and retrie; key to address
transform; random access storage; techniques",
oldlabel = "LumYD71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LumYD71",
}
@Article{Tucker:1971:DMP,
author = "Allen B. Tucker and Michael J. Flynn",
title = "Dynamic Microprogramming. Processor Organization and
Programming",
journal = j-CACM,
volume = "14",
number = "4",
pages = "240--250",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#TuckerF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A microassembly language is developed and the overhead
involved in subroutine linkages is analyzed. The
efficiency of a flexible software linkage scheme is
examined as to its overhead for various subroutine
characteristics. Three examples of problem-oriented
programming are considered and the resulting coding is
compared against a System/360 assembly language
version, with the technology normalized.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computers, digital; dynamically microprogrammed
processor; microassembly language; microprogramming;
microstorage; problem oriented programming;
problem-oriented languages; program processors; read
write; subroutine linkage",
oldlabel = "TuckerF71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TuckerF71",
}
@Article{Talbot:1971:ALT,
author = "Peggy Anne Talbot and John W. {Carr III} and Richard
R. {Coulter, Jr.} and Rosa C. Hwang",
title = "Animator: An On-Line Two-dimensional Film Animation
System",
journal = j-CACM,
volume = "14",
number = "4",
pages = "251--259",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#TalbotCCH71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays)",
corpsource = "Univ. Pennsylvania, Philadelphia, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer animation; computer graphics; dimensional
languages; microfilm recorder; on line system; online
operation; programming languages; two",
oldlabel = "TalbotCCH71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TalbotCCH71",
}
@Article{Stein:1971:CD,
author = "Marvin L. Stein and William D. Munro",
title = "On Complement Division",
journal = j-CACM,
volume = "14",
number = "4",
pages = "260--264",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:09 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#SteinM71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The division algorithm theorem is expressed in a form
that permits it to serve as the basis for devising
division operations that produce both quotient and
remainder in complement form. Algorithms for division
yielding complement results are derived for numbers
represented in any base greater than one. Both radix
and radix-less-one complementation schemes are
considered. The binary form of the algorithms thus
includes both two's and one's complement
implementation. The problem of quotient overflow for
complement results is dealt with as is that of
selecting an appropriate form of the remainder
condition for complement division.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithmic languages; CACMA; complement; digital
arithmetic; division; division algorithm; mathematics;
radix complementation schemes",
oldlabel = "SteinM71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SteinM71",
}
@Article{McNamee:1971:AAS,
author = "J. M. McNamee",
title = "{ACM Algorithm 408}: {A} Sparse Matrix Package (Part
{I})",
journal = j-CACM,
volume = "14",
number = "4",
pages = "265--273",
month = apr,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks
\cite{Sale:1973:SMP,Lawrence:1973:RAS,Sipala:1977:RAS,Gustavson:1978:RAS,Harms:1980:RSM}.",
acknowledgement = ack-nhfb,
classcodes = "C7410B (Power engineering computing)",
corpsource = "York Univ., Downsview, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; electrical engineering applications of
computers; electrical network problems; Fortran
subroutines; matrix; sparse matrix manipulation;
subroutines; tests",
treatment = "P Practical",
}
@Article{Galbi:1971:SPS,
author = "Elmer W. Galbi",
title = "Software and patents: a status report",
journal = j-CACM,
volume = "14",
number = "4",
pages = "274--278",
month = apr,
year = "1971",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/362575.362585",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Oct 22 14:07:06 MDT 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Olle:1971:IFA,
author = "T. William {Olle (Chairman)} and {Codasyl Systems
Committee}",
title = "Introduction to ``Feature Analysis of Generalized Data
Base Management Systems''",
journal = j-CACM,
volume = "14",
number = "5",
pages = "308--318",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:12 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#CODASYL71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This introduction gives a review of the current state
of the art in the systems and discusses the differences
and similarities between capabilities found in host
language systems and those found in self-contained
systems. Technical problems facing future designers are
described. The use of Cobol as a basis for further
development work is considered at some length with
respect to data structures, host language capabilities,
and self-contained capabilities.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structures; feature analysis; generalised data
base management systems; information; programming
languages; retrieval; standards; storage management;
transaction processing",
oldlabel = "CODASYL71",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CODASYL71",
}
@Article{Nielsen:1971:MRC,
author = "Norman R. Nielsen",
title = "The Merit of Regional Computing Networks",
journal = j-CACM,
volume = "14",
number = "5",
pages = "319--326",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:24 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Nielsen71a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "One of the suggested means for stimulating the spread
of computing capabilities in institutions of higher
learning is through the construction of regional
computing networks. One such network has been
constructed in the San Francisco Bay Area of Stanford
University. This paper reports upon the lessons learned
from the operation of that network over the past 2
yr.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C5600 (Data
communication equipment and techniques); C7810C
(Computer-aided instruction)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; computer aided instruction; computer
applications; computer sharing; computer utility;
computers, digital, data proce; computing; cooperative
networks; curriculum development; digital communication
systems; education; educational computing; engineering
education; R C; remote",
oldlabel = "Nielsen71a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nielsen71a",
}
@Article{Krolak:1971:MMA,
author = "Patrick Krolak and Wayne Felts and George Marble",
title = "A Man-Machine Approach Toward Solving the Traveling
Salesman Problem",
journal = j-CACM,
volume = "14",
number = "5",
pages = "327--334",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#KrolakFM71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a computer aided heuristic
technique which uses only a modest amount of computer
time in real-time to solve large (100 to 200) point
problems. This technique takes advantage of both the
computer's and the human's problem-solving abilities.
The computer is not asked to solve the problem in a
brute force way as in many of today's heuristics, but
it is asked to organize the data for the human so that
the human can solve the problem easily. The technique
used in this paper seems to point to new directions in
the field of man-machine interaction and in the field
of artificial intelligence.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C1270 (Man-machine
systems)",
corpsource = "Vanderbilt Univ., Nashville, TN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; assignment; CACMA; computer
aided heuristic techniques; computer applications;
cybernetics; heuristic procedure; heuristic
programming; interaction process; man machine
interaction; man-machine systems; operations research;
optimisation; problem; production planning and control;
rubber band tour generator; travelling salesman
problem",
oldlabel = "KrolakFM71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KrolakFM71",
}
@Article{Montanari:1971:ODC,
author = "Ugo Montanari",
title = "On the Optimal Detection of Curves in Noisy Pictures",
journal = j-CACM,
volume = "14",
number = "5",
pages = "335--345",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:28 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/Reverse.eng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Montanari71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Istituto Elaborazione Informazione, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "curve; description; dynamic programming; edge; global
recognition; heuristic; heuristic programming;
interaction graph; line; methods; noise; optimal
detection; optimisation; optimisation problem; parallel
processing; pattern recognition; picture; picture
processing; picture recognition; secondary",
oldlabel = "Montanari71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Montanari71",
}
@Article{Richards:1971:HKA,
author = "Donald L. Richards",
title = "How To Keep the Addresses Short",
journal = j-CACM,
volume = "14",
number = "5",
pages = "346--349",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:54 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Richards71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper demonstrates that a wide class of problems
can be formulated as covering problems solvable by
means of elementary arithmetic operations on the column
vectors of a ternary matrix.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150C (Compilers,
interpreters and other processors)",
corpsource = "Leasco Systems Corp., Tustin, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "addressing; assembler; CACMA; compilers; computers,
digital; covering problem; data handling; integer;
integer programming; minimisation; program; program
assemblers; programming; variable length addressing",
oldlabel = "Richards71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Richards71",
}
@Article{Fenichel:1971:ILV,
author = "Robert R. Fenichel",
title = "On Implementation of Label Variables",
journal = j-CACM,
volume = "14",
number = "5",
pages = "349--350",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Fenichel71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Variables of label mode are conventionally implemented
with a technique which fails to trap certain
programming errors. Fine-grained calender clocks have
recently become available; these allow implementation
of label variables via a new technique which traps all
programming errors of this variety.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACMA; compiler; computers, digital; DS; fine grained
calendar clocks; go; interpreter; label variables
implementation; program compilers; program debugging;
to; transfer",
oldlabel = "Fenichel71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fenichel71",
}
@Article{Morris:1971:ARI,
author = "James H. {Morris, Jr.}",
title = "Another Recursion Induction Principle",
journal = j-CACM,
volume = "14",
number = "5",
pages = "351--354",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "02F25 (94A25)",
MRnumber = "45 57",
MRreviewer = "H. R. Strong",
bibdate = "Mon Jan 22 07:06:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Morris71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An inductive method for proving things about
recursively defined functions is described. It is shown
to be useful for proving partial functions equivalent
and thus applicable in proofs about interpreters for
programming languages.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C4210 (Formal
logic)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; CACMA; compiler correctness; compiler
correctness proofs; computational linguistics;
computers, digital, languages; computers, digital,
programming; correctness; induction; interpreters;
proofs; proving; recursion; recursion induction
principle; recursive functions; theorem",
oldlabel = "Morris71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris71",
}
@Article{Schmitt:1971:AAD,
author = "H. Schmitt",
title = "{ACM Algorithm 409}: Discrete {Chebychev} Curve Fit
[{E2}]",
journal = j-CACM,
volume = "14",
number = "5",
pages = "355--356",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Schmitt71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "Tech. Hochschule, Darmstadt, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL procedure; algorithm; Chebyshev approximation;
discrete Chebychev curve fit; exchange; Remez
algorithm; subroutines",
oldlabel = "Schmitt71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schmitt71",
}
@Article{Chambers:1971:AAP,
author = "J. M. Chambers",
title = "{ACM Algorithm 410}: Partial Sorting [{M1}]",
journal = j-CACM,
volume = "14",
number = "5",
pages = "357--358",
month = may,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:09 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/acm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Chambers71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Bell Telephone Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN routine; order statistics; partial sorting;
partial sorting order statistics; sorting;
subroutines",
oldlabel = "Chambers71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chambers71",
}
@Article{Harada:1971:GRP,
author = "Kazuaki Harada",
title = "Generation of rosary permutations expressed in
{Hamiltonian} circuits",
journal = j-CACM,
volume = "14",
number = "6",
pages = "373--379",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90.30 (05.00)",
MRnumber = "44\#3675",
bibdate = "Mon Jan 22 06:48:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Harada71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Systematic generation of a specific class of
permutations fundamental to scheduling problems is
described. In a nonoriented complete graph with n
vertices, Hamiltonian circuits equivalent to $.5(n -
1)!$ specific permutations of $n$ elements, termed
rosary permutations, can be defined. Each of them
corresponds to two circular permutations which
mirror-image each other, and is generated successively
by a number system covering $3*4*\ldots*(n-1)$ sets of
edges. Every set of edges $\{E[k]\}, 1 <= E[k] <= k, 3
<= k <= (n-1)$ is determined recursively by
constructing a Hamiltonian circuit with $k$ vertices
from a Hamiltonian circuit with $k-1$ vertices,
starting with the Hamiltonian circuit of 3 vertices.
The basic operation consists of transposition of a pair
of adjacent vertices where the position of the pair in
the permutation is determined by $\{E[k]\}$. Two
algorithms treating the same example for five vertices
are presented. It is very easy to derive all possible
n! permutations from the $.5(n - 1 )!$ rosary
permutations be cycling the permutations and by taking
them in the reverse order-procedures which can be
performed fairly efficiently by computer.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics)",
corpsource = "Washington Univ., St. Louis, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "circuits; combinatorial algebra; graph theory;
Hamiltonian; nonoriented complete graph; permutation;
rosary permutations generation; scheduling",
oldlabel = "Harada71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Harada71",
}
@Article{Foley:1971:AOD,
author = "James D. Foley",
title = "An approach to the optimum design of computer graphics
systems",
journal = j-CACM,
volume = "14",
number = "6",
pages = "380--390",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Foley71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Univ. North Carolina, Chapel Hill, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "average response time prediction; computer graphics;
computer graphics systems; computer metatheory;
mathematical; model; optimisation; optimum design",
oldlabel = "Foley71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Foley71",
}
@Article{Amarel:1971:CSC,
author = "Saul Amarel",
title = "Computer Science: {A} Conceptual Framework for
Curriculum Planning",
journal = j-CACM,
volume = "14",
number = "6",
pages = "391--401",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:15 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Amarel71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two views of computer science are considered: a global
view which attempts to capture broad characteristics of
the field and its relationships to other fields, and a
local view which focuses on the inner structure of the
field. This structure is presented in terms of the
kinds of knowledge, problems, and activities that exist
within the discipline, as well as the relations between
them. An approach to curriculum planning in computer
science is presented which is guided by the structure
of the field, by the fact that change is an important
feature of the situation, and by the expectation that
computer science will continue to increase its working
contacts with other disciplines.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Rutgers Univ., New Brunswick, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; curriculum planning; education",
oldlabel = "Amarel71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Amarel71",
}
@Article{Bosarge:1971:NPR,
author = "W. E. {Bosarge, Jr.} and O. G. Johnson",
title = "Numerical properties of the {Ritz--Trefftz} algorithm
for optimal control",
journal = j-CACM,
volume = "14",
number = "6",
pages = "402--406",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.30",
MRnumber = "44\#7714",
MRreviewer = "A. Pasquali",
bibdate = "Mon Jan 22 06:27:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BosargeJ71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this paper the Ritz--Trefftz algorithm is applied
to the computer solution of the state regulator
problem. The algorithm represents a modification of the
Ritz direct method and is designed to improve the speed
of solution and the storage requirements to the point
where real-time implementation becomes feasible. The
modification is shown to be more stable computationally
than the traditional Ritz approach. \par
The first concern of the paper is to describe the
algorithm and establish its properties as a valid and
useful numerical technique. In particular such useful
properties as definiteness and reasonableness of
condition are established for the method. The second
part of the paper is devoted to a comparison of the new
techniques with the standard procedure of numerically
integrating a matrix Riccati equation to determine a
feedback matrix. The new technique is shown to be
significantly faster for comparable accuracy.",
acknowledgement = ack-nhfb,
classcodes = "C1330 (Optimal control); C4190 (Other numerical
methods)",
corpsource = "IBM Sci. Center, Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "control theory; equation; feedback matrix; matrix
Riccati; numerical; numerical analysis; numerical
integration; numerical methods; optimal control;
properties; regulator problem; Ritz Trefftz algorithm;
splines; state regulator problem",
oldlabel = "BosargeJ71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BosargeJ71",
}
@Article{Gladwin:1971:NCF,
author = "H. Tim Gladwin",
title = "A Note on Compiling Fixed Point Binary
Multiplications",
journal = j-CACM,
volume = "14",
number = "6",
pages = "407--408",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Glaswin71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is developed for compiling, as a sequence
of shifts, additions,and subtractions, many fixed point
binary multiplications involving a constant. The most
significant characteristics of the algorithm are the
simplicity of the test which determines if the
algorithm should be applied and the degree to which it
``suggests'' efficient object code.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Washington, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "additions; compiling fixed point binary
multiplications; compiling multiplications; digital
arithmetic; fixed point arithmetic; program compilers;
shifts; subtractions",
oldlabel = "Glaswin71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Glaswin71",
xxauthor = "H. Tim Glaswin",
}
@Article{Fraser:1971:MNP,
author = "A. G. Fraser",
title = "On the Meaning of Names in Programming Systems",
journal = j-CACM,
volume = "14",
number = "6",
pages = "409--416",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:34 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Fraser71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computational linguistics; context manipulation; data
names; file; functional; lambda calculus; names;
operating system; operating systems (computers);
programming; programming systems; programming theory;
theory",
oldlabel = "Fraser71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fraser71",
}
@Article{Walker:1971:BS,
author = "R. J. Walker",
title = "Binary Summation",
journal = j-CACM,
volume = "14",
number = "6",
pages = "417--417",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Walker71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary summation; digital arithmetic; floating point;
roundoff errors; space; storage",
oldlabel = "Walker71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Walker71",
}
@Article{Zelkowitz:1971:IDP,
author = "Marvin V. Zelkowitz",
title = "Interrupt Driven Programming",
journal = j-CACM,
volume = "14",
number = "6",
pages = "417--418",
month = jun,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:37 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Zelkowitz71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "associative; control; debugging; interrupt drive
programming; memories; microprogramming; parallel
processing; program execution",
oldlabel = "Zelkowitz71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Zelkowitz71",
}
@Article{McKenney:1971:SCO,
author = "J. L. McKenney and Fred M. Tonge",
title = "The State of Computer-Oriented Curricula in Business
Schools 1970",
journal = j-CACM,
volume = "14",
number = "7",
pages = "443--448",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:10 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#McKenneyT71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "business schools; computer curricula; education;
reviews",
oldlabel = "McKenneyT71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McKenneyT71",
}
@Article{Bernstein:1971:PTP,
author = "Arthur J. Bernstein",
title = "A Programmer Training Project",
journal = j-CACM,
volume = "14",
number = "7",
pages = "449--452",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:25:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Bernstein71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "General Electric Res. and Dev. Center, Schenectady,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "black; course organisation; curriculum; jobs;
programmer training project; programming; residents;
training",
oldlabel = "Bernstein71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bernstein71",
}
@Article{DeRemer:1971:SLK,
author = "Franklin L. DeRemer",
title = "Simple {LR(k)} Grammars",
journal = j-CACM,
volume = "14",
number = "7",
pages = "453--460",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "47 9893",
MRreviewer = "J. E. L. Peck",
bibdate = "Mon Jan 22 06:34:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#DeRemer71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A class of context-free grammars, called the ``Simple
LR(k)'' or SLR(k) grammars is defined.\par
This class has been shown to include weak precedence
and simple precedence grammars as proper subsets.
\par
How to construct parsers for the SLR(k) grammars is
also shown. These parser-construction techniques are
extendible to cover all of the LR(k) grammars of Knuth;
they have been implemented and by direct comparison
proved to be superior to precedence techniques, not
only in the range of grammars covered, but also in the
speed of parser construction and in the size and speed
of the resulting parsers.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. of California, Santa Cruz, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "context free grammars; context-free grammar;
context-free grammars; deterministic pushdown
automaton; finite-state machine; grammars; LR(k)
grammar; parser; parser construction; parsing
algorithm; precedence; precedence grammar; simple LR(K)
grammars; syntactic analysis",
oldlabel = "DeRemer71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DeRemer71",
}
@Article{Pratt:1971:LEG,
author = "Terrence W. Pratt and Daniel P. Friedman",
title = "A Language Extension for Graph Processing, and Its
Formal Semantics",
journal = j-CACM,
volume = "14",
number = "7",
pages = "460--467",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "46 6657",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 07:13:15 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Ai/lisp.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#PrattF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structure; directed graph; flowchart; formal
semantics; graph processing; Graspe; language
extension; Lisp; problem oriented languages; syntax",
oldlabel = "PrattF71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PrattF71",
}
@Article{Paton:1971:ABC,
author = "Keith Paton",
title = "An algorithm for the blocks and cut nodes of a graph",
journal = j-CACM,
volume = "14",
number = "7",
pages = "468--475",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "05-04",
MRnumber = "46 5135",
MRreviewer = "E. M. Reingold",
bibdate = "Mon Jan 22 07:11:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Paton71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Paton:1971:CAB}.",
abstract = "An efficient method is presented for finding blocks
and cutnodes of an arbitrary undirected graph. The
graph may be represented either (i) as an ordered list
of edges or (ii) as a packed adjacency matrix. If $w$
denotes the word length of the machine employed, the
storage (in machine words) required for a graph with
$n$ nodes and $m$ edges increases essentially as
$2(m+n)$ in case (i), or $(n^2)/w$ in case (ii). A
spanning tree with labeled edges is grown, two edges
finally bearing different labels if and only if they
belong to different blocks. For both representations
the time required to analyze a graph on $n$ nodes
increases as $n^G$ where $G$ depends on the type of
graph, $1 <= G <= 2$, and both bounds are attained.
\par
Values of G are derived for each of several suitable
families of test graphs, generated by an extension of
the web grammar approach. The algorithm is compared in
detail with that proposed by Read for which 1 <= G <=
3.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics)",
corpsource = "Medical Res. Council, London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; block; block-cutpoint-tree; blocks; cut
nodes; cutnode; fundamental cycle set; graph; graph
theory; labelled edges; lobe; lobe decomposition; lobe
decomposition graph; ordered list of edges; packed
adjacency matrix; separable; spanning tree; undirected;
web grammar",
oldlabel = "Paton71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Paton71",
}
@Article{Ferguson:1971:BAM,
author = "David E. Ferguson",
title = "Buffer Allocation in Merge-Sorting",
journal = j-CACM,
volume = "14",
number = "7",
pages = "476--478",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Ferguson71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A fixed buffer allocation for merge-sorting is
presented here which minimizes the number of
input-output operations for a given order of merge.
\par
When sorting on movable arm disks, the number of seeks
is equal to the number of input-output operations, and
the seek time usually controls the sort time. First
some standard terminology is introduced. Then the input
buffer allocation method is described, followed by an
analysis of the improvement to be expected over more
conventional allocation. This analysis makes use of a
particular distribution function. An analysis of a
completely different distribution is given which yields
similar results. This suggests that the results do not
depend on a particular distribution function. An
optimum output buffer size is also determined. It is
concluded that this buffering allocation can
significantly reduce the time of merge sorting on
movable arm disks when the input data are not random,
and that this output buffer allocation should be used
whether the data is random or not.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Programmatics Inc., Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "file; fixed buffer allocation; gamma distribution
function; input output operations; item; merge sort;
movable arm disks; optimum; output buffer size; seek
time; sorting; storage allocation; string",
oldlabel = "Ferguson71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ferguson71",
}
@Article{Ramamoorthy:1971:SOE,
author = "C. V. Ramamoorthy and M. J. Gonzalez",
title = "Subexpression ordering in the execution of arithmetic
expressions",
journal = j-CACM,
volume = "14",
number = "7",
pages = "479--485",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "46 6650",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 07:14:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#RamamoorthyG71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An arithmetic expression can often be broken down into
its component subexpressions. Depending on the hardware
environment in which the expression is to be executed,
these subexpressions can be evaluated in serials, in
parallel, or in a combination of these modes. This
paper shows that expression execution time can be
minimized only if consideration is given to the
ordering of the subexpressions. In particular,
subexpressions should be executed in order of
decreasing memory and processor time requirements. This
observation is valid for configurations ranging from a
uniprocessor with an unbuffered main memory to
multiprocessor with a ``cache'' buffer memory. If the
number of subexpressions which can be executed in
parallel exceeds the number of available processors,
then execution of some of these subexpressions must be
postponed. A procedure is given which combines this
requirement with the earlier ordering considerations to
provide an optimal execution sequence.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods); C6130 (Data
handling techniques)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arithmetic expression; arithmetic expressions; cache;
compilers; computational trees; data handling; digital
arithmetic; execution time; parallel processing;
subexpression ordering",
oldlabel = "RamamoorthyG71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RamamoorthyG71",
}
@Article{McVitie:1971:SMP,
author = "D. G. McVitie and L. B. Wilson",
title = "The Stable Marriage Problem",
journal = j-CACM,
volume = "14",
number = "7",
pages = "486--490",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B99 (68A10)",
MRnumber = "46 6808",
MRreviewer = "R. B. Potts",
bibdate = "Mon Jan 22 07:03:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#McVitieW71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The original work of Gale and Shapley on an assignment
method using the stable marriage criterion has been
extended to find all the stable marriage
assignments.\par
The algorithm derived for finding all the stable
marriage assignments is proved to satisfy all the
conditions of the problem. Algorithm 411 applies to
this paper.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C7310 (Mathematics
computing)",
corpsource = "Univ. Newcastle upon Tyne, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "assignment; assignment problems; assignment
procedures; combinatorial mathematics; combinatorics;
discrete mathematics; operational research; operations
research; stable marriage problem; university
entrance",
oldlabel = "McVitieW71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McVitieW71",
}
@Article{McVitie:1971:AAT,
author = "D. G. McVitie and L. B. Wilson",
title = "{ACM Algorithm 411}: Three Procedures for the Stable
Marriage Problem [{H}]",
journal = j-CACM,
volume = "14",
number = "7",
pages = "491--492",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#McVitieW71a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Newcastle upon Tyne, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL procedures; assignment; combinatorial
mathematics; operations research; stable marriage
problem; subroutines",
oldlabel = "McVitieW71a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McVitieW71a",
}
@Article{Cermak:1971:AAG,
author = "J. {\v{C}}erm{\'{a}}k",
title = "{ACM Algorithm 412}: Graph Plotter [{J6}]",
journal = j-CACM,
volume = "14",
number = "7",
pages = "492--493",
month = jul,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:05 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/acm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Cermak71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Watkins:1973:RAG}.",
acknowledgement = ack-nhfb,
classcodes = "C6150E (General utility programs)",
corpsource = "Univ. Chem. Technol., Pardubice, Czechoslovakia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL procedure; computer graphics; graph; line;
multivalued function; plot; printer; subroutines;
utility programs",
oldlabel = "Cermak71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cermak71",
}
@Article{Raduchel:1971:RAS,
author = "William J. Raduchel",
title = "Remark on ``{Algorithm 316}: Solution of Simultaneous
Nonlinear Equations [{C5}]''",
journal = j-CACM,
volume = "14",
number = "7",
pages = "493--??",
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Raduchel71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Brown:1967:AAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Raduchel71",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Raduchel71",
}
@Article{Morris:1971:PSS,
author = "Robert Morris",
title = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
journal = j-CACM,
volume = "14",
number = "8",
pages = "509--510",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:42:05 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0210 (Algebra); C1110 (Algebra)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; algebraic expressions; equivalence; greatest
common divisors; polynomial; polynomials; resultants;
roots; subresultants; symbolic and algebraic
manipulation; zero",
sponsororg = "Assoc. Computing Machinery",
treatment = "T Theoretical or Mathematical",
}
@Article{Hearn:1971:ASM,
author = "Anthony C. Hearn",
title = "Applications of symbol manipulation in theoretical
physics",
journal = j-CACM,
volume = "14",
number = "8",
pages = "511--516",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:06 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/reduce.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hearn71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper surveys the applications of symbolic
computation techniques to problems in theoretical
physics. Particular emphasis is placed on applications
in quantum electrodynamics where the most activity has
occurred.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "Univ. Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebraic; algebraic simplification; computational
physics; data handling; physics; quantum
electrodynamics; simplification; symbol manipulation;
symbolic computation; symbolic manipulation;
theoretical physics",
oldlabel = "Hearn71",
sponsororg = "Assoc. Computing Machinery",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hearn71",
}
@Article{Hall:1971:ASR,
author = "Andrew D. {Hall, Jr.}",
title = "The {Altran} system for rational function manipulation
--- a survey",
journal = j-CACM,
volume = "14",
number = "8",
pages = "517--521",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hall71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6140D (High level
languages); C7310 (Mathematics computing)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; Altran; coefficients; computation; data
structures; integer; language; languages; polynomial
manipulation; polynomials; problem oriented; rational
function manipulation; run time data structures;
symbolic",
oldlabel = "Hall71",
sponsororg = "Assoc. Computing Machinery",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hall71",
}
@Article{Fenichel:1971:LTS,
author = "Robert R. Fenichel",
title = "List Tracing in Systems Allowing Multiple Cell Types",
journal = j-CACM,
volume = "14",
number = "8",
pages = "522--526",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:19 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Fenichel71a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "configuration; list processing; list tracing; multiple
cell types; size; storage allocation",
oldlabel = "Fenichel71a",
sponsororg = "Assoc. Computing Machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fenichel71a",
}
@Article{Moses:1971:ASG,
author = "Joel Moses",
title = "Algebraic Simplification: {A} Guide for the
Perplexed",
journal = j-CACM,
volume = "14",
number = "8",
pages = "527--537",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A15",
MRnumber = "46 8465",
bibdate = "Mon Jan 22 07:06:18 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Comp.Alg.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Moses71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0210 (Algebra); C1110 (Algebra)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; algebraic simplification; automatic;
simplification capabilities; substitution",
oldlabel = "Moses71",
sponsororg = "Assoc. Computing Machinery",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moses71",
}
@Article{Jefferys:1971:AAM,
author = "William H. Jefferys",
title = "Automatic algebraic manipulation in celestial
mechanics",
journal = j-CACM,
volume = "14",
number = "8",
pages = "538--541",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Jefferys71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7320 (Physics and chemistry computing)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; automated algebraic manipulation; celestial
mechanics; integration; perturbation theory; physics;
Poisson series; processors",
oldlabel = "Jefferys71",
sponsororg = "Assoc. Computing Machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Jefferys71",
xxtitle = "Automated Algebraic Manipulation in Celestial
Mechanics",
}
@Article{Barton:1971:GRA,
author = "David Barton and John P. Fitch",
title = "General relativity and the application of algebraic
manipulative systems",
journal = j-CACM,
volume = "14",
number = "8",
pages = "542--547",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "83.53",
MRnumber = "48 1640",
MRreviewer = "I. K. Marek",
bibdate = "Mon Jan 22 06:23:42 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BartonF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes some applications of symbolic
algebra systems to problems of general relativity
including the derivation of the field equations, the
Petrov classification of a metric, and the solution of
the field equations in the presence of matter in a
simple case. Attention is drawn to the strictly
algebraic difficulties encountered in this work.",
acknowledgement = ack-nhfb,
classcodes = "B0210 (Algebra); C1110 (Algebra)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "Computer Lab., Cambridge, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; algebraic manipulation; algebraic
manipulative systems; equation manipulation; field
equations; general relativity; nonnumerical
mathematics; Petrov classification; symbolic; symbolic
mathematics",
oldlabel = "BartonF71",
sponsororg = "Assoc. Computing Machinery",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BartonF71",
}
@Article{Moses:1971:SIS,
author = "Joel Moses",
title = "Symbolic Integration: The Stormy Decade",
journal = j-CACM,
volume = "14",
number = "8",
pages = "548--560",
month = aug,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A15",
MRnumber = "46 8466",
MRreviewer = "D. B. Hunter",
bibdate = "Mon Jan 22 07:06:20 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Moses71a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Three approaches to symbolic integration in the 1960's
are described. The first, from artificial intelligence,
led to Slagle's SAINT and to a large degree to Moses'
SIN. The second, from algebraic manipulation, led to
Manove's implementation and to Horowitz' and Tobey's
reexamination of the Hermite algorithm for integrating
rational functions. The third, from mathematics, led to
Richardson's proof of the unsolvability of the problem
for a class of functions and for Risch's decision
procedure for the elementary functions.Generalizations
of Risch's algorithm to a class of special functions
and programs for solving differential equations and for
finding the definite integral are also described.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C4160 (Numerical
integration and differentiation)",
conflocation = "Los Angeles, CA, USA; 23-25 March 1971",
conftitle = "Papers from the 2nd symposium on symbolic and
algebraic manipulation",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; artificial intelligence; definite; definite
integrals; differential equations; Hermite; integral;
integrating rational functions; integration; Manove's
implementation; Moses' SIN; proof; rational functions;
Richardson's; Risch's decision procedure; SAINT;
Slagle's; symbolic integration; unsolvability",
oldlabel = "Moses71a",
sponsororg = "Assoc. Computing Machinery",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moses71a",
}
@Article{Teichroew:1971:ERU,
author = "Daniel Teichroew",
title = "Education Related to the Use of Computers in
Organizations",
journal = j-CACM,
volume = "14",
number = "9",
pages = "573--588",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:51 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Teichroew71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "Learn about data bases and management. Extensive
bibliography.",
classcodes = "C0220 (Computing education and training)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "colleges; computer education; curriculum development;
education; information systems; management; management
information systems; professional; societies;
universities",
oldlabel = "Teichroew71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Teichroew71",
}
@Article{Isoda:1971:EBT,
author = "Sadahiro Isoda and Eiichi Goto and Izumi Kimura",
title = "An Efficient Bit Table Technique for Dynamic Storage
Allocation of $2^n$-word Blocks",
journal = j-CACM,
volume = "14",
number = "9",
pages = "589--592",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#IsodaG71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient bit table technique for dynamic storage
allocation of $2^n$-word blocks, which requires a
minimized amount of memory for bookkeeping purposes, is
described. The technique has been tested in an
implementation of the list processing language $L^6$. A
number of ideas incorporated in the processor are also
described.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Tokyo Univ., Japan",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "$L^6$; 2/sup n/ word blocks; bit table; bit table
technique; bookkeeping; buddy system; dynamic storage
allocation; free storage; L/sup 6/; list processing;
list processing language; minimum memory; storage
allocation",
oldlabel = "IsodaG71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/IsodaG71",
}
@Article{Paton:1971:CAB,
author = "Keith Paton",
title = "Corrigendum: ``{An algorithm for the blocks and
cutnodes of a graph}''",
journal = j-CACM,
volume = "14",
number = "9",
pages = "592--592",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:33:19 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Paton:1971:ABC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Wong:1971:CSA,
author = "Eugene Wong and T. C. Chiang",
title = "Canonical Structure in Attribute Based File
Organization",
journal = j-CACM,
volume = "14",
number = "9",
pages = "593--597",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:44 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#WongC71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: PhD Th., UCB, EECS, 1973.",
acknowledgement = ack-nhfb,
annote = "Combinatorial retrieval of multi-attribute subsets,
applicable when there are few keyword choices. Thisis
of T. C. Chiang.",
classcodes = "C6120 (File organisation)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arbitrary Boolean functions; atoms; attribute based;
boolean algebra; canonical structure; file
organisation; file organization; intersections; lists;
queries",
oldlabel = "WongC71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WongC71",
}
@Article{Phillips:1971:NBO,
author = "David L. Phillips",
title = "A Note on Best One-Sided Approximations",
journal = j-CACM,
volume = "14",
number = "9",
pages = "598--600",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D15",
MRnumber = "45 6158",
MRreviewer = "H. L. Loeb",
bibdate = "Mon Jan 22 07:12:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Phillips71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "best; best approximation; best approximations; error;
function approximation; goodness of fit; logarithmic;
multiplicative constant; one sided approximations;
one-sided approximation; relationship; relative error;
uniform norm",
oldlabel = "Phillips71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Phillips71",
}
@Article{Liniger:1971:SCN,
author = "Werner Liniger",
title = "A stopping criterion for the {Newton--Raphson} method
in implicit multistep integration algorithms for
nonlinear systems of ordinary differential equations",
journal = j-CACM,
volume = "14",
number = "9",
pages = "600--601",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65.60",
MRnumber = "44\#7754",
bibdate = "Mon Jan 22 06:59:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Liniger71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "IBM, Yorktown Heights, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "implicit multistep integration; integration; linear
multistep formulas; Newton--Raphson method; nonlinear
differential equations; nonlinear systems; ordinary
differential equations; stopping criterion",
oldlabel = "Liniger71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Liniger71",
}
@Article{Flores:1971:ABS,
author = "Ivan Flores and George Madpis",
title = "Average Binary Search Length for Dense Ordered Lists",
journal = j-CACM,
volume = "14",
number = "9",
pages = "602--603",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#FloresM71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Flores:1972:CAB}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "City Univ. New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "average length; binary search; dense ordered lists;
information retrieval; list processing",
oldlabel = "FloresM71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FloresM71",
}
@Article{Fenichel:1971:CCL,
author = "Robert R. Fenichel",
title = "Comment on {Cheney}'s List-Compaction Algorithm",
journal = j-CACM,
volume = "14",
number = "9",
pages = "603--604",
month = sep,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:20 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Fenichel71b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "garbage collector; LISP; list processing; storage
allocation; virtual memory",
oldlabel = "Fenichel71b",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fenichel71b",
}
@Article{Earley:1971:TUD,
author = "Jay Earley",
title = "Toward an Understanding of Data Structures",
journal = j-CACM,
volume = "14",
number = "10",
pages = "617--627",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:11 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Earley71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structures; formalism; graph; implementation;
programming language; semantic",
oldlabel = "Earley71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Earley71",
}
@Article{ANSI:1971:CFS,
author = "{ANSI Subcommittee X3J3}",
title = "Clarification of {Fortran} Standards --- Second
Report",
journal = j-CACM,
volume = "14",
number = "10",
pages = "628--642",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#X3J371;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{ANSI:1966:AF}.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C6140D (High level
languages)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "American National Standard; Basic Fortran; Fortran;
FORTRAN; language; language standard; language standard
interpretation; language standard maintenance;
programming language; specification; standard
clarification; standardization; standardization
committee; standards",
oldlabel = "X3J371",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/X3J371",
}
@Article{Oldehoeft:1971:EAI,
author = "Arthur E. Oldehoeft and Samuel D. Conte",
title = "Experiments with an automated instructional system for
numerical methods",
journal = j-CACM,
volume = "14",
number = "10",
pages = "643--650",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#OldehoeftC71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7810C (Computer-aided instruction)",
corpsource = "Iowa State Univ., Ames, IA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer aided; computer aided instruction;
instruction; instructional systems; numerical methods",
oldlabel = "OldehoeftC71",
treatment = "X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OldehoeftC71",
}
@Article{Newman:1971:DP,
author = "William M. Newman",
title = "Display Procedures",
journal = j-CACM,
volume = "14",
number = "10",
pages = "651--660",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Newman71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays)",
corpsource = "Univ. Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer graphics; display files; display systems;
programming languages",
oldlabel = "Newman71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Newman71",
}
@Article{Nemeth:1971:UPM,
author = "Alan G. Nemeth and Paul D. Rovner",
title = "User program measurement in a time-shared
environment",
journal = j-CACM,
volume = "14",
number = "10",
pages = "661--666",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:46 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/monitor.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1971.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#NemethR71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A general discussion of the measurement of software
systems is followed by a description of a hardware and
software scheme for measuring user programs in a
time-shared environment. The TX-2 computer at MIT
Lincoln Laboratory was used for the implementation of
such a system and the characteristics of this
implementation are reported. Finally, it is shown how
other time-sharing systems may provide similar
measuring facilities.",
acknowledgement = ack-nhfb,
annote = "A general discussion of the measurement of software
systems is followed by a description of a hardware and
software scheme for measuring user programs in a
time-shared environment.",
classcodes = "C6150J (Operating systems)",
corpsource = "MIT, Lexington, MA, USA",
country = "USA",
descriptors = "Performance evaluation; software monitor; time
sharing; operating system; multiprogramming;
measurement; technology; virtual computer; performance
improvement",
enum = "2252",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer software; measurement; multiprogramming
systems; operating systems; performance improvement;
sharing systems; software; technology; time;
time-sharing systems; TX2 computer; user program
measurement; virtual computers",
language = "English",
oldlabel = "NemethR71",
references = "11",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NemethR71",
}
@Article{Courtois:1971:CCR,
author = "P. J. Courtois and F. Heymans and David Lorge Parnas",
title = "Concurrent Control with ``Readers'' and ``Writers''",
journal = j-CACM,
volume = "14",
number = "10",
pages = "667--668",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:52 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/softeng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#CouroisHP71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "Algorithms for scheduler design for multi accessed
database",
classcodes = "C6150J (Operating systems)",
corpsource = "MBLE Res. Lab., Brussels, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "critical section; mutual exclusion; operating systems
(computers); programs; resources; shared access to;
supervisory and executive",
oldlabel = "CouroisHP71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CouroisHP71",
}
@Article{Lyness:1971:AAE,
author = "J. N. Lyness and G. Sande",
title = "{ACM Algorithm 413}: {ENTCAF} and {ENTCRE}: Evaluation
of Normalized {Taylor} Coefficients of an Analytic
Function ({C5})",
journal = j-CACM,
volume = "14",
number = "10",
pages = "669--675",
month = oct,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Lyness71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Argonne Nat. Lab., IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Cauchy integral; complex arithmetic; complex
variables; fast; Fourier transform; interpolation;
mathematics; numerical differentiation; numerical
integration; subroutines; Taylor coefficients; Taylor
series",
oldlabel = "Lyness71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lyness71",
}
@Article{Branquart:1971:CSA,
author = "P. Branquart and J. Lewi and Michel Sintzoff and P. L.
Wodon",
title = "The composition of semantics in {Algol 68}",
journal = j-CACM,
volume = "14",
number = "11",
pages = "697--708",
month = nov,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BranquartLSW71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "MBLE, Brussels, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; Algol 68; data; design of programming
languages; programming languages; programming
primitives; recursive composition; semantics;
structures",
oldlabel = "BranquartLSW71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BranquartLSW71",
}
@Article{Hamblen:1971:UCH,
author = "John W. Hamblen",
title = "Using computers in higher education: past
recommendations, status, and needs",
journal = j-CACM,
volume = "14",
number = "11",
pages = "709--712",
month = nov,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:06 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Hamblen71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Southern Regional Education Board, Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; computers; data processing; degree
programs; education; educational technology; higher
education; laboratory; national goals; testing",
oldlabel = "Hamblen71",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hamblen71",
}
@Article{Shell:1971:OPS,
author = "Donald L. Shell",
title = "Optimizing the Polyphase Sort",
journal = j-CACM,
volume = "14",
number = "11",
pages = "713--719",
month = nov,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Shell71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Shell:1972:COP}.",
abstract = "Various dispersion algorithms for the polyphase
sorting procedure are examined.The optimum algorithm
based on minimizing the total number of unit strings
read is displayed. The logic of this algorithm is
rather complicated; hence, several other new dispersion
algorithms with more straightforward logic are
presented. Of the simple dispersion algorithms
discussed, the Horizontal is best. It does
approximately one-fourth to one and one-half percent
less reading and writing than most algorithms in use
today. An additional two and one-fourth to three
percent improvement can be achieved by utilizing the
Modified Optimum Algorithm. This algorithm is
relatively straightforward, but it requires a fairly
close estimate of the total number of unit strings
before the dispersion begins.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "General Electric Co., Schenectady, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dispersion algorithm; dispersion algorithms;
minimizing; optimisation; optimum; optimum dispersion
algorithm; polyphase sorting; repetition operator;
sorting; unit strings",
oldlabel = "Shell71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shell71",
}
@Article{Aramaki:1971:AEP,
author = "Itaru Aramaki and Tomokazu Kawabata and Kazuhiko
Arimoto",
title = "Automation of Etching-Pattern Layout",
journal = j-CACM,
volume = "14",
number = "11",
pages = "720--730",
month = nov,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:46 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#AramakiKA71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B1130B (Computer-aided circuit analysis and design);
B2210 (Printed circuits); C7410D (Electronic
engineering computing)",
corpsource = "Sumitomo Electric Industries Ltd., Osaka, Japan",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer-aided circuit design; etching; heuristic
etching pattern layout; ICs; Lee's algorithm; maze
running; printed circuit board; printed circuits;
wiring design",
oldlabel = "AramakiKA71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AramakiKA71",
}
@Article{Malcolm:1971:AFP,
author = "Michael A. Malcolm",
title = "On Accurate Floating-Point Summation",
journal = j-CACM,
volume = "14",
number = "11",
pages = "731--736",
month = nov,
year = "1971",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/362854.362889",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65G05 (68-XX)",
MRnumber = "47 4434",
MRreviewer = "P. Brock",
bibdate = "Mon Jan 22 07:01:06 MST 2001",
bibsource = "ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Malcolm71;
https://www.math.utah.edu/pub/bibnet/subjects/acc-stab-num-alg-2ed.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
acknowledgement = ack-nj # " and " # ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Stanford Univ., CA, USA",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accurate floating-point summation; digital arithmetic;
error analysis",
oldlabel = "Malcolm71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Malcolm71",
}
@Article{Golub:1971:AAC,
author = "G. H. Golub and L. B. Smith",
title = "{ACM Algorithm 414}: {Chebyshev} Approximation of
Continuous Functions by a {Chebyshev} System of
Functions [{E2}]",
journal = j-CACM,
volume = "14",
number = "11",
pages = "737--746",
month = nov,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:17 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/acm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BolubS71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL 60; approximation; Chebyshev approximation;
critical points; minimax; numerical properties;
orthogonal polynomials; Remez algorithm; subroutines",
oldlabel = "BolubS71",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BolubS71",
}
@Article{Gordon:1971:RPT,
author = "Richard Gordon and Gabor T. Herman",
title = "Reconstruction of Pictures from Their Projections",
journal = j-CACM,
volume = "14",
number = "12",
pages = "759--768",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#GordonH71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Gordon:1972:CRP}.",
abstract = "There are situations in the natural sciences and
medicine (e.g. in electron microscopy and X-ray
photography) in which it is desirable to estimate the
gray levels of a digital picture at the individual
points from the sums of the gray levels along straight
lines (projections) at a few angles. Usually, in such
situations, the picture is far from determined and the
problem is to find the ``most representative'' picture.
Three algorithms are described (all using Monte Carlo
methods) which were designed to solve this problem. The
algorithms are applicable in a large and varied number
of fields. The most important uses may be the
reconstruction of possibly asymmetric particles from
electron micrographs and three-dimensional X-ray
analysis.",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "State Univ., New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; biomedical image processing; efficient
encoding; electron microscopy; image; image processing;
linear programming; mathematical programming; medicine;
Monte Carlo; Monte Carlo methods; Monte Carlo
techniques; natural sciences; optical information;
optimization; physics; picture compression; picture
description; picture processing; processing;
projections; reconstruction of pictures; stereology;
techniques; X-ray analysis; X-ray photography",
oldlabel = "GordonH71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GordonH71",
}
@Article{Amidon:1971:ASB,
author = "E. L. Amidon and G. S. Akin",
title = "Algorithmic Selection of the Best Method for
Compressing Map Data Strings",
journal = j-CACM,
volume = "14",
number = "12",
pages = "769--774",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#AmidonA71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The best of a dozen different methods for compressing
map data is illustrated. The choices are generated by
encoding data strings-sequence of like codes-by three
methods and in four directions. Relationships are
developed between compression alternatives to avoid
comparing all of them. The technique has been used to
compress data from forest resource maps, but is widely
applicable to map and photographic data reduction.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C7890 (Other special
applications of computing)",
corpsource = "Pacific Southwest Forest and Range Experiment Station,
Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data compression; data reduction; data reduction and
analysis; data strings; forest resource maps;
information retrieval; input/output; map; map storage;
run coding; storage",
oldlabel = "AmidonA71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AmidonA71",
}
@Article{Mullin:1971:RUS,
author = "James K. Mullin",
title = "Retrieval-Update Speed Tradeoffs Using Combined
Indices",
journal = j-CACM,
volume = "14",
number = "12",
pages = "775--776",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:43 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Mullin71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
corpsource = "Univ. Western Ontario, London, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combined index files; file; file organisation; file
update; indexing; information retrieval; information
retrieval systems; inverted files; minimal cost;
organisation; query; retrieval time; speed tradeoffs",
oldlabel = "Mullin71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mullin71",
xxtitle = "Retrieval-Update Speed Tradeoffs Using Combined
Indexes",
}
@Article{Harrison:1971:IST,
author = "Malcolm C. Harrison",
title = "Implementation of the Substring Test by Hashing",
journal = j-CACM,
volume = "14",
number = "12",
pages = "777--779",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Harrison71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/spe.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "See also \cite{Tharp:1982:PTS}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "New York Univ., NY, USA",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compression; data handling; hashing; information;
information retrieval; programming; searching;
signature; subset; substring test",
oldlabel = "Harrison71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Harrison71",
}
@Article{Wulf:1971:BLS,
author = "W. A. (William A.) Wulf and D. B. Russell and A. N.
Habermann",
title = "{BLISS}: {A} Language for Systems Programming",
journal = j-CACM,
volume = "14",
number = "12",
pages = "780--790",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "46 8463",
MRreviewer = "P. Deussen",
bibdate = "Mon Jan 22 07:30:58 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Ai/Ai.misc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#WulfR71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://doi.acm.org/10.1145/362919.362936",
abstract = "A language, BLISS, is described. This language is
designed so as to be especially suitable for use in
writing production software systems for a specific
machine (the PDP-10): compilers, operating systems,
etc. Prime design goals of the design are the ability
to produce highly efficient object code, to allow
access to all relevant hardware features of the host
machine, and to provide a rational means by which to
cope with the evolutionary nature of systems programs.
A major feature which contributes to the realization of
these goals is a mechanism permitting the definition of
the representation of all data structures in terms of
the access algorithm for elements of the structure.",
acknowledgement = ack-nhfb,
classcodes = "C5420 (Mainframes and minicomputers); C6120 (File
organisation); C6150C (Compilers, interpreters and
other processors); C6150J (Operating systems)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "BLISS; compilers; data structures; implementation
language; language; minicomputers; operating systems;
program processors; programming languages; software
systems; supervisory and executive programs; systems
programming",
oldlabel = "WulfR71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WulfR71",
}
@Article{Rochfeld:1971:NLT,
author = "Arnold Rochfeld",
title = "New {LISP} Techniques for a Paging Environment",
journal = j-CACM,
volume = "14",
number = "12",
pages = "791--795",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:42 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Rochfeld71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6140D (High level
languages)",
corpsource = "Univ. Edinburgh, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "block segment; collection; compact; core
fragmentation; garbage; LISP; list processing; list
structures; management; paging environment; procedure
oriented languages; storage; virtual memory",
oldlabel = "Rochfeld71",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rochfeld71",
}
@Article{Blumberg:1971:NMN,
author = "John W. Blumberg and Clinton R. Foulk",
title = "A note on `a modification of {Nordsieck}'s method
using an ``off-step'' point'",
journal = j-CACM,
volume = "14",
number = "12",
pages = "796--796",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BlumbergF71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Ohio State Univ., Columbus, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "corrector; corrector methods; differential equations;
modification; multistep methods; Nordsieck's method;
numerical methods; off error; ordinary differential
equations; predictor; predictor-; round",
oldlabel = "BlumbergF71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BlumbergF71",
}
@Article{Gustafson:1971:RCG,
author = "Sven-{\AA}ke A. Gustafson",
title = "Rapid Computation of General Interpolation Formulas
and Mechanical Quadrature Rules",
journal = j-CACM,
volume = "14",
number = "12",
pages = "797--801",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05",
MRnumber = "46 10167a",
MRreviewer = "V. Pereyra",
bibdate = "Mon Jan 22 06:47:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gustafson71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Royal Inst. Technol., Stockholm, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "divided differences; formula; functionals; general
interpolation formulas; Hermitian; interpolation;
Lagrangian; linear; mechanical quadrature rules;
Newton's interpolation; rapid computation",
oldlabel = "Gustafson71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gustafson71",
}
@Article{Bourgeois:1971:EMA,
author = "Fran{\c{c}}ois Bourgeois and Jean-Claude Lassalle",
title = "An extension of the {Munkres} algorithm for the
assignment problem to rectangular matrices",
journal = j-CACM,
volume = "14",
number = "12",
pages = "802--804",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90C05",
MRnumber = "47 4628",
bibdate = "Mon Jan 22 06:27:39 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BourgeoisL71;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The assignment problem, together with Munkres proposed
algorithm for its solution in square matrices, is
presented first. Then the authors develop an extension
of this algorithm which permits a solution for
rectangular matrices. Timing results obtained by using
an adapted version of Silver's Algol procedure are
discussed, and a relation between solution time and
problem size is given.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "CERN, Geneva, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; assignment problem; matrix algebra; Munkres
algorithm; operations research; optimisation;
optimization theory; rectangular matrices",
oldlabel = "BourgeoisL71",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BourgeoisL71",
}
@Article{Bourgeois:1971:AAA,
author = "Fran{\c{c}}ois Bourgeois and John-Claude C. Lassalle",
title = "{ACM Algorithm 415}: Algorithm for the Assignment
Problem (Rectangular Matrices) [{H}]",
journal = j-CACM,
volume = "14",
number = "12",
pages = "805--806",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BourgeoisL71a;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#BourgeoisL71b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "CERN, Geneva, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; assignment problem; matrix algebra;
operations research; optimization; rectangular
matrices; subroutines",
oldlabel = "BourgeoisL71a; BourgeoisL71b",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BourgeoisL71a;
ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BourgeoisL71b",
}
@Article{Gustafson:1971:AARa,
author = "Sven-{\AA}ke Gustafson",
title = "{ACM Algorithm 416}: Rapid Computation of Coefficients
of Interpolation Formulas [{E1}]",
journal = j-CACM,
volume = "14",
number = "12",
pages = "806--807",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05",
MRnumber = "46 10167b",
MRreviewer = "V. Pereyra",
bibdate = "Mon Jan 22 06:47:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gustafson71a;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gustafson71c;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; coefficients; divided differences;
interpolation; interpolation formula; rapid
computation; subroutines",
oldlabel = "Gustafson71a; Gustafson71c",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gustafson71a;
ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gustafson71c",
}
@Article{Gustafson:1971:AARb,
author = "Sven-{\AA}ke Gustafson",
title = "{ACM Algorithm 417}: Rapid Computation of Weights of
Interpolatory Quadrature Rules [{D1}]",
journal = j-CACM,
volume = "14",
number = "12",
pages = "807--807",
month = dec,
year = "1971",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05",
MRnumber = "46 10167c",
MRreviewer = "V. Pereyra",
bibdate = "Mon Jan 22 06:47:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gustafson71b;
http://dblp.uni-trier.de/db/journals/cacm/cacm14.html#Gustafson71d;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; divided differences; interpolation;
interpolation formulae; mechanical quadrature rules;
rapid computation; subroutines; weights",
oldlabel = "Gustafson71b; Gustafson71d",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gustafson71b;
ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gustafson71d",
}
@Article{Lesk:1972:PPR,
author = "Arthur M. Lesk",
title = "Pictorial pattern recognition and the phase problem of
{X}-ray crystallography",
journal = j-CACM,
volume = "15",
number = "1",
pages = "3--6",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Lesk72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "A6100 (Structure of liquids and solids;
crystallography); A6150 (Crystalline state); B6140C
(Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Princeton Univ., NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "calculation methods; cross correlation;
crystallography; hypotheses; molecular model building;
pattern recognition; phase problem; physics; pictorial
pattern recognition; structural; X-ray; X-ray
crystallography",
oldlabel = "Lesk72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lesk72",
}
@Article{Levialdi:1972:SBP,
author = "Stefano Levialdi",
title = "On Shrinking Binary Picture Patterns",
journal = j-CACM,
volume = "15",
number = "1",
pages = "7--10",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Levialdi72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A parallel processing algorithm for shrinking binary
patterns to obtain single isolated elements, one for
each pattern, is presented. This procedure may be used
for counting patterns on a matrix, and a hardware
implementation of the algorithm using large scale
integrated technology is envisioned. The principal
features of this method are the very small window
employed (two-by-two elements), the parallel nature of
the process, and the possibility of shrinking any
pattern, regardless of the complexity of its
configuration. Problems regarding merging and
disconnection of patterns during the process as well as
the determination of the maximum number of steps
necessary to obtain a single isolated element from a
pattern, are reviewed and discussed. An analogy with a
neural network description, in terms of McCulloch-Pitts
``neurons'' is presented.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "CNR, Napoli, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "counting binary patterns; counting patterns;
disconnection; isolated element; large scale
integrated; matrix; merging; multiple connected;
multiple connected pictures; neural network; parallel
processing; pattern recognition; pictures; shrinking;
shrinking binary picture patterns; single; small
window; technology",
oldlabel = "Levialdi72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Levialdi72",
}
@Article{Duda:1972:UHT,
author = "Richard O. Duda and Peter E. Hart",
title = "Use of the {Hough} transformation to detect lines and
curves in pictures",
journal = j-CACM,
volume = "15",
number = "1",
pages = "11--15",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:51 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/Reverse.eng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#DudaH72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Hough has proposed an interesting and computationally
efficient procedure for detecting lines in pictures.
This paper points out that the use of angle-radius
rather than slope-intercept parameters simplifies the
computation further. It also shows how the method can
be used for more general curve fitting, and gives
alternative interpretations that explain the source of
its efficiency.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "Stanford Res. Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "angle radius; colinear points; curve detection;
curves; detecting lines; Hough transformation; line
detection; pattern recognition; picture processing;
pictures; point-line transformation",
oldlabel = "DudaH72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DudaH72",
}
@Article{Irons:1972:CES,
author = "Edgar T. Irons and Frans M. Djorup",
title = "A {CRT} Editing System",
journal = j-CACM,
volume = "15",
number = "1",
pages = "16--20",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#IronsD72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Inst. Defense Analyses, Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "CRT editing system; entry display; manipulation
program; text; text editing; time sharing",
oldlabel = "IronsD72",
treatment = "A Application; E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/IronsD72",
}
@Article{Dwyer:1972:TSA,
author = "T. A. Dwyer",
title = "Teacher\slash student authored {CAI} using the
{NEWBASIC} system",
journal = j-CACM,
volume = "15",
number = "1",
pages = "21--28",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:03 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Dwyer72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7810C (Computer-aided instruction)",
corpsource = "Univ. Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "CAI; capability; CATALYST; computer aided instruction;
flexible CAI scan; interactive; NEWBASIC system;
secondary school",
oldlabel = "Dwyer72",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dwyer72",
}
@Article{Shell:1972:COP,
author = "Donald L. Shell",
title = "Corrigendum: {``Optimizing the Polyphase Sort''}",
journal = j-CACM,
volume = "15",
number = "1",
pages = "28--28",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:37:36 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Shell:1971:OPS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{McCalla:1972:MMU,
author = "Gordon I. McCalla and Jeffrey R. Sampson",
title = "{MUSE}: {A} Model To Understand Simple {English}",
journal = j-CACM,
volume = "15",
number = "1",
pages = "29--40",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#McCallaS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Univ. Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ambiguity; computer model; English sentences;
generalization; information addition to memory;
interpretation; intersection procedure; language
translation and linguistics; MUSE; natural language
processing; network; resolution; semantic memory;
syntactic analysis; text",
oldlabel = "McCallaS72",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McCallaS72",
}
@Article{Shrager:1972:QPN,
author = "Richard I. Shrager",
title = "Quadratic Programming for Nonlinear Regression",
journal = j-CACM,
volume = "15",
number = "1",
pages = "41--45",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Shrager72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
corpsource = "Dept. Health and Education, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "diagonal method; linear constraints; magnified;
nonlinear regression; quadratic programming",
oldlabel = "Shrager72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shrager72",
}
@Article{Salzer:1972:OFF,
author = "Herbert E. Salzer",
title = "Ordering +-f(+-f(+-f(\ldots{}+-f(x)..))) When f(x) Is
Positive Monotonic",
journal = j-CACM,
volume = "15",
number = "1",
pages = "45--46",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Salzer72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4190 (Other numerical methods)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combination; numerical methods; ordering; positive
monotonic; real arguments; signs",
oldlabel = "Salzer72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Salzer72",
xxtitle = "Ordering +or-f(+or-f(+or-f(\ldots{}+or-f(x)\ldots{})))
when f(x) is positive monotonic",
}
@Article{Einarsson:1972:AAC,
author = "Bo Einarsson",
title = "{ACM Algorithm 418}: Calculation of {Fourier}
Integrals [{D1}]",
journal = j-CACM,
volume = "15",
number = "1",
pages = "47--48",
month = jan,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:40 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Einarsson72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark
\cite{Einarsson:1972:RAC,Piessens:1974:RAC}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Res. Inst. Nat. Defense, Tumba, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "calculation; FORTRAN routine; Fourier integrals;
integration; subroutines",
oldlabel = "Einarsson72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Einarsson72",
}
@Article{Macleod:1972:STR,
author = "I. D. G. Macleod",
title = "Certification of ``{Algorithm 380}: In-Situ
Transposition of a Rectangular Matrix [{F1}]''",
journal = j-CACM,
volume = "15",
number = "1",
pages = "49--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Macleod72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Laflin:1970:AAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Macleod72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Macleod72",
}
@Article{Schrack:1972:RAU,
author = "G{\"u}nther F. Schrack",
title = "Remark on ``{Algorithm 391}: Unitary Symmetric
Polynomials [{Z}]''",
journal = j-CACM,
volume = "15",
number = "1",
pages = "49--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Schrack72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McKay:1970:AAU}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Schrack72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schrack72",
}
@Article{Pager:1972:PCB,
author = "David Pager",
title = "A Proposal for a Computer-Based Interactive Scientific
Community",
journal = j-CACM,
volume = "15",
number = "2",
pages = "71--75",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:03 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Pager72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Because of the problems created by the explosion of
papers in the mathematical sciences and the drawbacks
that this places on research, it is suggested that a
tree of all mathematical results and terminology be
maintained in a multiterminal computer
system.\par
Users of the system can store in the computer an
updated file of their current knowledge, and on
selecting a paper to read, they can obtain from the
computer the minimum subtree of theorems required to
bring them from what they already know to the
background knowledge which the paper assumes. Under
certain conditions, means are also provided for the
contribution of useful comments by the readers of a
work and for interaction between commentators and with
the author. \par
This paper describes how the system can be organized
and the role required of readers, writers, and
commentators.",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
corpsource = "Univ. Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "commentators; computer utility; data structures;
information retrieval; information retrieval systems;
interactive system; organization of scientific
community; readers; trees; trees (mathematics);
writers",
oldlabel = "Pager72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pager72",
}
@Article{Eastman:1972:PRS,
author = "Charles M. Eastman",
title = "Preliminary report on a system for general space
planning",
journal = j-CACM,
volume = "15",
number = "2",
pages = "76--87",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Eastman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C7400 (Engineering
computing)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; architects; CAD; computer language;
computer-aided design; engineering; extension of ALGOL;
general space planning; heuristic programming;
orthographic drawings; set of programs; urban
designers",
oldlabel = "Eastman72",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Eastman72",
}
@Article{Martin:1972:OBT,
author = "William A. Martin and D. N. Ness",
title = "Optimizing Binary Trees Grown with a Sorting
Algorithm",
journal = j-CACM,
volume = "15",
number = "2",
pages = "88--93",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:02 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#MartinN72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; binary trees; data handling; optimisation;
optimization; recursion; retrieving information;
sorting; trees (mathematics)",
oldlabel = "MartinN72",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MartinN72",
}
@Article{Oldehoeft:1972:MCP,
author = "Arthur E. Oldehoeft and Maurice H. Halstead",
title = "Maximum computing power and cost factors in the
centralization problem",
journal = j-CACM,
volume = "15",
number = "2",
pages = "94--96",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#OldehoeftH72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
corpsource = "Iowa State Univ., Ames, IA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "centralisation; computer management; cost factors;
decentralisation; economics; economies of scale;
installations; large single machine installations;
management; maximum computing power; multimachine",
oldlabel = "OldehoeftH72",
treatment = "E Economic",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OldehoeftH72",
}
@Article{Jenkins:1972:AAZ,
author = "Michael A. Jenkins and J. F. Traub",
title = "{ACM Algorithm 419}: Zeros of a Complex Polynomial
[{C2}]",
journal = j-CACM,
volume = "15",
number = "2",
pages = "97--99",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#JenkinsT72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Withers:1974:RAZ}.",
acknowledgement = ack-nhfb,
classcodes = "C4150 (Nonlinear and functional equations); C7310
(Mathematics computing)",
corpsource = "Queen's Univ., Kingston, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "complex polynomial; FORTRAN; poles and zeros;
polynomials; roots; subroutine; subroutines; zeros",
oldlabel = "JenkinsT72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JenkinsT72",
}
@Article{Williamson:1972:AAH,
author = "Hugh Williamson",
title = "{ACM Algorithm 420}: Hidden-Line Plotting Program
[{J6}]",
journal = j-CACM,
volume = "15",
number = "2",
pages = "100--103",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:14 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1972.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Williamson72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks
\cite{Macleod:1973:RAH,Williamson:1973:RAH,Ellis:1974:RAHa,Gaither:1974:RAH,Ellis:1974:RAHb}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Tracor Computing Corp., Austin, TX, USA",
descriptors = "Fortran; graphics; iterative method; application;
method; human factors; diagram manipulation; hidden
line algorithm",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer graphics; data handling; FORTRAN; hidden line
plotting; subroutine; subroutines; surface plot",
oldlabel = "Williamson72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Williamson72",
}
@Article{Moorer:1972:MCC,
author = "James Anderson Moorer",
title = "Music and Computer Composition",
journal = j-CACM,
volume = "15",
number = "2",
pages = "104--113",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:49 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Moorer72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7820 (Humanities
computing)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; composition; computer music;
harmony; heuristic; humanities; models of cognitive
processes; music theory; program; programming",
oldlabel = "Moorer72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moorer72",
}
@Article{Flores:1972:CAB,
author = "Ivan Flores and George Madpis",
title = "Corrigendum: {``Average Binary Search Length for Dense
Ordered Lists''}",
journal = j-CACM,
volume = "15",
number = "2",
pages = "113--113",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:37:46 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Flores:1971:ABS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gordon:1972:CRP,
author = "Richard Gordon and Gabor T. Herman",
title = "Corrigendum: {``Reconstruction of Pictures from Their
Projections''}",
journal = j-CACM,
volume = "15",
number = "2",
pages = "113--113",
month = feb,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Fri Jan 17 18:38:30 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gordon:1971:RPT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Denning:1972:PAS,
author = "Peter J. Denning and Brian Randell",
title = "Papers from the 3rd {ACM} symposium on operating
systems principles",
journal = j-CACM,
volume = "15",
number = "3",
pages = "133--134",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Apr 08 20:44:30 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "access; computer; operating systems; operating systems
(computers); parallel processing supervisory;
partitioning; storage; time sharing systems",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical; T Theoretical or Mathematical",
}
@Article{Bobrow:1972:TPT,
author = "Daniel G. Bobrow and Jerry D. Burchfiel and Daniel L.
Murphy and Raymond S. Tomlinson",
title = "{TENEX}, {A} Paged Time-Sharing System for the
{PDP-10}",
journal = j-CACM,
volume = "15",
number = "3",
pages = "135--143",
month = mar,
year = "1972",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/361268.361271",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:04 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BobrowBMT72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "TENEX is a new time sharing system implemented on a
DEC PDP-10 augmented by special paging hardware
developed at BBN. This report specifies a set of goals
which are important for any time sharing system. It
describes how the TENEX design and implementation
achieve these goals. These include specifications for a
powerful multiprocess large memory virtual machine,
intimate terminal interaction, comprehensive uniform
file and I/O capabilities, and clean flexible system
structure. Although the implementation described here
required some compromise to achieve a system
operational within six months of hardware checkout,
TENEX has met its major goals and provided reliable
service at several sites and through the ARPA
network.",
acknowledgement = ack-nhfb,
annote = "Includes description of file system aspects and
protection.",
classcodes = "C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Computer Sci. Div., Cambridge, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "minicomputers; paged time sharing system; PDP 10;
TENEX; time-sharing programs",
oldlabel = "BobrowBMT72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BobrowBMT72",
}
@Article{Liskov:1972:DVO,
author = "Barbara H. Liskov",
title = "The Design of the {Venus} Operating System",
journal = j-CACM,
volume = "15",
number = "3",
pages = "144--149",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:22 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Liskov72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6150J (Operating
systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "MITRE Corporation. Bedford, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "architecture; computer architecture; operating systems
(computers); small computer; software; Venus operating
system",
oldlabel = "Liskov72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Liskov72",
}
@Article{Gaines:1972:OSB,
author = "R. Stockton Gaines",
title = "An Operating System Based on the Concept of a
Supervisory Computer",
journal = j-CACM,
volume = "15",
number = "3",
pages = "150--156",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gaines72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Inst. Defense Analyses, von Neumann Hall, Princeton,
NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "independent; operating system; operating systems
(computers); processes; supervisory computer",
oldlabel = "Gaines72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gaines72",
}
@Article{Schroeder:1972:HAI,
author = "Michael D. Schroeder and Jerome H. Saltzer",
title = "A Hardware Architecture for Implementing Protection
Rings",
journal = j-CACM,
volume = "15",
number = "3",
pages = "157--170",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:54 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#SchroederS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "access control; access privileges; architecture;
computer architecture; digital storage; Multics;
protection rings; system",
oldlabel = "SchroederS72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SchroederS72",
}
@Article{Habermann:1972:SCP,
author = "A. Nico Habermann",
title = "Synchronization of Communicating Processes",
journal = j-CACM,
volume = "15",
number = "3",
pages = "171--176",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:46 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Habermann72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Carnegie-Mellon Univ., Pittsburg, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "buffer store; communication; concurrency; operating
systems (computers); parallel processes; parallel
processing; synchronisation; synchronization",
oldlabel = "Habermann72",
sponsororg = "Assoc. Computing machinery",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Habermann72",
}
@Article{Teorey:1972:CAD,
author = "Toby J. Teorey and Tad B. Pinkerton",
title = "A Comparative Analysis of Disk Scheduling Policies",
journal = j-CACM,
volume = "15",
number = "3",
pages = "177--184",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:01 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/is.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#TeoreyP72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/TeoreyP72.html",
acknowledgement = ack-nhfb,
annote = "Analysis, design of hardware. Minimizing seeks and
latencies.",
cdrom = "CACMs1/CACM15/P177.pdf",
classcodes = "C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "criteria; disk scheduling policies; magnetic storage
systems; multiprogramming; performance; seek time;
waiting time",
oldlabel = "TeoreyP72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TeoreyP72",
}
@Article{Coffman:1972:SSP,
author = "Edward G. {Coffman, Jr.} and T. A. {Ryan, Jr.}",
title = "A study of storage partitioning using a mathematical
model of locality",
journal = j-CACM,
volume = "15",
number = "3",
pages = "185--190",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:02 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/cache.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#CoffmanR72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1220 (Simulation, modelling and identification);
C6150J (Operating systems)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Pennsylvania State Univ., University Park, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dynamic; fixed; mathematical model of locality;
modelling; multiprogramming; storage allocation;
storage partitioning",
oldlabel = "CoffmanR72",
sponsororg = "Assoc. Computing machinery",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CoffmanR72",
xxauthor = "Edward G. {Coffman, Jr.} and T. A. Ryan",
xxauthor = "E. G. {Coffman, Jr.} and T. A. {Ryan, Jr.}",
}
@Article{Denning:1972:PWS,
author = "Peter J. Denning and Stuart C. Schwartz",
title = "Properties of the Working Set Model",
journal = j-CACM,
volume = "15",
number = "3",
pages = "191--198",
month = mar,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "47 6119",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 06:35:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#DenningS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Denning:1973:CWM}.",
abstract = "A program's working set $W(t,T)$ at time $t$ is the
set of distinct pages among the T most recently
referenced pages. Relations between the average
working-set size, the missing-page rate, and the
interreference-interval distribution may be derived
both from time-average definitions and from
ensemble-average (statistical) definitions. An
efficient algorithm for estimating these quantities is
given. The relation to LRU (least recently used) paging
is characterized. The independent-reference model, in
which page references are statistically independent, is
used to assess the effects to interpage dependencies on
working-set size observations. Under general
assumptions, working-set size is shown to be normally
distributed.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
conflocation = "Palo Alto, CA, USA; 18-20 Oct. 1971",
conftitle = "Papers from the 3rd ACM symposium on operating systems
principles",
corpsource = "Princeton Univ., NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "model; modelling; paging; paging algorithms; program
behavior; program modeling; programming theory;
supervisory programs; working set; working-set model",
oldlabel = "DenningS72",
sponsororg = "Assoc. Computing machinery",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DenningS72",
}
@Article{Conway:1972:ISM,
author = "Richard W. Conway and William L. Maxwell and Howard L.
Morgan",
title = "On the Implementation of Security Measures in
Information Systems",
journal = j-CACM,
volume = "15",
number = "4",
pages = "211--220",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:33 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#ConwayMM72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "access control confidentiality; access management;
data banks; information systems; management; model;
modelling; operating systems; privacy; security;
security of data",
oldlabel = "ConwayMM72",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ConwayMM72",
}
@Article{Walden:1972:SIC,
author = "David C. Walden",
title = "A system for interprocess communication in a resource
sharing computer network",
journal = j-CACM,
volume = "15",
number = "4",
pages = "221--230",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:48 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1972.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/network.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Walden72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Reproduced in ``Advances in Computer Communications'',
W. W. Chu, (Ed.), (1974), 340--349.",
abstract = "A system of communication between processes in a
time-sharing system is described and the communication
system is extended so that it may be used between
processes distributed throughout a computer network.
\par
The hypothetical application of the system to an
existing network is discussed.",
acknowledgement = ack-nhfb,
annote = "A system of communication between processes in a
time-sharing system is described and the communication
is extended so that it may be used between processes
distributed throughout a computer network. The
hypothetical application of the system to an existing
network is discussed.",
classcodes = "C5490 (Other aspects of analogue and digital
computers); C5620 (Computer networks and techniques)",
corpsource = "Bolt Beranek and Newman Inc., Cambridge, MA, USA",
country = "USA",
descriptors = "Resource management; computer network; time sharing;
interprocess communication",
enum = "3213",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer networks; digital communication systems;
hypothetical application; interprocess communication;
resource sharing; time sharing; time-sharing;
time-sharing systems",
language = "English",
oldlabel = "Walden72",
references = "10",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Walden72",
}
@Article{Herbst:1972:ELP,
author = "N. M. Herbst and P. M. Will",
title = "An experimental laboratory for pattern recognition and
signal processing",
journal = j-CACM,
volume = "15",
number = "4",
pages = "231--244",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#HerbstW72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5490 (Other aspects of analogue and digital
computers)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "analogue input and output facilities; computer;
design; display systems; image; interactive terminal;
pattern recognition; process control digital;
processing; programming support; pseudorandom displays;
scanner control; scanners; signal processing; system;
TV camera",
oldlabel = "HerbstW72",
treatment = "A Application; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HerbstW72",
}
@Article{Matsushita:1972:HLE,
author = "Yutaka Matsushita",
title = "Hidden Lines Elimination for a Rotating Object",
journal = j-CACM,
volume = "15",
number = "4",
pages = "245--252",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "47 7945",
MRreviewer = "Rani Siromoney",
bibdate = "Mon Jan 22 07:02:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Matsushita72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is presented of determining which parts of
three-dimensional objects are visible and which are
invisible when the objects are rotated about some axis.
This paper describes a polygon comparison scheme in
which the relationships of two polygons can be
classified into tree types, and also discusses how the
relationship is changed for each pair of polygons under
rotation about some axis. A rotation table is defined
for each pair of polygons, which remains fixed as long
as rotation is about one axis and provides a means of
rapidly determining the visible and hidden line
relationship between two polygons. \par
Additional work must be done to extend this approach to
simultaneous rotation about several axes.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer drawn picture; computer graphics; data
handling; display programming; displays; graphics;
hidden line; hidden line problem; polygon comparison
scheme; problem; rotating object",
oldlabel = "Matsushita72",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Matsushita72",
}
@Article{Chase:1972:IGA,
author = "Stephen M. Chase",
title = "An implemented graph algorithm for winning {Shannon
Switching Games}",
journal = j-CACM,
volume = "15",
number = "4",
pages = "253--256",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Chase72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; computer; game playing; graph
algorithm; programme; Shannon Switching Games; winning
strategy",
oldlabel = "Chase72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chase72",
}
@Article{Horowitz:1972:CSP,
author = "Ellis Horowitz and Howard L. Morgan and Alan C. Shaw",
title = "Computers and Society: {A} Proposed Course for
Computer Scientists",
journal = j-CACM,
volume = "15",
number = "4",
pages = "257--261",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#HorowitzMS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The purpose of this paper is to describe a course
concerned with both the effects of computers on society
and the responsibilities of computer scientists to
society. The impact of computers is divided into five
components: political, economic, cultural, social, and
moral; the main part of the paper defines each
component and presents examples of the relevant issues.
In the remaining portions the possible formats for such
a course are discussed, a topic by topic outline is
given, and a selected set of references is listed. It
is hoped that the proposal will make it easier to
initiate courses on this subject.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer scientists; computers and society; course;
course proposal; cultural; economic; economic and
sociological effects; education; moral; political;
social; social implications",
oldlabel = "HorowitzMS72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HorowitzMS72",
}
@Article{Kuki:1972:CGF,
author = "Hirondo Kuki",
title = "Complex Gamma Function with Error Control [{S14}]",
journal = j-CACM,
volume = "15",
number = "4",
pages = "262--267",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D20",
MRnumber = "47 1249",
MRreviewer = "L. Fox",
bibdate = "Mon Jan 22 06:56:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kuki72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; complex; complex gamma function; complex
loggamma; error control; FORTRAN; function; function
approximation; loggamma function; programme;
subroutines",
oldlabel = "Kuki72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kuki72a",
}
@Article{Moler:1972:MCF,
author = "Cleve B. Moler",
title = "Matrix Computations with {Fortran} and Paging",
journal = j-CACM,
volume = "15",
number = "4",
pages = "268--270",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:06 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Moler72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C6140D (High level
languages)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN; Fortran; linear equations; matrix algebra;
matrix computations; memory hierarchy; nested loops;
nla; paged memory; virtual memory",
oldlabel = "Moler72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moler72",
}
@Article{Kuki:1972:AAC,
author = "Hirondo Kuki",
title = "{ACM Algorithm 421}: Complex Gamma Function with Error
Control [{S14}]",
journal = j-CACM,
volume = "15",
number = "4",
pages = "271--272",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D20",
MRnumber = "47 1249",
MRreviewer = "L. Fox",
bibdate = "Mon Jan 22 06:56:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kuki72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation);
C7310 (Mathematics computing)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; complex; complex gamma function; complex
loggamma; error control; FORTRAN; function; function
approximation; loggamma function; programme;
subroutines",
oldlabel = "Kuki72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kuki72a",
}
@Article{Whitney:1972:AAM,
author = "V. Kevin M. Whitney",
title = "{ACM Algorithm 422}: Minimal Spanning Tree [{H}]",
journal = j-CACM,
volume = "15",
number = "4",
pages = "273--274",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Whitney72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Kernighan:1973:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; FORTRAN; maximal spanning tree; minimal
spanning tree; spanning tree; subroutines; trees
(mathematics); undirected graph",
oldlabel = "Whitney72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Whitney72",
}
@Article{Moler:1972:AAL,
author = "Cleve B. Moler",
title = "{ACM Algorithm 423}: Linear Equation Solver [{F4}]",
journal = j-CACM,
volume = "15",
number = "4",
pages = "274--274",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Moler72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "array processing; Fortran; linear algebra; linear
equation solver; memory; paged memory; subroutines;
virtual",
oldlabel = "Moler72a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moler72a",
}
@Article{Walden:1972:NCN,
author = "David C. Walden",
title = "A Note on {Cheney}'s Nonrecursive List-Compacting
Algorithm",
journal = j-CACM,
volume = "15",
number = "4",
pages = "275--275",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:50 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Walden72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "A/S Norsk Data-Elektronikk, Oslo, Norway",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; garbage collection; list compacting; list
processing; nonrecursive; storage management",
oldlabel = "Walden72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Walden72a",
}
@Article{Hu:1972:CDC,
author = "T. C. Hu",
key = "file searching, double-chained tree, binary search
tree",
title = "A Comment on the Double-Chained Tree",
journal = j-CACM,
volume = "15",
number = "4",
pages = "276--276",
month = apr,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Hu72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary search tree; double chained tree; file
organisation; file searching; trees (mathematics)",
oldlabel = "Hu72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hu72",
}
@Article{Mullin:1972:IIS,
author = "James K. Mullin",
title = "An Improved Indexed-Sequential Access Method Using
Hashed Overflow",
journal = j-CACM,
volume = "15",
number = "5",
pages = "301--307",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:44 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/hash.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Mullin72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Western Ontario, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "cylinder; file management systems; file organisation;
hashed overflow; improved index sequential access
method; long overflow chains; movable head disc
devices; overflow records; record keys; scatter; space
allocation; storage; storage allocation; storage
management; treating",
oldlabel = "Mullin72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mullin72",
xxtitle = "An Improved Index Sequential Access Method Using
Hashed Overflow",
}
@Article{Bensoussan:1972:MVM,
author = "A. Bensoussan and C. T. Clingen and Robert C. Daley",
title = "The {Multics} Virtual Memory: Concepts and Design",
journal = j-CACM,
volume = "15",
number = "5",
pages = "308--318",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:53 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BensoussanCD72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Honeywell Information Systems Inc., Cambridge, MA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "concepts; design; hierarchy; information sharing;
memory; memory management; Multics virtual memory;
online operating systems; Operating segments paging
sharing management CACM; operating systems (computers);
paging; segmentation",
oldlabel = "BensoussanCD72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BensoussanCD72",
}
@Article{Christman:1972:MSA,
author = "Ronald D. Christman",
title = "{MUX}, a Simple Approach to On-Line Computing",
journal = j-CACM,
volume = "15",
number = "5",
pages = "319--329",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Christman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Univ. California, Los Alamos, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "batch system; CDC 6600 computer; cost; design
criteria; economics; implementation; input; modify
files; multi-access systems; multiplexer; MUX; online
computing; online operation; operating; overhead;
systems (computers); user reactions",
oldlabel = "Christman72",
treatment = "E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Christman72",
}
@Article{Parnas:1972:TSM,
author = "David Lorge Parnas",
title = "A technique for software module specification with
examples",
journal = j-CACM,
volume = "15",
number = "5",
pages = "330--336",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:20 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/obscure.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Parnas72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "programming; software design; software module
specification; technique",
oldlabel = "Parnas72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Parnas72",
}
@Article{Gentleman:1972:ICCa,
author = "W. Morven Gentleman",
title = "Implementing {Clenshaw--Curtis} quadrature. {I}.
Methodology and experience",
journal = j-CACM,
volume = "15",
number = "5",
pages = "337--342",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D30",
MRnumber = "48 5343",
MRreviewer = "D. F. Mayers",
bibdate = "Mon Jan 22 06:43:44 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Comp.Alg.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gentleman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Clenshaw--Curtis quadrature is a particularly
important automatic quadrature scheme for a variety of
reasons, especially the high accuracy obtained from
relatively few integrand values. However, it has
received little use because it requires the computation
of a cosine transformation and the arithmetic cost of
this has been prohibitive. This paper is in two parts;
a companion paper, ``II Computing the Cosine
Transformation,'' shows that this objection can be
overcome by computing the cosine transformation by a
modification of the fast Fourier transform algorithm.
\par
This first part discusses the strategy and various
error estimates, and summarizes experience with a
particular implementation of the scheme.",
acknowledgement = ack-nhfb,
classcodes = "C4110 (Error analysis in numerical methods); C4160
(Numerical integration and differentiation); C7310
(Mathematics computing)",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automatic quadrature; Chebyshev series; Clenshaw
Curtis; Clenshaw--Curtis quadrature; error analysis;
error estimates; experience; implementation;
integration; numerical integration; numerical methods;
strategy",
oldlabel = "Gentleman72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gentleman72",
}
@Article{Gentleman:1972:ICCb,
author = "W. Morven Gentleman",
title = "Implementing {Clenshaw--Curtis} quadrature. {II}.
Computing the cosine transformation",
journal = j-CACM,
volume = "15",
number = "5",
pages = "343--346",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D30",
MRnumber = "48 5344",
MRreviewer = "D. F. Mayers",
bibdate = "Mon Jan 22 06:43:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gentleman72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In a companion paper to this, ``I Methodology and
Experiences,'' the automatic Clenshaw--Curtis
quadrature scheme was described and how each quadrature
formula used in the scheme requires a cosine
transformation of the integrand values was shown. The
high cost of these cosine transformations has been a
serious drawback in using Clenshaw--Curtis quadrature.
\par
Two other problems related to the cosine transformation
have also been trouble some. First, the conventional
computation of the cosine transformation by recurrence
relation is numerically unstable, particularly at the
low frequencies which have the largest effect upon the
integral. Second, in case the automatic scheme should
require refinement of the sampling, storage is required
to save the integrand values after the cosine
transformation is computed. This second part of the
paper shows how the cosine transformation can be
computed by a modification of the fast Fourier
transform and all three problems overcome. The
modification is also applicable in other circumstances
requiring cosine or sine transformations, such as
polynomial interpolation through the Chebyshev
points.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Chebyshev series; Clenshaw Curtis quadrature;
Clenshaw--Curtis quadrature; cosine; cosine
transformation; fast Fourier transformation; fast
Fourier transforms; FFT; implementation; integration;
numerical methods; polynomial interpolation;
transformation",
oldlabel = "Gentleman72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gentleman72a",
}
@Article{Greenspan:1972:FFD,
author = "D. Greenspan and D. Schultz",
title = "Fast finite-difference solution of biharmonic
problems",
journal = j-CACM,
volume = "15",
number = "5",
pages = "347--350",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65N05",
MRnumber = "47 2829",
bibdate = "Mon Jan 22 06:46:20 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#GreenspanS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Setting the Reynolds number equal to zero, in a method
for solving the Navier-Strokes equations numerically,
results in a fast numerical method for biharmonic
problems. The equation is treated as a system of two
second order equations and a simple smoothing process
is essential for convergence. An application is made to
a crack-type problem.",
acknowledgement = ack-nhfb,
classcodes = "C4170 (Differential equations)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "biharmonic equation; biharmonic problems; boundary
value problem; boundary-value problems; convergence;
convergence of numerical methods; crack type problem;
difference equations; fast finite difference solution;
Navier Stokes equations; numerical analysis; partial
differential equations; process; smoothing; two second
order equations",
oldlabel = "GreenspanS72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GreenspanS72",
}
@Article{Dunham:1972:MNA,
author = "Charles B. Dunham",
title = "Minimax nonlinear approximation by approximation on
subsets",
journal = j-CACM,
volume = "15",
number = "5",
pages = "351--351",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Dunham72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4130 (Interpolation and function approximation)",
corpsource = "Univ. Western Ontario, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "function approximation; minimax nonlinear
approximation; optimisation; subsets",
oldlabel = "Dunham72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dunham72",
}
@Article{Harter:1972:OWF,
author = "Richard Harter",
title = "The Optimality of {Winograd}'s Formula",
journal = j-CACM,
volume = "15",
number = "5",
pages = "352--352",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "352.65F05",
MRnumber = "47 2801",
bibdate = "Mon Jan 22 06:48:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Harter72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "inner product; linear algebra; numerical analysis;
optimality; vectors; Winograd's formula",
oldlabel = "Harter72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Harter72",
}
@Article{Gentleman:1972:AAC,
author = "W. Morven Gentleman",
title = "{ACM Algorithm 424}: {Clenshaw--Curtis} Quadrature
[{D1}]",
journal = j-CACM,
volume = "15",
number = "5",
pages = "353--355",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:46 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gentleman72b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Good:1973:RAC,Geddes:1979:RCC}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Chebyshev series; Clenshaw Curtis quadrature; cosine
transform; FFT; FORTRAN subroutine; integration;
subroutines",
oldlabel = "Gentleman72b",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gentleman72b",
}
@Article{Hurst:1972:AAG,
author = "Rex L. Hurst and Robert E. Knop",
title = "{ACM Algorithm 425}: Generation of Random Correlated
Normal Variables [{G5}]",
journal = j-CACM,
volume = "15",
number = "5",
pages = "355--357",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#HurstK72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Page:1974:GRC}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Utah State Univ., Logan, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; FORTRAN subroutine; generation;
multivariate normal density; random correlated normal
variables; statistics; subroutines; timing",
oldlabel = "HurstK72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HurstK72",
}
@Article{Bron:1972:AAM,
author = "Coenraad Bron",
title = "{ACM Algorithm 426}: Merge Sort Algorithm [{M1}]",
journal = j-CACM,
volume = "15",
number = "5",
pages = "357--358",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Bron72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Bron:1974:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Technol. Univ., Eindhoven, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL 60 procedure; merge sort algorithm; merging;
recursion; sorting; subroutines",
oldlabel = "Bron72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bron72",
}
@Article{Linz:1972:AAF,
author = "Peter Linz",
title = "{ACM Algorithm 427}: {Fourier} Cosine Integral
[{D1}]",
journal = j-CACM,
volume = "15",
number = "5",
pages = "358--360",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:15 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Linz72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Univ. California, Davis, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN procedure; Fourier cosine integral;
integration; subroutines",
oldlabel = "Linz72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Linz72",
}
@Article{Yohe:1972:AAH,
author = "J. M. Yohe",
title = "{ACM Algorithm 428}: {Hu-Tucker} Minimum Redundancy
Alphabetic Coding Method [{Z}]",
journal = j-CACM,
volume = "15",
number = "5",
pages = "360--362",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Yohe72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Byrne:1973:RAH}.",
acknowledgement = ack-nhfb,
classcodes = "B6120B (Codes); C1260 (Information theory)",
corpsource = "Univ. Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "codes; encoding; FORTRAN subroutine; Hu Tucker minimum
redundancy alphabetic binary coding; method;
subroutines",
oldlabel = "Yohe72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Yohe72",
}
@Article{Ashenhurst:1972:RAC,
author = "Robert L. Ashenhurst",
title = "A report of the {ACM} curriculum committee on computer
education for management. Curriculum recommendations
for graduate professional programs in information
systems",
journal = j-CACM,
volume = "15",
number = "5",
pages = "363--398",
month = may,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:09 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ashenhurst72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "course descriptions; curriculum recommendations;
education; implementation; information systems; systems
analysis",
oldlabel = "Ashenhurst72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ashenhurst72",
xxtitle = "Curriculum Recommendations for Graduate Professional
Programs in Information Systems",
}
@Article{Blatny:1972:OPT,
author = "J. Blatny and S. R. Clark and T. A. Rourke",
title = "On the optimization of performance of time-sharing
systems by simulation",
journal = j-CACM,
volume = "15",
number = "6",
pages = "411--420",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BlatnyCR72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6150J (Operating
systems)",
corpsource = "Univ. Manitoba, Winnipeg, Man., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation theory; finite; infinite auxiliary store;
job scheduling algorithm; noncontiguous store; number
of jobs allowed to execute simultaneously;
optimisation; optimization of performance; optimum
round robin cycle time selection; programs; sharing
systems; simulation; slice techniques; store size;
time; time-sharing; variable time",
oldlabel = "BlatnyCR72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BlatnyCR72",
}
@Article{Spacek:1972:PEP,
author = "Thomas R. Spacek",
title = "A proposal to establish a pseudo virtual memory via
writable overlays",
journal = j-CACM,
volume = "15",
number = "6",
pages = "421--426",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Spacek72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "CIA, Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "collector; display; establishment; executable storage
size problems; folding; graphic; linkage editor;
loader; overlay structure; paging; pseudovirtual
memory; segmentation; storage allocation; writable
overlays",
oldlabel = "Spacek72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Spacek72",
}
@Article{Gilbert:1972:IBC,
author = "Philip Gilbert and W. J. Chandler",
title = "Interference between Communicating Parallel
Processes",
journal = j-CACM,
volume = "15",
number = "6",
pages = "427--437",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:16 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#GilbertC72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6150J (Operating
systems)",
corpsource = "Univ. Southern California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation theory; concurrent programming control;
cooperating processes; formal programs; inclusion;
interference between communicating parallel processes;
mutual exclusion; operating systems; parallel
processing; problem; sequences of states; transition
rule",
oldlabel = "GilbertC72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GilbertC72",
}
@Article{Gimpel:1972:BND,
author = "James F. Gimpel",
title = "Blocks --- {A} New Data type for {SNOBOL4}",
journal = j-CACM,
volume = "15",
number = "6",
pages = "438--447",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gimpel72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
corpsource = "Bell Telephone Labs. Inc., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "blocks; character; composing printable output;
datatype; dimensional aggregate of characters;
manipulation; overstriking; problem oriented languages;
right parallelepiped; SNOBOL 4; string processing; text
editing; text processing; three",
oldlabel = "Gimpel72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gimpel72",
}
@Article{Martin:1972:BMM,
author = "David F. Martin",
title = "A {Boolean} matrix method for the computation of
linear precedence functions",
journal = j-CACM,
volume = "15",
number = "6",
pages = "448--454",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "54 9175",
MRreviewer = "Daniel J. Rosenkrantz",
bibdate = "Mon Jan 22 07:01:57 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Martin72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "analysis; Boolean functions; boolean matrix method;
conflict free matrix; context; context-free grammars;
free parsing; linear precedence functions; matrix
algebra; precedence grammars; syntax",
oldlabel = "Martin72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Martin72",
}
@Article{OReagan:1972:CAC,
author = "Robert T. O'Reagan",
title = "Computer Assigned Codes from Verbal Responses",
journal = j-CACM,
volume = "15",
number = "6",
pages = "455--459",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:18 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#OReagan72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "US Bureau of the Census, Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "codes; computer coding; concept; data handling;
historical response patterns; reference list;
translation; verbal responses; word coding; word
strings",
oldlabel = "OReagan72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OReagan72",
}
@Article{Iguchi:1972:SMS,
author = "Ken Iguchi",
title = "A starting method for solving nonlinear {Volterra}
integral equations of the second kind",
journal = j-CACM,
volume = "15",
number = "6",
pages = "460--461",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Iguchi72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation)",
corpsource = "Nagoya Univ., Japan",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; fourth order method; integral equations;
nonlinear Volterra integral equations; numerical
methods; starting method",
oldlabel = "Iguchi72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Iguchi72",
}
@Article{Pohl:1972:SPC,
author = "Ira Pohl",
title = "A Sorting Problem and Its Complexity",
journal = j-CACM,
volume = "15",
number = "6",
pages = "462--464",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Pohl72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A technique for proving min-max norms of sorting
algorithms is given. One new algorithm for finding the
minimum and maximum elements of a set with fewest
comparisons is proved optimal with this technique.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. California, Santa Cruz, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "complexity; computational; computational
combinatorics; computational combinatories;
computational complexity; minimax norms; minimum and
maximum elements; sorting",
oldlabel = "Pohl72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pohl72",
}
@Article{Kolbig:1972:CAC,
author = "K. S. K{\"o}lbig",
title = "Certification of ``{Algorithm 363}: {Complex} error
function''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "465--466",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kolbig72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gautschi:1969:AAC}.",
acknowledgement = ack-nhfb,
classcodes = "C4120 (Functional analysis); C7310 (Mathematics
computing)",
corpsource = "CERN, Geneva, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "complex error function; function evaluation; special
functions; subroutines; Voigt function",
oldlabel = "Kolbig72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kolbig72",
}
@Article{Niessner:1972:RAE,
author = "Herbert Niessner",
title = "Remark on ``{Algorithm 343}: Eigenvalues and
eigenvectors of a real general matrix''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "466--466",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Niessner72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Grad:1968:AAE}.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C7310 (Mathematics
computing)",
corpsource = "Brown, Boveri and Co., Baden, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "eigenvalues; eigenvalues and eigenfunctions;
eigenvectors; FORTRAN; general; matrices; matrix
algebra; nonsymmetric matrices; QR algorithm;
subroutines",
oldlabel = "Niessner72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Niessner72",
}
@Article{Proll:1972:RAA,
author = "L. G. Proll",
title = "Remark on ``{ACM Algorithm 370}: {General} random
number generator [{G5}]''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "467--468",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:04 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1972.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Proll72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Butler:1970:AAG}.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Univ. Southampton, UK",
country = "USA",
descriptors = "RVG",
enum = "7783",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "cumulative distribution function; probability density
function; random number generation; random number
generator; subroutines; transformation",
language = "English",
oldlabel = "Proll72",
references = "0",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Proll72",
}
@Article{Schrack:1972:RAR,
author = "G{\"u}nther F. Schrack",
title = "Remark on ``{Algorithm 381}: Random vectors uniform in
solid angle''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "468--468",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Schrack72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Knop:1970:AAR}.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Univ. British Columbia, Vancouver, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "points uniform on; random number generation; random
vector generator; solid angle; sphere; spherically
symmetric probability distribution; subroutines",
oldlabel = "Schrack72a",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schrack72a",
}
@Article{Sale:1972:RAS,
author = "Arthur H. J. Sale",
title = "Remark on ``{Algorithm 393}: Special series summation
with arbitrary precision''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "468--469",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sale72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Abdali:1970:AAS}.",
acknowledgement = ack-nhfb,
classcodes = "C4120 (Functional analysis); C7310 (Mathematics
computing)",
corpsource = "Univ. Sydney, NSW, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; function evaluation; harmonic series;
series summation; subroutines",
oldlabel = "Sale72",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sale72",
}
@Article{Einarsson:1972:RAC,
author = "Bo Einarsson",
title = "Remark on ``{Algorithm 418}: Calculation of {Fourier}
integrals''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "469--469",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Einarsson72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Einarsson:1972:AAC,Piessens:1974:RAC}.",
acknowledgement = ack-nhfb,
classcodes = "C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Res. Inst. Nat. Defense, Tumba, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; coefficients; Filon integration; Filon
quadrature; Fourier; Fourier integrals; Fourier series;
integration; numerical methods; quadrature; Richardson
extrapolation; spline; splines (mathematics);
subroutines",
oldlabel = "Einarsson72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Einarsson72a",
}
@Article{Johnson:1972:RAI,
author = "Stephen C. Johnson and Brian W. Kernighan",
title = "Remark on ``{Algorithm 397}: An integer programming
problem''",
journal = j-CACM,
volume = "15",
number = "6",
pages = "469--469",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#JohnsonK72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Chang:1970:AAI}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "acm; cacm; change making problem; integer programming;
subroutines",
oldlabel = "JohnsonK72",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JohnsonK72",
}
@Article{Kandel:1972:CSV,
author = "Abraham Kandel",
title = "Computer Science --- {A} Vicious Circle",
journal = j-CACM,
volume = "15",
number = "6",
pages = "470--471",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kandel72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "New Mexico Inst. Mining and Technol., Socorro, NM,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer engineering; computer personnel; computer
science curriculum; education; personnel; systems
design",
oldlabel = "Kandel72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kandel72",
}
@Article{Koffman:1972:IIG,
author = "Elliot B. Koffman",
title = "Individualizing instruction in a generative {CAI}
tutor",
journal = j-CACM,
volume = "15",
number = "6",
pages = "472--473",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Koffman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C7810C
(Computer-aided instruction)",
corpsource = "Univ. Connecticut, Storrs, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "adaptive instruction; and sequential design;
combinational; computer aided instruction; computer
assisted instructions; education; generative CAI tutor;
machine language programming",
oldlabel = "Koffman72",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Koffman72",
}
@Article{Houstis:1972:AAP,
author = "E. N. Houstis and W. F. Mitchell and J. R. Rice",
title = "{ACM Algorithm 438}: Product Type Two-point
{Gauss--Legendre--Simpson}'s Integration",
journal = j-CACM,
volume = "15",
number = "6",
pages = "1071",
month = jun,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Sep 08 09:34:02 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Revens:1972:FTF,
author = "Lee Revens",
title = "The first twenty-five years: {ACM} 1947--1962",
journal = j-CACM,
volume = "15",
number = "7",
pages = "485--490",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68-03",
MRnumber = "52 16081",
bibdate = "Mon Jan 22 07:15:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Revens72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Revens72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Revens72",
xxtitle = "The First Twenty-Five Years",
xxtitle = "The first twenty-five years {ACM} 1947--1962",
}
@Article{Weiss:1972:PCI,
author = "Eric A. Weiss",
title = "Publications in Computing: An Informal Review",
journal = j-CACM,
volume = "15",
number = "7",
pages = "491--497",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68-03",
MRnumber = "52 16083",
bibdate = "Mon Jan 22 07:29:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Weiss72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computers; publications in computing; review",
oldlabel = "Weiss72",
treatment = "B Bibliography",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Weiss72",
}
@Article{Ralston:1972:NTY,
author = "Anthony Ralston",
title = "The Next Two Years ({ACM President}'s Letter)",
journal = j-CACM,
volume = "15",
number = "7",
pages = "499--500",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ralston72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Ralston72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ralston72",
}
@Article{Ershov:1972:AHF,
author = "Andrei P. Ershov",
title = "Aesthetics and the Human Factor in Programming",
journal = j-CACM,
volume = "15",
number = "7",
pages = "501--505",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ershov72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Ershov:1972:CAH}.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Novosibirsk Univ., USSR",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "aesthetics; human factor; human factors; programming",
oldlabel = "Ershov72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ershov72",
}
@Article{Probst:1972:ISI,
author = "G. G. Probst and Robert S. Oelman and Sam Wyly and C.
Lester Hogan and F. T. Cary and Gordon Bell and Donald
P. Kircher",
title = "As the Industry Sees It",
journal = j-CACM,
volume = "15",
number = "7",
pages = "506--517",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#ProbstOWHCBK72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital computers; future of computers; industry",
oldlabel = "ProbstOWHCBK72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ProbstOWHCBK72",
}
@Article{Arbib:1972:TAT,
author = "Michael A. Arbib",
title = "Toward an Automata Theory of Brains",
journal = j-CACM,
volume = "15",
number = "7",
pages = "521--527",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A25 (92A05)",
MRnumber = "53 7131",
MRreviewer = "Jill Humphries",
bibdate = "Mon Jan 22 06:21:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Arbib72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C4220 (Automata theory)",
corpsource = "Univ. Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automata theory; brain models; brains",
oldlabel = "Arbib72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Arbib72",
}
@Article{Manna:1972:FPA,
author = "Zohar Manna and Jean Vuillemin",
title = "Fix Point Approach to the Theory of Computation",
journal = j-CACM,
volume = "15",
number = "7",
pages = "528--536",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "55 13859",
MRreviewer = "Andrea Maggiolo-Schettini",
bibdate = "Mon Jan 22 07:01:29 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#MannaV72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
abstract = "Following the fix point theory of Scott, the semantics
of computer programs are defined in terms of the least
fix points of recursive programs. This allows not only
the justification of all existing verification
techniques, but also their extension to the handling,
in a uniform manner of various properties of computer
programs, including correctness, termination, and
equivalence.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computation; computational induction; computational
linguistics; correctness; equivalence; fixpoints;
least; least fix points; program diagnostics;
programming; recursive programs; semantics of computer
programs; semantics of programming languages;
termination; theory; verification techniques",
oldlabel = "MannaV72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MannaV72",
xxtitle = "Fixpoint Approach to the Theory of Computation",
}
@Article{Traub:1972:NMC,
author = "J. F. Traub",
title = "Numerical Mathematics and Computer Science",
journal = j-CACM,
volume = "15",
number = "7",
pages = "537--541",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65-03",
MRnumber = "54 4031",
MRreviewer = "R. H. Bartels",
bibdate = "Mon Jan 22 07:26:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Traub72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C4100 (Numerical analysis)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; computer science; foundations; numerical
mathematics; numerical methods; reviews; synthesis and
analysis",
oldlabel = "Traub72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Traub72",
}
@Article{Shanno:1972:MSV,
author = "David F. Shanno and Roman L. Weil",
title = "Management science: a view from nonlinear
programming",
journal = j-CACM,
volume = "15",
number = "7",
pages = "542--549",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90C10 (90C30)",
MRnumber = "55 9970",
bibdate = "Mon Jan 22 07:20:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#ShannoW72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
corpsource = "Univ. Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "integer; management science; mathematical programming;
nonlinear programming; reviews",
oldlabel = "ShannoW72",
treatment = "B Bibliography; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShannoW72",
}
@Article{Moses:1972:TGT,
author = "Joel Moses",
title = "Toward a General Theory of Special Functions",
journal = j-CACM,
volume = "15",
number = "7",
pages = "550--554",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "34-02 12H05",
MRnumber = "53 3384",
MRreviewer = "K. Okugawa",
bibdate = "Mon Jan 22 07:06:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Moses72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C1100 (Mathematical techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "general theory; mathematics; special functions",
oldlabel = "Moses72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Moses72",
}
@Article{Foster:1972:VCA,
author = "Caxton C. Foster",
title = "A View of Computer Architecture",
journal = j-CACM,
volume = "15",
number = "7",
pages = "557--565",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Foster72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture)",
corpsource = "Univ. Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer architecture; microcomputers; predict;
reviews",
oldlabel = "Foster72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Foster72",
}
@Article{Fraser:1972:IBC,
author = "A. G. Fraser",
title = "On the interface between computers and data
communications systems",
journal = j-CACM,
volume = "15",
number = "7",
pages = "566--573",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:35 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/network.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Fraser72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Reproduced in Advances in Computer Commun., Chu,W.W
(Ed.), (1974), 246-253.",
acknowledgement = ack-nhfb,
classcodes = "C5610 (Computer interfaces)",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer interfaces; computers; data communication
systems; data communications; interface; specifying",
oldlabel = "Fraser72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fraser72",
}
@Article{BrinchHansen:1972:SM,
author = "Per {Brinch Hansen}",
title = "Structured Multiprogramming",
journal = j-CACM,
volume = "15",
number = "7",
pages = "574--578",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:15 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Os/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Hansen72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "This paper presents a proposal for structured
representation of multiprogramming in a high level
language. Shared variables are introduced, and their
role in `critical regions (denoted by the structured
statement region var do Statement)' is discussed. A
synchronization primitive `await Boolean' delays a
process until the components of a shared variable
satisfy the boolean expression. For explicit control of
the scheduling of resources, an event queue is
associated with a shared variable, and two procedures
await (event) (leave a critical region associated with
the shared variable and join the event queue) and cause
(event) (enable all processes in the event queue to
reenter their critical regions) are provided, which can
control process scheduling to any degree desired.",
classcodes = "C6150J (Operating systems)",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "concurrency; critical regions; event variables; high
level; language; multiprogramming; operating systems;
structured multiprogramming",
oldlabel = "Hansen72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hansen72",
}
@Article{Lynch:1972:OSP,
author = "William C. Lynch",
title = "Operating System Performance",
journal = j-CACM,
volume = "15",
number = "7",
pages = "579--585",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Lynch72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Case Western Res. Univ., Cleveland, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer; model; operating system performance;
operating systems (computers); reviews; systems; total
system",
oldlabel = "Lynch72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lynch72",
}
@Article{Kimbleton:1972:RCS,
author = "Stephen R. Kimbleton",
title = "The role of computer system models in performance
evaluation",
journal = j-CACM,
volume = "15",
number = "7",
pages = "586--590",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:48 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kimbleton72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C1220 (Simulation, modelling
and identification); C6150J (Operating systems)",
corpsource = "UNIV. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer selection and evaluation; computer system
models; evaluation; modelling; operating; operating
systems; performance; systems (computers)",
oldlabel = "Kimbleton72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kimbleton72",
}
@Article{Rosen:1972:PSL,
author = "Saul Rosen",
title = "Programming Systems and Languages (1965--1975)",
journal = j-CACM,
volume = "15",
number = "7",
pages = "591--600",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:00 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Rosen72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In spite of impressive gains by PL/I, Fortran and
Cobol remain the languages in which most of the world's
production programs are written and will remain so into
the foreseeable future. There is a great deal of
theoretical interest in Algol 68 and in extensible
languages, but so far at least they have had little
practical impact. Problem-oriented languages may very
well become the most important language development
area in the next five to ten years.\par
In the operating system area all major computer
manufacturers set out to produce very ambitious
multiprogramming systems, and they all ran into similar
problems. A number of university projects,though not
directly comparable to those of the manufacturers, have
contributed greatly to a better understanding of
operating system principles. Important trends include
the increased interest in the development of system
measurement and evaluation techniques,and increased use
of microprogramming for some programming system
functions.",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages); C6150J (Operating
systems)",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "history; languages; microprogramming;
multiprogramming; operating system; operating systems;
operating systems (computers); problem oriented
languages; programming; programming systems; reviews",
oldlabel = "Rosen72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rosen72",
}
@Article{Sammet:1972:PLH,
author = "Jean E. Sammet",
title = "Programming Languages: History and Future",
journal = j-CACM,
volume = "15",
number = "7",
pages = "601--610",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:22 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sammet72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses both the history and future of
programming languages (= higher level languages).
\par
Some of the difficulties in writing such a history are
indicated. A key part of the paper is a tree showing
the chronological development of languages and their
interrelationships. Reasons for the proliferation of
languages are given. The major languages are listed
with the reasons for their importance. A section on
chronology indicates the happenings of the significant
previous time periods and the major topics of 1972. Key
concepts other than specific languages are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages)",
corpsource = "IBM Corp., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "chronological; development; future; future directions;
higher level languages; history; language
interrelationships; languages; programming language
future; programming language history; programming
language tree; programming languages; reviews",
oldlabel = "Sammet72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sammet72",
}
@Article{Fosdick:1972:PBM,
author = "Lloyd D. Fosdick",
title = "The Production of Better Mathematical Software",
journal = j-CACM,
volume = "15",
number = "7",
pages = "611--617",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Fosdick72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Univ. Colorado, Boulder, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer software; mathematical software; mathematics;
production; programming",
oldlabel = "Fosdick72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fosdick72",
}
@Article{Bobrow:1972:RAP,
author = "Daniel G. Bobrow",
title = "Requirements for Advanced Programming Systems for List
Processing",
journal = j-CACM,
volume = "15",
number = "7",
pages = "618--627",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:02 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Ai/lisp.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Bobrow72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Xerox, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "advanced programming systems; list processing;
requirements",
oldlabel = "Bobrow72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bobrow72",
}
@Article{Bachman:1972:ESS,
author = "Charles W. Bachman",
title = "The Evolution of Storage Structures",
journal = j-CACM,
volume = "15",
number = "7",
pages = "628--634",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:30 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Bachman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "Good overview of basic definitions and their
relationships",
classcodes = "C6120 (File organisation)",
corpsource = "Honeywell Information Systems, Billerica, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data base management systems; Data Structure Diagram
graphic technique; data structures; evolution; storage
management; storage structures",
oldlabel = "Bachman72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bachman72",
}
@Article{Rice:1972:PFS,
author = "John R. Rice",
title = "On the Present and Future of Scientific Computation",
journal = j-CACM,
volume = "15",
number = "7",
pages = "637--639",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Rice72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7320 (Physics and chemistry computing); C7490
(Computing in other engineering fields)",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "engineering applications of computers; future; natural
sciences; physical sciences; physics; present;
scientific computation",
oldlabel = "Rice72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rice72",
}
@Article{Benjamin:1972:GPI,
author = "Robert I. Benjamin",
title = "A generational perspective of information system
development",
journal = j-CACM,
volume = "15",
number = "7",
pages = "640--643",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:50 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Benjamin72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7100 (Business and administration)",
corpsource = "Xerox Corp., Rochester, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computing milieu; generational perspective;
information system development; management data
processing; management information systems",
oldlabel = "Benjamin72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Benjamin72",
}
@Article{Sedelow:1972:LAH,
author = "Sally Yeates Sedelow",
title = "Language Analysis in the Humanities",
journal = j-CACM,
volume = "15",
number = "7",
pages = "644--647",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sedelow72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Univ. Kansas, Lawrence, KS, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "concordances; humanities; indices; language analysis;
language translation and linguistics; pattern
generation; pattern recognition",
oldlabel = "Sedelow72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sedelow72",
}
@Article{Zinn:1972:CIP,
author = "Karl L. Zinn",
title = "Computers in the instructional process: directions for
research and development",
journal = j-CACM,
volume = "15",
number = "7",
pages = "648--651",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Zinn72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7810C (Computer-aided instruction)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer aided instruction; computers; development;
directions; education; instructional process; research
and",
oldlabel = "Zinn72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Zinn72",
}
@Article{Sturman:1972:CUS,
author = "Gerald M. Sturman",
title = "Computers and Urban Society",
journal = j-CACM,
volume = "15",
number = "7",
pages = "652--657",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sturman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7000 (Computer applications); C7130 (Public
administration)",
corpsource = "Parsons Brinckerhoff Quade and Douglas Inc., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "administrative data processing; brief survey;
computers; engineering analysis; engineering
applications of computers; government; information
systems; sciences; social and behavioural; urban
society; urban systems",
oldlabel = "Sturman72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sturman72",
}
@Article{Salton:1972:DDP,
author = "Gerard Salton",
title = "Dynamic Document Processing",
journal = j-CACM,
volume = "15",
number = "7",
pages = "658--668",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Salton72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automatic; automatic indexing; automatic search and;
clustered files; collection growth; dynamic document;
indexing; information; information retrieval;
interactive user controlled search process; iterative
searching; library automation; library mechanisation;
processing; query modification; retrieval",
oldlabel = "Salton72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Salton72",
}
@Article{Knuth:1972:ABA,
author = "Donald E. Knuth",
title = "Ancient {Babylonian} algorithms",
journal = j-CACM,
volume = "15",
number = "7",
pages = "671--677",
month = jul,
year = "1972",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/361454.361514",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "01A15",
MRnumber = "52 #13132",
bibdate = "Sat Mar 23 15:01:20 2002",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Knuth72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery. See errata
\cite{Knuth:1976:EAB}.",
acknowledgement = ack-nhfb,
classcodes = "C1100 (Mathematical techniques)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ancient Babylonian algorithms; Babylonian; computer
science; history of computation; mathematics; origins
of mathematics; sexagesimal number system; tablets",
oldlabel = "Knuth72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knuth72",
}
@Article{Bauer:1972:PKZ,
author = "Friedrich L. Bauer and H. W{\"o}ssner",
title = "The {``Plankalk{\"u}l''} of {Konrad Zuse}: a
forerunner of today's programming languages",
journal = j-CACM,
volume = "15",
number = "7",
pages = "678--685",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (68-03)",
MRnumber = "52 16093",
bibdate = "Mon Jan 22 06:23:57 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BauerW72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages)",
corpsource = "Tech. Univ. M{\"u}nchen, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "history of; Konrad Zuse; languages; notational and
conceptual system; Plankalkul; programming; programming
languages; programming theory",
oldlabel = "BauerW72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BauerW72",
xxpages = "679--685",
}
@Article{Sprague:1972:WVC,
author = "Richard E. Sprague",
title = "A {Western} View of Computer History",
journal = j-CACM,
volume = "15",
number = "7",
pages = "686--692",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68-03",
MRnumber = "52 16082",
bibdate = "Mon Jan 22 07:23:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sprague72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Litton ARS, Morristown, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "1945 to 1955; computer history; digital computers",
oldlabel = "Sprague72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sprague72",
}
@Article{Alt:1972:ACR,
author = "Franz L. Alt",
title = "Archaeology of computers --- reminiscences,
1945--1947",
journal = j-CACM,
volume = "15",
number = "7",
pages = "693--694",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68-03",
MRnumber = "52 16079",
bibdate = "Mon Jan 22 06:21:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Alt72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Twenty-fifth anniversary of the Association for
Computing Machinery",
acknowledgement = ack-nhfb,
classcodes = "C5420 (Mainframes and minicomputers)",
corpsource = "American Inst. Phys., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "1945 to 1947; digital computers; ENIAC; history of
computers; reminiscences; special purpose computers",
oldlabel = "Alt72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Alt72",
}
@Article{Borodin:1972:CE,
author = "Allan Borodin and C. C. Gotlieb",
title = "Computers and Employment",
journal = j-CACM,
volume = "15",
number = "7",
pages = "695--702",
month = jul,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BorodinG72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Univ. Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computers; economic and sociological effects;
employment; social implications; unemployment",
oldlabel = "BorodinG72",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BorodinG72",
}
@Article{Herriot:1972:MGF,
author = "John G. Herriot",
title = "In Memory of {George E. Forsythe}",
journal = j-CACM,
volume = "15",
number = "8",
pages = "719--720",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "01A70",
MRnumber = "52 7801",
bibdate = "Mon Jan 22 06:49:40 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Herrit72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles in honor of {George E.
Forsythe} ({ACM} Student Competition Award Papers).",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Herrit72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Herrit72",
xxauthor = "John G. Herrit",
}
@Article{Knuth:1972:GFD,
author = "Donald E. Knuth",
title = "{George Forsythe} and the development of {Computer
Science}",
journal = j-CACM,
volume = "15",
number = "8",
pages = "721--726",
month = aug,
year = "1972",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/361532.361538",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "01A70 (68-03)",
MRnumber = "MR0386953 (52 \#7802)",
bibdate = "Sat Mar 23 15:01:59 2002",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Knuth72a;
https://www.math.utah.edu/pub/bibnet/authors/f/forsythe-george-elmer.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
MathSciNet database",
note = "Collection of articles in honor of George E. Forsythe
(ACM Student Competition Award Papers).",
acknowledgement = ack-nhfb,
fjournal = "Communications of the Association for Computing
Machinery",
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Knuth72a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knuth72a",
}
@Article{Crowe:1972:GPA,
author = "David Crowe",
title = "Generating Parsers for Affix Grammars",
journal = j-CACM,
volume = "15",
number = "8",
pages = "728--734",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "53 4635",
MRreviewer = "Ole Lehrmann Madsen",
bibdate = "Mon Jan 22 06:34:07 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Crowe72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles in honor of {George E. Forsythe
(ACM Student Competition Award Papers)}.",
abstract = "Koster, the inventor of affix grammars, suggests a
top-down scheme for parsing them, based on recursive
procedures. This paper presents a bottom-up scheme for
parsing them, based on an extension of Floyd Production
Language (FPL). Included is an algorithm, similar to
that of DeRemer's, for covering a large class of affix
grammars into FPL. The paper discusses the
applicabilities of the conversion algorithm and affix
grammars in general, and some possible extensions to
Koster's definition of affix grammars.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "721; 723",
corpsource = "Univ. British Columbia, Vancouver, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "affix grammars; algorithmic language processing;
algorithmic languages; automata theory --- Grammars;
bottom up; computer metatheory; grammars; parsers;
syntax directed compiling; translator writing systems;
two level grammars",
oldlabel = "Crowe72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Crowe72",
}
@Article{Helbig:1972:PRC,
author = "Robert E. Helbig and Patrick K. Orr and Robert R.
Roediger",
title = "Political Redistricting by Computer",
journal = j-CACM,
volume = "15",
number = "8",
pages = "735--741",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#HelbigOR72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Criteria for acceptable redistricting are discussed,
including population equality, compactness, contiguity,
and preservation of natural and\slash or political
boundaries. Only nonpartisan criteria are considered.
Using 1970 Bureau of Census population data, specific
results are given for the ten Congressional Districts
in the state of Missouri and for the seven St. Louis
county Council seats. Results from the use of the
algorithm indicate the feasibility of political
redistricting with the aid of a computer.",
acknowledgement = ack-nhfb,
classcodes = "C7810 (Social and behavioural sciences computing)",
classification = "723",
corpsource = "Washington Univ., St. Louis, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; compactness; computer; contiguity; data
processing, business; equal population; legislative
districts; political redistricting; reapportionment;
social and behavioural sciences; transportation",
oldlabel = "HelbigOR72",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HelbigOR72",
}
@Article{Benjamin:1972:EES,
author = "Arthur J. Benjamin",
title = "Extensible Editor for a Small Machine with Disk
Storage",
journal = j-CACM,
volume = "15",
number = "8",
pages = "742--747",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Benjamin72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A design philosophy for developing a sophisticated
utility program is illustrated by the actual design and
implementation of a text editor. A versatile data
structure is employed so that only a small number of
programmed subroutines are necessary for all types of
data manipulation. Such a data structure is described,
and its merits are illustrated by the ease with which
powerful extensions can be implemented in terms of a
few basic editing functions.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques); C6150E (General utility programs)",
classification = "723",
corpsource = "Brandeis Univ., Waltham, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "collection; command; computer programming --- Macros;
computer systems programming --- Supervisory and
Executive Programs; context searching; data processing;
data storage, magnetic --- Disk Storage; data
structures; design; disc storage; executive program;
extensible editor; garbage; interpreter; list
processing; macro language; paging; parameter
substitution; philosophy; processing; programs;
recursion; small machine; state table; storage
allocation; string manipulation; text editing; text
editor; utility; utility program; virtual memory",
oldlabel = "Benjamin72a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Benjamin72a",
}
@Article{Rosin:1972:ERM,
author = "Robert F. Rosin and Gideon Frieder and Richard H.
{Eckhouse, Jr.}",
title = "Environment for Research in Microprogramming and
Emulation",
journal = j-CACM,
volume = "15",
number = "8",
pages = "748--760",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:15 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#RosinFE72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The development of the research project in
microprogramming and emulation at State University of
New York at Buffalo consisted of three phases: the
evaluation of various possible machines to support this
research; the decision to purchase one such machine,
which appears to be superior to the others considered;
and the organization and definition of goals for each
group in the project. Each of these phases is reported,
with emphasis placed on the early results achieved in
this research.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C7430 (Computer
engineering)",
classification = "722; 723",
corpsource = "State Univ. New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer architecture; computer systems; computer
systems, digital; emulation; engineering applications
of computers; environment for research; hardware
evaluation; language processors; management;
microprogramming; nanoprogram; project; simulation",
oldlabel = "RosinFE72",
treatment = "X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RosinFE72",
}
@Article{Oden:1972:MMC,
author = "P. H. Oden and Gerald S. Shedler",
title = "A Model of Memory Contention in a Paging Machine",
journal = j-CACM,
volume = "15",
number = "8",
pages = "761--771",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 13903",
bibdate = "Mon Jan 22 07:10:28 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#OdenS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles in honor of {George E.
Forsythe} ({ACM} Student Competition Award Papers).",
abstract = "In the model presented, the number of page-frames of
main memory allocated to a problem program varies in
time. These changes in memory configuration are
represented explicitly in the model, CPU requirements
and page exception characteristics of program material
being described statistically. Expressions for the
distribution of the number of page-frames allocated to
an executing program, the long run expected fraction of
a program's execution time in a given number of
page-frames, and the average execution interval of the
multiprogrammed load are obtained. It is pointed out
heuristically and demonstrated numerically that an
increase is obtainable in the average execution
interval of the multiprogrammed load over that
resulting from equal fixed partitioning of main
memory.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; demand paging; file
organisation; management; memory; memory contention;
modelling; multiprogrammed; operating; paging machines;
probability --- Queueing Theory; queuing analysis;
storage; storage allocation; systems studies",
oldlabel = "OdenS72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OdenS72",
}
@Article{Bernstein:1972:CFM,
author = "H. J. Bernstein and H. T. Gladwin",
title = "Compiling fixed-point multiplications",
journal = j-CACM,
volume = "15",
number = "8",
pages = "772--772",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods); C6110 (Systems
analysis and programming)",
corpsource = "Brookhaven Nat. Lab., Upton, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compiling multiplications; digital arithmetic; fixed
point arithmetic; programming",
treatment = "P Practical",
}
@Article{vanderPoel:1972:CCS,
author = "W. L. {van der Poel}",
title = "Comment on the composition of semantics in {Algol
68}",
journal = j-CACM,
volume = "15",
number = "8",
pages = "772--772",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Poel72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. Technol. Delft, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; ALGOL 68; composition of semantics; data;
design; programming languages; programming primitives;
recursive composition; structures",
oldlabel = "Poel72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Poel72",
}
@Article{Bernstein:1972:CFP,
author = "Herbert J. Bernstein",
title = "Compiling Fixed-Point Multiplications",
journal = j-CACM,
volume = "15",
number = "8",
pages = "772--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:25:57 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Bernstein72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Bernstein72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bernstein72",
}
@Article{Morris:1972:BVW,
author = "James H. {Morris, Jr.}",
title = "A Bonus from {van Wijngaarden}'s Device",
journal = j-CACM,
volume = "15",
number = "8",
pages = "773--773",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:03 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Morris72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; ALGOL 60 programs; eliminate all labels;
nonlocal transfers; procedure returns",
oldlabel = "Morris72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris72",
}
@Article{Jones:1972:CAB,
author = "Peter R. Jones",
title = "Comment on Average Binary Search Length",
journal = j-CACM,
volume = "15",
number = "8",
pages = "774--774",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:03 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Jones72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary searching; data handling; record retrieval;
search length",
oldlabel = "Jones72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Jones72",
}
@Article{Read:1972:NGR,
author = "Ronald C. Read and K. Harada",
title = "A Note on the Generation of Rosary Permutations. With
a Response by {K. Harada}",
journal = j-CACM,
volume = "15",
number = "8",
pages = "775--775",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "53 9706",
MRreviewer = "Dennis White",
bibdate = "Mon Jan 22 07:15:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Read72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles in honor of {George E.
Forsythe} ({ACM} Student Competition Award Papers).",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics)",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "associating an integer; combinatorial mathematics;
generation; rosary permutations",
oldlabel = "Read72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Read72",
}
@Article{Squire:1972:AAL,
author = "W. Squire",
title = "{ACM Algorithm 429}: Localization of the Roots of a
Polynomial [{C2}]",
journal = j-CACM,
volume = "15",
number = "8",
pages = "776--777",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Squire72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Williams:1973:RAL,Driessen:1973:RAL}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Squire72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Squire72",
}
@Article{Purdom:1972:AAI,
author = "Paul Walton {Purdom, Jr.} and Edward F. Moore",
title = "{ACM Algorithm 430}: Immediate Predominators in a
Directed Graph [{H}]",
journal = j-CACM,
volume = "15",
number = "8",
pages = "777--778",
month = aug,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#PurdomM72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "PurdomM72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PurdomM72",
}
@Article{Levitt:1972:CAS,
author = "Karl N. Levitt and William H. Kautz",
title = "Cellular Arrays for the Solution of Graph Problems",
journal = j-CACM,
volume = "15",
number = "9",
pages = "789--801",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#LevittK72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Several parallelized algorithms are presented for the
solution of certain spanning tree, distance, and path
problems, with direct applications to wire routing,
PERT chart analysis, and the analysis of many types of
networks. These algorithms exhibit a computation time
that in many cases grows at a rate not exceeding log//2
n, where n is the number of nodes in the graph.
Straightforward cellular implementations of the
well-known serial algorithms for these problems require
about n steps, and noncellular implementations require
from n**2 to n**3 steps.",
acknowledgement = ack-nhfb,
classcodes = "C5420 (Mainframes and minicomputers); C7310
(Mathematics computing)",
classification = "722; 723",
corpsource = "Stanford Res. Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cellular arrays; data storage, digital; graph
problems; graph theory; mathematical techniques ---
Graph Theory; special purpose computers",
oldlabel = "LevittK72",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LevittK72",
}
@Article{Ghosh:1972:FOC,
author = "Sakti P. Ghosh",
title = "File Organization --- The Consecutive Retrieval
Property",
journal = j-CACM,
volume = "15",
number = "9",
pages = "802--808",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:55 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ghosh72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Some important theorems on the consecutive retrieval
property are proved. Conditions under which the
consecutive retrieval property exists and remain
invariant have been established. An outline for
designing an information retrieval system based on the
consecutive retrieval property is discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "721; 723",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "consecutive; consecutive retrieval; data processing;
file organisation; file organization; information
retrieval; information retrieval system; information
retrieval systems; minimum access; query structure;
record; storage; storage on tapes; storage space;
structure; time",
oldlabel = "Ghosh72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ghosh72",
}
@Article{Mor:1972:NAA,
author = "Moshe Mor and T. Lamdan",
title = "A New Approach to Automatic Scanning of Contour Maps",
journal = j-CACM,
volume = "15",
number = "9",
pages = "809--812",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:52 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#MorL72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The structure of a general contour map is analyzed,
and its topological properties are utilized in
developing a new scanning algorithm. The problem of
detection and recognition of contour lines is solved by
a two color labeling method. It is shown that for maps
containing normal contour lines only, it suffices to
distinguish between so-called ``even'' and ``odd''
lines. The ``tangency problem'' involved in practical
scanning is discussed, and a solution base on
minimizing computer memory space and simplifying
control program is suggested.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C7890 (Other special
applications of computing)",
classification = "723",
corpsource = "Israeli Min. Defense, Tel-Aviv, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic scanning; cartography; computer graphics;
contour maps; data handling; digitizing; image
processing; topology",
oldlabel = "MorL72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MorL72",
}
@Article{Richman:1972:AEA,
author = "Paul L. Richman",
title = "Automatic Error Analysis for Determining Precision",
journal = j-CACM,
volume = "15",
number = "9",
pages = "813--817",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65G05",
MRnumber = "47 2808",
bibdate = "Mon Jan 22 07:15:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Richman72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem considered is that of evaluating a
rational expression to within any desired tolerance on
a computer which performs variable-precision
floating-point arithmetic operations. An automatic
error analysis technique is given for determining,
directly from the results of a trial low-precision
interval arithmetic calculation, just how much
precision and data accuracy are required to achieve a
desired final accuracy. The technique given generalize
easily to the evaluation of many nonrational
expressions.",
acknowledgement = ack-nhfb,
classcodes = "B0290B (Error analysis in numerical methods); C4110
(Error analysis in numerical methods); C5230 (Digital
arithmetic methods)",
classification = "921",
corpsource = "Bell Telephone Labs. Inc., Denver, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic error analysis; control; digital arithmetic;
error analysis; floating point arithmetic; interval
arithmetic; mathematical techniques; precision;
precision control",
oldlabel = "Richman72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Richman72",
}
@Article{Ravindran:1972:AAC,
author = "Arunachalam Ravindran",
title = "{ACM Algorithm 431}: {A} Computer Routine for
Quadratic and Linear Programming Problems [{H}]",
journal = j-CACM,
volume = "15",
number = "9",
pages = "818--820",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ravindran72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Ravindran:1974:RAC,Proll:1974:RAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Ravindran72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ravindran72",
}
@Article{Bartels:1972:AAS,
author = "Richard H. Bartels and G. W. Stewart",
title = "{ACM Algorithm 432}: Solution of the Matrix Equation
{\boldmath {$AX+XB=C$}} [{F4}]",
journal = j-CACM,
volume = "15",
number = "9",
pages = "820--826",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:37 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.lin.alg.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BartelsS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "linear algebra; linear equations; matrices",
kwds = "nla, Schur form, Sylvester equation, Lyapunov
equation, matrix equation",
oldlabel = "BartelsS72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BartelsS72",
}
@Article{Deutsch:1972:TAR,
author = "Edward S. Deutsch",
title = "Thinning Algorithms on Rectangular, Hexagonal, and
Triangular Arrays",
journal = j-CACM,
volume = "15",
number = "9",
pages = "827--837",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:45 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Deutsch72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Three thinning algorithms are developed: one each for
use with rectangular, hexagonal, and triangular arrays.
The approach to the development of each algorithm is
the same. Pictorial results produced by each of the
algorithms are presented and the relative performances
of the algorithms are compared. It is found that the
algorithm operating with the triangular array is the
most sensitive to image irregularities and noise, yet
it will yield a thinned image with an overall reduced
number of points. It is concluded that the algorithm
operating in conjunction with the hexagonal array has
features which strike a balance between those of the
other two arrays.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
classification = "723",
corpsource = "Univ. Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accurate floating-point summation; comparison; digital
arithmetic; error; error propagation; floating point
summation methods; truncation",
oldlabel = "Deutsch72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Deutsch72",
}
@Article{Gregory:1972:CFP,
author = "James Gregory",
title = "A Comparison of Floating Point Summation Methods",
journal = j-CACM,
volume = "15",
number = "9",
pages = "838--838",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:46:23 MST 2001",
bibsource = "ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Gregory72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nj # " and " # ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Argonne Nat. Lab., IL, USA",
descriptors = "Simulation; statistics; numeric calculation",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "comparison; digital arithmetic; error; error
propagation; floating point summation methods;
truncation",
oldlabel = "Gregory72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gregory72",
}
@Article{Khalil:1972:EBT,
author = "Hatem M. Khalil",
title = "The Eigenproblem of Block Tridiagonal Matrices",
journal = j-CACM,
volume = "15",
number = "9",
pages = "839--839",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "839.65F15",
MRnumber = "47 2802",
bibdate = "Mon Jan 22 06:54:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Khalil72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
corpsource = "Univ. Delaware, Newark, DE, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "block tridiagonal matrices; eigenvalues; eigenvalues
and eigenfunctions; eigenvalues and eigenvectors;
eigenvectors; linear algebra; matrix algebra; partial
differential equations",
oldlabel = "Khalil72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Khalil72",
}
@Article{Parnas:1972:CDP,
author = "David Lorge Parnas and A. Nico Habermann and R. C.
Holt",
title = "Comment on Deadlock Prevention Method",
journal = j-CACM,
volume = "15",
number = "9",
pages = "840--841",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#ParnasH72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "deadlock; deadlock prevention method; deadly embrace;
interlock; knotting; lockout; multiprogramming;
resource allocation; scheduling; time sharing;
time-sharing; time-sharing systems",
oldlabel = "ParnasH72",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ParnasH72",
xxauthor = "David Lorge Parnas and A. Nico Habermann",
xxauthor = "D. L. Parnas and A. N. Habermann and R. C. Holt",
}
@Article{Rubinstein:1972:CBT,
author = "Richard Rubinstein and Julian Feldman",
title = "A controller for a {Braille} terminal",
journal = j-CACM,
volume = "15",
number = "9",
pages = "841--842",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#RubinsteinF72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C5610
(Computer interfaces)",
corpsource = "Univ. California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "blind programming aid; braille; computer interfaces;
computer peripheral equipment; computer terminal;
controller; tactile terminal; terminal",
oldlabel = "RubinsteinF72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RubinsteinF72",
}
@Article{Tan:1972:FIS,
author = "K. C. Tan",
title = "On {Foster}'s Information Storage and Retrieval Using
{AVL} Trees",
journal = j-CACM,
volume = "15",
number = "9",
pages = "843--843",
month = sep,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Tan72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See C. C. Foster, Proc. ACM 20th National Conference,
pp. 192--205 (1965).",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(mathematical); AVL trees; binary trees; file
organisation; information retrieval; information
storage; search trees; trees",
oldlabel = "Tan72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tan72",
}
@Article{Dijkstra:1972:HP,
author = "Edsger W. Dijkstra",
title = "The Humble Programmer",
journal = j-CACM,
volume = "15",
number = "10",
pages = "859--866",
month = oct,
year = "1972",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/355604.361591",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Dijkstra72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "We shall do a much better programming job, provided
that we approach the task with a full appreciation if
its tremendous difficulty, provided that we stick to
modest and elegant programming languages, provided that
we respect the intrinsic limitations of the human mind
and approach the task as Very Humble Programmers.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Dijkstra72",
remark = "This is the 1972 ACM Turing Award Lecture. John
McCarthy's 1971 ACM Turing Award lecture was not
published until 1987.",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dijkstra72",
}
@Article{Morris:1972:DPT,
author = "James B. Morris",
title = "Demand Paging Through Utilization of Working Sets on
the {Maniac II}",
journal = j-CACM,
volume = "15",
number = "10",
pages = "867--872",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Morris72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A hardware implementation on the Maniac II computer of
the working set model for demand paging, as introduced
by Denning, is discussed. characteristics of the Maniac
II are given, along with a description of the basic
demand paging scheme and the associative memory which
has been added to the Maniac II hardware. A description
of the hardware design for implementation of the
working set model is discussed and a specification of
the actions taken under various conditions which may
arise during the operation of the full working set
model, demand paging system is given.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6120 (File
organisation)",
classification = "723",
corpsource = "Univ. California, Los Alamos, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "associative memory; associative storage; computer
architecture; computer operating systems; data storage,
digital; demand paging; dynamic storage allocation;
file; hardware implementation; MANIAC II; model;
organisation; storage allocation; storage management;
utilization of working sets; virtual memory; working
set",
oldlabel = "Morris72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris72a",
}
@Article{Ahrens:1972:CMS,
author = "Joachim H. Ahrens and Ulrich Dieter",
title = "Computer Methods for Sampling from the Exponential and
Normal Distributions",
journal = j-CACM,
volume = "15",
number = "10",
pages = "873--882",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "49 1728",
MRreviewer = "V. Dupac",
bibdate = "Mon Jan 22 06:20:51 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1972.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#AhrensD72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Various methods are known for transforming uniformly
distributed random numbers into exponentially and
normally distributed quantities. The most efficient
ones are compared, in terms of memory requirements and
speed, with some new algorithms. A number of procedures
convert Taylor series expansions directly into sampling
steps, an approach which may be used for sampling from
any continuous distribution. For the exponential
distribution a definite recommendation can be made,
whereas in the case of the normal distribution there
remains a choice between slower and shorter algorithms
and faster but space consuming methods.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
classification = "913; 922",
corpsource = "Nova Scotia Tech. Coll., Halifax, NS, Canada",
country = "USA",
descriptors = "RVG",
enum = "6926",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer aided sampling; computer methods; distributed
random numbers; distributions; exponential; normal
distributions; random number generation; sampled data
systems; sampling; sampling steps; uniformly",
language = "English",
oldlabel = "AhrensD72",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AhrensD72",
}
@Article{Hanson:1972:IEI,
author = "Richard J. Hanson",
title = "Integral Equations of Immunology",
journal = j-CACM,
volume = "15",
number = "10",
pages = "883--890",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65R05",
MRnumber = "48 10166",
MRreviewer = "S. Malon",
bibdate = "Mon Jan 22 06:48:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Hanson72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The inversion of a particular integral equation of the
first (Fredholm) kind is the basic problem considered.
The strategy which yielded success consisted of three
essential points: (1) fit the known experimental data
by a curve with properties which derive from properties
of the (as yet unknown) function; (2) stabilize the
computation for the unknown function by using singular
value decomposition; (3) constrain the unknown function
approximation (since it represents a probability
distribution) to be nonnegative. \par
A number of test cases are presented. One set of actual
experimental data is analyzed with the procedures
presented.",
acknowledgement = ack-nhfb,
classcodes = "B0290R (Integral equations); C4180 (Integral
equations)",
classification = "461; 921",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "biomedical engineering; curve fitting; decomposition;
experimental data; first kind; immunology; integral
equation of; integral equations; integral equations of
the first kind; inversion; mathematical techniques;
medicine; nonnegative constraints; numerical methods;
singular value; singular value analysis",
oldlabel = "Hanson72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hanson72",
}
@Article{Simmons:1972:GED,
author = "Robert F. Simmons and Jonathan Slocum",
title = "Generating {English} Discourse from Semantic
Networks",
journal = j-CACM,
volume = "15",
number = "10",
pages = "891--905",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/lisp.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#SimmonsS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A system is described for generating English sentences
from a form of semantic nets in which the nodes are
word-sense meanings and the paths are primarily deep
case relations. The grammar used by the system is in
the form of a network that imposes an ordering on a set
of syntactic transformations that are expressed as LISP
functions. The generation algorithm uses the
information in the semantic network to select
appropriate generation paths through the grammar. The
system is designed for use as a computational tool that
allows a linguist to develop and study methods for
generating surface strings from an underlying semantic
structure. Initial findings with regard to form
determiners such as voice, form, tense, and mood, some
rules for embedding sentences, and some attention to
pronominal substitution are reported. The system is
programmed in LISP 1.5 and is available from the
authors.",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
classification = "721; 723; 901",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; computer applications; computer
programming languages --- lisp; data processing ---
Humanities Applications; deep case relations; English
sentence generation; information science --- Language
Translation and Linguistics; language translation and
linguistics; LISP functions; semantic generation;
semantic networks",
oldlabel = "SimmonsS72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SimmonsS72",
xxauthor = "Reid G. Simmons and Jonathan Slocum",
}
@Article{Dathe:1972:CDT,
author = "Gert Dathe",
title = "Conversion of Decision Tables by Rule Mask Method
without Rule Mask",
journal = j-CACM,
volume = "15",
number = "10",
pages = "906--909",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Dathe72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two algorithms for generating computer programs from
decision tables are described. The algorithms allow
handling limited entry, extended entry, and mixed entry
tables. The algorithms are based on the rule mask
method but need not have the masks at execution time.
They perform the logical operations immediately rather
than at the end of the interpreting process. Execution
time can be considerably reduced by instantly marking
rules which are not applicable or conditions which are
already tested. The new algorithms combine to a certain
degree the advantages of mask methods with those of
tree methods.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150C
(Compilers, interpreters and other processors)",
classification = "723",
corpsource = "Software AG, Darmstadt, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; conversion; decision tables;
mask; program generation; program processors; rule mask
method without rule",
oldlabel = "Dathe72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dathe72",
}
@Article{Frazer:1972:SNS,
author = "W. D. Frazer and C. K. Wong",
title = "Sorting by Natural Selection",
journal = j-CACM,
volume = "15",
number = "10",
pages = "910--913",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:39 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#FrazerW72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A family of sorting algorithms is proposed, the
members of which make fuller use of the memory space
and thus yield longer sorted strings. Extensive
simulation results are presented, and various
implications and further applications are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "IBM Thomas J.Watson Res. Center, Yorktown Heights, NY,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACM; computer programming --- Subroutines; computer
systems programming; natural selection; sorting",
oldlabel = "FrazerW72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FrazerW72",
}
@Article{Ershov:1972:CAH,
author = "A. P. Ershov",
title = "Corrigendum: {``Aesthetics and the Human Factor in
Programming''}",
journal = j-CACM,
volume = "15",
number = "10",
pages = "913--913",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 14:08:57 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ershov:1972:AHF}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Akima:1972:AAI,
author = "Hiroshi Akima",
title = "{ACM Algorithm 433}: Interpolation and Smooth Curve
Fitting Based on Local Procedures [{E2}]",
journal = j-CACM,
volume = "15",
number = "10",
pages = "914--918",
month = oct,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Akima72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Anderson:1976:RIS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Akima72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Akima72",
}
@Article{Robertson:1972:RAT,
author = "J. Douglas Robertson",
title = "Remark on ``{Algorithm 398}: Tableless Date
Conversion''",
journal = j-CACM,
volume = "15",
number = "10",
pages = "918--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Robertson72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Stone:1970:AAT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Robertson72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Robertson72",
}
@Article{Fox:1972:CSC,
author = "Phyllis Fox",
title = "Comparative Study of Computer Programs for Integrating
Differential Equations",
journal = j-CACM,
volume = "15",
number = "11",
pages = "941--948",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Fox72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The integration methods represented include multistep
methods (predictor-correctors), single-step methods
(Runge--Kutta) and extrapolation methods (both
polynomial and rational). The testing procedure is
described together with the evaluation criteria
applied. A set of test problems on which the programs
were tested is included in appendix. For the particular
problems and criteria used in the investigation it was
found that a program based on rational extrapolation
showed the best performance.",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations)",
classification = "723; 921",
corpsource = "Newark Coll. Engng., NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "comparative study; computer programming; computer
programs; differential; differential equations;
equations; extrapolation methods; integration methods;
mathematical techniques --- Differential Equations;
mathematical techniques --- Integration;
predictor-corrector methods",
oldlabel = "Fox72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fox72",
}
@Article{Malcolm:1972:ARP,
author = "Michael A. Malcolm",
title = "Algorithms to Reveal Properties of Floating-Point
Arithmetic",
journal = j-CACM,
volume = "15",
number = "11",
pages = "949--951",
month = nov,
year = "1972",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/355606.361870",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:07 MST 2001",
bibsource = "Compendex database;
ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Malcolm72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
note = "See also \cite{Gentleman:1974:MAR}.",
abstract = "Two algorithms are presented in the form of Fortran
subroutines. Each subroutine computes the radix and
number of digits of the floating-point numbers and
whether rounding or chopping is done by the machine on
which it is run. The methods are shown to work on any
``reasonable'' floating-point computer.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723",
corpsource = "Stanford Univ., CA, USA",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "chopping; computer programming; computer programming
languages --- Fortran; digital arithmetic; digits;
floating point arithmetic; Fortran subroutines;
mathematical techniques --- Digital Arithmetic; number
of; properties; radix; rounding",
oldlabel = "Malcolm72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Malcolm72",
}
@Article{Patrick:1972:HPA,
author = "Merrell L. Patrick",
title = "A Highly Parallel Algorithm for Approximating All
Zeros of a Polynomial with Only Real Zeros",
journal = j-CACM,
volume = "15",
number = "11",
pages = "952--955",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65H05",
MRnumber = "48 1455",
bibdate = "Mon Jan 22 07:11:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Patrick72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is described based on Newton's method
which simultaneously approximates all zeros of a
polynomial with only real zeros. The algorithm, which
is conceptually suitable for parallel computation,
determines its own starting values so that convergence
to the zeros is guaranteed. Multiple zeros and their
multiplicity are readily determined. At no point in the
method is polynomial deflation used.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
classification = "723; 921",
corpsource = "Duke Univ., Durham, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximation with real zeros; computer programming;
function approximation; guaranteed convergence; highly;
mathematical techniques --- Poles and Zeros;
mathematical techniques --- Polynomials; multiple
zeros; Newton's method; parallel algorithm; parallel
numerical algorithms; poles and zeros; polynomial
zeros; polynomials; real polynomials; real zeros;
starting values",
oldlabel = "Patrick72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Patrick72",
}
@Article{Ledgard:1972:MTC,
author = "Henry F. Ledgard",
title = "Model for Type Checking --- with an Application to
{Algol 60}",
journal = j-CACM,
volume = "15",
number = "11",
pages = "956--966",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Ledgard72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper attempts to isolate the notion of type
checking and presents a partial solution to the type
checking problem based on the notions of abstraction
and application of functions. A program is mapped into
an expression within a decidable subset of the
lambda-calculus, which characterizes the type relations
within the program and eliminates all other
information. The determination of the type-wise
correctness or incorrectness of the program is resolved
by reducing its corresponding lambda-calculus
expression to one of two normal forms, the constant
``correct'' for a type-wise correct program or the
constant ``error.'' An application to type checking in
Algol 60 is made, and the attendant problems faced for
any notion of type checking are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "Johns Hopkins Univ., Baltimore, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstraction; ALGOL; ALGOL 60; application of
functions; compilation; computer programming languages;
execution; lambda calculus; model; program compilers;
type checking",
oldlabel = "Ledgard72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ledgard72",
}
@Article{Henderson:1972:DSS,
author = "Peter B. Henderson",
title = "Derived Semantics for Some Programming Language
Constructs",
journal = j-CACM,
volume = "15",
number = "11",
pages = "967--973",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Henderson72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The constructs of a simple programming language are
introduced and described informally in terms of values
and side-effects. a translator is defined which
translates the language into flowcharts for a simple
machine. The action of the machine in executing a
flowchart is defined. A proof is constructed that the
effect of translating and executing any program can be
expressed solely in terms of the value and side-effect
of the program. during the course of constructing the
proof, formal definitions of the concepts of value and
side-effect are derived in order to make the proof
rigorous. Correctness of the implementation involves
checking that the definitions derived in the step above
are an acceptable formalization of the informal
description given in the first step.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Univ. Newcastle upon Tyne, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; constructs; derived
semantics; flowcharts; lambda calculus; programming
language; programming theory; side effects; translator;
values",
oldlabel = "Henderson72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Henderson72",
}
@Article{Verhelst:1972:CLE,
author = "M. Verhelst",
title = "The Conversion of Limited-Entry Decision Tables to
Optimal and Near-Optimal Flowcharts: Two New
Algorithms",
journal = j-CACM,
volume = "15",
number = "11",
pages = "974--980",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:15 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Verhelst72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The algorithms are first derived for treating decision
tables not containing an ELSE-rule, but the
optimum-approaching algorithm is shown to be equally
valid for tables including such a rule. Both algorithms
are compared with existing ones and are applied to a
somewhat large decision table derived from a real
case.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Univ. Louvain, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer programming --- Subroutines;
computer programming languages; conversion; decision
tables; flowcharting; limited entry decision tables;
minimum execution time; near; optimal flowcharts;
optimisation; optimum approaching algorithm; optimum
finding",
oldlabel = "Verhelst72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Verhelst72",
}
@Article{Baecker:1972:GCV,
author = "H. D. Baecker",
title = "Garbage Collection for Virtual Memory Computer
Systems",
journal = j-CACM,
volume = "15",
number = "11",
pages = "981--986",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:35 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Baecker72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In list processing there is typically a growing demand
for space during program execution. This paper examines
the practical implications of this growth within a
virtual memory computer system, proposes two new
garbage collection techniques for virtual memory
systems, and compares them with traditional methods by
discussion and by simulation.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems --- Storage Allocation;
computer programming languages; data storage, digital;
file organisation; garbage collection; list; paging;
processing; segmentation; storage allocation; storage
management; virtual memory; virtual memory computer
systems",
oldlabel = "Baecker72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Baecker72",
}
@Article{Ramberg:1972:AMG,
author = "John S. Ramberg and Bruce W. Schmeiser",
title = "Approximate Method for Generating Symmetric Random
Variables",
journal = j-CACM,
volume = "15",
number = "11",
pages = "987--990",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#RambergS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method for generating values of continuous symmetric
random variables that is relatively fast, requires
essentially no computer memory, and is easy to use is
developed. The method, which uses a uniform zero-one
random number source, is based on the inverse function
of the lambda distribution of Tukey. Since it
approximates many of the continuous theoretical
distributions and empirical distributions frequently
used in simulations, the method should be useful to
simulation practitioners.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
classification = "922",
corpsource = "Univ. Iowa, Iowa City, IA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximate method; inverse function; lambda
distribution of Tukey; mathematical models;
mathematical statistics; random number generation;
random number source; simulation; symmetric random
variable generation; uniform zero one",
oldlabel = "RambergS72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RambergS72",
}
@Article{March:1972:AAE,
author = "David L. March",
title = "{ACM Algorithm 434}: Exact Probabilities for
${R\times{C}}$ Contingency Tables [{G2}]",
journal = j-CACM,
volume = "15",
number = "11",
pages = "991--992",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#March72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark
\cite{Boulton:1974:RAE,Hancock:1975:RAE,Boulton:1976:REP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "March72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/March72",
}
@Article{Fullerton:1972:AAM,
author = "Wayne Fullerton",
title = "{ACM Algorithm 435}: Modified Incomplete Gamma
Function [{S14}]",
journal = j-CACM,
volume = "15",
number = "11",
pages = "993--995",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Fullerton72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Schoene:1978:RMI}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Fullerton72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fullerton72",
}
@Article{Lum:1972:ARK,
author = "Vincent Y. Lum and P. S. T. Yuen",
title = "Additional results on key-to-address transform
techniques: a fundamental performance study on large
existing formatted files",
journal = j-CACM,
volume = "15",
number = "11",
pages = "996--997",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#LumY72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "file; file organisation; fundamental performance; hash
coding; key to address transform techniques; large
existing formatted files; organization; study",
oldlabel = "LumY72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LumY72",
}
@Article{Kennedy:1972:NOD,
author = "Steve Kennedy",
title = "A Note on Optimal Doubly-Chained Trees",
journal = j-CACM,
volume = "15",
number = "11",
pages = "997--998",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Kennedy72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary search; file organisation; file searching;
optimal doubly chained trees; tree; trees
(mathematical)",
oldlabel = "Kennedy72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kennedy72",
}
@Article{Eisenberg:1972:FCD,
author = "Murray A. Eisenberg and Michael R. McGuire",
title = "Further comments on {Dijkstra}'s concurrent
programming control problem",
journal = j-CACM,
volume = "15",
number = "11",
pages = "999--999",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:45 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#EisenbergM72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "critical; Dijkstra's concurrent programming control
problem; multiprocessing; multiprocessing programs;
section",
oldlabel = "EisenbergM72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EisenbergM72",
}
@Article{Smoliar:1972:CMM,
author = "Stephen W. Smoliar",
title = "Comments on {Moorer's Music} and computer
composition",
journal = j-CACM,
volume = "15",
number = "11",
pages = "1000--1001",
month = nov,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:00 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Smoliar72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Tech. Israel Inst. Technol., Haifa, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; computer composition;
computer music; heuristic; humanities; programming",
oldlabel = "Smoliar72",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smoliar72",
}
@Article{Phillips:1972:DPA,
author = "J. Richard Phillips and H. C. Adams",
title = "Dynamic Partitioning for Array Languages",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1023--1032",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#PhillipsA72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The classical process of partitioning an array into
subarrays is extended to a more useful array language
operation. Various modes of partitioning are defined
for different types of arrays, so that subarrays may
vary over the original array in a nearly arbitrary
manner. These definitions are motivated with several
realistic examples to illustrate the value of
partitioning for array languages. Of general interest
is the data structure for partitioning. This consists
of dynamic tree structures which are used to derive and
maintain the array control information. These are
described in sufficient detail to be of value in the
design of other array languages. The description
presented in this paper is implemented in a new array
language, OL/2, currently under development at the
University of Illinois.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6140D (High level
languages)",
classification = "723",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "array languages; array partitioning; computer
programming languages; data processing --- Data
Structures; data structure; data structures; dynamic
partitioning; dynamic tree structures; OL/2;
programming languages",
oldlabel = "PhillipsA72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PhillipsA72",
}
@Article{Bayer:1972:IRM,
author = "Rudolf Bayer and C. Witzgall",
title = "Index Ranges for Matrix Calculi",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1033--1039",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BayerW72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes a scheme for symbolic manipulation
of index expressions which arise as a by-product of the
symbolic manipulation of expressions in the matrix
calculi described by the authors in a previous paper.
This scheme attempts program optimization by
transforming the original algorithm rather than the
machine code. The goal is to automatically generate
code for handling the tedious address calculations
necessitated by complicated data structures. The paper
is therefore preoccupied with ``indexing by position.''
The relationship of ``indexing by name'' and ``indexing
by position'' is discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Boeing Sci. Res. Labs., Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "address calculations; algorithm; computer programming
languages; data handling; data processing; data
structures; expressions; index; index ranges; indexing
by name; indexing by position; matrix algebra; matrix
calculi; program optimization; symbolic manipulation;
transformation",
oldlabel = "BayerW72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BayerW72",
}
@Article{Earley:1972:MIC,
author = "Jay Earley and Paul Caizergues",
title = "Method for Incrementally Compiling Languages with
Nested Statement Structure",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1040--1044",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#EarleyC72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The method permits editing of the source language
using a general purpose text editor, and incremental
processing of changes without frequent recompilation of
entire routines. The essential points of the method
are: the syntax of the language is restricted insofar
as which constructs may occur on lines; an internal
data structure (called the skeleton) is maintained to
represent the statement structure; the recompilation is
partially batched in the sense that recompilation of
modified lines does not occur until the last of a set
of editing commands has been received; and the parsing
and compilation are factored into two parts, that done
on individual lines and that done globally to handle
the relationships between the lines.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ALGOL; computer operating systems --- Program
Compilers; computer programming languages; data
processing --- Data Structures; editor; general purpose
text; incremental compilation; nested statement
structure; PL/I; program compilers; programming
languages; source language",
oldlabel = "EarleyC72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EarleyC72",
}
@Article{Luccio:1972:WIL,
author = "Fabrizio Luccio",
title = "Weighted Increment Linear Search for Scatter Tables",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1045--1047",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Luccio72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new linear search for hash tables whose increment
step is a function of the key being addressed is
presented. Comparisons with known methods are given, in
terms of efficiency and computation complexity. In
particular, the new method applies to tables of size n
equals 2**r. It allows full table searching, and
practically eliminates primary clustering at a very low
cost.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Univ. Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "clustering; computer programming; hash; information
retrieval systems; information searching techniques;
scatter tables; table lookup; tables; weighted
increment linear search",
oldlabel = "Luccio72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Luccio72",
}
@Article{Barr:1972:CMN,
author = "Donald R. Barr and Norman L. Sezak",
title = "A Comparison of Multivariate Normal Generators",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1048--1049",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#BarrS72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Naval Postgraduate School, Monterey, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "comparison; covariance matrix; Gaussian random number
generator; multivariate; multivariate normal
generators; normal random vectors; random number
generation; simulation; triangular factorization",
oldlabel = "BarrS72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BarrS72",
}
@Article{Moore:1972:NMS,
author = "John Moore and Prentiss Robinson",
title = "New Method for the Solution of the {Cauchy} Problem
for Parabolic Equations",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1050--1052",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:45 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#MooreR72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An integral equation representation is given for
parabolic partial differential equations. When the
equations are defined in unbounded domains, as in the
initial value (Cauchy) problem, the solution of the
integral equation by the method of successive
approximation has inherent advantages over other
methods. Error bounds for the method are of order
h**3**/**2 and h**7**/**2 (h is the increment size)
depending on the finite difference approximations
involved.",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations)",
classification = "921",
corpsource = "Univ. Newcastle, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Cauchy problem; initial value problem; integral
equation representation; mathematical techniques;
parabolic; partial differential equations; successive
approximation",
oldlabel = "MooreR72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MooreR72",
}
@Article{Parnas:1972:CUD,
author = "David Lorge Parnas",
title = "On the Criteria To Be Used in Decomposing Systems into
Modules",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1053--1058",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/softeng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Parnas72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses modularization as a mechanism for
improving the flexibility and comprehensibility of a
system while allowing the shortening of its development
time. The effectiveness of a ``modularization'' is
dependent upon the criteria used in dividing the system
into modules. A system design problem presented and
both a conventional and unconventional decomposition
are described. It is shown that the unconventional
decompositions have distinct advantages for the goals
outlined. The criteria used in arriving at the
decompositions are discussed. The unconventional
decomposition, if implemented with the conventional
assumption that a module consists of one or more
subroutines, will be less efficient in most cases. An
alternative approach to implementation which does not
this effect is sketched.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "comprehensibility; computer programming; criteria;
decomposition; flexibility; modularization; modules;
programming; software engineering; systems",
oldlabel = "Parnas72a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Parnas72a",
}
@Article{Brown:1972:LLP,
author = "P. J. Brown",
title = "Levels of Language for Portable Software",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1059--1062",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Brown72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An increasing amount of software is being implemented
in a portable form. A popular way of accomplishing this
is to encode the software in a specially designed
machine-independent language and then to map this
language, often using a macro processor, into the
assembly language of each desired object machine. The
design of the machine-independent language is the key
factor in this operation. This paper discusses the
relative merits of pitching this language at a high
level or a low level, and presents some comparative
results.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Univ. Kent, Canterbury, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "assembly language; computer programming; levels of
language; machine independent language; macro
processor; portable software; procedure oriented
languages",
oldlabel = "Brown72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brown72",
}
@Article{Sherman:1972:TDM,
author = "Stephen Sherman and Forest {Baskett III} and James C.
Browne",
title = "Trace-Driven Modeling and Analysis of {CPU} Scheduling
in a Multiprogramming System",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1063--1069",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#ShermanBB72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The scheduling methods tested included the best
possible and worst possible methods, the traditional
methods of multiprogramming theory, round-robin,
first-come-first-served, and dynamic predictors. The
relative and absolute performances of these scheduling
methods are given. It is concluded that a successful
CPU scheduling method must be preemptive and must
prevent a given job from holding the CPU for too long a
period.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis; computer systems programming; CPU
scheduling; first come first served; microscopic level
job stream data; modelling; multiprogramming;
multiprogramming system; round robin; trace driven
modelling",
oldlabel = "ShermanBB72",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShermanBB72",
xxtitle = "Trace-Driven Modeling and Analysis of {CPU} Scheduling
in Multiprogramming System",
}
@Article{Boland:1972:AAPa,
author = "W. Robert Boland",
title = "{ACM Algorithm 436}: Product Type Trapezoidal
Integration",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1070--1070",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Boland72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Boland72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boland72",
}
@Article{Boland:1972:AAPb,
author = "W. Robert Boland",
title = "{ACM Algorithm 437}: Product Type {Simpson}'s
Integration [{D1}]",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1070--1071",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Boland72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Boland72a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boland72a",
}
@Article{Boland:1972:AAPc,
author = "W. Robert Boland",
title = "{ACM Algorithm 438}: Product Type Two-Point
{Gauss--Legendre--Simpson}'s Integration [{D1}]",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1071--??",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:15 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Boland72b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Boland72b",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boland72b",
xxpages = "1072",
}
@Article{Sullins:1972:CAP,
author = "Walter L. Sullins",
title = "Certification of ``{Algorithm 266}: Pseudo-Random
Numbers [{G5}]''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1072--1073",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Sullins72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Pike:1965:AAP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Sullins72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sullins72",
}
@Article{Boland:1972:AAPd,
author = "W. Robert Boland",
title = "{ACM Algorithm 439}: Product Type Three-point
{Gauss--Legendre--Simpson}'s Integration [{D1}]",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1072--??",
month = dec,
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Boland72b;
http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Boland72c;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Boland72b; Boland72c",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boland72b;
ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boland72c",
xxpages = "1071--??",
}
@Article{Hallet:1972:CAS,
author = "P. Hallet and E. Mund",
title = "Certification of ``{Algorithm 379}: Squank''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1073--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:00 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#HalletM72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Lyness:1970:AAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "HalletM72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HalletM72",
}
@Article{Schuegraf:1972:RAL,
author = "Ernst Schuegraf",
title = "Remark on ``{Algorithm 176}: Least Squares Surface
Fit''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1073--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Schuegraf72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Arthurs:1963:AAL}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Schuegraf72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schuegraf72",
}
@Article{Frisch:1972:RAR,
author = "Michael J. Frisch",
title = "Remark on ``{Algorithms 352, 385, 392}: Remarks on
Characteristic Values and Associated Solutions of
{Mathieu}'s Differential Equation, Exponential
Integral, and Systems of Hyperbolic {P.D.E.}''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1074--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:24 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Frisch72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Clemm:1969:AAC,Paciorek:1970:AAE,Smith:1970:AAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Frisch72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Frisch72",
}
@Article{Marshall:1972:RAD,
author = "D. R. T. Marshall",
title = "Remark on ``{Algorithm 394}: Decision Table
Translation''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1074--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Marshall72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Dial:1970:AAD}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Marshall72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Marshall72",
}
@Article{Schuegraf:1972:RAB,
author = "Ernst Schuegraf",
title = "Remark on ``{Algorithm 195}: {BANDSOLVE}''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1074--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Schuegraf72a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Thurnau:1963:AAB}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Schuegraf72a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schuegraf72a",
}
@Article{Heiberger:1972:RAR,
author = "Richard M. Heiberger",
title = "Remark on ``{Algorithm 405}: Roots of Matrix
Pencils''",
journal = j-CACM,
volume = "15",
number = "12",
pages = "1075--??",
year = "1972",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm15.html#Heiberger72;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Dell:1971:AAR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Heiberger72",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Heiberger72",
}
@Article{Denning:1973:CWM,
author = "Peter J. Denning and Stuart C. Schwartz",
title = "Corrigendum: ``{Properties of the working-set
model}''",
journal = j-CACM,
volume = "15",
number = "2",
pages = "191--198",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue May 28 11:37:15 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Denning:1972:PWS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Shedler:1973:QMM,
author = "Gerald S. Shedler",
title = "A Queuing Model of a Multiprogrammed Computer with a
Two-Level Storage System",
journal = j-CACM,
volume = "16",
number = "1",
pages = "3--10",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "51 14680",
MRreviewer = "K. Vairaran",
bibdate = "Mon Jan 22 07:20:52 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Shedler73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The results are presented of an analysis of a
probabilistic model of a multiprogrammed computer
system with a two-level storage system in which there
is sequential dependency of accesses between the
devices. Expressions are obtained for the long-run
probability that both the CPU and each of the storage
devices are busy. Some numerical results are given
which quantify the gains in CPU utilization obtainable
by multiprogramming in the presence of this type of
storage system.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory)",
classification = "723; 922",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming --- Multiprogramming;
data storage, digital; dependency of accesses;
hierarchical index ses; hierarchical index sets;
modelling; multiprogrammed computer; multiprogrammed
computer system; multiprogramming; probability;
queueing theory; queuing model; sequential; storage
system; two level",
oldlabel = "Shedler73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shedler73",
}
@Article{Bays:1973:RHC,
author = "Carter Bays",
title = "The Reallocation of Hash-Coded Tables",
journal = j-CACM,
volume = "16",
number = "1",
pages = "11--14",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bays73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "When the space allocation for a hash-coded table is
altered, the table entries must be rescattered over the
new space. A technique for accomplishing this
rescattering is presented. The technique is independent
of both the length of the table and the hashing
function used, and can be utilized in conjunction with
a linear reallocation of the table being rescattered.
Moreover, it can be used to eliminate previously
flagged deletions from any hash-coded table, or to
change from one hashing method to another. The
efficiency of the technique is discussed and
theoretical statistics are given.",
acknowledgement = ack-nhfb,
annote = "Algorithm to handle increase or decrease within a
direct access table containing entries.",
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation)",
classification = "723",
corpsource = "Univ. South Carolina, Columbia, SC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; data storage, digital;
deletions; dynamic storage; hash code; programming;
reallocation; scatter storage; storage allocation",
oldlabel = "Bays73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bays73",
}
@Article{Morris:1973:PPL,
author = "James H. {Morris, Jr.}",
title = "Protection in Programming Languages",
journal = j-CACM,
volume = "16",
number = "1",
pages = "15--21",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Morris73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Linguistic mechanisms which can be used to protect one
subprogram from another's malfunctioning are described.
Function-producing functions and various type-tagging
schemes are considered. An attempt is made to
distinguish between access limitation and
authentication.",
acknowledgement = ack-nhfb,
classcodes = "C6100 (Software techniques and systems)",
classification = "723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "access control; access keys; authentication; computer
programming languages; environments; programming
languages; protection; seals; secrecy; security of
data; trademarks; types",
oldlabel = "Morris73",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris73",
}
@Article{Muraoka:1973:TRS,
author = "Yoichi Muraoka and David J. Kuck",
title = "On the Time Required for a Sequence of Matrix
Products",
journal = j-CACM,
volume = "16",
number = "1",
pages = "22--26",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "51 2347",
MRreviewer = "M. Tetruasvili",
bibdate = "Mon Jan 22 07:07:03 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MuraokaK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses the multiplication of conformable
sequences of row vectors, column vectors, and square
matrices. The minimum time required to evaluate such
products on ordinary serial computers as well as
parallel computers is discussed. Algorithms are
presented which properly parse such matrix sequences
subject to the constraints of the machine
organization.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; computer programming languages;
computers; digital arithmetic; matrix algebra; matrix
expressions; matrix multiplication; operation
minimization; parallel computers; parallel machine;
parallel processing; sequence of matrix products;
serial; time required",
oldlabel = "MuraokaK73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MuraokaK73",
}
@Article{James:1973:ACP,
author = "E. B. James and Derek P. Partridge",
title = "Adaptive Correction of Program Statements",
journal = j-CACM,
volume = "16",
number = "1",
pages = "27--37",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#JamesP73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method of analyzing statements in a programming
language which can tolerate a considerable inaccuracy
in their specification is proposed. This method
involves principles at present mainly confined to
studies in the area of artificial intelligence such as
feature extraction, approximate tree matching, and
strategy improvement by feedback from the matching
process. A pilot program incorporating the principles
is described and preliminary operating results are
presented. A final section surveys further principles
which are currently being investigated.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Imperial Coll. Sci. and Technol., London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "adaptive correction; artificial intelligence;
automatic parsing; compiler; computer metatheory;
computer programming languages; linguistic pattern
matching; program statements; programming; programming
languages; syntax analysis; theory",
oldlabel = "JamesP73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JamesP73",
}
@Article{Richman:1973:VPE,
author = "Paul L. Richman",
title = "Variable-Precision Exponentiation",
journal = j-CACM,
volume = "16",
number = "1",
pages = "38--40",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D20",
MRnumber = "51 4631",
MRreviewer = "V. V. Ivanov",
bibdate = "Mon Jan 22 07:15:57 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Richman73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A previous paper presented an efficient algorithm,
called the Recomputation Algorithm, for evaluating a
rational expression to within any desired tolerance on
a computer which performs variable-precision arithmetic
operations. The Recomputation Algorithm can be applied
to expressions involving any variable-precision
operations having $O(10^(-p) + \sum_i|E_i|)$ error
bounds, where $p$ denotes the operation's precision and
$E_i$ denotes the error in the operation's $i$-th
argument. \par
This paper presents an efficient variable-precision
exponential operation with an error bound of the above
order. Other operations such as log, sin, and cos,
which have simple series expansions, can be handled
similarly.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723; 921",
corpsource = "Bell Telephone Labs. Inc., Denver, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; digital arithmetic; error
analysis; exponential function; exponentiation;
interval arithmetic; mathematical programming; variable
precision; variable-precision",
oldlabel = "Richman73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Richman73",
}
@Article{Crawford:1973:RBS,
author = "C. R. Crawford",
title = "Reduction of a Band-Symmetric Generalized Eigenvalue
Problem",
journal = j-CACM,
volume = "16",
number = "1",
pages = "41--44",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F15",
MRnumber = "51 7266",
MRreviewer = "W. Niethammer",
bibdate = "Mon Jan 22 06:33:30 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/gvl.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Crawford73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is described for reducing a generalized
eigenvalue problem to an ordinary problem, in case A
and B are symmetric band matrices with B positive
definite. If n is the order of the matrix and m the
bandwidth, the matrices A and B are partitioned into
m-by-m blocks; and the algorithm is described in terms
of these blocks. The algorithm reduces the generalized
problem to an ordinary eigenvalue problem for a
symmetric band matrix C whose bandwidth is the same as
A and B. The algorithm is similar to those of
Rutishauser and Schwartz for the reduction of symmetric
matrices to band form. The calculation of C requires
order N**2m operation. The round-off error in the
calculation of C is of the same order as the sum of the
errors at each of the n/m steps of the algorithm, the
latter errors being largely determined by the condition
of B with respect to inversion.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "723; 921",
corpsource = "Univ. Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; eigenvalues and
eigenfunctions; generalized eigenvalues; mathematical
techniques; matrix algebra; reduction; symmetric band
matrices",
kwds = "nla, geig, band matrix, symmetric matrix",
oldlabel = "Crawford73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Crawford73",
}
@Article{Blount:1973:PAC,
author = "Sumner E. Blount and Louis Fein",
title = "The practical aspect of computer science education ---
discussion",
journal = j-CACM,
volume = "16",
number = "1",
pages = "45--46",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BlountF73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Digital Equipment Corp., Acton, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer engineering; computer science; curriculum;
digital computers; education; systems design",
oldlabel = "BlountF73",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BlountF73",
}
@Article{Bays:1973:NWC,
author = "Carter Bays",
title = "A note on when to chain overflow items within a
direct-access table",
journal = j-CACM,
volume = "16",
number = "1",
pages = "46--47",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:06 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bays73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. South Carolina, Columbia, SC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "chaining; collision; data handling; direct access
table; hash code; information; open hash; overflow
items; retrieval",
oldlabel = "Bays73a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bays73a",
}
@Article{Atkins:1973:MRA,
author = "M. Stella Atkins",
title = "Mutual recursion in {Algol 60} using restricted
compilers",
journal = j-CACM,
volume = "16",
number = "1",
pages = "47--48",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Atkins73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors)",
corpsource = "Univ. Warwick, Coventry, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; ALGOL 60; mutual recursion; program compilers;
restricted compilers",
oldlabel = "Atkins73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Atkins73",
}
@Article{Gallaher:1973:AAM,
author = "L. J. Gallaher",
title = "{ACM Algorithm 440}: {A} Multidimensional {Monte
Carlo} Quadrature with Adaptive Stratified Sampling
[{D1}]",
journal = j-CACM,
volume = "16",
number = "1",
pages = "49--50",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:57 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Gallaher73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Georgia Inst. Technol., Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "adaptive quadrature; ALGOL; integral; integration;
Monte Carlo methods; Monte Carlo Quadrature;
multidimensional; sampling; sequential stratification;
stratified; subroutines",
oldlabel = "Gallaher73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gallaher73",
}
@Article{Knop:1973:AAR,
author = "Robert E. Knop",
title = "{ACM Algorithm 441}: Random Deviates from the Dipole
Distribution [{G5}]",
journal = j-CACM,
volume = "16",
number = "1",
pages = "51--51",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:18 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1973.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Knop73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Florida State Univ., Tallahassee, FL, USA",
country = "USA",
descriptors = "RVG",
enum = "7514",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dipole distribution; FORTRAN; probability density;
random deviates; random number; statistics;
subroutines",
language = "English",
oldlabel = "Knop73",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knop73",
}
@Article{Hill:1973:AAN,
author = "G. W. Hill and A. W. Davis",
title = "{ACM Algorithm 442}: Normal Deviate [{S14}]",
journal = j-CACM,
volume = "16",
number = "1",
pages = "51--52",
month = jan,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:54 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1973.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#HillD73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "CSIRO, Glen Osmond, Australia",
country = "USA",
descriptors = "RVG",
enum = "7393",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; normal deviate; normal distribution inverse;
probit; statistics; subroutines; Taylor series
approximation; transform",
language = "English",
oldlabel = "HillD73",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HillD73",
}
@Article{Merrill:1973:RCR,
author = "R. D. Merrill",
title = "Representation of Contours and Regions for Efficient
Computer Search",
journal = j-CACM,
volume = "16",
number = "2",
pages = "69--82",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "51 7362",
MRreviewer = "Arnold Griffith",
bibdate = "Mon Jan 22 07:04:03 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Merrill73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A novel computer-searchable representation for the
three basic pictorial features, contour maps, region
coverage, and line structures, is described. The
representation, which has practical storage
requirements, provides a rapid means of searching large
files for data associated with geometric position as
well as with attribute value. An application of this
representation to handling terrain information
illustrates its utility. The algebraic properties of
the data structure make it computationally easy to
determine whether a point lies within a closed
boundary; compute the area contained by a closed
boundary; generate the closed boundary representing the
union or intersection of two closed boundaries; and
determine the neighboring boundaries to a point and the
minimum distances between them and the point. Pertinent
to mapping.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C7400 (Engineering
computing)",
classification = "405; 723",
corpsource = "Lockheed Palo Alto Res. Laboratory, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "applications of computers; cartography; computer
graphics; computer searchable structure; contour map
representation; data handling; data processing --- Data
Handling; data processing --- Data Structures;
engineering; graphic data retrieval; maps and mapping;
region boundary representation",
oldlabel = "Merrill73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Merrill73",
}
@Article{Crespi-Reghizzi:1973:UGI,
author = "Stefano Crespi-Reghizzi and Michel A. Melkanoff and L.
Lichten",
title = "The Use of Grammatical Inference for Designing
Programming Languages",
journal = j-CACM,
volume = "16",
number = "2",
pages = "83--90",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "50 15446",
MRreviewer = "Leon Levy",
bibdate = "Mon Jan 22 06:34:00 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/colt.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Crespi-ReghizziML73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Both in designing a new programming language and in
extending an existing language, the designer is faced
with the problem of deriving a ``natural'' grammar for
the language. We are proposing an interactive approach
to the grammar design problem wherein the designer
presents a sample of sentences and structures as input
to a grammatical inference algorithm. The algorithm
then constructs a grammar which is a reasonable
generalization of the examples submitted by the
designer. \par
The implementation is presently restricted to a
subclass of operator precedence grammars, but a second
algorithm is outlined which applies to a larger class
of context-free grammars.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6140 (Programming languages)",
classification = "723",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; context; context-free
grammars; extensible languages; free grammars; grammar
design; grammatical inference; identification in the
limit; inference; language definition; operator;
precedence grammars; programming languages",
oldlabel = "Crespi-ReghizziML73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Crespi-ReghizziML73",
}
@Article{Gimpel:1973:TDP,
author = "James F. Gimpel",
title = "A Theory of Discrete Patterns and Their Implementation
in {SNOBOL4}",
journal = j-CACM,
volume = "16",
number = "2",
pages = "91--100",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A15 (68A45)",
MRnumber = "52 7198",
MRreviewer = "John K. Debenham",
bibdate = "Mon Jan 22 06:44:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Gimpel73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The notion of a discrete pattern is formalized and
certain properties deduced. A pattern is shown to be a
generalization of a formal language. Algorithms for
implementing the kinds of patterns in SNOBOL4 are
given. The general approach is to create, in-so-far as
possible, a bottom-up parse from a top-down
specification.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6140 (Programming languages)",
classification = "723",
corpsource = "Bell Telephone Labs., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; data processing ---
Data Structures; discrete patterns; formal language;
formal languages; parsing; pattern implementation;
pattern matching; pattern recognition systems; pattern
theory; patterns; programming languages; SNOBOL4;
string processing",
oldlabel = "Gimpel73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gimpel73",
}
@Article{Rokne:1973:AES,
author = "J. Rokne",
title = "Automatic Errorbounds for Simple Zeros of Analytic
Functions",
journal = j-CACM,
volume = "16",
number = "2",
pages = "101--104",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65E05",
MRnumber = "51 4638",
MRreviewer = "E. Maliszewski",
bibdate = "Mon Jan 22 07:16:52 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Rokne73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The Cauchy-Ostrowski theorem on convergence of Newton
iterates for an analytic function in one variable is
extended to include computational errors using complex
interval arithmetic. Several numerical examples are
given for polynomials with real and complex roots and
one example for the Bessel function of the first
kind.",
acknowledgement = ack-nhfb,
classcodes = "B0290B (Error analysis in numerical methods); B0290D
(Functional analysis); B0290K (Nonlinear and functional
equations); C4110 (Error analysis in numerical
methods); C4120 (Functional analysis); C4150 (Nonlinear
and functional equations)",
classification = "723",
corpsource = "Univ. Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis; analytic functions; automatic errorbounds;
Bessel functions; Cauchy-Ostrowski theorem; complex
interval arithmetic; complex intervals; convergence of
numerical methods; data processing --- Data Handling;
data processing --- Data Structures; error; interval
arithmetic; iterative methods; mathematical techniques;
Newton's method; poles and zeros; polynomials; real
interval arithmetic; real intervals; simple zeros;
zeros of Bessel functions; zeros of polynomials",
oldlabel = "Rokne73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rokne73",
}
@Article{Brent:1973:RRT,
author = "Richard P. Brent",
title = "Reducing the Retrieval Time of Scatter Storage
Techniques",
journal = j-CACM,
volume = "16",
number = "2",
pages = "105--109",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:04 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Brent73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Modification of open addressing with double hashing to
reduce the average number of probes for a successful
search.",
abstract = "A new method for entering and retrieving information
in a hash table is described. The method is intended to
be efficient if most entries are looked up several
times. The expected number of probes to look up an
entry, predicted theoretically and verified by Monte
Carlo experiments, is considerably less than for other
comparable methods if the table is nearly full. An
example of a possible Fortran implementation is
given.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "address; address calculation; addressing; calculation;
computer programming languages --- Fortran; content
addressing; data storage, digital --- Random Access;
file organisation; file searching; has; has code; hash
addressing; information retrieval systems; linear
probing; linear quotient; linear quotient method;
method; retrieval time; scatter storage techniques;
storage management; symbol table",
oldlabel = "Brent73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brent73",
}
@Article{Graham:1973:SDE,
author = "Robert M. Graham and Gerald J. {Clancy, Jr.} and David
B. DeVaney",
title = "A Software Design and Evaluation System",
journal = j-CACM,
volume = "16",
number = "2",
pages = "110--116",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:59 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#GrahamCD73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A critical failure of current software system design
and implementation methodology is that the performance
of a proposed design is not evaluated before it is
actually implemented. In this paper the reasons for
this failure are explored, and a new methodology which
overcomes many of the difficulties is proposed. A
system which integrates performance evaluation with
design and implementation is described. This system is
based on a simple, high level language which is used to
describe the evolving system at all stages of its
development. The source language description is used as
direct input to performance analysis and simulation
routines. using the performance information obtained
from these routines as feedback, the problems which
adversely affect performance are detected early enough
so that they can be corrected without costly major
reimplementation of the proposed system.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other processors);
C6150J (Operating systems)",
classification = "723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compilers; computer programming languages; computer
software; computer systems programming; computer
systems programming --- Supervisory and Executive
Programs; data processing --- Data Structures;
debugging; des language; evaluation; executive
programs; high level language; performance analysis;
program maintenance; program processors; simulation;
software design; supervisory and; supervisory systems;
system programming",
oldlabel = "GrahamCD73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GrahamCD73",
}
@Article{Balzer:1973:OIC,
author = "Robert M. Balzer",
title = "An Overview of the {ISPL} Computer System Design",
journal = j-CACM,
volume = "16",
number = "2",
pages = "117--122",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:01 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Balzer73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper explores the advantages of the concurrent
design of the language, operating system, and machine
(via microcode) to create an interactive programming
laboratory. It describes the synergistic effect that
the freedom to move and alter features from one of
these domains to another has had on the design of this
system (which has not been implemented). This freedom
simplified both incremental compilation and the
system's addressing structure, and centralized the
communication mechanisms enabling the construction of
hierarchical subsystems. It also suggested an important
new concept for operating systems: separation of the
scheduling from the maintenance functions in resource
allocation. This separation enables incorporation of
new scheduling algorithms (decision of what to do)
without endangering the system integration (correctly
performing the scheduling decisions).",
acknowledgement = ack-nhfb,
classcodes = "C6100 (Software techniques and systems); C6150J
(Operating systems)",
classification = "723",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; computer system
design; computer systems, digital --- Time Sharing;
computers --- Data Communication Systems; hierarchical
subsystems; incremental compilation; interactive
programming laboratory; interprogram communication;
ISPL; language; machine; operating system; operating
systems (computers); programming",
oldlabel = "Balzer73",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Balzer73",
}
@Article{Fritsch:1973:AAS,
author = "Fred N. Fritsch and R. E. Shafer and W. P. Crowley",
title = "{ACM Algorithm 443}: Solution of the Transcendental
Equation $w e^w = x$ [{C5}]",
journal = j-CACM,
volume = "16",
number = "2",
pages = "123--124",
month = feb,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:27 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#FritschSC73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks \cite{Einarsson:1974:STE}.",
acknowledgement = ack-nhfb,
classcodes = "B0290D (Functional analysis); C4120 (Functional
analysis); C7310 (Mathematics computing)",
corpsource = "Univ. California, Livermore, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN; function evaluation; iteration; iterative
methods; subroutines; transcendental equation",
oldlabel = "FritschSC73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FritschSC73",
}
@Article{Austing:1973:CSC,
author = "Richard H. Austing and Gerald L. Engel",
title = "A Computer Science Course Program for Small Colleges",
journal = j-CACM,
volume = "16",
number = "3",
pages = "139--147",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:22 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#AustingE73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This report gives recommendations for the content,
implementation, and operation of a program of computer
science courses specifically directed to small
colleges. Implementation problems are discussed,
specifically within the constraints of limited faculty
and for the purposes of satisfying a wide variety of
objectives. Detailed descriptions of four courses are
given; suggestions are made for more advanced work; and
an extensive library list is included.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901",
corpsource = "Univ. Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer organization course; computer science course;
computer science education; data processing; education;
file organization course; programming course; reviews;
small colleges; social implications course;
universities",
oldlabel = "AustingE73",
treatment = "B Bibliography; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AustingE73",
}
@Article{Wagner:1973:CPM,
author = "Robert A. Wagner",
title = "Common Phrases and Minimum-Space Text Storage",
journal = j-CACM,
volume = "16",
number = "3",
pages = "148--152",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:42 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Wagner73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method for saving storage space for text strings,
such as compiler diagnostic messages, is described. The
method relies on hand selection of a set of text
strings which are common to one or more messages. These
phrases are then stored only once. The storage
technique gives rise to a mathematical optimization
problem: determine how each message should use the
available phrases to minimize its storage requirement.
This problem is nontrivial when phrases which overlap
exist. However, a dynamic programming algorithm is
presented which solves the problem in time which grows
linearly with the number of characters in the text.
Algorithm 444 applies to this paper.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C6120 (File organisation); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Cornell Univ., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "common phrases; computer operating systems --- Program
Compilers; computer programming; diagnostic messages;
dynamic programming; error messages; file organisation;
minimum space; optimization; program diagnostics; text
storage",
oldlabel = "Wagner73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wagner73",
}
@Article{Feinroth:1973:TUF,
author = "Y. Feinroth and E. Franceschini and M. Goldstein",
title = "Telecommunications Using a Front-End Minicomputer",
journal = j-CACM,
volume = "16",
number = "3",
pages = "153--160",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#FeinrothFG73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The use of a front-end minicomputer to provide varied
remote terminal access to a large scale computer is
considered. The problems of embedding
telecommunications I/O within an operating system are
discussed, and it is shown how the decentralization of
intelligence acquired by front-end processing vastly
simplifies the problem. A specific implementation is
discussed with emphasis on the main
processor-minicomputer link, the hardware-software
implementation, the effect on the main processor
operating system, and an assessment of the advantages
over a hardwired line controller.",
acknowledgement = ack-nhfb,
classcodes = "C5600 (Data communication equipment and techniques)",
classification = "718; 723",
corpsource = "New York Univ., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computers; computers, miniature; digital communication
systems; front end processor; front-end processor;
large scale computer; minicomputer; minicomputers;
operating; operating system; remote; remote job entry;
systems (computers); telecommunication systems;
telecommunications; terminals",
oldlabel = "FeinrothFG73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FeinrothFG73",
xxauthor = "Y. Feinroth and Ed Franceschini and M. Goldstein",
}
@Article{Pack:1973:EMC,
author = "Charles D. Pack",
title = "The Effects of Multiplexing on a
Computer-Communications System",
journal = j-CACM,
volume = "16",
number = "3",
pages = "161--168",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/network.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Pack73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A study is made of the way in which asynchronous time
division multiplexing changes the stochastic nature of
the arrival process from a user to the computer and,
consequently, affects the performance of a time-shared
computer-communications system. It is concluded that
while, for certain values of system parameters, there
is noticeable improvement in the performance of the
computer (model), in the sense that time-shared
scheduling delays are reduced, these improvements are
offset by the transmission delays imposed by
multiplexing so that there may be little or no change
in the computer-communications system performance.
Analytical and simulation results are based on the
model of the computer-communications system being an
M/D/I queue (the multiplexor) in tandem with a single
exponential server (the computer). Analytical results
include a general description of the output process of
an M/D/1 queue and the conditions under which this
output process is approximately Poisson.",
acknowledgement = ack-nhfb,
classcodes = "C5600 (Data communication equipment and techniques)",
classification = "718; 722; 723",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACm",
keywords = "computer communications; computer programming ---
Subroutines; computers; digital communication systems;
multiplexing; operating systems; scheduling algorithms;
systems; time sharing; time-sharing",
oldlabel = "Pack73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pack73",
}
@Article{Conway:1973:DID,
author = "Richard W. Conway and Thomas R. Wilcox",
title = "Design and Implementation of a Diagnostic Compiler for
{PL/I}",
journal = j-CACM,
volume = "16",
number = "3",
pages = "169--179",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:34 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#ConwayW73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "PL/C is a compiler for a dialect for PL/I. The design
objective was to provide a maximum degree of diagnostic
assistance in a batch processing environment. For the
most part this assistance is implicit and is provided
automatically by the compilers. The most remarkable
characteristic of PL/C is its perseverance --- it
completes translation of every program submitted and
continues execution until a user-established error
limit is reached. This requires that the compiler
repair errors encountered during both translation and
execution, and the design of PL/C is dominated by this
consideration. PL/C also introduces several explicit
user-controlled facilities for program testing. To
accommodate these extensions to PL/I without abandoning
compatibility with the IBM compiler, PL/C permits
``pseudo comments'' --- constructions whose contents
can optionally be considered either source text or
comment. In spite of the diagnostic effort PL/C is a
fast and efficient processor. It effectively
demonstrates that compilers can provide better
diagnostic assistance than is customarily offered, even
when a sophisticated source language is employed, and
that this assistance need not be prohibitively
costly.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Cornell Univ., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "batch processing environment; batch-processing;
computer operating systems; computer programming
languages --- Program Debugging; computer programming
languages --- Program Diagnostics; design; diagnostic
compiler; diagnostics; implementation; PL/1; PL/C;
PL/I; program; program compilers",
oldlabel = "ConwayW73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ConwayW73",
}
@Article{Salzer:1973:GCS,
author = "Herbert E. Salzer",
title = "{Gray} code and the $\pm$ sequence when $\pm f(\pm
f(\pm f(\cdots \pm f(x) \cdots)))$ is ordered",
journal = j-CACM,
volume = "16",
number = "3",
pages = "180--180",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Salzer73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary sequences; binary system; codes; functions;
Galois sum; Gray code; ordering; positive monotonic;
sign sequences",
oldlabel = "Salzer73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Salzer73",
}
@Article{Bookstein:1973:HST,
author = "Abraham Bookstein",
title = "On {Harrison}'s Substring Testing Technique",
journal = j-CACM,
volume = "16",
number = "3",
pages = "180--181",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bookstein73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data handling; hashing; information storage;
retrieval; substring testing technique",
oldlabel = "Bookstein73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bookstein73",
}
@Article{Payne:1973:GEP,
author = "William H. Payne",
title = "Graduate Education: The Ph.{D}. Glut",
journal = j-CACM,
volume = "16",
number = "3",
pages = "181--182",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Payne73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See response and rebuttal \cite{Freeman:1974:GEP}.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accreditation; education; graduate education; Ph.D.
glut; Ph.D. production",
oldlabel = "Payne73",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Payne73",
}
@Article{Wagner:1973:AAA,
author = "Robert A. Wagner",
title = "{ACM Algorithm 444}: An Algorithm for Extracting
Phrases in a Space-Optimal Fashion [{Z}]",
journal = j-CACM,
volume = "16",
number = "3",
pages = "183--185",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Wagner73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Vanderbilt Univ., Nashville, TN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; coding; data handling; extracting phrases;
information retrieval; PARSE; PL/I; subroutines; text
compression",
oldlabel = "Wagner73a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wagner73a",
}
@Article{Chang:1973:AAB,
author = "Shi-Kuo Chang",
title = "{ACM Algorithm 445}: Binary Pattern Reconstruction
from Projections [{Z}]",
journal = j-CACM,
volume = "16",
number = "3",
pages = "185--186",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:24 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Chang73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Lau:1973:RAB}.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C7800 (Other
computer applications)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; binary pattern; compression; data; picture
processing; projections; reconstruction; subroutines",
oldlabel = "Chang73",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chang73",
}
@Article{Lau:1973:RAB,
author = "John Lau",
title = "Remark on ``{Algorithm 445: Binary Pattern
Reconstruction from Projections [{Z}]}''",
journal = j-CACM,
volume = "16",
number = "3",
pages = "186--186",
month = mar,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Lau73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Chang:1973:AAB}.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C7800 (Other
computer applications)",
corpsource = "Univ. British Columbia, Vancouver, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; binary pattern reconstruction; compression;
data; picture processing; projections; subroutines",
oldlabel = "Lau73",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lau73",
}
@Article{Hassitt:1973:IHL,
author = "Anthony Hassitt and J. W. Lageschulte and Leonard E.
Lyon",
title = "Implementation of a High Level Language Machine",
journal = j-CACM,
volume = "16",
number = "4",
pages = "199--212",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:54 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#HassittLL73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Computing machines which directly execute the
statements of a high level language have been proposed
in the past. This report describes the actual
implementation of such a machine: it is a computer
whose ``machine language'' is APL. The machine is fully
operational and correctly executes almost all of the
APL operations on scalars, vectors, and arrays. The
machine automatically allocates memory, executes
statements, calls functions, converts numbers from one
type to another, checks subscripts, and automatically
detects many types of programmer errors.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6140D (High level
languages)",
classification = "723",
corpsource = "IBM Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "APL; computer architecture; computer operating systems
--- Program Compilers; computer programming languages;
computing machines; emulators; high level language;
high level language machine; implementation;
interpreters; microprogramming; procedure oriented
languages",
oldlabel = "HassittLL73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HassittLL73",
xxtitle = "Implementation of High Level Language Machine",
}
@Article{Williams:1973:AMH,
author = "John G. Williams",
title = "Asymmetric Memory Hierarchies",
journal = j-CACM,
volume = "16",
number = "4",
pages = "213--222",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "51 2378",
MRreviewer = "I. Kaufmann",
bibdate = "Mon Jan 22 07:30:08 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Williams73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A study is presented of some of the system
implications of memory hierarchies in which the backing
or secondary store has a very small read time, relative
of both the time required for writing and to the read
time of conventional backing storage devices. Several
analytic models are introduced, and it is shown that
such hierarchies may operate in ways which differ from
those of more conventional hierarchies. In particular,
it is shown that it may not be necessary to
multiprogram in such a situation. \par
In the past, backing storage devices have been roughly
symmetric with respect to their read and write times.
This situation may not continue, as several devices are
currently under development which may have a very small
read-time/write-time ratio. This study places
particular emphasis on one such system-the RCA
read/write holographic optical memory.",
acknowledgement = ack-nhfb,
classcodes = "C5320Z (Other digital storage); C6120 (File
organisation)",
classification = "722; 723; 741",
corpsource = "RCA, Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "asymmetric memory; asymmetric memory hierarchies;
asymmetric memory hierarchy; computer systems
programming --- Multiprogramming; data storage,
optical; demand paging; file organisation; holographic;
holographic optical memory; holography; memory device;
memory hierarchy; optical memory; optical stores;
paging; Performance Evaluation: Analytic; storage
device; storage hierarchy; virtual memory",
oldlabel = "Williams73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Williams73",
}
@Article{Kuki:1973:SSA,
author = "H. Kuki and W. J. Cody",
title = "A Statistical Study of the Accuracy of Floating Point
Number Systems",
journal = j-CACM,
volume = "16",
number = "4",
pages = "223--230",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (65G05)",
MRnumber = "51 2344",
MRreviewer = "I. Kaufmann",
bibdate = "Wed Aug 31 13:47:33 1994",
bibsource = "ftp://ftp.math.utah.edu/pub/tex/bib/cacm1960.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents the statistical results of tests
of the accuracy of certain arithmetic systems in
evaluating sums, products and inner products, and
analytic error estimates for some of the computations.
The arithmetic systems studied are 6-digit hexadecimal
and 22-digit binary floating point number
representations combined with the usual chop and round
modes of arithmetic with various numbers of guard
digits, and with a modified round mode with guard
digits. In a certain sense, arithmetic systems
differing only in their use of binary or hexadecimal
number representations are shown to be approximately
statistically equivalent in accuracy. Further, the
usual round mode with guard digits is shown to be
statistically superior in accuracy to the usual chop
mode in all cases save one. The modified round mode is
found to be superior to the chop mode in all cases.",
acknowledgement = ack-nhfb # " and " # ack-nj,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accuracy; arithmetic; computer programming; digital
arithmetic; error analysis; floating point arithmetic;
floating point number systems; guard digits; number
representation; rounding; statistical study",
oldlabel = "KukiC73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KukiC73",
}
@Article{Burkhard:1973:SAB,
author = "Walter A. Burkhard and Robert M. Keller",
title = "Some Approaches to Best-Match File Searching",
journal = j-CACM,
volume = "16",
number = "4",
pages = "230--236",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:51 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/pre75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BurkhardK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem of searching the set of keys in a file to
find a key which is closest to a given query key is
discussed. After ``closest'', in terms of a metric on
the key space, is suitably defined, three file
structures are presented together with their
corresponding search algorithms, which are intended to
reduce the number of comparisons required to achieve
the desired result. These methods are derived using
certain inequalities satisfied by metrics and by
graph-theoretic concepts. Some empirical results are
presented which compare the efficiency of the
methods.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "Univ. California, San Diego, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "best match; data processing; file organisation; file
searching; file structuring; heuristics; information
retrieval systems",
oldlabel = "BurkhardK73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BurkhardK73",
}
@Article{Strong:1973:RCT,
author = "James P. {Strong, III} and Azriel Rosenfeld",
title = "A Region Coloring Technique for Scene Analysis",
journal = j-CACM,
volume = "16",
number = "4",
pages = "237--246",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:47 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#StrongR73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method of converting a picture into a ``cartoon'' or
``map'' whose regions correspond to differently
textured regions is described. Texture edges in the
picture are detected, and solid regions surrounded by
these (usually broken) edges are ``colored in'' using a
propagation process. The resulting map is cleaned by
comparing the region colors with the textures of the
corresponding regions in the picture, and also by
merging some regions with others according to criteria
based on topology and size. The method has been applied
to the construction of could cover maps from cloud
cover pictures obtained by satellites.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays)",
classification = "405; 723; 741",
corpsource = "NASA, Greenbelt, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer graphics; data processing --- Natural
Sciences Applications; edge detection; maps and
mapping; pattern recognition systems; picture; picture
processing; processing; region colouring technique;
scene analysis",
oldlabel = "StrongR73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/StrongR73",
}
@Article{Rodriguez-Rosell:1973:DIE,
author = "Juan Rodriguez-Rosell and Jean-Pierre Dupuy",
title = "The design, implementation, and evaluation of a
working set dispatcher",
journal = j-CACM,
volume = "16",
number = "4",
pages = "247--253",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:48 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Rodriguez-RosellD73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The behavior of a computer system is largely dependent
upon the algorithm employed to allocate the system
resources to the processes competing for them. Recent
research in time-sharing paging systems has developed
the working set model for program behavior, and a
resource allocation strategy based on this model has
been proposed. Two implementations along these
principles have been reported, but it seems that in
neither case have further results been announced. This
report discusses the design and implementation of a
dispatcher based on the working set principle, presents
data to permit analysis of its behavior, and indicates
future directions of research on methods of controlling
a computer system.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Royal Inst. Technol., Stockholm, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems, digital; computers --- Operating
Procedures; design; evaluation; implementation;
operating systems; resource allocation; scheduler;
software evaluation; supervisory and executive
programs; supervisory systems; time sharing;
time-sharing systems; working set; working set
dispatcher",
oldlabel = "Rodriguez-RosellD73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rodriguez-RosellD73",
}
@Article{Broucke:1973:AAT,
author = "R. Broucke",
title = "{ACM Algorithm 446}: Ten Subroutines for the
Manipulation of {Chebyshev} Series [{C1}]",
journal = j-CACM,
volume = "16",
number = "4",
pages = "254--256",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Broucke73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark and certification
\cite{Piessens:1975:RCA}.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximations; Chebyshev approximation; Chebyshev
series; curve fitting; Manipulation; negative powers;
series (mathematics); subroutines",
oldlabel = "Broucke73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Broucke73",
}
@Article{Ragland:1973:CAG,
author = "Larry C. Ragland and Donald I. Good",
title = "Certification of ``{Algorithm 386}: Greatest Common
Divisor of $n$ Integers and Multipliers''",
journal = j-CACM,
volume = "16",
number = "4",
pages = "257--257",
month = apr,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#RaglandG73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Bradley:1970:AAG}.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Euclidean algorithm; greatest common divisor;
inductive assertion method; integers; multipliers;
number theory; proof of algorithms",
oldlabel = "RaglandG73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RaglandG73",
}
@Article{Pager:1973:PCC,
author = "David Pager",
title = "On the Problem of Communicating Complex Information",
journal = j-CACM,
volume = "16",
number = "5",
pages = "275--281",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:04 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Pager73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The nature of the difficulty involved in communicating
mathematical results between scientists using a
computer based information retrieval system is
examined. The problem is analyzed in terms of
psychological and information-processing processes, and
what turns out to be a vicious circle of effects is
described. The paper then considers how the
presentation of information by a computer-based
information retrieval system, or by other media, can be
improved. Some trade-offs which affect the design of
the presentation are mentioned, and a number of ideas
for improvement are described. These include ways of
augmenting written language by various notational and
linguistic devices, the exhibition of the structure
inherent in the information the authors are
communicating, and a sophisticated interactive system
controlled by computer.",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
classification = "723; 901",
corpsource = "Univ. Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "communication; complex information; computer based
information retrieval; computers --- Data Communication
Systems; information; information retrieval systems;
information science --- Information Retrieval;
interactive system; language; mathematics; proof;
psychology; system",
oldlabel = "Pager73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pager73",
}
@Article{Low:1973:PQE,
author = "David W. Low",
title = "Programming by Questionnaire: an Effective Way to Use
Decision Tables",
journal = j-CACM,
volume = "16",
number = "5",
pages = "282--286",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:47 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Low73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Programming by questionnaire combines aspects of
decision table programming and general purpose
programming by using decision tables to construct an
application program through the selection of certain
source statements from a predefined file. It is
proposed that programming by questionnaire is a useful
compromise between general and special purpose
programming for a significant class of large scale
problems. The elements of the approach are discussed
and an existing application is described.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "IBM Corp., Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic program; automatic program generation;
computer systems programming; decision tables;
generation; productivity; programmer; programming;
questionnaire; simulator generation",
oldlabel = "Low73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Low73",
}
@Article{King:1973:SCU,
author = "Peter J. H. King and Roger G. Johnson",
title = "Some Comments on the Use of Ambiguous Decision Tables
and Their Conversion to Computer Programs",
journal = j-CACM,
volume = "16",
number = "5",
pages = "287--290",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:52 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#KingJ73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper comments upon recently published work on
decision table translation using methods similar to
rule-mask technique. The applicability of these methods
under various possible conventions on overall table
meaning is discussed, and it is argued that there is a
place both for the multi-rule and the single-rule (or
action set) convention in decision table usage.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Birbeck Coll., Univ. London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programs; computer systems programming;
conversion; decision tables",
oldlabel = "KingJ73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KingJ73",
}
@Article{Salasin:1973:HSI,
author = "John Salasin",
title = "Hierarchical Storage in Information Retrieval",
journal = j-CACM,
volume = "16",
number = "5",
pages = "291--295",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Salasin73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A probabilistic analysis is employed to determine the
effect of hierarchical storage organizations on
information retrieval operations. The data storage
hardware is assumed to consist of n-levels of linearly
connected memory hardware with increasing data access
times and increasing data storage capabilities. A
system might, for example, consist of fast
semiconductor memory, computer core memory, extended
core storage, disk memory, and data cells. Equations
are derived to predict the effect of such a system on
data access times using sequential files, random access
files, and structured files employing
multiple-hierarchical linked lists.",
acknowledgement = ack-nhfb,
annote = "Simple evaluation of record fetch costs using various
accessing sequences.",
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 901",
corpsource = "Univ. Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis; analytic; computer operating systems ---
Storage Allocation; data access times; file
organisation; files; hierarchical storage; information
retrieval; information retrieval systems; linked lists;
memory hierarchy; performance evaluation;
probabilistic; random access; sequential files;
structured files",
oldlabel = "Salasin73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Salasin73",
}
@Article{Corneil:1973:MEN,
author = "Derek G. Corneil and C. C. Gotlieb and Y. M. Lee",
title = "Minimal Event-Node Network of Project Precedence
Relations",
journal = j-CACM,
volume = "16",
number = "5",
pages = "296--298",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#CorneilGL73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A procedure for constructing a minimal event-node
network to represent a set of precedence relations
without parallel activities is presented. A minimal
even-node network is an event-node network in which
both the number of nodes and the number of arcs are the
minima to preserve the given precedence relations.
Counterexamples are given to show that the algorithm
presented by A. C. Fisher, J. S. Liebman, and G. L.
Nemhauser (1968) produces event-node networks which are
not minimal. Since our procedure includes the
set-covering problem, the time required may grow
exponentially with the number of given activities.",
acknowledgement = ack-nhfb,
classcodes = "C7100 (Business and administration)",
classification = "912",
corpsource = "Univ. Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "event node network; event-node network; management
science; management sciences; minimal; minimal
event-node network; network analysis; operations
research; project precedence relations",
oldlabel = "CorneilGL73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CorneilGL73",
}
@Article{Mercer:1973:AGP,
author = "Andrew Mercer and Azriel Rosenfeld",
title = "An Array Grammar Programming System",
journal = j-CACM,
volume = "16",
number = "5",
pages = "299--305",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MercerR73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A package of Fortran programs has been developed that
permits a user to interactively design and test array
grammars. The user can control the rule selection
procedure in a derivation or parse, using weighted
programming matrices; he also has a choice of instance
selection schemes (raster, random, parallel). Examples
are given involving array languages consisting of
simple geometrical patterns, as well as a language of
``neuron pictures.''",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C7430 (Computer engineering)",
classification = "721; 723",
corpsource = "Kappa Systems Inc., Arlington, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "array grammar; array grammars; automata theory ---
Grammars; automatic testing; CAD; computer graphics;
computer programming languages; computer-aided design;
Fortran programs; grammars; interactively; picture
grammars; programming system; test",
oldlabel = "MercerR73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MercerR73",
}
@Article{Reingold:1973:NLM,
author = "Edward M. Reingold",
title = "A Nonrecursive List Moving Algorithm",
journal = j-CACM,
volume = "16",
number = "5",
pages = "305--307",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:25 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Reingold73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient, nonrecursive algorithm is given for
moving any LIST-type list. In particular, the algorithm
requires no storage other than the new nodes into which
the list is to be moved, and no additional bits per
node for marking; the algorithm runs in time
proportional to the number of nodes in the list. The
original list structure is destroyed as it is moved.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; computer
programming languages; computer programming languages
--- lisp; garbage collection; LISP; list moving; list
processing; nonrecursive algorithm; storage
management",
oldlabel = "Reingold73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Reingold73",
}
@Article{Vos:1973:RAC,
author = "H. Vos",
title = "Remark on ``{Algorithm 300}: {Coulomb} Wave
Functions''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "308--309",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Vos73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gunn:1967:AAC}.",
acknowledgement = ack-nhfb,
classcodes = "B0290D (Functional analysis); C4120 (Functional
analysis); C7310 (Mathematics computing)",
corpsource = "Vrije Univ., Amsterdam, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Coulomb wave functions; function evaluation;
mathematics; wave functions",
oldlabel = "Vos73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Vos73",
}
@Article{Bayer:1973:M,
author = "G. Bayer",
title = "Maxflow",
journal = j-CACM,
volume = "16",
number = "5",
pages = "309--309",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7300 (Natural sciences computing)",
corpsource = "Tech. Univ., Braunschweig, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arcs; flows; input parameters; maxflow; network;
network analysis",
treatment = "T Theoretical or Mathematical",
}
@Article{Bayer:1973:RAM,
author = "G. Bayer",
title = "Remark on ``{Algorithm 324}: Maxflow''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "309--??",
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:01 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bayer73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Bayer:1968:AAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Bayer73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bayer73",
}
@Article{Holmgren:1973:RAM,
author = "B. Holmgren and D. Obradovi{\'c} and {\AA}. Kolm",
title = "Remark on ``{Algorithm 333}: Minit Algorithm for
Linear Programming''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "310--310",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#HolmgrenOK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Salazar:1968:AAM,Obradovic:1973:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "ASEA, Vasteras, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "linear programming; minit algorithm",
oldlabel = "HolmgrenOK73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HolmgrenOK73",
xxauthor = "B. Holmgren and {\AA}. Kolm and D. Obradovi{\'c}",
}
@Article{Obradovic:1973:RAM,
author = "D. Obradovi{\'c}",
title = "Remark on ``{Algorithm 333}: Minit Algorithm for
Linear Programming''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "310--310",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Obradovic73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Salazar:1968:AAM,Holmgren:1973:RAM}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Boris Kidric Inst. Nuclear Sci., Beograd, Yugoslavia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "linear programming; mini algorithm",
oldlabel = "Obradovic73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Obradovic73",
}
@Article{Howell:1973:RAE,
author = "Jo Ann Howell",
title = "Remark on ``{Algorithm 406}: Exact Solution of Linear
Equations Using Residue Arithmetic''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "311--311",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Howell73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Howell:1971:AAE}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C5230
(Digital arithmetic methods); C7310 (Mathematics
computing)",
corpsource = "Yale Univ., New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital arithmetic; exact solution; inversion; linear
algebra; linear equations; matrix; mixed radix
conversion; modulus; prime number; residue arithmetic",
oldlabel = "Howell73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Howell73",
}
@Article{Sale:1973:SMP,
author = "Arthur H. J. Sale",
title = "Remark on ``{Algorithm 408}: {A} Sparse Matrix
Package''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "311--311",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Sale73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McNamee:1971:AAS,Lawrence:1973:RAS}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Univ. Sydney, NSW, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; matrix algebra; sparse matrix package",
oldlabel = "Sale73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sale73",
}
@Article{Wheeler:1973:IEQ,
author = "Robert E. Wheeler",
title = "Remark on ``{Algorithm 402}: Increasing the Efficiency
of {Quicksort}''",
journal = j-CACM,
volume = "16",
number = "5",
pages = "311--311",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:24 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Wheeler73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{vanEmden:1970:AAI}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "E. I. du Pont Nemours and Co., Wilmington, DE, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "efficiency; quicksort; sorting",
oldlabel = "Wheeler73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wheeler73",
}
@Article{Roy:1973:RPR,
author = "M. K. Roy",
title = "Reflection-free permutations, rosary permutations and
adjacent transposition algorithms",
journal = j-CACM,
volume = "16",
number = "5",
pages = "312--312",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics)",
corpsource = "Jadavpur Univ., Calcutta, India",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "adjacent transposition algorithms; combinatorial
analysis; combinatorial mathematics; permutation;
reflection free; rosary",
treatment = "T Theoretical or Mathematical",
}
@Article{Roy:1973:RFP,
author = "Mohit Kumar Roy",
title = "Reflection-Free Permutations, Rosary Permutations, and
Adjacent Transposition Algorithms",
journal = j-CACM,
volume = "16",
number = "5",
pages = "312--313",
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Roy73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Roy73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Roy73",
}
@Article{McMorrow:1973:CMC,
author = "Clyde H. McMorrow",
title = "Concerning music and computer composition in
computational linguistics",
journal = j-CACM,
volume = "16",
number = "5",
pages = "313--313",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#McMorrow73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Eagle Signal Corp., Davenport, IA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computational linguistics; computer composition;
humanities; music",
oldlabel = "McMorrow73",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McMorrow73",
}
@Article{Wexelblat:1973:ACC,
author = "Richard L. Wexelblat",
title = "Another Comment on Computer Music",
journal = j-CACM,
volume = "16",
number = "5",
pages = "313--314",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Wexelblat73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7820 (Humanities computing)",
corpsource = "Bell Labs., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "composer; computer music; humanities; musical taste;
value judgment",
oldlabel = "Wexelblat73",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wexelblat73",
}
@Article{Estell:1973:CPA,
author = "Robert G. Estell",
title = "A comment on the practical aspects of computer science
education",
journal = j-CACM,
volume = "16",
number = "5",
pages = "314--315",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Estell73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science education; curriculum; digital
computers; education",
oldlabel = "Estell73",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Estell73",
}
@Article{Fajman:1973:WIT,
author = "Roger Fajman and John Borgelt",
title = "{WYLBUR}, An Interactive Text Editing and Remote Job
Entry System",
journal = j-CACM,
volume = "16",
number = "5",
pages = "314--322",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:31 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#FajmanB73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "WYLBUR is a comprehensive system for manipulating all
kinds of text, such as computer programs, letters, and
manuscripts, using typewriter terminals connected to a
computer. It has facilities for remote job entry and
retrieval as well as facilities for text alignment and
justification. A powerful method for addressing text by
content is provided. This paper describes the external
appearance of WYLBUR as well as its internal structure.
A short description of the major features of ORVYL, a
general purpose time-sharing system which operates in
conjunction with WYLBUR, is also included.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "723",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "addressing; computer systems programming; content;
content addressing; data entry; data handling; data
processing; document preparation; interactive text
editing; ORVYL; remote; remote job entry; remote job
retrieval; terminal; text editing",
oldlabel = "FajmanB73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FajmanB73",
}
@Article{Frailey:1973:PAM,
author = "Dennis J. Frailey",
title = "A Practical Approach to Managing Resources and
Avoiding Deadlocks",
journal = j-CACM,
volume = "16",
number = "5",
pages = "323--329",
month = may,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:13 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Frailey73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Resource scheduling and allocation can be expensive
with regard to time and space in multiprogramming or
time-sharing environments involving large numbers of
tasks and resources with conflicting requirements.
\par
Detection and\slash or prevention of deadlocks can
require massive amounts of additional overhead if
efficient usage of resources is to be maintained. A
resource management program is described which uses
linked lists along with other techniques to overcome a
large portion of this overhead. The program, which is
currently running as part of a large scale general
purpose operating system, keeps resources relatively
active but does not detect or prevent all deadlocks in
its implemented state. Certain changes, which would
permit more comprehensive levels of deadlock
prevention\slash detection at additional cost, have not
been incorporated in the running system due to the
infrequency of deadlock situations.",
acknowledgement = ack-nhfb,
annote = "Description of a limited implementation and good
overview.",
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Southern Methodist Univ., Dallas, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(computers); allocation; computer systems programming;
deadlock; deadly embrace; file organisation;
multiprocessing; multiprogramming; operating systems;
resource; resource allocation; resource management;
resource scheduling; scheduling; storage allocation;
time sharing; time-sharing; time-sharing programs",
oldlabel = "Frailey73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Frailey73",
}
@Article{Hamlet:1973:EMR,
author = "Richard G. Hamlet",
title = "Efficient multiprogramming resource allocation and
accounting",
journal = j-CACM,
volume = "16",
number = "6",
pages = "337--342",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hamlet73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
corpsource = "Univ. Maryland, Baltimore, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accounting; efficient; executive; memory; monitor;
multiprogramming; resource allocation; storage
allocation",
oldlabel = "Hamlet73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hamlet73",
xxpages = "337--343",
}
@Article{Gelenbe:1973:MWS,
author = "Erol Gelenbe and J. C. A. Boekhorst and J. L. W.
Kessels",
title = "Minimizing Wasted Space in Partitioned Segmentation",
journal = j-CACM,
volume = "16",
number = "6",
pages = "343--349",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Gelenbe73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; dynamic storage allocation; file
organisation; fragmentation; multiple; page sizes;
paged virtual memory; partitioned segmentation; storage
allocation; storage management; system; wasted space",
oldlabel = "Gelenbe73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gelenbe73",
xxauthor = "Erol Gelenbe",
xxauthor = "E. Gelenbe and J. C. A. Boekhorst and J. L. W.
Kessels",
}
@Article{Hill:1973:SPM,
author = "J. Carver Hill",
title = "Synchronizing processors with memory-content-generated
interrupts",
journal = j-CACM,
volume = "16",
number = "6",
pages = "350--351",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hill73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Univ. California, Livermore, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "associative memories; debugging; interrupts;
microprogramming; monitors; multiprocessing programs;
multiprocessor; parallel processing; supervisors;
synchronisation; synchronizing processors",
oldlabel = "Hill73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hill73",
}
@Article{Stone:1973:NOS,
author = "Harold S. Stone and Samuel H. Fuller",
title = "On the Near-Optimality of the
Shortest-Latency-Time-First Drum Scheduling
Discipline",
journal = j-CACM,
volume = "16",
number = "6",
pages = "352--353",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:34 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#StoneF73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: Technical Note No.12, DSL.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer systems; drum scheduling discipline; file
organisation; latency scheduling; minimal; shortest
latency time first; storage allocation; storage
management",
oldlabel = "StoneF73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/StoneF73",
}
@Article{Stockhausen:1973:AOC,
author = "Peter F. Stockhausen",
title = "Adapting optimal code generation for arithmetic
expressions to the instruction sets available on
present-day computers",
journal = j-CACM,
volume = "16",
number = "6",
pages = "353--354",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Stockhausen73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Bell Labs., Murray Hill., NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arithmetic expressions; codes; digital arithmetic;
instruction; optimal code generation; sets",
oldlabel = "Stockhausen73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Stockhausen73",
}
@Article{Ling:1973:CGA,
author = "Robert F. Ling",
title = "A Computer Generated Aid for Cluster Analysis",
journal = j-CACM,
volume = "16",
number = "6",
pages = "355--361",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Ling73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5530 (Pattern recognition and computer vision
equipment); C5540 (Terminals and graphic displays)",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "cluster analysis; computer aided analysis; computer
graphics; factor analysis; hierarchical clustering;
numerical taxonomy; pattern; recognition",
oldlabel = "Ling73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ling73",
}
@Article{Shneiderman:1973:ODB,
author = "Ben Shneiderman",
title = "Optimum Data Base Reorganization Points",
journal = j-CACM,
volume = "16",
number = "6",
pages = "362--365",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:10 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Shneiderman73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Shneiderman73.html",
acknowledgement = ack-nhfb,
annote = "Criteria for file reorganization",
cdrom = "CACMs1/CACM16/P362.pdf",
classcodes = "C6120 (File organisation)",
corpsource = "State Univ. New York, Stony Brook, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "cost per access; data base; file organisation; files;
information retrieval; optimum; reorganization;
strategies",
oldlabel = "Shneiderman73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shneiderman73",
}
@Article{Strunz:1973:DDT,
author = "Horst Strunz",
title = "The development of decision tables via parsing of
complex decision situations",
journal = j-CACM,
volume = "16",
number = "6",
pages = "366--369",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Strunz73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Mathematischer Beratungs- and Programmierungsdienst
GmbH, Cologne, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "decision grid chart; decision tables; development;
parsing; problem analysis",
oldlabel = "Strunz73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Strunz73",
}
@Article{Bell:1973:TC,
author = "James R. Bell",
title = "Threaded Code",
journal = j-CACM,
volume = "16",
number = "6",
pages = "370--372",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:22 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bell73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The concept of ``threaded code'' is presented as an
alternative to machine language code. Hardware and
software realizations of it are given. In software it
is realized as interpretive code not needing an
interpreter. Extensions and optimizations are
mentioned.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6110 (Systems analysis
and programming); C6140B (Machine-oriented languages)",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "code; compiled code; hardware; interpreter; machine;
machine code; machine oriented languages;
microprogramming; programming; software; space
tradeoff; subroutine calls; threaded code; time
tradeoff",
oldlabel = "Bell73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bell73",
}
@Article{Hopcroft:1973:AAE,
author = "John E. Hopcroft and Robert Endre Tarjan",
title = "{ACM Algorithm 447}: Efficient Algorithms for Graph
Manipulation [{H}]",
journal = j-CACM,
volume = "16",
number = "6",
pages = "372--378",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:48 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#HopcroftT73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; algorithms; graph manipulation; graph theory;
mathematics; partitioning; subroutines",
oldlabel = "HopcroftT73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HopcroftT73",
}
@Article{Beyer:1973:AAN,
author = "Terry Beyer and D. F. Swinehart",
title = "{ACM Algorithm 448}: Number of Multiply-Restricted
Partitions [{A1}]",
journal = j-CACM,
volume = "16",
number = "6",
pages = "379--379",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BeyerS73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Oregon, Eugene, OR, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "change making; digital arithmetic; enumeration;
FORTRAN; multiply restricted partitions; positive
integer; subroutine; subroutines",
oldlabel = "BeyerS73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BeyerS73",
}
@Article{Ferguson:1973:LSP,
author = "J. Ferguson and P. A. Staley",
title = "Least Squares Piecewise Cubic Curve Fitting",
journal = j-CACM,
volume = "16",
number = "6",
pages = "380--382",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D10",
MRnumber = "50 15267",
MRreviewer = "Bernard H. Rosman",
bibdate = "Mon Jan 22 06:39:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#FergusonS73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The matrices involved in a linear least squares
formulation are determined for the problem of fitting
piecewise cubic functions, those possessing a
continuous derivative, to arrays of planar data.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
corpsource = "Teledyne Ryan Aeronaut. Co., San Diego, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation splines; curve fitting; data; data
reduction; data reduction and analysis; function
approximation; least; least squares; piecewise cubic;
reduction; squares approximations",
oldlabel = "FergusonS73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FergusonS73",
}
@Article{Hoskins:1973:CSS,
author = "W. D. Hoskins",
title = "Cubic spline solutions to fourth-order boundary value
problems",
journal = j-CACM,
volume = "16",
number = "6",
pages = "382--385",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65L10",
MRnumber = "58 31861",
bibdate = "Mon Jan 22 06:50:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hoskins73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The cubic spline approximation to the fourth-order
differential equation $y''''+p(x)y''+q(x)y'+r(x)y=t(x)$
is shown to reduce to the solution of a five-term
recurrence relationship. For some special cases the
approximation is shown to be simply related to a finite
difference representation with a local truncation error
of order $(y/720)\delta^8$.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
B0290P (Differential equations); C4130 (Interpolation
and function approximation); C4170 (Differential
equations)",
corpsource = "Univ. Manitoba, Winnipeg, Man., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(mathematics); boundary value problem; boundary value
problems; boundary-value problems; cubic spline;
differential; differential equations; equations; fourth
order; splines",
oldlabel = "Hoskins73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hoskins73",
}
@Article{Alt:1973:CPT,
author = "Franz L. Alt and Judith Yuni Kirk",
title = "Computer Photocomposition of Technical Text",
journal = j-CACM,
volume = "16",
number = "6",
pages = "386--391",
month = jun,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:12 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#AltK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Describes the typesetting system used by the American
Institute of Physics.",
abstract = "In computer assisted typesetting by means of
photocomposition, special problems arise in highly
technical material such as mathematical formulas. New
solutions to several of these problems have been
devised in the information system of the American
Institute of Physics. They include: the representation
of special characters (foreign alphabets, mathematical
symbols, etc.) not available on input keyboards or on
the photocomposer; the generation of such symbols, e.g.
by overprinting; the precise positioning of accent
marks (floating diacritics); line breaks, i.e. words or
formulas placed partly at the end of one line and
partly at the beginning of the next; and certain
aspects of error correction.",
acknowledgement = ack-nhfb,
classcodes = "C7230 (Publishing and reproduction)",
corpsource = "American Inst. Phys., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer; computer controlled typesetting; graphics;
photocomposition; printing; technical text; text
processing; typesetting",
oldlabel = "AltK73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AltK73",
}
@Article{Nolan:1973:MCR,
author = "Richard L. Nolan",
title = "Managing the Computer Resource: {A} Stage Hypothesis",
journal = j-CACM,
volume = "16",
number = "7",
pages = "399--405",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:44 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Nolan73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Based on the study of expenditures for data
processing, a descriptive stage hypothesis is
presented. It is suggested that the planning,
organizing, and controlling activities associated with
managing the computer resource will change in character
over a period of time, and will evolve in patterns
roughly correlated to four stages of the computer
budget: Stage I (computer acquisition), Stage II
(intense system development), Stage III (proliferation
of controls), and Stage IV (user\slash service
orientation). Each stage is described and related to
individual tasks for managing the computer resource.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
classification = "723",
corpsource = "Harvard Univ. Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer; computer budget; computer expenditures;
computer management; computer resource; control; data
processing; data processing, business; economics;
management; organizing; planning; resource; stage
hypothesis",
oldlabel = "Nolan73",
treatment = "E Economic",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nolan73",
}
@Article{Huang:1973:NIO,
author = "J. C. Huang",
title = "A Note on Information Organization and Storage",
journal = j-CACM,
volume = "16",
number = "7",
pages = "406--410",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 13900",
bibdate = "Mon Jan 22 06:51:15 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Huang73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Since the logical structure of a data base can be
represented by a tree or graph, it is quite natural for
us to view the process of designing a data base as that
of constructing a tree or a graph. \par
A general method for constructing such a tree or a
graph is provided. There are three important elements
in this general construction method; namely, a set of
binary relations, an algorithm for constructing subsets
of a set, and an algorithm for selecting an element
from the given set of objects. The use of different
relations and algorithms results in different
information structures, as list, tree, ring, etc. Thus
the problem of information organization and storage is
reduced to that of defining relations and formulating
algorithms under a given set of constraints. \par
The results presented may be valuable to designers as
useful design concepts, and may serve as a basis for
developing a formal theory on the subject.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901; 921",
corpsource = "Univ. Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(mathematical); data base; data-base management; file
organisation; file organization; graph; graph theory;
information; information retrieval; information
retrieval systems; information structure; management;
mathematical techniques --- Graph Theory; storage
allocation; structure; tree; trees",
oldlabel = "Huang73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Huang73",
}
@Article{Kozdrowicki:1973:CIC,
author = "Edward W. Kozdrowicki and Dennis W. Cooper",
title = "{COKO III}: the {Cooper-Koz} Chess Program",
journal = j-CACM,
volume = "16",
number = "7",
pages = "411--427",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#KozdrowickiC73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "COKO III is a chess player written entirely in
Fortran. On the IBM 360-65, COKO III plays a minimal
chess game at the rate of. 2 sec cpu time per move,
with a level close to lower chess club play. A
selective tree searching procedure controlled by
tactical chess logistics allows a deployment of
multiple minimal game calculations to achieve some
optimal move selection. In addition, an interesting
phenomenon called a tree searching catastrophe has
plagued COKO's entire development just as it troubles a
human player. Standard exponential growth is curbed to
a large extent by the definition and trimming of the
Fischer set. Representation of the chess environment is
described along with a strategic preanalysis procedure
that maps the Lasker regions. Specific chess algorithms
are described which could be used as a command
structure by anyone desiring to do some chess program
experimentation. A comparison is made of some
mysterious actions of human players and COKO III.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7810 (Social and
behavioural sciences computing)",
classification = "723",
corpsource = "Univ. California, Davis, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; chess program; COKO III;
computer systems programming; FORTRAN; games of skill;
heuristic programming; minimal chess game; selective
searching; tree searching",
oldlabel = "KozdrowickiC73",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KozdrowickiC73",
}
@Article{Howard:1973:MSD,
author = "John H. {Howard, Jr.}",
title = "Mixed Solutions for the Deadlock Problem",
journal = j-CACM,
volume = "16",
number = "7",
pages = "427--430",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Howard73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Mixtures of detection, avoidance, and prevention
provide more effective and practical solutions to the
deadlock problem than any one of these alone. The
individual techniques can be tailored for subproblems
of resource allocation and still operate together to
prevent deadlocks. This paper presents a method, based
on the concept of the hierarchical operating system,
for constructing appropriate mixtures and suggests
appropriate subsystems for the most frequently
occurring resource allocation problems.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer systems
programming --- Multiprogramming; deadlock problem;
deadlocks; hierarchical systems; mixed solutions;
multiprogramming; operating systems; operating systems
(computers); resource allocation",
oldlabel = "Howard73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Howard73",
}
@Article{Gelenbe:1973:DPP,
author = "Erol Gelenbe",
title = "Distribution of a Program in Primary and Fast Buffer
Storage",
journal = j-CACM,
volume = "16",
number = "7",
pages = "431--434",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Gelenbe73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A virtual memory computer system with a fast buffer
(cache) memory between primary memory and central
processing unit is considered. The optimal distribution
of a program between the buffer and primary memory is
studied using the program's lifetime function.
Expressions for the distribution of a program which
maximizes the useful fraction of the cost-time integral
of primary and fast buffer storage are obtained for
swapping and nonswapping buffer management policies.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cache; computer systems programming; cost time
integral; distribution of a program; fast buffer;
function; lifetime; lifetime function; storage; virtual
memory; virtual memory computer system; virtual
storage",
oldlabel = "Gelenbe73a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gelenbe73a",
}
@Article{Rosin:1973:TAP,
author = "Robert F. Rosin",
title = "Teaching ``About Programming''",
journal = j-CACM,
volume = "16",
number = "7",
pages = "435--438",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:14 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Rosin73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents the goals and organization of a
course about programming designed to provide entering
students in a graduate program with a cultural
enrichment in their professional lives. The students
are expected to have taken at least two programming
courses prior to this one and, therefore, to be
familiar with at least two programming languages, both
as students and users. Teaching someone how to program
is similar to teaching him to play a musical
instrument: neither skill can be taught-they must be
learned. However, the teacher still serves several
vital purposes: to present a set of rules for producing
well-formed utterances; to offer numerous
demonstrations of his own skill; and to function as an
involved critic. Finally, the teacher is the source of
information about the process in which the student is
involved.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming)",
classification = "723",
corpsource = "Univ. Aarhus, Denmark",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; education;
professionalism; programming; programming concepts;
teaching",
oldlabel = "Rosin73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rosin73",
xxpages = "435--439",
}
@Article{McFarlan:1973:CRG,
author = "F. Warren McFarlan and Richard L. Nolan",
title = "Curriculum Recommendations for Graduate Professional
Programs in Information Systems: Recommended Addendum
on Information Systems Administration",
journal = j-CACM,
volume = "16",
number = "7",
pages = "439--441",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:49 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#McFarlanN73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An addendum to the Report of the ACM Curriculum
Committee on Computer Education for Management is
proposed. The proposed addendum is to include in the
curriculum a course on Information Systems
administration. It is important for two reasons: (1)
the systems designer must understand the administrative
framework in which he must operate to work effectively,
and (2) an important objective of the curriculum
recommendations is to prepare the future manager of the
computer activity. \par
It is felt that the importance of these two reasons
justifies the addition of the recommended course.
\par
The course is outlined in the format of the original
report.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C0310 (EDP
management); C7100 (Business and administration)",
classification = "723; 901",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administration; computer management; curriculum
recommendations; education; information retrieval
systems; information systems; information systems
administration; information systems management;
management; management information systems",
oldlabel = "McFarlanN73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McFarlanN73",
xxpages = "439--442",
}
@Article{Kandel:1973:CSS,
author = "Abraham Kandel",
title = "Computer Science --- Seminars for Undergraduates",
journal = j-CACM,
volume = "16",
number = "7",
pages = "442--442",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Kandel73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "New Mexico Inst. Mining Technol., Soccorro., NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; curriculum; digital computers;
education; fuzzy educational structure; imprecise
synthesis; seminars; undergraduates",
oldlabel = "Kandel73",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kandel73",
}
@Article{vonBochmann:1973:MEL,
author = "Gregor von Bochmann",
title = "Multiple Exits from a Loop Without the {GOTO}",
journal = j-CACM,
volume = "16",
number = "7",
pages = "443--444",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bochmann73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages)",
corpsource = "Univ. Montreal, Que., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "control structures; exit statement; from loops; goto
free programming; multiple exits; multiple exits from
loops; programming languages",
oldlabel = "Bochmann73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bochmann73",
}
@Article{Hall:1973:EBA,
author = "Patrick A. V. Hall",
title = "Equivalence Between {AND\slash OR} Graphs and
Context-Free Grammars",
journal = j-CACM,
volume = "16",
number = "7",
pages = "444--445",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hall73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C4210 (Formal
logic)",
corpsource = "City Univ., London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "AND/OR graphs; artificial intelligence; context free
grammars; context-free grammars; equivalance; graph
theory; language theory",
oldlabel = "Hall73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hall73",
}
@Article{Fiala:1973:AAS,
author = "Frantisek Fiala",
title = "{ACM Algorithm 449}: Solution of Linear Programming
Problems in $0$-$1$ Variables [{H1}]",
journal = j-CACM,
volume = "16",
number = "7",
pages = "445--447",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:27 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Fiala73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Univ. Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN; linear programming; subroutine; subroutines;
zero one programming",
oldlabel = "Fiala73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fiala73",
}
@Article{Kernighan:1973:RAM,
author = "Brian W. Kernighan",
title = "Remark on ``{Algorithm 422: Minimal Spanning Tree}''",
journal = j-CACM,
volume = "16",
number = "7",
pages = "448--448",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Kernighan73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Whitney:1972:AAM}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Bell Telephone Labs. Inc., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "minimal spanning tree; Prim algorithm; spanning tree;
subroutine; trees (mathematical)",
oldlabel = "Kernighan73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kernighan73",
}
@Article{Macleod:1973:RAH,
author = "I. D. G. Macleod and A. M. Collins",
title = "Remark on ``{Algorithm 420}: Hidden-Line Plotting
Program''",
journal = j-CACM,
volume = "16",
number = "7",
pages = "448--448",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MacleodC73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark
\cite{Williamson:1972:AAH,Ellis:1974:RAHb,Gaither:1974:RAH,Williamson:1973:RAH,Ellis:1974:RAHa}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Australian Nat. Univ., Canberra, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer graphics; data handling; hidden line; surface
plot",
oldlabel = "MacleodC73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MacleodC73",
}
@Article{Nikolai:1973:CAD,
author = "Paul J. Nikolai",
title = "Certification of ``{Algorithm 407}: {DIFSUB} for
Solution of Ordinary Differential Equations''",
journal = j-CACM,
volume = "16",
number = "7",
pages = "448--448",
month = jul,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Nikolai73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gear:1971:AAD}.",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations); C7310 (Mathematics computing)",
corpsource = "Wright-Patterson Air Force Base, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "boundary value; certification; differential equations;
DIFSUB; ordinary differential equations; problems",
oldlabel = "Nikolai73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nikolai73",
}
@Article{Smith:1973:LPW,
author = "Michael H. Smith",
title = "A Learning Program Which Plays Partnership Dominoes",
journal = j-CACM,
volume = "16",
number = "8",
pages = "462--467",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Smith73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A learning program has been written in BASIC to play
four-player partnership dominoes. Because dominoes is a
game of incomplete information, the program uses
somewhat different principles of artificial
intelligence from those used in programs for games of
complete information, such as checkers, chess, and go.
The program was constructed to use a ``strategy
signature table'' which classifies board situations
through the interactions of game parameters. Each entry
in the table contains adaptively determined weights
indicating the advisability of various strategies. Once
chosen, a strategy then employs probability analysis
and linear polynomial evaluation to choose a move. Our
program wins approximately two-thirds of its games in
tournament situations, and has defeated championship
players.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7890 (Other special
applications of computing)",
classification = "461; 912",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; BASIC; game playing; games of
skill; heuristic; intelligence; learning program;
learning: heuristic procedures; partnership dominoes;
problem; programming; solving; systems science and
cybernetics",
oldlabel = "Smith73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smith73",
}
@Article{MacLennan:1973:FAB,
author = "B. J. MacLennan",
title = "{Fen} --- an Axiomatic Basis for Program Semantics",
journal = j-CACM,
volume = "16",
number = "8",
pages = "468--474",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (02G99)",
MRnumber = "51 9561",
MRreviewer = "W. D. Maurer",
bibdate = "Mon Jan 22 07:00:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MacLennan73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The notions of data item, function, and relation. It
is argued that the system is more suitable than set
theory (or its derivatives) for the concise and
accurate description of program semantics. It is shown
how the system can be used to build composite data
types out of simper ones with the operations of rowing,
structuring, and uniting. It is also demonstrated that
completely new primitive types can be introduced into
languages through the mechanism of singleton data
types. Both deterministic and nondeterministic
functions are shown to be definable in the system.
\par
It is described how the local environment can be
modeled as a data item and how imperative statements
can be considered functions on the environment. The
nature of recursive functions is briefly discussed, and
a technique is presented by which they can be
introduced into the system. The technique is contrasted
with the use of the paradoxical combinator, Y. The
questions of local and global environments and of
various modes of function calling and parameter passing
are touched upon. The theory is applied to the proof of
several elementary theorems concerning the semantics of
the assignment, conditional, and iterative statements.
An appendix is included which presents in detail the
formal system governing webs and fen, the abstractions
used informally in the body of the paper.",
abstract2 = "A formal system is presented which abstracts the
notions of data item, function, and relation. It is
shown how the system can be used to build composite
data types out of simpler ones with the operations of
rowing, structuring, and uniting. It is also
demonstrated that completely new primitive types can be
introduced into languages through the mechanism of
singleton data types. Both deterministic and
nondeterministic functions are shown to be definable in
the system. It is described how the local environment
can be modeled as a data item and how imperative
statements can be considered functions on the
environment. The nature of recursive functions is
briefly discussed, and a technique is presented by
which they can be introduced into the system.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Florida State Univ., Tallahassee, FL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "axioms; computer metatheory; correctness; data; data
structures; data types; definition; description
languages; extensible languages; fen; formal
description; formal language; formal language
definition; formal languages; formal systems;
lambda-calculus; models of computation; modes;
semantics; types",
oldlabel = "MacLennan73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MacLennan73",
}
@Article{Misunas:1973:PNS,
author = "David Misunas",
title = "{Petri} Nets and Speed Independent Design",
journal = j-CACM,
volume = "16",
number = "8",
pages = "474--481",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:42 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/async.circuits.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Misunas73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Petri nets are investigated as one method of modeling
speed independent asynchronous circuits. A study of
circuit realization of Petri nets leads to a
demonstration of their usefulness in modeling speed
independent operation. This usefulness is emphasized by
the design of a speed independent processor from
modules developed in the investigation of Petri net
implementation.",
acknowledgement = ack-nhfb,
classcodes = "C4230D (Sequential switching theory); C5210 (Logic
design methods)",
classification = "721; 723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "asynchronous circuits; asynchronous sequential logic;
design; logic design; Petri nets; speed independent",
oldlabel = "Misunas73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Misunas73",
}
@Article{Machura:1973:AAR,
author = "Marek Machura and Andrzej Mulawa",
title = "{ACM Algorithm 450}: {Rosenbrock} Function
Minimization [{E4}]",
journal = j-CACM,
volume = "16",
number = "8",
pages = "482--483",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:40 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MachuraM73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks
\cite{Bultheel:1974:RAR,Klemes:1974:RAR,Ellis:1974:RAHa,Davies:1976:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Inst. Automation and Measurements, Warsaw, Poland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "direct search; FORTRAN; function minimization;
minimisation; Rosenbrock; subroutine; subroutines;
unconstrained problem",
oldlabel = "MachuraM73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MachuraM73",
}
@Article{Goldstein:1973:AAC,
author = "Richard B. Goldstein",
title = "{ACM Algorithm 451}: Chi-Square Quantiles [{G1}]",
journal = j-CACM,
volume = "16",
number = "8",
pages = "483--485",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Goldstein73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See certification \cite{Knight:1975:CAC}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Providence Coll., RI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Chi square quantiles; probability; statistic;
statistics; subroutines",
oldlabel = "Goldstein73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Goldstein73",
}
@Article{Liu:1973:AAE,
author = "C. N. Liu and D. T. Tang",
title = "{ACM Algorithm 452}: Enumerating Combinations of $m$
Out of $n$ Objects [{G6}]",
journal = j-CACM,
volume = "16",
number = "8",
pages = "485--485",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#LiuT73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combinations; FORTRAN; NXCBN; permutations;
statistics; subroutines",
oldlabel = "LiuT73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LiuT73",
}
@Article{Piessens:1973:AAG,
author = "Robert Piessens",
title = "{ACM Algorithm 453}: {Gaussian} Quadrature Formulas
for {Bromwich}'s Integral [{D1}]",
journal = j-CACM,
volume = "16",
number = "8",
pages = "486--487",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:42 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Piessens73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Univ. Leuven, Heverlee, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "BROMIN; Bromwich's integral; complex; FORTRAN;
Gaussian quadrature formulas; integration; Laplace
transform; Laplace transforms; numerical inversion;
subroutines",
oldlabel = "Piessens73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Piessens73",
}
@Article{Richardson:1973:AAC,
author = "Joel A. Richardson and J. L. Kuester",
title = "{ACM Algorithm 454}: The Complex Method for
Constrained Optimization [{E4}]",
journal = j-CACM,
volume = "16",
number = "8",
pages = "487--489",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#RichardsonK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Shere:1974:RAC}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Arizona State Univ., Tempe, AZ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Box's algorithm; complex method; constrained
optimization; FORTRAN; maximum; multivariable;
nonlinear function; optimisation; subroutines",
oldlabel = "RichardsonK73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RichardsonK73",
}
@Article{Andrejkova:1973:RCA,
author = "G. Andrejkova and J. Vinar",
title = "Remark and Certification on ``{Algorithm 404}: Complex
Gamma Function''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "489--489",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#AndrejkovaV73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Safarik Univ., Kosice, Czechoslovakia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; certification; comment; complex gamma
function; functions",
oldlabel = "AndrejkovaV73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AndrejkovaV73",
}
@Article{DeMorgan:1973:RAE,
author = "Richard M. {De Morgan}",
title = "Remark on ``{Algorithm 357: An Efficient Prime Number
Generator [A1]}''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "489--489",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Morgan73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Singleton:1969:AAEb}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Digital Equipment Co. Ltd., Reading, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; mathematics; prime number generator",
oldlabel = "Morgan73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morgan73",
}
@Article{Watkins:1973:RAG,
author = "Richard P. Watkins",
title = "Remark on ``{Algorithm 412}: Graph Plotter''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "489--490",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Watkins73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Cermak:1971:AAG}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Royal Melbourne Inst. Technol., Vic., Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computer graphics; graph plotter;
plotters",
oldlabel = "Watkins73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Watkins73",
}
@Article{Byrne:1973:HMR,
author = "J. G. Byrne",
title = "{Hu-Tucker} minimum redundancy alphabetic coding
method",
journal = j-CACM,
volume = "16",
number = "8",
pages = "490--490",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Trinity Coll., Dublin, Ireland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; alphabetic coding method; encoding; Hu;
minimum redundancy; Tucker",
treatment = "P Practical",
}
@Article{Good:1973:CQ,
author = "A. J. Good",
title = "{Clenshaw--Curtis} quadrature",
journal = j-CACM,
volume = "16",
number = "8",
pages = "490--490",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Systems, Sci. and Software, La Jolla, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; Clenshaw Curtis quadrature; integration",
treatment = "P Practical",
}
@Article{Williams:1973:RAL,
author = "Edward J. Williams",
title = "Remark on ``{Algorithm 429}: Localization of the Roots
of a Polynomial''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "490--490",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Williams73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Squire:1972:AAL,Driessen:1973:RAL}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Ford Motor Co., Dearborn, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; localization; polynomials; roots of a
polynomial",
oldlabel = "Williams73a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Williams73a",
}
@Article{Byrne:1973:RAH,
author = "J. G. Byrne",
title = "Remark on ``{Algorithm 428}: {Hu-Tucker} Minimum
Redundancy Alphabetic Coding Method''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "490--??",
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Byrne73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Yohe:1972:AAH}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Byrne73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Byrne73",
}
@Article{Good:1973:RAC,
author = "Albert J. Good",
title = "Remark on ``{Algorithm 424}: {Clenshaw--Curtis}
Quadrature''",
journal = j-CACM,
volume = "16",
number = "8",
pages = "490--??",
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Good73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gentleman:1972:AAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Good73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Good73",
}
@Article{Manna:1973:IMP,
author = "Zohar Manna and Stephen Ness and Jean Vuillemin",
title = "Inductive Methods for Proving Properties of Programs",
journal = j-CACM,
volume = "16",
number = "8",
pages = "491--502",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "51 2331",
MRreviewer = "W. D. Maurer",
bibdate = "Mon Jan 22 07:01:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/ml.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MannaNV73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "There are two main purposes in this paper: first,
clarification and extension of known results about
computation of recursive programs, with emphasis on the
difference between the theoretical and practical
approaches; second, presentation and examination of
various known methods for proving properties of
recursive programs. Discussed in detail are two
powerful inductive methods, computational induction and
structural induction, including examples of their
application.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computability and decidability; computation induction;
computer metatheory; inductive methods; least
fixedpoint; programming theory; properties of programs;
proving; recursive programs; structural induction",
oldlabel = "MannaNV73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MannaNV73",
xxauthor = "Zohar Manna and Stephen Nes and Jean Vuillemin",
}
@Article{Peterson:1973:CWR,
author = "W. W. Peterson and Tadao Kasami and Nobuki Tokura",
title = "On the Capabilities of While, Repeat, and Exit
Statements",
journal = j-CACM,
volume = "16",
number = "8",
pages = "503--512",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "51 4707",
MRreviewer = "J. E. L. Peck",
bibdate = "Mon Jan 22 07:12:24 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#PetersonKT73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A well-formed program is defined as a program in which
loops and if statements are properly nested and can be
entered only at their beginning. A corresponding
definition is given for a well-formed flowchart. It is
shown that a program is well formed if and only if it
can be written with if, repeat, and multi-level exit
statements for sequence control. It is also shown that
if, while, and repeat statements with single-level exit
do not suffice. It is also shown that any flowchart can
be converted to a well-formed flowchart by node
splitting. Practical implications are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Univ. Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "capabilities; computer metatheory; exit; exit
statement; flowchart; go to statement; node splitting;
programming theory; repeat statement; software
reliability; statement; well formed program;
well-formed program; while statement",
oldlabel = "PetersonKT73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PetersonKT73",
}
@Article{Foster:1973:GAT,
author = "Caxton C. Foster",
title = "A Generalization of {AVL} Trees",
journal = j-CACM,
volume = "16",
number = "8",
pages = "513--517",
month = aug,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:15 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Foster73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A generalization of AVL trees is proposed in which
imbalances up to (triangle shape) is a small integer.
An experiment is performed to compare these trees with
standard AVL trees and with balanced trees on the basis
of mean retrieval time, of amount of restructuring
expected, and on the worst case of retrieval time. It
is shown that, by permitting imbalances of up to five
units, the retrieval time is increased a small amount
while the amount of restructuring required is decreased
by a factor of ten. \par
A few theoretical results are derived, including the
correction of an earlier paper, and are duly compared
with the experimental data. Reasonably good
correspondence is found.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6120 (File organisation)",
classification = "723; 901",
corpsource = "Univ. Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "AVL trees; balanced trees; file organisation;
generalisation; information retrieval systems;
information storage and; information storage and
retrieval; retrieval; trees (mathematical)",
oldlabel = "Foster73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Foster73",
}
@Article{Buzen:1973:CAC,
author = "Jeffrey P. Buzen",
title = "Computational Algorithms for Closed Queueing Networks
with Exponential Servers",
journal = j-CACM,
volume = "16",
number = "9",
pages = "527--531",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "50 15423",
bibdate = "Mon Jan 22 06:29:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1973.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Buzen73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Methods are presented for computing the equilibrium
distribution of customers in closed queueing networks
with exponential servers. Expressions for various
marginal distributions are also derived. The
computational algorithms are based on two-dimensional
iterative techniques which are highly efficient and
quite simple to implement. Implementation
considerations such as storage allocation strategies
and order of evaluation are examined in some detail.",
acknowledgement = ack-nhfb,
annote = "Methods are presented for computing the equilibrium
distribution of customers in closed queueing networks
with exponential servers. Expressions for various
marginal distributions are also derived.",
classcodes = "B0240C (Queueing theory); C1140C (Queueing theory)",
classification = "912; 922",
corpsource = "Harvard Univ., Cambridge, MA, USA",
country = "USA",
date = "14/12/79",
descriptors = "Exponential queueing network; number of elements in
system; method",
enum = "483",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "closed queueing networks; computational algorithms;
distributions; equilibrium distributions; exponential
servers; operations research; probability; queueing
networks; queueing theory; steady state",
language = "English",
oldlabel = "Buzen73",
references = "6",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Buzen73",
}
@Article{Ganapathy:1973:ITA,
author = "S. Ganapathy and V. Rajaraman",
title = "Information Theory Applied to the Conversion of
Decision Tables to Computer Programs",
journal = j-CACM,
volume = "16",
number = "9",
pages = "532--539",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/inductive.inference.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#GanapathyR73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Using ideas from information theory, this paper
develops a heuristic algorithm that converts a limited
entry decision table to a tree structured computer
program with near minimum average processing time. The
method is applicable to any limited entry decision
table and does not require that actions have single
rules or that the cost of testing conditions be equal.
It is thus more general than the previously published
heuristic algorithms. Compared to the optimal algorithm
of Reinwald and Soland, this algorithm is easy to code
and takes a much smaller translation time; it is thus
felt that it is more useful in practice. The algorithm
is well suited for manual conversion of decision tables
to flowcharts.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723; 731; 922",
corpsource = "Indian Inst. Technol., New Delhi, India",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer; computer systems programming --- Decision
Tables; conversion; decision tables; decision theory
and analysis; information measure; information theory;
optimum computer programs; programming theory;
programs",
oldlabel = "GanapathyR73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GanapathyR73",
}
@Article{Cardenas:1973:ESF,
author = "Alfonso F. Cardenas",
title = "Evaluation and Selection of File Organization --- {A}
Model and System",
journal = j-CACM,
volume = "16",
number = "9",
pages = "540--548",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:33 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Cardenas73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This work first discusses the factors that affect file
(data base) organization performance, an elusive
subject, and then presents a methodology, a model and a
programmed system to estimate primarily total storage
costs and average access time of several file
organizations, given a specific data base, query
characterization and device-related specifications.
Based on these estimates, an appropriate file structure
may be selected for the specific situation. The system
is a convenient tool to study file structures and to
facilitate as much as possible the process of data base
structure design and evaluation.",
acknowledgement = ack-nhfb,
annote = "Tree, indexed, and ring files compared for six files
and various retrieval requests.",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "access time; data base; data management; data
processing; data structures; design; evaluation; file
management; file organisation; file organization; file
structures; model; selection; simulation; storage
requirement",
oldlabel = "Cardenas73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cardenas73",
xxtitle = "Evaluation and Selection of File Organization --- {A}
Model and a System",
}
@Article{Casey:1973:DTS,
author = "Richard G. Casey",
title = "Design of Tree Structures for Efficient Querying",
journal = j-CACM,
volume = "16",
number = "9",
pages = "549--556",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:57 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Casey73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper poses an optimization problem in the design
of such trees to serve a well-specified application.
The problem is academic in the sense that ordinarily
the optimal tree cannot be implemented by means of
practical techniques. On the other hand, it is
potentially useful for the comparison it affords
between observed performance and that of an intuitively
attractive ideal search procedure. As a practical
application of such a model this paper considers the
design of a novel tree search scheme based on a bit
vector representation of data and shows that
essentially the same algorithm can be used to design
either an ideal search tree or a bit-vector tree. An
experimental study of a small formatted file
illustrates the concepts.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 901",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "clustering; data; data structure; data structures;
design; file organisation; information retrieval;
information retrieval systems; information storage;
information storage and; management; querying;
retrieval; search; tree file; tree structures",
oldlabel = "Casey73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Casey73",
}
@Article{Rodriguez-Rosell:1973:EWS,
author = "Juan Rodriguez-Rosell",
title = "Empirical Working Set Behavior",
journal = j-CACM,
volume = "16",
number = "9",
pages = "556--560",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:47 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Rodriguez-Rosell73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The working set model for program behavior has been
proposed in recent years as a basis for the design of
scheduling and paging algorithms. Although the words
``working set'' are now commonly encountered in the
literature dealing with resource allocation, there is a
dearth of published data on program working set
behavior. It is the purpose of this paper to present
empirical data from actual program measurements, in the
hope that workers in the field might find experimental
evidence upon which to substantiate and base
theoretical work.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Royal Inst. Technol., Stockholm, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory; measurement; operating systems
(computers); paging; program behaviour; scheduling;
software; software measurement; virtual memory; virtual
storage; working set",
oldlabel = "Rodriguez-Rosell73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rodriguez-Rosell73",
}
@Article{Gates:1973:STS,
author = "Geoffrey W. Gates and David A. Poplawski",
title = "A Simple Technique for Structured Variable Lookup",
journal = j-CACM,
volume = "16",
number = "9",
pages = "561--565",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#GatesP73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple technique for the symbol-table lookup of
structured variables based on simple automata theory is
presented. The technique offers a deterministic
solution to a problem which is currently handled in a
nondeterministic manner in PL/I and COBOL compilers.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
classification = "723",
corpsource = "Michigan State Univ., East Lansing, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; COBOL; computer programming
languages; computer systems programming; deterministic;
PL/1; PL/I; structured variable; table lookup",
oldlabel = "GatesP73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GatesP73",
}
@Article{Zelkowitz:1973:RE,
author = "Marvin V. Zelkowitz",
title = "Reversible Execution",
journal = j-CACM,
volume = "16",
number = "9",
pages = "566--566",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:38 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/debug.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Zelkowitz73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
corpsource = "Univ. Maryland, Baltimore, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "backtracking; computer program; debugging; PL/I;
program debugging; programming language; programming
languages; reversible execution",
oldlabel = "Zelkowitz73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Zelkowitz73",
}
@Article{Barnhill:1973:SKC,
author = "Robert E. Barnhill and David T. Pilcher",
title = "{Sard} kernels for certain bivariate cubatures",
journal = j-CACM,
volume = "16",
number = "9",
pages = "567--570",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D30",
MRnumber = "52 2150",
MRreviewer = "P. Brock",
bibdate = "Mon Jan 22 06:23:28 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BarnhillP73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An error analysis for some bivariate cubatures is
given. The remainders are obtained by the use of Sard
kernels. Numerical results and computer graphs are
given for some of the kernel functions.",
acknowledgement = ack-nhfb,
classcodes = "B0290B (Error analysis in numerical methods); B0290M
(Numerical integration and differentiation); C4110
(Error analysis in numerical methods); C4160 (Numerical
integration and differentiation)",
classification = "921",
corpsource = "Univ. Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bivariate cubatures; cubatures; error analysis;
integration; mathematical techniques; numerical
integration; numerical methods; remainder formulas;
Sard kernels",
oldlabel = "BarnhillP73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BarnhillP73",
}
@Article{Hunter:1973:AAA,
author = "D. B. Hunter and Julia M. Williams",
title = "{ACM Algorithm 455}: Analysis of Skew Representations
of the Symmetric Group",
journal = j-CACM,
volume = "16",
number = "9",
pages = "571--572",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#HunterW73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Bradford, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; analysis; binary model; group theory; lattice;
outer product; permutation; skew representations;
subroutines; symmetric group",
oldlabel = "HunterW73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HunterW73",
}
@Article{Fencl:1973:AAR,
author = "Zden{\v{e}}k Fencl",
title = "{ACM Algorithm 456}: Routing Problem",
journal = j-CACM,
volume = "16",
number = "9",
pages = "572--574",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Fencl73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Tesch:1974:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "RCA, Marlborough, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "FORTRAN; graph theory; Hamiltonian circuit;
optimisation; routing problem; shortest path;
subroutines; travelling salesman problem",
oldlabel = "Fencl73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fencl73",
}
@Article{Bron:1973:AAF,
author = "Coen Bron and Joep Kerbosch",
title = "{ACM Algorithm 457}: Finding All Cliques of an
Undirected Graph",
journal = j-CACM,
volume = "16",
number = "9",
pages = "575--577",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:12 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/clique.color.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BronK73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "An implicit enumeration algorithm for listing all
cliques in a graph. Includes easily translated code.",
classcodes = "C7310 (Mathematics computing)",
corpsource = "Technol. Univ., Eindhoven, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; backtracking algorithm; branch and bound
technique; cliques; clusters; fgraph coloring related
clique backtracking branch and bound; graph theory;
maximal complete; recursion; subgraph; subroutines;
undirected graph",
oldlabel = "BronK73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BronK73",
}
@Article{Roy:1973:RAG,
author = "Mohit Kumar Roy",
title = "Remark on ``{Algorithm 323}: Generation of
Permutations in Lexicographic Order [{G6}]''",
journal = j-CACM,
volume = "16",
number = "9",
pages = "577--578",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:27 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Roy73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ord-Smith:1968:AAG,Leitch:1969:CGP}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Jadavpur Univ., Calcutta, India",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; generation; lexicographic order;
permutations; statistics",
oldlabel = "Roy73a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Roy73a",
}
@Article{Lawrence:1973:RAS,
author = "E. E. Lawrence",
title = "Remark on ``{Algorithm 408}: {A} Sparse Matrix
Package''",
journal = j-CACM,
volume = "16",
number = "9",
pages = "578--578",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Lawrence73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McNamee:1971:AAS,Sale:1973:SMP}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Mullard Ltd., Mitcham, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; matrix algebra; sparse matrix package",
oldlabel = "Lawrence73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lawrence73",
}
@Article{Williamson:1973:RAH,
author = "Hugh Williamson",
title = "Remark on ``{Algorithm 420}: Hidden-Line Plotting
Program''",
journal = j-CACM,
volume = "16",
number = "9",
pages = "578--579",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:15 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Williamson73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Williamson:1972:AAH,Macleod:1973:RAH,Ellis:1974:RAHa,Ellis:1974:RAHb,Gaither:1974:RAH}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Nat. Con-Serv. Inc., Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computer graphics; data handling; hidden
line plotting; program",
oldlabel = "Williamson73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Williamson73",
}
@Article{Driessen:1973:RAL,
author = "H. B. Driessen and E. W. LeM. Hunt",
title = "Remark on ``{Algorithm 429: Localization of the Roots
of a Polynomial}''",
journal = j-CACM,
volume = "16",
number = "9",
pages = "579--579",
month = sep,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:46 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#DriessenH73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Squire:1972:AAL,Williams:1973:RAL}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Supreme Headquarters Allied Powers Europe, The Hague,
Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; localization; polynomial; polynomials;
roots",
oldlabel = "DriessenH73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DriessenH73",
}
@Article{McGeachie:1973:MTU,
author = "John S. McGeachie",
title = "Multiple Terminals Under User Program Control in a
Time-Sharing Environment",
journal = j-CACM,
volume = "16",
number = "10",
pages = "587--590",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#McGeachie73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "User-written programs on the Dartmouth Time-Sharing
System can communicate with many remote terminals
simultaneously and can control the interactions between
these terminals. Such programs can be written using
standard input and output instructions in any language
available on the system. This paper describes how this
multiple-terminal facility was implemented without
requiring any changes in the system executive or in any
of the system's compilers or interpreters.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "722",
corpsource = "Dartmouth Coll., Hanover, NH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems, digital; multiple terminals; on-line
interaction; remote consoles; time sharing;
time-sharing programs; user program control",
oldlabel = "McGeachie73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McGeachie73",
}
@Article{Bobrow:1973:MSI,
author = "Daniel G. Bobrow and Ben Wegbreit",
title = "A Model and Stack Implementation of Multiple
Environments",
journal = j-CACM,
volume = "16",
number = "10",
pages = "591--603",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:06 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BobrowW73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents an implementation technique using
a single stack to hold procedure activation storage
which allows retention of that storage for durations
not necessarily tied to control flow. The technique has
the property that, in the simple case, it runs
identically to the usual automatic stack allocation and
deallocation procedure. Applications of this technique
to multitasking, coroutines, backtracking, label-valued
variables, and functional arguments are discussed. In
the initial model, a single real processor is assumed,
and the implementation assumes multiple-processes
coordinate by passing control explicitly to one
another.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; control; coroutines; dendrarchy;
dynamic; funarg problem; label-valued variables; model;
multiple environments; multiprocessing programs;
multiprocessor; multitasking; programming; retention;
stack allocation; stack implementation; storage
allocation; structures; systems",
oldlabel = "BobrowW73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BobrowW73",
}
@Article{Lum:1973:GPA,
author = "Vincent Y. Lum",
title = "General Performance Analysis of Key-to-Address
Transformation Methods Using an Abstract File Concept",
journal = j-CACM,
volume = "16",
number = "10",
pages = "603--612",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:15 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Lum73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a new approach to the analysis of
performance of the various key-to-address
transformation methods. In this approach the keys in a
file are assumed to have been selected from the key
space according to a certain probabilistic selection
algorithm. All files with the same number of keys
selected from this key space will be suitably weighted
in accordance with the algorithm, and the average
performance of the transformation methods on these
files will be used as the potential of these methods.
Using this analysis, methods with the same overall
performance can be classified and key distributions
partial to certain transformations can be identified.
All this can be done analytically. The approach is
applied to a group of transformation methods using
files whose keys are selected randomly.",
acknowledgement = ack-nhfb,
annote = "analysis and results using distributions from the
entire key domain.",
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract file concept; access; direct addressing; file
organisation; hashing; information retrieval systems;
key to address transformation; performance analysis;
random; scatter storage; storage management",
oldlabel = "Lum73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lum73",
}
@Article{Lampson:1973:NCP,
author = "Butler W. Lampson",
title = "A Note on the Confinement Problem",
journal = j-CACM,
volume = "16",
number = "10",
pages = "613--615",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Lampson73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This note explores the problem of confining a program
during its execution so that it cannot transmit
information to any other program except its caller. A
set of examples attempts to stake out the boundaries of
the problem. Necessary conditions for a solution are
stated and informally justified.",
acknowledgement = ack-nhfb,
annote = "Prevention of privacy leaks between programs.",
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; confinement; leakage of
data; operating systems (computers); privacy;
proprietary program; protection; security; security of
data",
oldlabel = "Lampson73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lampson73",
}
@Article{Hirschberg:1973:CDM,
author = "Daniel S. Hirschberg",
title = "A Class of Dynamic Memory Allocation Algorithms",
journal = j-CACM,
volume = "16",
number = "10",
pages = "615--618",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:09 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hirschberg73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new dynamic memory allocation algorithm, the
Fibonacci system, is introduced. This algorithm is
similar to, but seems to have certain advantages over,
the ``buddy'' system. A generalization is mentioned
which includes both of these systems as special
cases.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Princeton Univ., NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "buddy system; computer operating systems; dynamic
memory allocation algorithms; dynamic storage
allocation; Fibonacci; Fibonacci system; fragmentation;
simulation; storage allocation",
oldlabel = "Hirschberg73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hirschberg73",
}
@Article{Prieve:1973:UPR,
author = "Barton G. Prieve",
title = "Using Page Residency to Select the Working Set
Parameter",
journal = j-CACM,
volume = "16",
number = "10",
pages = "619--620",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:13:58 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Prieve73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Denning's method for selecting the working set
parameter, which uses interreference intervals, is
examined. Several omissions in his model are noted, and
new assumptions are introduced to overcome these
omissions. Using this modified model, Denning's results
on page residency are rederived and reconsidered for
selecting the working set parameter.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6120 (File
organisation)",
classification = "723",
corpsource = "Bell Telephone Labs., Inc., Naperville, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; page residency; program
behaviour; programming theory; virtual storage; working
set parameter",
oldlabel = "Prieve73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Prieve73",
}
@Article{Millstein:1973:CSI,
author = "Robert E. Millstein",
title = "Control Structures in {Illiac IV Fortran}",
journal = j-CACM,
volume = "16",
number = "10",
pages = "621--627",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Millstein73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "As part of an effort to design and implement a Fortran
compiler on the ILLIAC IV, an extended Fortran, called
IVTRAN, has been developed. This language provides a
means of expressing data and control structures
suitable for exploiting ILLIAC IV parallelism.
\par
This paper reviews the hardware characteristics of the
ILLIAC and singles out unconventional features which
could be expected to influence language (and compiler)
design. The implications of these features for data
layout and algorithm structure are discussed, and the
conclusion is drawn that data allocation rather than
code structuring is the crucial ILLIAC optimization
problem. A satisfactory method of data allocation is
then presented. Language structures to utilize this
storage method and express parallel algorithms are
described.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "Massachusetts Computer Associates, Inc., Wakefield,
MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "array allocation; array processing; computer
programming languages; control structures; explicit
parallelism; FORTRAN; ILLIAC IV; ILLIAC IV Fortran;
parallel control; parallel control structures; parallel
processing; parallelism detection; procedure oriented
languages; program compilers; structures",
oldlabel = "Millstein73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Millstein73",
}
@Article{Mifsud:1973:AMP,
author = "Charles J. Mifsud and Michael J. Bohlen",
title = "Addendum to a Multiple-Precision Division Algorithm",
journal = j-CACM,
volume = "16",
number = "10",
pages = "628--??",
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MifsudB73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
note = "See \cite{Mifsud:1970:MDA}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "MifsudB73",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MifsudB73",
}
@Article{Robers:1973:AAD,
author = "P. D. Robers and S. S. Robers",
title = "{ACM Algorithm 458}: Discrete Linear ${L}_1$
Approximation by Interval Linear Programming [{E2}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "629--631",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#RobersR73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); B0290F (Interpolation
and function approximation); C1180 (Optimisation
techniques); C4130 (Interpolation and function
approximation); C7310 (Mathematics computing)",
corpsource = "Ernst and Ernst, Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "discrete linear; FORTRAN; function approximation;
interval linear programming; L/sub 1/ approximation;
linear programming; suboptimisation method; subroutine;
subroutines",
oldlabel = "RobersR73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RobersR73",
}
@Article{Syslo:1973:AAE,
author = "Maciej M. Syslo",
title = "{ACM Algorithm 459}: The Elementary Circuits of a
Graph [{H}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "632--633",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Syslo73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Syslo:1975:RAE}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. Wroclaw, Poland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; elementary circuits; graph; graph theory; path
search algorithm; subroutines",
oldlabel = "Syslo73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Syslo73",
}
@Article{Saylor:1973:AAC,
author = "Paul E. Saylor and James D. Sebastian",
title = "{ACM Algorithm 460}: Calculation of Optimum Parameters
for Alternating Direction Implicit Procedures [{D3}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "633--635",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#SaylorS73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations); C7310 (Mathematics computing)",
corpsource = "Univ. Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "alternating direction implicit; differential
equations; elliptic difference; equations; FORTRAN;
optimum parameters; procedures; simultaneous equations;
subroutine; subroutines",
oldlabel = "SaylorS73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SaylorS73",
}
@Article{Burkowski:1973:AAC,
author = "Forbes J. Burkowski and W. D. Hoskins",
title = "{ACM Algorithm 461}: Cubic Spline Solutions to a Class
of Functional Differential Equations [{D2}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "635--637",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#BurkowskiH73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
B0290P (Differential equations); C4130 (Interpolation
and function approximation); C4170 (Differential
equations); C7310 (Mathematics computing)",
corpsource = "Univ. Manitoba, Winnipeg, Man., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(mathematics); boundary value problem; boundary-value
problems; cubic spline solutions; differential
equations; FORTRAN; functional differential equations;
piecewise continuous approximation; splines; SPNBVF;
subroutine; subroutines",
oldlabel = "BurkowskiH73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BurkowskiH73",
}
@Article{Donnelly:1973:AAB,
author = "Thomas G. Donnelly",
title = "{ACM Algorithm 462}: Bivariate Normal Distribution
[{S15}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "638--638",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Donnelly73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. North Carolina, Chapel Hill, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "bivariate normal distribution; FORTRAN; frequency
distribution; statistics; subroutine; subroutines",
oldlabel = "Donnelly73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Donnelly73",
}
@Article{Lewart:1973:AAA,
author = "C. R. Lewart",
title = "{ACM Algorithm 463}: Algorithms {SCALE1}, {SCALE2},
and {SCALE3} for Determination of Scales on Computer
Generated Plots [{J6}]",
journal = j-CACM,
volume = "16",
number = "10",
pages = "639--640",
month = oct,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Lewart73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Bell Telephone Lab., Inc., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; computer generated plots; computer
graphics; determination of; FORTRAN; SCALE 1; SCALE 2;
SCALE 3; scales; subroutines",
oldlabel = "Lewart73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lewart73",
}
@Article{Bachman:1973:PN,
author = "Charles W. Bachman",
title = "The Programmer as Navigator",
journal = j-CACM,
volume = "16",
number = "11",
pages = "653--658",
month = nov,
year = "1973",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/355611.362534",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:31 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Bachman73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "This is the 1973 ACM Turing Award Lecture.",
acknowledgement = ack-nhfb,
annote = "Turing award acceptance speech-general view of the
state of database work from a DBTG originator.",
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation); C6130 (Data handling techniques)",
corpsource = "Honeywell Information Systems Inc., Waltham, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "access; addressing; data handling; database; file
organisation; network hierarchical data model CACM;
programmer; programming",
oldlabel = "Bachman73",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bachman73",
}
@Article{Fabry:1973:DVO,
author = "Robert S. Fabry",
title = "Dynamic Verification of Operating System Decisions",
journal = j-CACM,
volume = "16",
number = "11",
pages = "659--668",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Fabry73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Dynamic verification of a decision implies that every
time the decision is made there is a consistency check
performed on the decision using independent hardware
and software. The dynamic verification of operating
system decisions is used on the PRIME system being
designed and constructed at the University of
California, Berkeley. PRIME is an experimental
time-sharing system which is to have the properties of
continuous availability, data privacy, and cost
effectiveness. The technique of dynamic verification
allows the construction of an operating system which
does not make certain decisions improperly even in the
presence of a single hardware or software fault.
Furthermore, multiple faults lead to unreliable
operation only if the faults happen to reinforce each
other. On PRIME, dynamic verification is used to ensure
that one user's information cannot become available to
another user gratuitously even in the presence of a
single hardware or software fault.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems); C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer systems; computer
systems, digital; data privacy; data security; dynamic
verification; fault tolerance; modular; operating
systems; operating systems (computers); program
verification; reliability; security of data; software",
oldlabel = "Fabry73",
treatment = "P Practical; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fabry73",
}
@Article{Mickunas:1973:PGS,
author = "M. Dennis Mickunas and Victor B. Schneider",
title = "A Parser-Generating System for Constructing Compressed
Compilers",
journal = j-CACM,
volume = "16",
number = "11",
pages = "669--676",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#MikunasS73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a parser-generating system (PGS)
currently in use on the CDC-6500 computer at Purdue
University. The PGS is a FORTRAN-coded program that
accepts a translation grammar as input and constructs
from it a compact, machine-coded compiler. In the input
translation grammar, each BNF syntactic rule
corresponds to a (possibly empty) ``code generator''
realizable as an assembly language, FORTRAN or Algol,
subroutine that is called whenever that syntactic rule
is applied in the parse of a program. Typical one-pass
compilers constructed by the PGS translate source
programs at speeds approaching 14,000 cards per minute.
For an XPL compiler, the parser program and its tables
currently occupy 288 words of 60-bit core memory of
which 140 words are parsing table entries and 82 words
are links to code generators.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4220 (Automata theory); C6150C
(Compilers, interpreters and other processors)",
classification = "723",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "BNF; compression algorithm; computer operating systems
--- Program Compilers; computer programming languages;
data compression; grammars; interpreters; parser
generators; program; program compilers; pushdown
automata; syntactic analysis; translation grammars;
translator writing systems",
oldlabel = "MikunasS73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MikunasS73",
}
@Article{Jordan:1973:SCA,
author = "B. W. {Jordan, Jr.} and R. C. Barrett",
title = "Scan Conversion Algorithm with Reduced Storage
Requirements",
journal = j-CACM,
volume = "16",
number = "11",
pages = "676--682",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#JordanB73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The scan conversion algorithm that is described uses a
linked list data structure to process the lines of the
drawing in strips corresponding to groups of scan
lines. A relatively small primary memory buffer area is
used to accumulate the binary image for a group of scan
lines. When this portion of the drawing has been
plotted, the buffer is reused for the next portion.
Because of the list processing procedures used, only a
single pass through the XY display file is required
when generating the binary image and only a slight
increase in execution time over the fully buffered core
results. Results show that storage requirements can be
reduced by more than 80\% while causing less than a
10\% increase in execution time.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
classification = "723",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer graphics; data handling; discrete image; dot
generation; line drawing; raster plotter; reduced
storage requirements; scan conversion; scan conversion
algorithm",
oldlabel = "JordanB73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JordanB73",
}
@Article{Slagle:1973:EAT,
author = "James R. Slagle and Lewis M. Norton",
title = "Experiments with an Automatic Theorem-Prover Having
Partial Ordering Inference Rules",
journal = j-CACM,
volume = "16",
number = "11",
pages = "682--688",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/nonmono.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#SlagleN73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a detailed description of the
program and a comprehensive account of the experiments
that have been performed with it.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
classification = "723",
corpsource = "Nat. Inst. Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; heuristics; inference rules;
paramodulation; partial ordering; resolution; theorem
proving",
oldlabel = "SlagleN73",
treatment = "X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SlagleN73",
}
@Article{Reinsch:1973:AAE,
author = "Christian H. Reinsch",
title = "{ACM Algorithm 464}: Eigenvalues of a Real, Symmetric,
Tridiagonal Matrix [{F2}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "689--689",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Reinsch73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
author-dates = "Christian H. Reinsch (?? ?? 1932--8 October 2022)",
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Tech. Univ., M{\"u}nchen, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; eigenvalues; eigenvalues and eigenfunctions;
matrix; matrix algebra; QR; real; subroutines;
symmetric; transformation; tridiagonal",
oldlabel = "Reinsch73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Reinsch73",
}
@Article{Hill:1973:AAS,
author = "G. W. Hill",
title = "{ACM Algorithm 465}: {Student}'s $t$ Frequency
[{S14}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "690--690",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:52 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Hill73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "CSIRO, Glen Osmond, SA, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; approximation; density function; series;
statistics; student's t statistic; subroutine;
subroutines",
oldlabel = "Hill73a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hill73a",
}
@Article{Ehrlich:1973:AAF,
author = "Gideon Ehrlich",
title = "{ACM Algorithm 466}: Four Combinatorial Algorithms
[{G6}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "690--691",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:32 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Ehrlich73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Weizmann Inst. Sci., Rehovot, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combinations; combinatorial algorithms; permutations;
PL/1; statistics; subroutines",
oldlabel = "Ehrlich73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ehrlich73",
}
@Article{Brenner:1973:AAM,
author = "Norman Brenner",
title = "{ACM Algorithm 467}: Matrix Transposition in Place
[{F1}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "692--694",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:03 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Brenner73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Leathers:1979:RAS}.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "in place; matrix algebra; matrix operations; number
theory; permutations; primitive; rectangular matrix;
roots; subroutines; transposition",
oldlabel = "Brenner73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brenner73",
}
@Article{Patterson:1973:AAA,
author = "T. N. L. Patterson",
title = "{ACM Algorithm 468}: Algorithm for Automatic Numerical
Integration Over a Finite Interval [{D1}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "694--699",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Patterson73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "finite interval; FORTRAN algorithm; integration;
numerical; numerical integration; numerical methods;
quadrature; subroutines",
oldlabel = "Patterson73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Patterson73",
}
@Article{Lam:1973:AAA,
author = "C. Lam and J. McKay",
title = "{ACM Algorithm 469}: Arithmetic Overa Finite Field
[{A1}]",
journal = j-CACM,
volume = "16",
number = "11",
pages = "699--699",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#LamM73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C5230
(Digital arithmetic methods); C7310 (Mathematics
computing)",
corpsource = "Caltech Univ., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algebra; ALGOL; arithmetic; digital arithmetic; finite
field; linear algebra; rational operations;
subroutines",
oldlabel = "LamM73",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LamM73",
}
@Article{Denning:1973:NSO,
author = "Peter J. Denning and G. Scott Graham",
title = "A Note on Subexpression Ordering in the Evaluation of
Arithmetic Expressions",
journal = j-CACM,
volume = "16",
number = "11",
pages = "700--702",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "50 11844",
MRreviewer = "B. S. Baker",
bibdate = "Mon Jan 22 06:35:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#DenningG73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Erratum, ibid. 17, 1974, 455.",
abstract = "A counterexample to the supposed optimality of an
algorithm for generating schedules for trees of tasks
with unequal execution times is presented. A comparison
with the ``critical path'' heuristic is discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C5230
(Digital arithmetic methods); C6150J (Operating
systems)",
classification = "723",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arithmetic expressions; computer operating systems;
digital arithmetic; execution; multiprocessing
programs; multiprocessor scheduling; ordering;
scheduling; subexpression; task; tree scheduling",
oldlabel = "DenningG73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DenningG73",
xxtitle = "A Note on Subexpression Ordering in the Execution of
Arithmetic Expressions",
}
@Article{Feldman:1973:CBS,
author = "Jerome A. Feldman and James R. Low and R. P. Brent",
title = "Comment on {Brent}'s scatter storage algorithm (and
author's reply)",
journal = j-CACM,
volume = "16",
number = "11",
pages = "703--703",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#FeldmanL73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dynamic chaining; file organisation; hashing; Hashing;
information storage and retrieval; scatter storage;
scatter storage algorithm; searching; storage
allocation; storage management; symbol table",
oldlabel = "FeldmanL73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FeldmanL73",
}
@Article{Wegner:1973:TSP,
author = "Eberhard Wegner",
title = "Tree-Structured Programs",
journal = j-CACM,
volume = "16",
number = "11",
pages = "704--705",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Wegner73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6110 (Systems analysis
and programming)",
corpsource = "Tech. Univ., Berlin, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compilers; control structures; data structures;
fixpoints; flowcharts; goto statements; graphs;
inductive assertion; least; program documentation;
program flow; programming; programming language design;
proof of programs; semantics of programming languages;
structured programming; tree structure",
oldlabel = "Wegner73",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wegner73",
}
@Article{Salzer:1973:RSC,
author = "Herbert E. Salzer",
title = "A recurrence scheme for converting from one orthogonal
expansion into another",
journal = j-CACM,
volume = "16",
number = "11",
pages = "705--707",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05 (65Q05)",
MRnumber = "52 15956",
bibdate = "Mon Jan 22 07:18:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Salzer73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Chebyshev; Clenshaw recurrence; Hamming recurrence;
numerical methods; orthogonal expansions; polynomials;
recurrence; schemes; series; series (mathematics);
series interconversion",
oldlabel = "Salzer73a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Salzer73a",
}
@Article{Stenger:1973:AAS,
author = "Frank Stenger",
title = "An algorithm for the approximate solution of
{Wiener--Hopf} integral equations",
journal = j-CACM,
volume = "16",
number = "11",
pages = "708--710",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Stenger73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290R (Integral equations); C4180 (Integral
equations)",
corpsource = "Univ. Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; approximate solution; convolution; Hopf;
integral equations; numerical methods; Wiener",
oldlabel = "Stenger73",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Stenger73",
}
@Article{Ehrlich:1973:SBE,
author = "Louis W. Ehrlich",
title = "Solving the Biharmonic Equation in a Square: a Direct
Versus a Semidirect Method",
journal = j-CACM,
volume = "16",
number = "11",
pages = "711--714",
month = nov,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Ehrlich73a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two methods for solving the biharmonic equation are
compared. One method is direct, using
eigenvalue-eigenvector decomposition. The other method
is iterative, solving a Poisson equation directly at
each iteration.",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations)",
classification = "723",
corpsource = "Johns Hopkins Univ., Baltimore, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "biharmonic; biharmonic equation; compared; computer
systems programming; decomposition; difference;
difference equations; eigenvalues and eigenfunctions;
eigenvector; equations; iterative; iterative methods;
numerical methods; partial differential; Poisson
equation; square",
oldlabel = "Ehrlich73a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ehrlich73a",
}
@Article{Couger:1973:CRU,
author = "J. Daniel Couger",
title = "Curriculum Recommendations for Undergraduate Programs
in Information Systems",
journal = j-CACM,
volume = "16",
number = "12",
pages = "727--749",
month = dec,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:49 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Couger73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The need for education related to information systems
in organizations is discussed, and a curriculum is
proposed for an undergraduate program. Material
necessary for such programs is identified, and courses
incorporating it are specified.Detailed course
descriptions are presented. Program organization and a
problems of implementation are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C0310 (EDP
management); C6110 (Systems analysis and programming);
C7100 (Business and administration)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "curriculum; education; information analysis;
information systems; management information systems;
management systems; recommendations; system design;
systems analysis; undergraduate; undergraduate
curricula",
oldlabel = "Couger73",
treatment = "B Bibliography; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Couger73",
}
@Article{Sibley:1973:DDM,
author = "Edgar H. Sibley and Robert W. Taylor",
title = "A Data Definition and Mapping Language",
journal = j-CACM,
volume = "16",
number = "12",
pages = "750--759",
month = dec,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:34 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#SibleyT73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/SibleyT73.html",
acknowledgement = ack-nhfb,
annote = "Overview of data translation",
cdrom = "CACMs1/CACM16/P750.pdf",
classcodes = "C6120 (File organisation)",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data base management; data definition language; data
structures; data translation; file organisation; file
translation; mapping language; storage allocation;
storage structure; systems",
oldlabel = "SibleyT73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SibleyT73",
}
@Article{Kubicek:1973:AAL,
author = "Milan Kubicek",
title = "{ACM Algorithm 470}: Linear Systems with Almost
Tridiagonal Matrix [{F4}]",
journal = j-CACM,
volume = "16",
number = "12",
pages = "760--761",
month = dec,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Kubicek73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7310
(Mathematics computing)",
corpsource = "Tech. Univ., Praha, Czechoslovakia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "almost tridiagonal matrix; FAKUB; FORTRAN; linear
systems; matrix algebra; program; sparse matrix;
subroutines",
oldlabel = "Kubicek73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kubicek73",
}
@Article{Gautschi:1973:AAE,
author = "Walter Gautschi",
title = "{ACM Algorithm 471}: Exponential Integrals [{S13}]",
journal = j-CACM,
volume = "16",
number = "12",
pages = "761--763",
month = dec,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Gautschi73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; computation; continued fractions; exponential
integrals; integration; recurrence relations;
recursive; subroutine; subroutines",
oldlabel = "Gautschi73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gautschi73",
}
@Article{Herriot:1973:AAP,
author = "John G. Herriot and Christian H. Reinsch",
title = "{ACM Algorithm 472}: Procedures for Natural Spline
Interpolation [{E1}]",
journal = j-CACM,
volume = "16",
number = "12",
pages = "763--768",
month = dec,
year = "1973",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:39 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm16.html#Herriot73;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
author-dates = "Christian H. Reinsch (?? ?? 1932--8 October 2022)",
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; cubic natural spline; interpolation;
natural spline interpolation; procedures; splines
(mathematics); subroutines",
oldlabel = "Herriot73",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Herriot73",
}
@Article{Lyon:1974:SDL,
author = "Gordon Lyon",
title = "Syntax-directed least-errors analysis for context-free
languages: a practical approach",
journal = j-CACM,
volume = "17",
number = "1",
pages = "3--14",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:29 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lyon74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Nat. Bur. Stand., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arbitrary input strings; context free grammars;
context-free languages; dynamic programming; error
analysis; least errors correction; merging; parsing;
separability; state; stored subanalyses",
oldlabel = "Lyon74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lyon74",
}
@Article{Malcolm:1974:FMS,
author = "Michael A. Malcolm and John Palmer",
title = "A fast method for solving a class of tridiagonal
linear systems",
journal = j-CACM,
volume = "17",
number = "1",
pages = "14--17",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F05",
MRnumber = "48 10076",
MRreviewer = "D. B. Hunter",
bibdate = "Mon Jan 22 07:01:08 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#MalcolmP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The solution of linear systems having real, symmetric,
diagonally dominant,tridiagonal coefficient matrices
with constant diagonals is considered. It is proved
that the diagonals of the LU decomposition converges
when floating-point precision. It is also proved that
the computed LU decomposition converges when
floating-point arithmetic is used and that the limits
of the LU diagonals using floating point are roughly
within machine precision of the limits using real
arithmetic. This fact is exploited to reduce the number
of floating-point operations required to solve a linear
system from $8n-7$ to $5n+2k-3$, where $k$ is much less
than $n$, the order of the matrix. If the elements of
the subdiagonals and superdiagonals are 1, then only
$4n+2k-3$ operations are needed. The entire LU
decomposition takes $k$ words of storage, and
considerable savings in array subscripting are
achieved. Upper and lower bounds on $k$ are obtained in
terms of the ratio of the coefficient matrix diagonal
constants and parameters of the floating-point number
system. Various generalizations of these results are
discussed.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C5230
(Digital arithmetic methods)",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "digital arithmetic; fast method; floating point;
linear systems; matrix algebra; numerical linear
algebra; operations; real arithmetic; Toeplitz
matrices; tridiagonal matrices",
kwds = "nla, linear system, tridiagonal matrix, fast
algorithm",
oldlabel = "MalcolmP74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MalcolmP74",
}
@Article{Akima:1974:MBI,
author = "Hiroshi Akima",
title = "A method of bivariate interpolation and smooth surface
fitting based on local procedures",
journal = j-CACM,
volume = "17",
number = "1",
pages = "18--20",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:57 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/pre75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Akima74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
corpsource = "US Dept. Commerce, Boulder, Colo., USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "bivariate interpolation; interpolation; local; partial
derivative; polynomial; procedures; smooth surface
fitting",
oldlabel = "Akima74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Akima74",
}
@Article{Gibbs:1974:TP,
author = "Norman E. Gibbs and William G. {Poole, Jr.}",
title = "Tridiagonalization by Permutations",
journal = j-CACM,
volume = "17",
number = "1",
pages = "20--24",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F15",
MRnumber = "48 7567",
MRreviewer = "J. Hurt",
bibdate = "Mon Jan 22 06:44:02 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#GibbsP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Tridiagonalizing a matrix by similarity
transformations is an important computational tool in
numerical linear algebra. Consider the class of sparse
matrices which can be tridiagonalized using only row
and corresponding column permutations. The advantages
of using such a transformation include the absence of
round-off errors and improved computation time when
compared with standard transformations. \par
A graph theoretic algorithm which examines an arbitrary
$n \times n$ matrix and determines whether or not it
can be permuted into tridiagonal form is given. The
algorithm requires no arithmetic while the number of
comparisons, the number of assignments, and the number
of increments are linear in $n$. This compares very
favorably with standard transformation methods. \par
If the matrix is permutable into tridiagonal form, the
algorithm gives the explicit tridiagonal form.
Otherwise, early rejection will occur.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
corpsource = "College William and Mary, Williamsburg, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; bandwidth; eigenvalues; graph; matrix
algebra; permutation; sparse matrix; tridiagonal
matrix",
kwds = "nla, tridiagonal matrix, permutation matrix",
oldlabel = "GibbsP74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GibbsP74",
}
@Article{Piessens:1974:AAC,
author = "Robert Piessens",
title = "{ACM Algorithm 473}: Computation of {Legendre} Series
Coefficients [{C6}]",
journal = j-CACM,
volume = "17",
number = "1",
pages = "25--25",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Piessens74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Univ. Leuven, Heverlee, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Chebyshev; Chebyshev approximation; coefficients;
computation; FORTRAN; Legendre series; LEGSER; series;
series (mathematics); subroutines",
oldlabel = "Piessens74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Piessens74",
}
@Article{Akima:1974:AAB,
author = "Hiroshi Akima",
title = "{ACM Algorithm 474}: Bivariate Interpolation and
Smooth Surface Fitting Based on Local Procedures
[{E2}]",
journal = j-CACM,
volume = "17",
number = "1",
pages = "26--31",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Akima74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Anderson:1979:RBI}.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "US Dept Commerce, Boulder, Colo., USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "bivariate interpolation; FORTRAN; interpolation;
ITPLBV; local; partial derivative; polynomial;
procedures; SFCFIT; smooth surface fitting;
subroutines",
oldlabel = "Akima74a",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Akima74a",
}
@Article{Sutherland:1974:RPC,
author = "Ivan E. Sutherland and Gary W. Hodgman",
title = "Reentrant Polygon Clipping",
journal = j-CACM,
volume = "17",
number = "1",
pages = "32--42",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SutherlandH74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Evand and Sutherland Computer Corp., Salt Lake City,
UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; computer; computer graphics; data
handling; graphics; hidden line; perspective;
perspective projection; pictures; planes; polygon
clipping; reentrant polygon clipping; surface; three
dimensions",
oldlabel = "SutherlandH74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SutherlandH74",
}
@Article{King:1974:CAV,
author = "Peter J. H. King and Roger G. Johnson",
title = "Comments on the algorithms of {Verhelst} for the
conversion of limited-entry decision tables to
flowcharts (and author's reply)",
journal = j-CACM,
volume = "17",
number = "1",
pages = "43--45",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#KingJ74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Birkbeck Coll., Univ. London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; conversion; decision table; decision
tables; flow charting; flowcharting; optimal programs;
preprocessor; search",
oldlabel = "KingJ74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KingJ74",
}
@Article{Knott:1974:NSC,
author = "Gary D. Knott",
title = "A Numbering System for Combinations",
journal = j-CACM,
volume = "17",
number = "1",
pages = "45--46",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:19 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Knott74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Nat. Inst. Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "coding system; coding systems; combinations;
combinatorics; numbering system; programming;
programming techniques; storage mapping function;
storage mapping functions",
oldlabel = "Knott74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knott74",
}
@Article{Lucas:1974:CRG,
author = "Henry C. {Lucas, Jr.}",
title = "A {CRT} Report Generating System",
journal = j-CACM,
volume = "17",
number = "1",
pages = "47--48",
month = jan,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lucas74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "automated systems design; data; management;
processing; programming; report generation; report
generators; systems analysis",
oldlabel = "Lucas74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lucas74",
}
@Article{Rothnie:1974:ABF,
author = "James B. {Rothnie, Jr.} and Tomas Lozano",
title = "Attribute Based File Organization in a Paged Memory
Environment",
journal = j-CACM,
volume = "17",
number = "2",
pages = "63--69",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/database.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#RothnieL74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This article analyzes the high cost of page accessing
and proposes a method called multiple key hashing which
attempts to minimize it. since this approach is not
always preferable to inversion, a combined method is
described. The exact specifications of this combination
for a file with given data and traffic characteristics
are formulated as a mathematical program. The proposed
heuristic solution to this program can often improve on
a simple inversion technique by a factor of 2 or 3.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "attribute based file organization; cost; data
organization; data processing; data storage, digital;
file organisation; file organization; heuristic
solution; inverted file; mathematical; mathematical
programming; multikey retrieval; multiple key hashing;
page accessing; paged memories; paged memory
environment; paging; program; retrieval algorithm;
virtual storage",
oldlabel = "RothnieL74",
treatment = "A Application; E Economic; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RothnieL74",
}
@Article{Jordan:1974:COR,
author = "B. W. {Jordan, Jr.} and R. C. Barrett",
title = "A Cell Organized Raster Display for Line Drawings",
journal = j-CACM,
volume = "17",
number = "2",
pages = "70--77",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#JordanB74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Raster scan computer graphics displays with ``real
time'' character generators have previously been
limited to alphanumeric characters. A display is
described which extends the capabilities of this
organization to include general graphics. The
feasibility of such a display is shown by deriving the
minimum number of patterns required in the read only
memory of the character generator to synthesize an
arbitrary line. The synthesis process does not
compromise picture quality, since the resulting dot
patterns are identical with those of a conventional
raster display. The time constraints of a raster
display are shown to be satisfied for a typical design
for very complex line drawings.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
classification = "722",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrary line; cell organized raster display; complex
line drawings; computer; computer graphic equipment;
computer graphics; computer peripheral equipment;
discrete; dot; dot generation; graphics displays;
image; line drawing; line drawings; matrix displays;
minimum; number of patterns; patterns; read only
memory; real time character generators",
oldlabel = "JordanB74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JordanB74",
}
@Article{Ramberg:1974:AMG,
author = "John S. Ramberg and Bruce W. Schmeiser",
title = "An Approximate Method for Generating Asymmetric Random
Variables",
journal = j-CACM,
volume = "17",
number = "2",
pages = "78--82",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "48 10043",
MRreviewer = "J. Spanier",
bibdate = "Mon Jan 22 07:14:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1974.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#RambergS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Tukey's lambda distribution is generalized to provide
an algorithm for generating values of unimodal
asymmetric random variables. This algorithm has the
same advantages as the symmetric random variable
generator previously given by the authors, except that
the addition of another parameter complicates the
problem of finding the parameter values to fit a
distribution.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
classification = "723; 922",
corpsource = "Univ. Iowa, IA, USA",
country = "USA",
descriptors = "RNG; RVG",
enum = "2505",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximate method; approximations; computer
programming --- Subroutines; distribution; generating
asymmetric random variables; mathematical statistics;
moments; Monte Carlo; Monte Carlo methods; probability;
random number generation; random numbers; random
variables; simulation; statistics; Tukey's lambda
distribution; unimodal asymmetric random; variables",
language = "English",
oldlabel = "RambergS74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RambergS74",
}
@Article{Lamport:1974:PED,
author = "Leslie Lamport",
title = "The Parallel Execution of {DO} Loops",
journal = j-CACM,
volume = "17",
number = "2",
pages = "83--93",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lamport74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Methods are developed for the parallel execution of
different iterations of a DO loop. Both asynchronous
multiprocessor computers and array computers are
considered. Practical application to the design of
compilers for such computers is discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150C
(Compilers, interpreters and other processors)",
classification = "722; 723",
corpsource = "Massachusetts Computer Associates Inc., Wakefield, MA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "array computers; asynchronous multiprocessor; computer
operating systems --- Program Compilers; computer
systems, digital; computers; computing; design of
compilers; DO loops; loops; parallel; parallel
execution; parallel processing; program compilers;
programming; vector computers",
oldlabel = "Lamport74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport74",
}
@Article{Ledgard:1974:PSC,
author = "Henry F. Ledgard",
title = "{Production Systems}: or can we do better than
{BNF}?",
journal = j-CACM,
volume = "17",
number = "2",
pages = "94--102",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:06 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ledgard74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Since the development of BNF, the definition of the
syntax of programming languages has been almost
universally associated with context-free requirements.
\par
Yet numerous interesting and difficult issues in syntax
stem from the context-sensitive requirements, notably
the compatibility between the declaration of an
identifier and its uses, the correspondence between
actual and formal parameters, and issues arising from
block structure. This paper explores the use of a
formal notation called Production Systems in providing
a readable and complete formal definition of syntax. As
a practical illustration, a small but significant
subset of PL/I is considered. A more detailed
presentation, as well as the application to define
abstract syntax and translations between languages, is
given in a previous paper by the author.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "721; 723",
corpsource = "Univ. Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; BNF; compilers; computer programming
languages; context sensitive grammars; context
sensitive requirements; context-sensitive grammars;
definition; definition of syntax; formal; formal
definition; PL/I standards; Production Systems;
readable and complete formal; syntax; syntax of
programming languages; translation",
oldlabel = "Ledgard74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ledgard74",
xxpages = "93--102",
}
@Article{Wegbreit:1974:SLP,
author = "Ben Wegbreit",
title = "The Synthesis of Loop Predicates",
journal = j-CACM,
volume = "17",
number = "2",
pages = "102--112",
month = feb,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "49 8420",
MRreviewer = "Armin Cremers",
bibdate = "Mon Jan 22 07:28:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Wegbreit74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Current methods for mechanical program verification
require a complete predicate specification on each
loop. Because this is tedious and error prone,
producing a program with complete, correct predicates
is reasonably difficult and would be facilitated by
machine assistance. This paper discusses techniques for
mechanically synthesizing loop predicates. Two classes
of techniques are considered: (1) heuristic methods
which derive loop predicates from boundary conditions
and/or partially specified inductive assertions: (2)
extraction methods which use input predicates and
appropriate weak interpretations to obtain certain
classes of loop predicates by an evaluation on the weak
interpretation.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "721; 723",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "assertions; automata theory --- Theorem Proving;
boundary conditions; computer operating systems;
computer programming; extraction methods; heuristic
methods; inductive; inductive assertions; input
predicates; interpretations; loop predicates;
mechanical program verification; program debugging;
program verification; program verifiers; programming
theory; property extraction; synthesis; synthesis of
loop predicates; theorem proving; weak; weak
interpretation; weak interpretations; well founded
sets; well-founded sets",
oldlabel = "Wegbreit74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wegbreit74",
}
@Article{Sreenivasan:1974:CRS,
author = "K. Sreenivasan and A. J. Kleinman",
title = "On the Construction of a Representative Synthetic
Workload",
journal = j-CACM,
volume = "17",
number = "3",
pages = "127--133",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:46 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SreenivasanK74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A general method of constructing a drive workload
representative of a real workload is described. The
real workload is characterized by its demands on the
various system resources. These characteristics of the
real workload are obtained from the system accounting
data. The characteristics of the drive workload are
determined by matching the joint probability density of
the real workload with that of the drive workload. The
drive workload is realized by using a synthetic program
in which the characteristics can be varied by varying
the appropriate parameters. Calibration experiments are
conducted to determine expressions relating the
synthetic program parameters with the workload
characteristics. The general method is applied to the
case of two variables, cpu seconds and number of I/O
activities; and a synthetic workload with 88 jobs is
constructed to represent a month's workload consisting
of about 6000 jobs.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems); C7430 (Computer engineering)",
classification = "722",
corpsource = "MITRE Corp., Bedford, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "activities; calibration experiments; computer systems,
digital; computer testing; construction; cpu seconds;
data; drive; joint probability density; number of I/O;
real workload; representative synthetic workload;
simulation; synthetic program; synthetic workload;
system accounting; system resources; workload",
oldlabel = "SreenivasanK74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SreenivasanK74",
}
@Article{Balkovich:1974:DMR,
author = "E. Balkovich and W. Chiu and Leon Presser and R.
Wood",
title = "Dynamic Memory Repacking",
journal = j-CACM,
volume = "17",
number = "3",
pages = "133--138",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BalkovichCPW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A probabilistic model of a multiprogramming system is
exercised in order to determine the conditions under
which the dynamic repacking of main memory is
beneficial. An expression is derived for the maximum
interference that a repacking process may introduce
before the original performance of the system is
degraded. Alternative approaches to repacking are
discussed, and the operating conditions that lead to
improved system throughput through repacking are
delineated.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. California, Santa Barbara, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "central; computer systems programming; dynamic memory
repacking; file organisation; fragmentation; maximum
interference; multiprogramming; multiprogramming
system; multiprogramming system model; probabilistic
model; processor productivity; resource utilization;
storage; storage fragmentation; system; throughput",
oldlabel = "BalkovichCPW74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BalkovichCPW74",
}
@Article{Morgan:1974:OSA,
author = "Howard Lee Morgan",
title = "Optimal Space Allocation on Disk Storage Devices",
journal = j-CACM,
volume = "17",
number = "3",
pages = "139--142",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Morgan74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "When the amount of space required for file storage
exceeds the amount which can be kept online, decisions
must be made as to which files are to be permanently
resident and which mountable. These decisions will
affect the number of mount requests issued to the
operators. This is often a bottleneck in a computing
facility, and reducing the number of mounts thus
decreases turnaround time. An optimization model for
the assignment of files to disk packs, and packs to
either resident or nonresident status is presented.
Heuristics are suggested for those cases in which it is
inefficient to compute the actual optimum.",
acknowledgement = ack-nhfb,
annote = "Optimization of file allocation to mountable
diskpacks.",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bottleneck; computer operating systems; computing
facility; disc analysis; disc files; disc storage
devices; file; file systems; Heuristics; magnetic disc
storage; memory hierarchy; optimal space allocation;
optimization model; scheduling; storage; storage
allocation",
oldlabel = "Morgan74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morgan74",
}
@Article{Loeser:1974:SPT,
author = "Rudolf Loeser",
title = "Some Performance Tests of ``Quicksort'' and
Descendants",
journal = j-CACM,
volume = "17",
number = "3",
pages = "143--152",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:34 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Loeser74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Detailed performance evaluations are presented for six
ACM algorithms: quicksort (No. 64), Shellsort (No.
201), stringsort (No. 207), ``TREESORTS3'' (No. 245),
quickersort (No. 271), and qsort (No. 402). Algorithms
271 and 402 are refinements of algorithm 64, and all
three are discussed in some detail. The evidence given
here demonstrates that qsort (No. 402) requires many
more comparisons that its author claims. Of all these
algorithms, quickersort requires the fewest comparisons
to sort random arrays.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Smithsonian Astrophys. Obs., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "'quicksort'; ACM; algorithms; computer programming;
computer testing; general; performance evaluations;
performance tests; purpose sort algorithm; qsort;
quicksort; quicksort quickersort qsort CACM; random
arrays; Shellsort; sorting; sorting algorithm
documentation; sorting efficiency; sorting performance
tests; string sort; TREESORT3; utility sort algorithm",
oldlabel = "Loeser74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Loeser74",
}
@Article{Wright:1974:AAV,
author = "Thomas Wright",
title = "{ACM Algorithm 475}: Visible Surface Plotting Program
[{J6}]",
journal = j-CACM,
volume = "17",
number = "3",
pages = "152--155",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:52 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1972.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Wright74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks
\cite{Frederick:1975:RA,Mashburn:1975:RAV,Doran:1975:RAV,Duta:1976:RVS,Swieten:1979:RVS}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
corpsource = "Nat. Center Atmospheric Res., Boulder, CO, USA",
country = "USA",
descriptors = "FORTRAN; graphics; application; method; human factors;
hidden line algorithm; contour surface",
enum = "3343",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer graphics; contour surface; hidden line
problem; subroutines; visible surface plotting
program",
language = "English",
oldlabel = "Wright74",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wright74",
}
@Article{Bosten:1974:RAI,
author = "Nancy E. Bosten and E. L. Battiste",
title = "Remark on ``{Algorithm 179}: Incomplete Beta Ratio''",
journal = j-CACM,
volume = "17",
number = "3",
pages = "156--157",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BostenB74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ludwig:1963:AAI}.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "IMSL, Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Algorithm 179; computer aided analysis; function
approximation; incomplete beta ratio; subroutines",
oldlabel = "BostenB74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BostenB74",
}
@Article{Barrett:1974:SCA,
author = "R. C. Barrett and B. W. {Jordan, Jr.}",
title = "Scan Conversion Algorithms for a Cell Organized Raster
Display",
journal = j-CACM,
volume = "17",
number = "3",
pages = "157--163",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:34 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BarrettF74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Raster scan computer graphics with ``real time''
character generators have previously been limited to
alphanumeric characters. A display has been described
which extends the capabilities of this organization to
include general graphics. Two fundamentally different
scan conversion algorithms which have been developed to
support this display are presented. One is most
suitable to noninteractive applications and the other
to interactive applications. The algorithms were
implemented in Fortran on the CDC6400 computer. Results
obtained from the implementations show that the
noninteractive algorithms can significantly reduce
display file storage requirements at little cost in
execution time over that of a conventional raster
display. The interactive algorithm improve response
time and reduce storage requirements.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques)",
classification = "723",
corpsource = "Hughes Aircraft Co., Culver City, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "'real time' character generators; cell organized
raster display; computer graphics; computer programming
--- Subroutines; data handling; general graphics;
interactive applications; noninteractive applications;
scan conversion algorithms",
oldlabel = "BarrettF74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BarrettF74",
}
@Article{Ravindran:1974:RAC,
author = "Arunachalam Ravindran",
title = "Remark on ``{Algorithm 431}: {A} Computer Routine for
Quadratic and Linear Programming Problems''",
journal = j-CACM,
volume = "17",
number = "3",
pages = "157--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ravindran74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ravindran:1972:AAC,Proll:1974:RAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Ravindran74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ravindran74",
}
@Article{Withers:1974:RAZ,
author = "David H. Withers",
title = "Remark on ``{Algorithm 419}: Zeros of a Complex
Polynomial''",
journal = j-CACM,
volume = "17",
number = "3",
pages = "157--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Withers74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Jenkins:1972:AAZ}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Withers74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Withers74",
}
@Article{Ackerman:1974:QSH,
author = "A. Frank Ackerman",
title = "Quadratic Search for Hash Tables of Size $p^n$",
journal = j-CACM,
volume = "17",
number = "3",
pages = "164--164",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "48 10178",
bibdate = "Mon Jan 22 06:20:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ackerman74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "file organisation; quadratic search for hash tables;
table lookup",
oldlabel = "Ackerman74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ackerman74",
}
@Article{Smoliar:1974:ECC,
author = "Stephen W. Smoliar",
title = "Emotional Content Considered Dangerous",
journal = j-CACM,
volume = "17",
number = "3",
pages = "164--165",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:01 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Smoliar74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Smoliar74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smoliar74",
}
@Article{Stone:1974:NCP,
author = "Harold S. Stone",
title = "A note on a combinatorial problem of {Burnett} and
{Coffman}",
journal = j-CACM,
volume = "17",
number = "3",
pages = "165--166",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "05A05",
MRnumber = "48 10826",
bibdate = "Mon Jan 22 07:24:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Stone74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C6130 (Data handling
techniques)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "combinatorial analysis; combinatorial mathematics;
combinatorial problem; derangements; file organisation;
interleaved memory systems; interleaving; mean;
memories; memory bandwidth; rencontres",
oldlabel = "Stone74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Stone74",
}
@Article{Krogh:1974:EIV,
author = "Fred T. Krogh",
title = "Efficient Implementation of a Variable Projection
Algorithm for Nonlinear Least Squares Problems",
journal = j-CACM,
volume = "17",
number = "3",
pages = "167--169",
month = mar,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65K05",
MRnumber = "49 1773",
bibdate = "Mon Jan 22 06:56:19 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Krogh74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See errata \cite{Krogh:1974:EEI}.",
abstract = "Nonlinear least squares problems frequently arise for
which the variables to be solved for can be separated
into a linear and a nonlinear part. A variable
projection algorithm has been developed recently which
is designed to take advantage of the structure of a
problem whose variables separate in this way. This
paper gives a slightly more efficient and slightly more
general version of this algorithm than has appeared
earlier.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
classification = "723; 921",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer aided analysis; computer programming; least
squares approximations; lsq; mathematical techniques
--- Least Squares Approximations; nllsq; nlop; nlsq;
nonlinear least squares; parameter estimation;
problems; variable projection; variable projection
algorithm; varpro",
oldlabel = "Krogh74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Krogh74",
}
@Article{Saltzer:1974:SLM,
author = "Jerome H. Saltzer",
title = "A Simple Linear Model of Demand Paging Performance",
journal = j-CACM,
volume = "17",
number = "4",
pages = "181--186",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:09 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/cache.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Saltzer74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper proposes and analyzes a demand paged
virtual memory computer system. The simple model
combines the effect of the information reference
pattern with the effect of the automatic management
algorithm to produce a single, composite statement: the
mean number of memory references between paging
exceptions increases linearly with the size of the
paging memory. The resulting model is easy to
manipulate, and is applicable to such diverse problems
as choosing an optimum size for a paging memory,
arranging for reproducible memory usage charges, and
estimating the amount of core memory sharing.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic management algorithm; automatically managed
multilevel memory system; computer metatheory; computer
testing; core memory; demand paging performance;
information; linear model; memory hierarchy; memory
models; operating systems (computers); optimum; paging;
performance; Performance Evaluation: Analytic;
performance measurement; predicting the; program
reference model; reference pattern; reproducible memory
usage charges; sharing; size; storage; virtual; virtual
memory",
oldlabel = "Saltzer74",
treatment = "A Application; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Saltzer74",
}
@Article{Franklin:1974:CPF,
author = "Mark A. Franklin and R. K. Gupta",
title = "Computation of Page Fault Probability from Program
Transition Diagram",
journal = j-CACM,
volume = "17",
number = "4",
pages = "186--191",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#FranklinG74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is given for calculating page fault
probability in a virtual memory system operating under
demand paging with various memory sizes and replacement
rules. A first order Markov model of program behavior
is assumed, and a representation of the system based on
memory states, control states, and memory substates is
presented. The algorithm is general in the sense that
the page fault probabilities can be calculated for
nonpredictive replacement rules applied to any program
represented by a one-step Markov chain. A detailed
example is given to illustrate the algorithm for Random
and Least Recently Used (LRU) replacement rules.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7430 (Computer
engineering)",
classification = "723",
corpsource = "Washington Univ., St. Louis, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory; computer testing; control states;
demand paging; fault tolerant computing; Markov model;
memory; memory states; memory substates; nonpredictive
replacement rules; page fault probability; program
transition diagram; various memory sizes; virtual;
virtual storage",
oldlabel = "FranklinG74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FranklinG74",
}
@Article{Boyse:1974:ECP,
author = "John W. Boyse",
title = "Execution Characteristics of Programs in a
Page-On-Demand System",
journal = j-CACM,
volume = "17",
number = "4",
pages = "192--196",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:51 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Boyse74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Data are presented which show the execution
characteristics of two types of commonly used programs
in a large-scale, time-shared computer system. A
software monitoring facility built into the supervisor
was used for data collection during normal system
operation. These data were analyzed, and results of
this analysis are presented for a FORTRAN compiler and
an interactive line file editor. Probability
distribution functions and other data are given for
such things as CPU intervals, I/O intervals, and the
number of such intervals during execution. Empirical
distributions are compared with simple theoretical
distributions (exponential, hyperexponential, and
geometric). Other data show paging characteristics of
tasks as a function of the number of pages those tasks
have in core.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150C (Compilers,
interpreters and other processors); C6150G (Diagnostic,
testing, debugging and evaluating systems); C6150J
(Operating systems)",
classification = "723",
corpsource = "Univ. Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "characteristics; compiler execution behaviour;
computer metatheory; computer testing; CPU intervals;
demand paging; editor; execution behaviour; Fortran
compiler; I/O intervals; interactive line file; large
scale, time shared computer system; monitoring
facility; page on demand system; paging
characteristics; probability distribution functions;
program behaviour; program execution; software;
supervisory and executive programs; virtual memory;
virtual storage",
oldlabel = "Boyse74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boyse74",
}
@Article{Smith:1974:LCE,
author = "Graham Smith and Ian M. Sefton",
title = "On {Lions}' Counter Example for {Gotlieb}'s Method for
the Construction of School Timetables",
journal = j-CACM,
volume = "17",
number = "4",
pages = "196--197",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SmithS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The timetable problem is an essentially discrete
problem. Although the discrete problem may have no
feasible solution, there may exist a solution to the
equivalent continuous problem. An example is given, for
which the nondiscrete solution can be interpreted as a
set of timetables, differing from week to week, which
together satisfy the long-term requirements of the
timetable problem.",
acknowledgement = ack-nhfb,
classcodes = "C7110 (Educational administration); C7890 (Other
special applications of computing)",
classification = "921",
corpsource = "Univ. New South Wales, Kensington, NSW, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial; combinatorial mathematics; discrete
problem; educational administrative data; Gotlieb's
method; mathematical programming; multiindex problem;
processing; schedule; scheduling; school timetables;
timetable",
oldlabel = "SmithS74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SmithS74",
}
@Article{Lindstrom:1974:CLS,
author = "Gary Lindstrom",
title = "Copying List Structures Using Bounded Workspace",
journal = j-CACM,
volume = "17",
number = "4",
pages = "198--202",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:08 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lindstrom74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two new algorithms are presented for list structure
copying using bounded workspace. The first, of
primarily theoretical interest, shows that without cell
tag bits the task can be performed in time n**2. The
second algorithm, assuming one tag bit in each cell,
delivers attractive practical speed. Any noncyclic
structure is copied in linear speed, while cyclic
structures are copied in average time less than n log
n. No foreknowledge of cycle absence is necessary to
achieve linear speed. A variation of the second
algorithm solves an open problem concerning list
structure marking. That result demonstrates that
marking can be done in average time n log n without the
aid of supplemental tag bits or stacks.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Univ. Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; bounded workspace; complexity; computer
programming; copying list structures; cyclic; data
structures; list; list processing; list structure
marking; noncyclic structure; one tag bit; space;
structure copying; structures",
oldlabel = "Lindstrom74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lindstrom74",
}
@Article{Even:1974:PTS,
author = "Shimon Even",
title = "Parallelism in Tape-Sorting",
journal = j-CACM,
volume = "17",
number = "4",
pages = "202--204",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Even74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two methods for employing parallelism in tape-sorting
are presented. Method A is the natural way to use
parallelism. Method B is new. Both approximately
achieve the goal of reducing the processing time by a
divisor which is the number of processors.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Weizmann Inst. Sci., Rehovot, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; external sorting;
parallel processing; parallelism; queues; reducing the
processing time; sorting; stacks; tape sorting",
oldlabel = "Even74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Even74",
}
@Article{Lucas:1974:SCU,
author = "Henry C. {Lucas, Jr.} and David B. Montgomery and Jean
Claude Larreche",
title = "A study of computer use in a graduate school of
business",
journal = j-CACM,
volume = "17",
number = "4",
pages = "205--206",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:01 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#LucasML74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C7100
(Business and administration)",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accounting records; commerce; computer aided
instruction; computer use; cumulative; curriculum;
education; general problem solving tool; graduate
school of business; process model; questionnaires;
research",
oldlabel = "LucasML74",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LucasML74",
}
@Article{Freeman:1974:GEP,
author = "Peter Freeman and Michael A. Malcolm and William H.
Payne",
title = "Graduate Education: The {Ph.D.} Glut: Response and
Rebuttal",
journal = j-CACM,
volume = "17",
number = "4",
pages = "206--207",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#FreemanMP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Payne:1973:GEP}.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
corpsource = "Univ. California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accreditation; advanced degrees; education; graduate
education; Ph.D.; Ph.D. production; response and
rebutted; what kind",
oldlabel = "FreemanMP74",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FreemanMP74",
}
@Article{Sterling:1974:ITM,
author = "Theodor D. Sterling and Seymour V. Pollack",
title = "Ideal teaching machines --- a solution to the
pedagogic language problem",
journal = j-CACM,
volume = "17",
number = "4",
pages = "207--208",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SterlingP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6140D (High
level languages)",
corpsource = "Simon Fraser Univ., Burnaby, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer; education; ideal teaching machine; pedagogic
language problem; problem oriented languages;
simulated; teaching machines",
oldlabel = "SterlingP74",
treatment = "A Application; G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SterlingP74",
}
@Article{Abrahams:1974:SRL,
author = "Paul W. Abrahams",
title = "Some Remarks on Lookup of Structured Variables",
journal = j-CACM,
volume = "17",
number = "4",
pages = "209--210",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Abrahams74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
corpsource = "New York Univ., NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "compilers; data structures; deterministic; finite
state machine; lookup of structured variables;
qualified references; sequence of identifiers;
structured; symbol table; table lookup; variables",
oldlabel = "Abrahams74",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Abrahams74",
}
@Article{Simmons:1974:AMP,
author = "Grover C. Simmons",
title = "Addendum to {M. L. Patrick} Paper",
journal = j-CACM,
volume = "17",
number = "4",
pages = "209--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Simmons74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Simmons74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Simmons74",
}
@Article{Balfour:1974:AAM,
author = "A. Balfour",
title = "An alternative approach to mutual recursion {in Algol}
60 using restricted compilers",
journal = j-CACM,
volume = "17",
number = "4",
pages = "210--210",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Balfour74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors)",
corpsource = "Heriot-Watt Univ., Edinburgh, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ALGOL; Algol 60; compiler; mutual recursion; program
compilers; restricted compilers; restrictions",
oldlabel = "Balfour74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Balfour74",
}
@Article{Lee:1974:IPS,
author = "R. C. T. Lee and C. L. Chang and Richard J.
Waldinger",
title = "An Improved Program-Synthesizing Algorithm and its
Correctness",
journal = j-CACM,
volume = "17",
number = "4",
pages = "211--217",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (68A40)",
MRnumber = "49 10175",
MRreviewer = "S. Amarel",
bibdate = "Mon Jan 22 06:58:17 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#LeeCW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An improved program-synthesizing algorithm based on
the algorithm proposed by Waldinger and Lee in 1969 is
given. In the old algorithm, the program-synthesizing
problem is translated into a theorem-proving problem,
and a program is obtained by analyzing a proof.
\par
For the improved algorithm, the analysis is not
necessary, and a program is obtained as soon as the
proof is completed. This is achieved by using a
modified variable tracing mechanism invented by Green
in 1969. The correctness of the improved algorithm is
also proved; i.e. the program thus obtained always
satisfies the specification.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Nat. Inst. Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory; consequence; consequence finding;
correctness; finding; modified variable tracing
mechanism; primitive resolutions; problem; program
synthesizing algorithm; program-synthesizing
algorithms; programming theory; theorem proving",
oldlabel = "LeeCW74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LeeCW74",
}
@Article{Cline:1974:SPV,
author = "A. K. Cline",
title = "Scalar- and Planar-Valued Curve Fitting Using Splines
Under Tension. {I}",
journal = j-CACM,
volume = "17",
number = "4",
pages = "218--220",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05",
MRnumber = "49 8274",
MRreviewer = "J. W. Jerome",
bibdate = "Mon Jan 22 06:31:43 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1974.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/pre75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Cline74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The spline under tension was introduced by Schweikert
in an attempt to imitate cubic splines but avoid the
spurious critical points they induce. The defining
equations are presented here, together with an
efficient method for determining the necessary
parameters and computing the resultant spline. The
standard scalar-valued curve fitting problem is
discussed, as well as the fitting of open and closed
curves in the plane. The use of these curves and the
importance of the tension in the fitting of contour
lines are mentioned as application.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
classification = "921",
corpsource = "Nat. Center Atmospheric Res., Boulder, CO, USA",
country = "USA",
descriptors = "Realization; polynomial; approximation; method;
interpolation; FORTRAN; graphics; iterative method;
information system; spline; curve fitting",
enum = "597",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "contouring; cubic splines; curve fitting; curves in
the plane; fitting; function approximation;
interpolation; mathematical techniques; scalar valued
curve; splines; splines (mathematics); splines under
tension",
language = "English",
oldlabel = "Cline74",
references = "3",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cline74",
}
@Article{Cline:1974:AAS,
author = "A. K. Cline",
title = "{ACM Algorithm 476}: Six Subprograms for Curve Fitting
Using Splines Under Tension [{E2}]",
journal = j-CACM,
volume = "17",
number = "4",
pages = "220--223",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Cline74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Nat. Center Atmospheric Res., Boulder, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "contouring; curve fitting; FORTRAN; function
approximation; interpolation; splines (mathematics);
splines under tension; subprograms; subroutines",
oldlabel = "Cline74a",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cline74a",
}
@Article{Ehrlich:1974:AAG,
author = "Gideon Ehrlich",
title = "{ACM Algorithm 477}: Generator of Set-Partitions to
Exactly {$R$} Subsets [{G7}]",
journal = j-CACM,
volume = "17",
number = "4",
pages = "224--225",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ehrich74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C7310 (Mathematics
computing)",
corpsource = "Weizmann Inst. Sci., Rehovot, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "mutually exclusive subsets; PARTEXACT; partitions;
permutations; set theory; subroutines; subset
generation; subsets",
oldlabel = "Ehrich74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ehrich74",
}
@Article{Einarsson:1974:STE,
author = "Bo Einarsson",
title = "Remark on ``{Algorithm 443}: Solution of the
Transcendental Equation $w\exp(w)=x$''",
journal = j-CACM,
volume = "17",
number = "4",
pages = "225--225",
month = apr,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:42 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Einarsson74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Fritsch:1973:AAS}.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Res. Inst. Nat. Defense, Tumba, Sweden",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "function evaluation; subroutines; transcendental
equation; violation of the Fortran standard",
oldlabel = "Einarsson74",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Einarsson74",
}
@Article{Shaw:1974:RCC,
author = "Mary Shaw",
title = "Reduction of Compilation Costs Through Language
Contraction",
journal = j-CACM,
volume = "17",
number = "5",
pages = "245--250",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:48 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Shaw74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Programming languages tailored to particular groups of
users can often be constructed by removing unwanted
features from a general purpose language. This paper
describes the use of simulation techniques to predict
the savings in compilation cost achievable by such an
approach. The results suggest a function which
describes the effect of changes in the power of a
language on the compilation cost of an algorithm
expressed in that language: when features not actually
used by the algorithm are removed from the language,
the cost of compiling the algorithm decreases
moderately, but when features that are needed are
removed, the compilation cost increases sharply.",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compilation costs; compiler design; computational
complexity; computer programming languages; design of
programming languages; general purpose language;
language contraction; languages; programming;
programming languages; simulation techniques",
oldlabel = "Shaw74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shaw74",
}
@Article{Wegbreit:1974:TDT,
author = "Ben Wegbreit",
title = "The Treatment of Data Types in {EL1}",
journal = j-CACM,
volume = "17",
number = "5",
pages = "251--264",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:37 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Wegbreit74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In constructing a general purpose programming
language, a key issue is providing a sufficient set of
data types and associated operations in a manner that
permits both natural problem-oriented notation and
efficient implementation. The EL1 language contains a
number of features specifically designed to
simultaneously satisfy both requirements. The resulting
treatment of data types includes provision for
programmer-defined data types and generic routines,
programmer control over type conversion, and very
flexible data type behavior, in a context that allows
efficient compiled code and compact data
representation.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
classification = "723",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "behaviour; coercion; compilation; computer programming
languages; data description language; data handling;
data type definition; data types; efficient
implementation; EL1; extensible; flexible data type;
general purpose programming language; generic routines;
language; languages; mode unions; modes; problem
oriented notation; procedure oriented languages;
programmer control; programmer defined data types; type
conversion",
oldlabel = "Wegbreit74a",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wegbreit74a",
}
@Article{Wagner:1974:OCR,
author = "Robert A. Wagner",
title = "Order-$n$ Correction for Regular Languages",
journal = j-CACM,
volume = "17",
number = "5",
pages = "265--268",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:44 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Wagner74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is presented for calculating a string B,
belonging to a given regular language L, which is
``nearest'' (in number of edit operations) to a given
input string $a$. $B$ is viewed as a reasonable
``correction'' for the possibly erroneous string $a$,
where a was originally intended to be a string of $L$.
\par
The calculation of $B$ by the method presented requires
time proportional to $|a|$, the number of characters in
$a$. The method should find applications in information
retrieval, artificial intelligence, and spelling
correction systems.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Vanderbilt Univ., Nashville, TN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; compiler error recovery;
computer programming languages; context free languages;
context-free languages; correction; corrector; edit
operations; error correction; error correction codes;
errors; finite state automata; information;
nondeterministic finite state automata;
nondeterministic finite-state automata; order $n$
correction; regular events; regular languages;
retrieval; spelling correction; string best match
problem",
oldlabel = "Wagner74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wagner74",
}
@Article{Tsao:1974:DSD,
author = "Nai Kuan Tsao",
title = "On the Distributions of Significant Digits and
Roundoff Errors",
journal = j-CACM,
volume = "17",
number = "5",
pages = "269--271",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65G05",
MRnumber = "49 6595",
MRreviewer = "N. N. Abdelmalek",
bibdate = "Mon Jan 22 07:26:38 MST 2001",
bibsource = "Compendex database;
ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Tsao74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Generalized logarithmic law is derived for the
distribution of the first $t$ significant digits of a
random digital integer. This result is then used to
determine the distribution of the roundoff errors in
floating-point operations, which is a mixture of
uniform and reciprocal distributions.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "921",
corpsource = "Aerospace Res. Labs., Wright-Patterson AFB, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Benford's Law; digital arithmetic; digital integer;
distributions; error analysis; floating point
operations; Law of Anomalous Numbers; logarithmic law;
mathematical techniques; mean value; random;
reciprocal; roundoff errors; significant digits;
uniform distribution; variance; Zipf's Law",
oldlabel = "Tsao74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tsao74",
}
@Article{Wunderlich:1974:DNT,
author = "Marvin C. Wunderlich and J. L. Selfridge",
title = "Design for a Number Theory Package with an Optimized
Trial Division Routine",
journal = j-CACM,
volume = "17",
number = "5",
pages = "272--276",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:59 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#WunderlichS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A number theory package is described which uses doubly
linked list structures for storing multiprecise
integers. The package has been coded in IBM's Basic
Assembly Language and makes heavy use of the macro
language and conditional assembly. An optimally coded
trial division routine is also described which can be
used to determine the unique factorization of large
integers.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "921",
corpsource = "Northern Illinois Univ., Dekalb, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arithmetic; Basic; conditional assembly; design;
doubly linked list structures; doubly linked lists;
factorization; integers; macro language; mathematical
techniques; multiprecise; number theory; number theory
package; optimally coded; optimized trial division;
pseudoprime; routine; trial division; utility
programs",
oldlabel = "WunderlichS74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WunderlichS74",
}
@Article{Gentleman:1974:MAR,
author = "W. Morven Gentleman and Scott B. Marovich",
title = "More on Algorithms that Reveal Properties of Floating
Point Arithmetic Units",
journal = j-CACM,
volume = "17",
number = "5",
pages = "276--277",
month = may,
year = "1974",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360980.361003",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:47 MST 2001",
bibsource = "ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#GentlemanM74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/fparith.bib",
note = "See \cite{Malcolm:1972:ARP}.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
corpsource = "Univ. Waterloo, Ont., Canada",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; base of the arithmetic; digital
arithmetic; floating point arithmetic units; high
level; languages; trailing digits",
oldlabel = "GentlemanM74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GentlemanM74",
}
@Article{Gold:1974:MMR,
author = "D. E. Gold and David J. Kuck",
title = "A Model for Masking Rotational Latency by Dynamic Disk
Allocation",
journal = j-CACM,
volume = "17",
number = "5",
pages = "278--288",
month = may,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#GoldK74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents the background and algorithms for
masking the rotational latency of a disk or drum. It
discusses the anticipatory input and output of blocks
of data to buffer and primary memories for a
mono-programmed computer system. A basic permutation
algorithm and several variations are given. Because of
the anticipatory nature of the I/O scheduling, these
algorithms are restricted to classes of programs with
predictable behavior. While the methods are not
restricted to numerical computations, matrix and
partial differential equation methods are typical
examples of their use. It is shown tha latency may be
masked using a small amount of buffer memory. The
methods discussed are independent of the overall size
of the data base being considered.",
acknowledgement = ack-nhfb,
annote = "Optimal arrangement of data to minimize buffer
needs.",
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(computers); algorithm; anticipatory input;
anticipatory output; behaviour; buffer; buffer memory;
computer operating systems; computer system; data
storage, magnetic --- Disk; dynamic disc allocation;
magnetic disc and drum storage; masking; memory
hierarchy; model; monoprogrammed; operating systems;
permutation; permutation algorithm; predictable;
primary memories; rotational latency; staging; storage
allocation",
oldlabel = "GoldK74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GoldK74",
}
@Article{Cohen:1974:TLE,
author = "Jacques Cohen and Carl Zuckerman",
title = "Two Languages for Estimating Program Efficiency",
journal = j-CACM,
volume = "17",
number = "6",
pages = "301--308",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/monitor.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1974.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#CohenZ74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two languages enabling their users to estimate the
efficiency of computer programs are presented. The
program whose efficiency one wishes to estimate is
written in the first language, a go-to-less programming
language which includes most of the features of Algol
60. The second language consists of interactive
commands enabling its users to provide additional
information about the program written in the first
language and to output results estimating its
efficiency. Processors for the two languages are also
described. The first processor is a syntax-directed
translator which compiles a program into a symbolic
formula representing the execution time for that
program. The second processor is a set of procedures
for algebraic manipulation which can be called by the
user to operate on the formula produced by the first
processor. Examples of the usage of the two languages
are included. The limitations of the present system,
its relation to Knuth's work on the analysis of
algorithms, and some of the directions for further
research are also discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Brandeis Univ., Waltham, MA, USA",
country = "USA",
descriptors = "Programming language; runtime/storage efficiency;
analysis; algorithm",
enum = "614",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis of algorithms; computer programming
languages; efficiency; estimating program efficiency;
go to less; interactive commands; languages; procedure
oriented languages; processors; program; program
diagnostics; program efficiency; programming language;
programming languages; symbolic manipulation; syntax
directed translation; syntax-directed translation",
language = "English",
oldlabel = "CohenZ74",
references = "16",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CohenZ74",
}
@Article{Henschen:1974:TPL,
author = "Lawrence J. Henschen and Ross A. Overbeek and Larry
Wos",
title = "A Theorem-Proving Language for Experimentation",
journal = j-CACM,
volume = "17",
number = "6",
pages = "308--314",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A40",
MRnumber = "49 6698",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:49:32 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#HenschenOW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Because of the large number of strategies and
inference rules presently under consideration in
automated theorem proving, there is a need for
developing a language especially oriented toward
automated theorem proving. This paper discusses some of
the features and instructions of this language. The use
of this language permits easy extension of automated
theorem-proving programs to include new strategies
and/or new inference rules. Such extend ability will
permit general experimentation with the various
alternative systems.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C6140D (High level
languages)",
classification = "723",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "alternative systems; automated theorem proving;
computer programming languages; experimentation;
factoring; paramodulation; problem oriented languages;
programming languages; resolution; strategies and
inference rules presently; theorem proving",
oldlabel = "HenschenOW74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HenschenOW74",
}
@Article{Gimpel:1974:MSM,
author = "James F. Gimpel",
title = "The Minimization of Spatially-Multiplexed Character
Sets",
journal = j-CACM,
volume = "17",
number = "6",
pages = "315--318",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:27 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Gimpel74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes a technique for compacting
character sets in a digital computer while retaining
fast access to individual bits. It considers the
problem of minimizing the storage needed to contain
such tables. Reduction techniques are developed, and
the problem is shown to reduce to a covering problem.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Bell Telephone Labs., Holmdel, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "character sets; compacting character sets; computer
programming; covering problem; data handling; data
structures; fast access to; individual bits; lexical
analysis; minimizing the storage; parsing; reduction;
scanning; spatial multiplexing; string processing;
techniques",
oldlabel = "Gimpel74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gimpel74",
}
@Article{Barrodale:1974:AAS,
author = "I. Barrodale and F. D. K. Roberts",
title = "{ACM Algorithm 478}: Solution of an Overdetermined
System of Equations in the {$L_1$} Norm [{F4}]",
journal = j-CACM,
volume = "17",
number = "6",
pages = "319--320",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BarrodaleR74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Fritsch:1975:RAS}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); B0290F (Interpolation
and function approximation); C1180 (Optimisation
techniques); C4130 (Interpolation and function
approximation); C7310 (Mathematics computing)",
corpsource = "Univ. Victoria, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; function approximation; l/sub 1/
approximation; l1 norm; linear programming; minimizes;
overdetermined system of equations; simplex method;
subroutines; sum of the absolute values of the
residuals",
oldlabel = "BarrodaleR74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BarrodaleR74",
}
@Article{Page:1974:AAM,
author = "R. L. Page",
title = "{ACM Algorithm 479}: {A} Minimal Spanning Tree
Clustering Method [{Z}]",
journal = j-CACM,
volume = "17",
number = "6",
pages = "321--323",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:01 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Page74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Magnuski:1975:RAM,White:1976:RMS}.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C7310
(Mathematics computing)",
corpsource = "Colorado State Univ., Fort Collins, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "complete graph; feature; FORTRAN; graph theory; human
perception; minimal spanning tree; pattern recognition;
selection; subroutines",
oldlabel = "Page74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Page74",
}
@Article{Gaither:1974:HPP,
author = "B. Gaither",
title = "Hidden-line plotting program",
journal = j-CACM,
volume = "17",
number = "6",
pages = "324--324",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques); C7310 (Mathematics computing)",
corpsource = "New Mexico Inst. Mining and Technol., Socorro, NM,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computer graphics; division by zero; hidden
line; plotting program",
treatment = "G General Review; P Practical",
}
@Article{Piessens:1974:RAC,
author = "Robert Piessens",
title = "Remark on ``{Algorithm 418}: Calculation of {Fourier}
Integrals''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "324--324",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Piessens74b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Einarsson:1972:AAC,Einarsson:1972:RAC}.",
acknowledgement = ack-nhfb,
classcodes = "B0290Z (Other numerical methods); C4190 (Other
numerical methods); C7310 (Mathematics computing)",
corpsource = "Univ. Leuven, Heverlee, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; Fourier integrals; Fourier transforms;
integration",
oldlabel = "Piessens74b",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Piessens74b",
}
@Article{Piessens:1974:RAM,
author = "Robert Piessens",
title = "Remark on ``{Algorithm 400}: Modified {Ha{\aa}vie}
Integration''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "324--324",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Piessens74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Wallick:1970:AAM}.",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
C4160 (Numerical integration and differentiation);
C7310 (Mathematics computing)",
corpsource = "Univ. Leuven, Heverlee, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; automatic; integration; integrators;
modified H{\aa}vie integration; numerical analysis;
overflows; specified tolerances",
oldlabel = "Piessens74a",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Piessens74a",
}
@Article{Ellis:1974:RAHa,
author = "T. M. R. Ellis",
title = "Remark on ``{Algorithm 420}: Hidden-Line Plotting
Program''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "324--325",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:50 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ellis74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark
\cite{Williamson:1972:AAH,Macleod:1973:RAH,Williamson:1973:RAH,Ellis:1974:RAHb,Gaither:1974:RAH,Machura:1973:AAR}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques); C7310 (Mathematics computing)",
corpsource = "Univ. Sheffield, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computer graphics; error; hidden line
plotting program; plotting program",
oldlabel = "Ellis74",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ellis74",
}
@Article{Gaither:1974:RAH,
author = "Blaine Gaither",
title = "Remark on ``{Algorithm 420}: Hidden-Line Plotting
Program''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "324--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Gaither74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Williamson:1972:AAH,Macleod:1973:RAH,Williamson:1973:RAH,Ellis:1974:RAHa,Ellis:1974:RAHb}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Gaither74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gaither74",
}
@Article{Page:1974:GRC,
author = "R. L. Page",
title = "Remark on ``{Algorithm 425}: Generation of Random
Correlated Normal Variables''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "325--325",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Page74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Hurst:1972:AAG}.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Colorado State Univ., Fort Collins, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; array parameters; random correlated normal
variables; random number generation; revises; work",
oldlabel = "Page74a",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Page74a",
}
@Article{Boulton:1974:RAE,
author = "D. M. Boulton",
title = "Remark on ``{Algorithm 434}: Exact Probabilities for
{$R \times C$} Contingency Tables''",
journal = j-CACM,
volume = "17",
number = "6",
pages = "326--326",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:38 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Boulton74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{March:1972:AAE,Hancock:1975:RAE}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Monash Univ., Melbourne, Vic., Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; cell frequency combinations; contingency
tables; dimensional contingency table; exact
probabilities; inefficient; marginal sum constraints;
probability; two",
oldlabel = "Boulton74",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boulton74",
}
@Article{Slysz:1974:ESS,
author = "William D. Slysz",
title = "An Evaluation of Statistical Software in the Social
Sciences",
journal = j-CACM,
volume = "17",
number = "6",
pages = "326--332",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:33 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Slysz74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7810 (Social and behavioural sciences computing)",
corpsource = "Univ. Connecticut, Storrs, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "bivariate; BMD; college; cost; DATA TEXT; descriptive
statistics; factor analysis; one way analysis of
variance; OSIRIS; Pearson correlation; performance;
regression; social and behavioural sciences; social
sciences; SPSS; statistical analysis; statistical
computation; statistical packages; statistical
software; tables; TSAR; university",
oldlabel = "Slysz74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Slysz74",
xxtitle = "An evaluation of software in the social sciences",
}
@Article{Adams:1974:CRC,
author = "John Adams and John Gary",
title = "Compact Representation of Contour Plots for Phone Line
Transmission",
journal = j-CACM,
volume = "17",
number = "6",
pages = "333--336",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#AdamsG74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Methods for the compact representation of contour
plots are described and tested. These are intended to
reduce the cost of transmitting contour plots over
phone lines. Some of these methods could be used to
transmit contour plots over voice grade phone lines.",
acknowledgement = ack-nhfb,
classcodes = "B6210D (Telephony); C5540 (Terminals and graphic
displays); C5600 (Data communication equipment and
techniques)",
classification = "723",
corpsource = "Nat. Center Atmospheric Res., Boulder, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compact representation; computer graphics; contour
plots; data compaction; data transmission; data
transmission systems; phone line; remote terminal;
transmission; voice grade phone lines",
oldlabel = "AdamsG74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AdamsG74",
}
@Article{Wulf:1974:HKM,
author = "William A. Wulf and Ellis S. Cohen and William M.
Corwin and Anita K. Jones and Roy Levin and C. Pierson
and Fred J. Pollack",
title = "{HYDRA}: The Kernel of a Multiprocessor Operating
System",
journal = j-CACM,
volume = "17",
number = "6",
pages = "337--345",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#WulfCCJLPP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes the design philosophy of HYDRA
the kernel of an operating system for C. mmp, the
Carnegie-Mellon Multi-Mini-Processor. This philosophy
is realized through the introduction of a generalized
notion of ``resource,'' both physical and virtual,
called an ``object.'' Mechanisms are presented for
dealing with objects, including the creation of new
types, specification of new operations applicable to a
given type, sharing, and protection of any reference to
a given object against improper application of any of
the operations defined with respect to that type of
object. The mechanisms provide a coherent basis for
extension of the system in two directions: the
introduction of new facilities, and the creation of
highly secure systems.",
acknowledgement = ack-nhfb,
annote = "Includes protection mechanism using capabilities
attached to references.",
classcodes = "C6150J (Operating systems)",
classification = "722",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; design philosophy; highly
secure systems; HYDRA; kernel; multiprocessing
programs; multiprocessor operating system; new
facilities; nucleus; operating systems (computers);
protection; security olit hydra capabilities; sharing",
oldlabel = "WulfCCJLPP74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WulfCCJLPP74",
}
@Article{Barton:1974:ITA,
author = "Ian J. Barton and Susan E. Creasey and Michael F.
Lynch and Michael J. Snell",
title = "An Information-Theoretic Approach to Text Searching in
Direct Access Systems",
journal = j-CACM,
volume = "17",
number = "6",
pages = "345--350",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:41 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BartonCLS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Using direct access computer files of bibliographic
information, an attempt is made to overcome one of the
problems often associated with information retrieval,
namely, the maintenance and use of large dictionaries,
the greater part of which is used only infrequently. A
novel method is presented, which maps the hyperbolic
frequency distribution. This is more suited to
implementation on storage devices. \par
This method treats text as a string of characters
rather than words bounded by spaces, and chooses
subsets of strings such that their frequencies of
occurrence are more even than those of word types. The
members of this subset are then used as index keys for
retrieval. The rectangular distribution of key
frequencies results in a much simplified file
organization and promises considerable cost
advantages.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 731",
corpsource = "Univ. Sheffield, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bibliographic information; bit vector; character
string; characteristics; computer files; data
processing --- File Organization; dictionaries; direct
access; direct access systems; file organisation; file
organization; hyperbolic frequency distribution of
text; index keys; information retrieval; information
theory; large; rectangular distribution; simplified
file organization; text searching",
oldlabel = "BartonCLS74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BartonCLS74",
}
@Article{Minieka:1974:CSS,
author = "Edward Minieka",
title = "On Computing Sets of Shortest Paths in a Graph",
journal = j-CACM,
volume = "17",
number = "6",
pages = "351--353",
month = jun,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "05C35",
MRnumber = "49 7178",
MRreviewer = "Torrence D. Parsons",
bibdate = "Mon Jan 22 07:04:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Minieka74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two algorithms are presented that construct the $k$
shortest paths between every pair of vertices in a
directed graph. These algorithms generalize the Floyd
algorithm and the Dantzig algorithm for finding the
shortest path between every pair of vertices in a
directed graph.",
acknowledgement = ack-nhfb,
classcodes = "C7190 (Other fields of business and administrative
computing)",
classification = "921",
corpsource = "Univ. Illinois, Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer aided analysis; critical path
analysis; Dantzig algorithm; directed graph; Floyd
algorithm; graph; mathematical techniques; network;
shortest path; shortest paths",
oldlabel = "Minieka74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Minieka74",
}
@Article{Ritchie:1974:UTS,
author = "Dennis M. Ritchie and Ken Thompson",
title = "The {UNIX} Time-Sharing System",
journal = j-CACM,
volume = "17",
number = "7",
pages = "365--375",
month = jul,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:12 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#RitchieT74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses the nature and implementation of
the file system and of the user command interface. UNIX
is a general-purpose, multi-user, interactive operating
system for the Digital Equipment Corporation
PDP-11\slash 40 and 11\slash 45 computers. It offers a
number of features seldom found even in larger
operating systems, including: (1) a hierarchical file
system incorporating demountable volumes; (2)
compatible file, device, and inter-process I/O; (3) the
ability to initiate asynchronous processes; (4) system
command language selectable on a per-user basis; and
(5) over 100 subsystems including a dozen languages.",
acknowledgement = ack-nhfb,
annote = "Interactive operating system for PDP-11, VAX with a
hierarchical file system incorporating demountable
volumes.",
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "asynchronous; command language; compatible file;
computer systems programming; demountable volumes; file
organisation; file system; hierarchical file system;
operating; operating systems (computers); processes;
sharing systems; system; system command language; time
sharing; time-; UNIX interactive operating system",
oldlabel = "RitchieT74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RitchieT74",
}
@Article{Fuller:1974:MTP,
author = "Samuel H. Fuller",
title = "Minimal-Total-Processing Time Drum and Disk Scheduling
Disciplines",
journal = j-CACM,
volume = "17",
number = "7",
pages = "376--381",
month = jul,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:35 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Fuller74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This article investigates the application of
minimal-total-processing-time (MTPT) scheduling
disciplines to rotating storage units when random
arrival of requests is allowed. Fixed-head drum and
moving-head disk storage units are considered, and
emphasis is placed on the relative merits of the MTPT
scheduling discipline with respect to the
shortest-latency-time-first (SLTF) scheduling
discipline. The results of the simulation studies
presented show that neither scheduling discipline is
unconditionally superior to the other.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; disc scheduling; drum
scheduling; fixed head drum; intra cylinder disc;
management; minimal total processing time; moving head
disc; operating systems (computers); rotating storage
units; scheduling; scheduling disciplines; shortest
latency time first; simulation; sorting; storage",
oldlabel = "Fuller74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fuller74",
}
@Article{Bruno:1974:SIT,
author = "John L. Bruno and Edward G. {Coffman, Jr.} and Ravi
Sethi",
title = "Scheduling Independent Tasks To Reduce Mean Finishing
Time",
journal = j-CACM,
volume = "17",
number = "7",
pages = "382--387",
month = jul,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35",
MRnumber = "50 9338",
MRreviewer = "John C. Gittins",
bibdate = "Mon Jan 22 06:28:38 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1974.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BrunoCS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A deterministic model of independent tasks is
introduced and new results are derived which extend and
generalize the algorithms known for minimizing mean
finishing time. In addition to presenting and analyzing
new algorithms it is shown that the most general
mean-finishing-time problem for independent tasks is
polynomial complete, hence unlikely to admit of a
non-enumerative solution.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C6150J (Operating systems)",
classification = "723",
corpsource = "Pennsylvania State Univ., University Park, PA, USA",
descriptors = "Scheduling; Finish Time",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACM; computer programming languages; deterministic
model; independent tasks; mean finishing time;
minimisation; minimize; minimizing mean finishing time;
minimizing mean flow time; operating systems
(computers); optimal; polynomial complete; scheduling;
scheduling algorithms; scheduling independent tasks;
sequencing algorithms; storage required",
oldlabel = "BrunoCS74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BrunoCS74",
}
@Article{Saltzer:1974:PCI,
author = "Jerome H. Saltzer",
title = "Protection and the Control of Information Sharing in
{Multics}",
journal = j-CACM,
volume = "17",
number = "7",
pages = "388--402",
month = jul,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Saltzer74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The design of mechanisms to control the sharing of
information in the Multics system is described. Five
design principles help provide insight into the
tradeoffs among different possible designs. The key
mechanisms described include access control lists,
hierarchical control of access specifications,
identification and authentication of users, and primary
memory protection. The paper ends with a discussion of
several known weaknesses in the current protection
mechanism design.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C6130 (Data handling
techniques); C6150J (Operating systems)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "access control lists; authentication; computer systems
programming; control; control of access specifications;
descriptors; design principles; hierarchical;
identification; information sharing; mechanism design;
Multics system; operating systems (computers);
operating virtual memory CACM; primary memory
protection; privacy; protection; security; security of
data; storage; time sharing systems; virtual; virtual
memory",
oldlabel = "Saltzer74a",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Saltzer74a",
}
@Article{Fabry:1974:CBA,
author = "Robert S. Fabry",
title = "Capability-Based Addressing",
journal = j-CACM,
volume = "17",
number = "7",
pages = "403--412",
month = jul,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;o
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Fabry74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Various addressing schemes making use of segment
tables are examined. The inadequacies of these schemes
when dealing with shared addresses are explained. These
inadequacies are traced to the lack of an efficient
absolute address for objects in these systems. The
direct use of a capability as an address is shown to
overcome these difficulties because it provides the
needed absolute address. Implementation of
capability-based addressing is discussed. It is
predicted that the use of tags to identify capabilities
will dominate. A hardware address translation scheme
which never requires the modification of the
representation of capabilities is suggested.",
acknowledgement = ack-nhfb,
annote = "The direct use of a capability as an address is shown
to be useful when dealing with shared addresses.
Implementation of capability-based addressing is
discussed.",
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "address translation scheme; addresses; addressing;
addressing hardware; addressing schemes; associative;
CACM memory management segments pages operating
security olit capabilities; capabilities; capability
based addressing; code; computer utility; data
structures; hardware; hash table; information retrieval
systems; information sharing; operating systems;
programming conventions; protection; protection
hardware; registers; security of data; segment tables;
shared; storage management; tagged architecture; tags",
oldlabel = "Fabry74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fabry74",
}
@Article{Popek:1974:FRV,
author = "Gerald J. Popek and Robert P. Goldberg",
title = "Formal Requirements for Virtualizable Third Generation
Architectures",
journal = j-CACM,
volume = "17",
number = "7",
pages = "412--421",
month = jul,
year = "1974",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/800009.808061",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "49 10177",
MRreviewer = "I. Kaufmann",
bibdate = "Mon Jan 22 07:13:00 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#PopekG74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Virtual machine systems have been implemented on a
limited number of third generation computer systems,
for example CP-67 on the IBM 360/67. The value of
virtual machine techniques to ease the development of
operating systems, to aid in program transferability,
and to allow the concurrent running of disparate
operating systems, test and diagnostic programs has
been well recognized. However, from previous empirical
studies, it is known that many third generation
computer systems, e.g. the DEC PDP-10, cannot support a
virtual machine system. In this paper, the hardware
architectural requirements for virtual machine systems
are discussed. First, a fairly specific definition of a
virtual machine is presented which includes the aspects
of efficiency, isolation, and identical behavior. A
model of third generation-like computer systems is then
developed. The model includes a processor with
supervisor and user modes, memory that has a simple
protection mechanism, and a trap facility. In this
context, instruction behavior is then carefully
characterized.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C7430 (Computer
engineering)",
classification = "722",
corpsource = "Univ. California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract model; architectures; computer architecture;
computer operating systems; formal requirements;
generation architecture; hypervisor; operating system;
sufficient conditions; systems; third; third generation
computer; virtual machine; virtual machine monitor;
virtual machines; virtual memory; virtualizable third
generation",
oldlabel = "PopekG74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PopekG74",
}
@Article{Hahn:1974:NTC,
author = "Bruce Hahn",
title = "A New Technique for Compression and Storage of Data",
journal = j-CACM,
volume = "17",
number = "8",
pages = "434--436",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:50 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Hahn74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes techniques that can, in most
cases, decrease storage size by a factor of from two to
four. The techniques involve special handling of
leading and trailing blanks, and the encoding of other
symbols in groups of fixed size as unique fixed point
numbers. The efficiency of the system is considered and
pertinent statistics are given and compared with
statistics for other information coding techniques.",
acknowledgement = ack-nhfb,
annote = "Generation of a character dictionary and its use to
minimize space.",
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "731",
corpsource = "Univ. Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "coding techniques; compression; data handling; data
management; data storage; efficiency; encoding; file
maintenance; file organisation; fixed point numbers;
information coding techniques; information theory;
programs; text compression; utility",
oldlabel = "Hahn74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hahn74",
}
@Article{Evans:1974:UAS,
author = "Arthur {Evans, Jr.} and William Kantrowitz and Edwin
Weiss",
title = "A User Authentication Scheme Not Requiring Secrecy in
the Computer",
journal = j-CACM,
volume = "17",
number = "8",
pages = "437--442",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:18 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#EvansKW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In many computer operating systems a user
authenticates himself by entering a secret password
known solely to himself and the system. The system
compares this password with one recorded in a Password
Table which is available to only the authentication
program. The integrity of the system depends on keeping
the table secret. In this paper a password scheme is
presented which does not require secrecy in the
computer. All aspects of the system, including all
relevant code and data bases, may be known by anyone
attempting to intrude. The scheme is based on using a
function H which the would-be intruder is unable to
invert. This function is applied to the user's password
and the result compared to a table entry, a match being
interpreted as authentication of the user. The intruder
may know all about H and have access to the table, but
he can penetrate the system only if he can invert H to
determine an input that produces a given output. This
paper discusses issues surrounding selection of a
suitable H.",
acknowledgement = ack-nhfb,
annote = "Password protection by irreversible transformation",
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "MIT, Lexington, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "authentication; computer operating systems;
cryptology; engineering problems; human; invert; one
way encryption; operating system security; operating
systems (computers); password scheme; security;
security of data; user authentication scheme",
oldlabel = "EvansKW74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EvansKW74",
}
@Article{Purdy:1974:HSL,
author = "George B. Purdy",
title = "A High Security Log-in Procedure",
journal = j-CACM,
volume = "17",
number = "8",
pages = "442--445",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:12 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Purdy74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The protection of time sharing systems from
unauthorized users is often achieved by the use of
passwords. By using one-way ciphers to code the
passwords, the risks involved with storing the
passwords in the computer can be avoided. The selection
of a suitable one-way cipher is discussed. It is
suggested that for this purpose polynomials over a
prime modulus are superior to one-way ciphers derived
from Shannon codes.",
acknowledgement = ack-nhfb,
annote = "Password protection by irreversible cryptographic
transformation",
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "Univ. Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "code; computer operating systems; cryptography; data
processing --- Security of Data; one way ciphers;
operating systems; operating systems (computers);
passwords; security; security of data; time sharing
systems",
oldlabel = "Purdy74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Purdy74",
}
@Article{Friedman:1974:ETR,
author = "Theodore D. Friedman and Lance J. Hoffman",
title = "Execution Time Requirements for Encipherment
Programs",
journal = j-CACM,
volume = "17",
number = "8",
pages = "445--449",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#FriedmanH74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/prng.bib",
note = "See letter \cite{McCarthy:1975:AFP}.",
abstract = "The time taken to decipher 20,000 words of data by
four additive methods on a Control Data 6400 computer
was measured using assembly language and Fortran
routines. Standard deviations were computed for 100
runs by each method, and from this the range of error
at the 95 percent confidence level was calculated. The
time required for selecting and fetching the plaintext
data and for storing the ciphertext was separately
measured (the ``null transformation'' ), and was then
compared with the times required by each enciphering
method. The enciphering processes required at least
four times as much cpu time when programmed in
Fortran.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "additive ciphers; assembly language; cpu;
cryptography; cryptology; data processing; double key
encipherment; enciphering time coefficient;
encipherment programs; errors; execution time;
experiments; Fortran; null; one word key; operating
systems (computers); privacy transformations;
protection; pseudo random key; security; security of
data; time; transformation",
oldlabel = "FriedmanH74",
treatment = "A Application; T Theoretical or Mathematical; X
Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FriedmanH74",
}
@Article{Neufeld:1974:GCC,
author = "G. A. Neufeld and John Tartar",
title = "Graph Coloring Conditions for the Existence of
Solutions to the Timetable Problem",
journal = j-CACM,
volume = "17",
number = "8",
pages = "450--453",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35",
MRnumber = "52 16594",
MRreviewer = "Ethan D. Bolker",
bibdate = "Mon Jan 22 07:07:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#NeufeldT74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A necessary and sufficient condition is presented for
the existence of a solution to the Gotlieb
class-teacher timetable problem. Several relationships
are established between the class-teacher timetable
problem and graphs with preconditions. These
preconditions place additional restrictions on the
coloration of a graph. The preconditions correspond to
the unavailability constraints and preassigned meetings
in the class-teacher timetable problem. Using some
recent results that convert graphs with preconditions
to graphs without them, it is shown that the existence
of a coloration of a graph is the required necessary
and sufficient condition.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C7110 (Educational
administration)",
classification = "912; 921",
corpsource = "Univ. Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "class-teacher timetable problem; class-teacher
timetables; coloration; educational administrative data
processing; graph colouring conditions; graph theory;
graphs; graphs with preconditions; mathematical
techniques; necessary and; operations research;
preassignment; prevention of assignment; scheduling;
sufficient condition; timetable problem",
oldlabel = "NeufeldT74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NeufeldT74",
}
@Article{Lamport:1974:NSD,
author = "Leslie Lamport",
title = "A New Solution of {Dijkstra}'s Concurrent Programming
Problem",
journal = j-CACM,
volume = "17",
number = "8",
pages = "453--455",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "49 8418",
MRreviewer = "James Howland",
bibdate = "Mon Jan 22 06:57:14 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lamport74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple solution to the mutual exclusion problem is
presented which allows the system to continue to
operate despite the failure of any individual
component.",
acknowledgement = ack-nhfb,
annote = "A solution which is more failure proof.",
classcodes = "C6150J (Operating systems)",
classification = "723",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; concurrent programming;
critical section; Dijkstra's concurrent programming
problem; failure; fault tolerant computing;
multiprocessing; multiprocessing programs; mutual
exclusion; semaphores",
oldlabel = "Lamport74a",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport74a",
}
@Article{Cavouras:1974:CPD,
author = "John C. Cavouras",
title = "On the Conversion of Programs to Decision Tables:
Method and Objectives",
journal = j-CACM,
volume = "17",
number = "8",
pages = "456--462",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Cavouras74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problems of converting programs to decision tables
are investigated. Objectives of these conversions are
mainly program debugging and optimization in practice.
Extensions to the theory of computation and
computability are suggested.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6110 (Systems analysis
and programming); C6150G (Diagnostic, testing,
debugging and evaluating systems)",
classification = "723",
corpsource = "Univ. Glasgow, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis; computability; computability and
decidability; computer systems programming; conversion
of programs; debugging; decision tables; objectives;
optimization; program; semantics; systems; theory of
programming",
oldlabel = "Cavouras74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cavouras74",
}
@Article{Lyche:1974:AAP,
author = "Tom Lyche and Larry L. Schumaker",
title = "{ACM Algorithm 480}: Procedures for computing
Smoothing and Interpolating Natural Splines [{E1}]",
journal = j-CACM,
volume = "17",
number = "8",
pages = "463--467",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#LycheS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Algol; approximation; coefficients; interpolating;
interpolation; natural sciences applications of
computers; natural splines; smoothing; spline
smoothing; splines (mathematics); subroutines",
oldlabel = "LycheS74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LycheS74",
}
@Article{Crandall:1974:AAA,
author = "Keith C. Crandall",
title = "{ACM Algorithm 481}: Arrow to Precedence Network
Transformation [{H}]",
journal = j-CACM,
volume = "17",
number = "8",
pages = "467--469",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Crandall74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7100 (Business and administration)",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "arrow convention; arrow convention networks; computer
aided analysis; convention; critical path; critical
path analysis; network transformation; precedence;
precedence networks; resource allocation; scheduling;
subroutines",
oldlabel = "Crandall74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Crandall74",
}
@Article{McKay:1974:AAT,
author = "John McKay and E. Regener",
title = "{ACM Algorithm 482}: Transitivity Sets [{G7}]",
journal = j-CACM,
volume = "17",
number = "8",
pages = "470--470",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:07 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#McKayR74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C7310 (Mathematics
computing)",
corpsource = "McGill Univ., Montreal, Que., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Algol; algorithm; graph; natural sciences applications
of computers; orbits; semigroup; set theory; sets;
spanning tree; subroutines; transitivity; transitivity
sets",
oldlabel = "McKayR74",
page = "470",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McKayR74",
}
@Article{Bultheel:1974:RAR,
author = "Adhemar Bultheel",
title = "Remark on ``{Algorithm 450}: {Rosenbrock} Function
Minimization''",
journal = j-CACM,
volume = "17",
number = "8",
pages = "470--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:47 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Bultheel74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Machura:1973:AAR,Klemes:1974:RAR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Bultheel74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bultheel74",
}
@Article{Stroud:1974:GHI,
author = "A. H. Stroud",
title = "{Gauss} Harmonic Interpolation Formulas",
journal = j-CACM,
volume = "17",
number = "8",
pages = "471--475",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D05",
MRnumber = "50 15265",
MRreviewer = "Stephen Hilbert",
bibdate = "Mon Jan 22 07:24:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Stroud74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Let $R$ be an open, bounded, simply connected region
in the $(x,y)$-plane and let $(x*,y*)$ be a point in
$R$. Assuming R is starlike with respect to $(x*,y*)$,
we discuss a method for computing Gauss harmonic
interpolation formulas for $R$ and the point $(x*,y*)$.
\par
Such formulas approximate a harmonic function at
$(x*,y*)$ in terms of a linear combination of its
values at certain selected points on the boundary of
$R$. Such formulas are useful for approximating the
solution of the Dirichlet problem for $R$.",
acknowledgement = ack-nhfb,
classification = "921",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Dirichlet problem; harmonic interpolation; harmonic
quadrature; interpolation; mathematical techniques;
quadrature",
oldlabel = "Stroud74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Stroud74",
}
@Article{Shere:1974:RAC,
author = "Kenneth D. Shere",
title = "Remark on ``{Algorithm 454}: The Complex Method for
Constrained Optimization''",
journal = j-CACM,
volume = "17",
number = "8",
pages = "471--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:00 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Shere74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Richardson:1973:AAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Shere74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shere74",
}
@Article{Lagerlof:1974:IRR,
author = "Rolf O. E. Lagerl{\"o}f",
title = "Interpolation with Rounded Ramp Functions",
journal = j-CACM,
volume = "17",
number = "8",
pages = "476--479",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:59 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Lagerlof74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new interpolation function is introduced. It has
infinitely many continuous derivatives and is a
composition of ramp functions with smoothed bends
called Rounded Ramp Functions. How the interpolation
function can be extended to more than one variable is
shown. An efficient Fortran program is given by which
the interpolation function can be obtained for a given
point set.",
acknowledgement = ack-nhfb,
classification = "921",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "mathematical techniques",
oldlabel = "Lagerlof74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lagerlof74",
xxauthor = "Rolf O. E. Lagerlof",
xxauthor = "Rolf O. E. Lagerloef",
}
@Article{Acton:1974:RRF,
author = "Forman S. Acton",
title = "Recurrence Relations for the {Fresnel} Integral
$\int_0^\infty[\exp(-ct)dt/(t)^{1/2}(1+t^2)]$ and
Similar Integrals",
journal = j-CACM,
volume = "17",
number = "8",
pages = "480--481",
month = aug,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D20 (33A70)",
MRnumber = "49 6554",
bibdate = "Mon Jan 22 06:20:27 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Acton74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The class of functions defined by
$\int_0^\infty[\exp(- cX)dt/(1+Y)(t^{1/2})^k]$ where
$X$ and $Y$ are either $t$ or $t^2$ and $k$ is $-1$,
$0$, or $1$ can be evaluated by recurrences for all but
small values of the parameter $c$. These recurrences,
given here, are more efficient than the usual
asymptotic series.",
acknowledgement = ack-nhfb,
classification = "921",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "exponential integral; Fresnel integral; mathematical
techniques; recurrence relations",
oldlabel = "Acton74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Acton74",
}
@Article{McCracken:1974:PLI,
author = "Daniel D. McCracken",
title = "A Problem-List of Issues Concerning Computers and
Public Policy --- {A} Report of the {ACM} Commitee on
Computers and Public Policy",
journal = j-CACM,
volume = "17",
number = "9",
pages = "495--503",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#McCracken74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "McCracken74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McCracken74",
}
@Article{Willers:1974:NIA,
author = "I. M. Willers",
title = "A New Integration Algorithm for Ordinary Differential
Equations Based on Continued Fraction Approximations",
journal = j-CACM,
volume = "17",
number = "9",
pages = "504--508",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65L05",
MRnumber = "49 8367",
MRreviewer = "G. D. Byrne",
bibdate = "Mon Jan 22 07:30:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Willers74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new integration algorithm is found, and an
implementation is compared with other programmed
algorithms. The new algorithm is a step-by-step
procedure for solving the initial value problem in
ordinary differential equations. It is designed to
approximate poles of small integer order in the
solutions of the differential equations by continued
fractions obtained by manipulating the sums of
truncated Taylor series expansions. The new method is
compared with Gragg-Bulirsh-Stoer, and the Taylor
series method. \par
The Taylor series method and the new method are shown
to be superior in speed and accuracy, while the new
method is shown to be most superior when the solution
is required near a singularity. The new method can
finally be seen to pass automatically through
singularities where all the other methods which are
discussed will have failed.",
acknowledgement = ack-nhfb,
classcodes = "B0290M (Numerical integration and differentiation);
B0290P (Differential equations); C4160 (Numerical
integration and differentiation); C4170 (Differential
equations)",
classification = "921",
corpsource = "CERN, Geneve, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "boundary-value problems; continued fraction
approximations; continued fractions; differential
equations; initial value problem; integration;
integration algorithm; mathematical techniques;
ordinary differential equations; program comparison;
singularities; singularity; step by step procedure;
Taylor series; Taylor series expansions",
oldlabel = "Willers74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Willers74",
}
@Article{Aberth:1974:PNA,
author = "Oliver Aberth",
title = "A Precise Numerical Analysis Program",
journal = j-CACM,
volume = "17",
number = "9",
pages = "509--513",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1974.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Aberth74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A description is given of a program for computing the
solution to a small number of standard numerical
analysis problems to any specified accuracy, up to a
limit of 2000 correct decimal places. \par
Each computed number is bounded in an interval with a
multiple precision midpoint. Arithmetic operations
involving these numbers are executed according to
interval arithmetic concepts, with non-significant
digits automatically discarded. Details are supplied of
problem specification and problem computation.",
acknowledgement = ack-nhfb,
classcodes = "B0290 (Numerical analysis); C4100 (Numerical
analysis); C7310 (Mathematics computing)",
classification = "921",
corpsource = "Texas A and M Univ., College Station, TX, USA",
country = "USA",
descriptors = "Method; realization; numerical method; optimization;
information system; program construction; error
control; interval arithmetic",
enum = "3",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arithmetic; arithmetic operations; error control;
interval; interval arithmetic; list structure;
mathematical techniques; methods; multiple; multiple
precision; natural sciences applications of computers;
numerical; numerical analysis; precision midpoint;
program; specified accuracy",
language = "English",
oldlabel = "Aberth74",
references = "11",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Aberth74",
}
@Article{Cheung:1974:IGD,
author = "To-yat. Cheung",
title = "Interactive Graphic Display for Region Partitioning by
Linear Programming",
journal = j-CACM,
volume = "17",
number = "9",
pages = "513--516",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Cheung74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Using linear programming, an interactive graphic
display system has been implemented to solve the region
design problem of partitioning a region into N
nonoverlapping subregions in such a way that their
areas are in specified proportions and that the total
cost of servicing them is a minimum. In a
conversational manner, a user can easily obtain
different partitionings by specifying and modifying the
boundary, the service centers' locations, the area
proportions, and the cost functions. Examples are
included.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C5540 (Terminals and graphic displays)",
classification = "723; 921",
corpsource = "Univ. Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "area proportions; area specification; boundary;
computer graphics; cost; cost functions; interactive
graphic display; interactive terminals; linear; linear
programming; mathematical programming, linear; minimum;
nonoverlapping subregions; of servicing; programming;
region design; region partitioning; service centers'
locations",
oldlabel = "Cheung74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cheung74",
}
@Article{Schkolnick:1974:ERT,
author = "Mario Schkolnick",
title = "The Equivalence of Reducing Transition Languages and
Deterministic Languages",
journal = j-CACM,
volume = "17",
number = "9",
pages = "517--519",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "49 8436",
bibdate = "Mon Jan 22 07:19:24 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Schkolnick74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The class of reducing transition languages introduced
by Eickel, Paul, Bauer, and Samelson was shown by
Morris to be a proper superclass of the simple
precedence languages. In this paper this result is
extended, showing that, in fact, the first class is
equivalent to the class of deterministic context free
languages.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; context free
languages; context-free languages; deterministic;
deterministic context free grammars; deterministic
context-free grammars; equivalence; languages;
precedence languages; reducing transition languages;
superclass; syntax controlled generators",
oldlabel = "Schkolnick74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schkolnick74",
}
@Article{Watkins:1974:AAM,
author = "Steven L. Watkins",
title = "{ACM Algorithm 483}: Masked Three-Dimensional Plot
Program with Rotations [{J6}]",
journal = j-CACM,
volume = "17",
number = "9",
pages = "520--523",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:27 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1973.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Watkins74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Feinstein:1975:RMT}.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6150E
(General utility programs)",
corpsource = "Univ. Texas, Austin, TX, USA",
country = "USA",
descriptors = "FORTRAN; graphics; application; method; human factors;
diagram manipulation; three-dimensional plot",
enum = "3241",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "complete computer programs; computer graphics; masked;
plot program; plotting; programs; rotations; three
dimensional plotting; three-dimensional plotting;
utility",
language = "English",
oldlabel = "Watkins74",
references = "0",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Watkins74",
}
@Article{Burrell:1974:AAE,
author = "Keith H. Burrell",
title = "{ACM Algorithm 484}: Evaluation of the Modified
{Bessel} Functions ${K}_0(z)$ and ${K}_1(z)$ for
Complex Arguments [{S17}]",
journal = j-CACM,
volume = "17",
number = "9",
pages = "524--526",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Burrell74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290D (Functional analysis); C4120 (Functional
analysis); C7310 (Mathematics computing)",
corpsource = "California Inst. Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; applications of computers; Bessel
functions; complex arguments; function evaluation;
Gauss-Hermite quadrature; Hankel functions; modified
Bessel functions; natural sciences; subroutines",
oldlabel = "Burrell74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Burrell74",
}
@Article{Eidson:1974:AAC,
author = "Harold D. Eidson and Larry L. Schumaker",
title = "{ACM Algorithm 485}: Computation of $g$-Splines via a
Factorization Method [{E2}]",
journal = j-CACM,
volume = "17",
number = "9",
pages = "526--530",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#EidsonS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximation; computation; computers; factorization
method; FORTRAN subroutines; function approximation;
g-splines; Hermite/Birkoff data; interpolating; natural
sciences applications of; spline approximation;
splines; splines (mathematics); subroutines",
oldlabel = "EidsonS74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EidsonS74",
}
@Article{Young:1974:FOA,
author = "John W. Young",
title = "A First Order Approximation to the Optimal Checkpoint
Interval",
journal = j-CACM,
volume = "17",
number = "9",
pages = "530--531",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:23 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Young74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
corpsource = "Martin Marietta Corp., Orlando, FL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "checkpoint; diagnostics; errors; first order
approximation; job failures; minimisation; minimize the
cost; operating systems (computers); optimum checkpoint
interval; program; programming checkpoint; random",
oldlabel = "Young74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Young74",
xxtitle = "A First Order Approximation to the Optimum Checkpoint
Interval",
}
@Article{Shwayder:1974:EIT,
author = "Keith Shwayder",
title = "Extending the Information Theory Approach to
Converting Limited-Entry Decision Tables to Computer
Programs",
journal = j-CACM,
volume = "17",
number = "9",
pages = "532--537",
month = sep,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:31 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Shwayder74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper modifies an earlier algorithm for
converting decision tables into flowcharts which
minimize subsequent execution time when compiled into a
computer program. The algorithms considered in this
paper perform limited search and, accordingly, do not
necessarily result in globally optimal solutions. There
is an analogy between the problem of converting
decision tables into efficient flowcharts and the
well-understood problem in information theory of
noiseless coding. The results of the noiseless coding
literature are used to explore the limitations of
algorithms used to solve the decision table problem.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6130 (Data
handling techniques)",
classification = "723",
corpsource = "Univ. Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "coding; computer programs; computer systems
programming; converting; converting decision tables;
decision tables; depth of search; flowcharting;
flowcharts; information theory approach; limited
search; list processing; noiseless channel; noiseless
coding; sorting",
oldlabel = "Shwayder74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shwayder74",
}
@Article{Hoare:1974:MOS,
author = "C. A. R. Hoare",
title = "Monitors: An Operating System Structuring Concept",
journal = j-CACM,
volume = "17",
number = "10",
pages = "549--557",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:23 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/ProbAlgs.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Hoare74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Erratum in {\em Communications of the ACM}, Vol. 18,
No. 2 (February), p. 95, 1975. This paper contains one
of the first solutions to the Dining Philosophers
problem.",
abstract = "This paper develops Brinch-Hansen's concept of a
monitor as a method of structuring an operating system.
It introduces a form of synchronization, describes a
possible method of implementation in terms of
semaphores and gives a suitable proof rule.
Illustrative examples include a single resource
scheduler, a bounded buffer, an alarm clock, a buffer
pool, a disk head optimizer, and a version of the
problem of readers and writers.",
acknowledgement = ack-nhfb,
annote = "Monitors",
checked = "7 April 1989",
classcodes = "C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Queen's Univ. Belfast, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "alarm clock; bounded buffer; buffer pool; CACM
synchronization communication semaphores; computer
operating systems; disc; exclusion; head optimizer;
monitors; multiprogramming; mutual; operating system
structuring concept; operating systems (computers);
proof rule; readers; scheduler; scheduling; semaphores;
single resource; structured multiprogramming;
structuring; synchronization; writers",
oldlabel = "Hoare74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hoare74",
}
@Article{Shen:1974:WBM,
author = "Kenneth K. Shen and James L. Peterson",
title = "A Weighted Buddy Method for Dynamic Storage
Allocation",
journal = j-CACM,
volume = "17",
number = "10",
pages = "558--562",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:58 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#ShenP74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Shen:1975:CWB}.",
abstract = "An extension of the buddy method, called the weighted
buddy method, for dynamic storage allocation is
presented. The weighted buddy method allows block sizes
of $2^k$ and $3(2^k)$, whereas the original buddy
method allowed only block sizes of $2^k$. This
extension is achieved at an additional cost of only two
bits per block. Simulation results are presented which
compare this method with the buddy method. These
results indicate that for a uniform request
distribution, the buddy system has less total memory
fragmentation than the weighted buddy algorithm.
However, the total fragmentation is smaller for the
weighted buddy method when the requests are for
exponentially distributed block sizes.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "allocation; buddy; buddy systems; computer operating
systems; dynamic storage allocation; exponentially
distributed block sizes; file organisation;
fragmentation; memory allocation; operating systems
(computers); simulation; storage; system; total memory;
uniform request distribution; weighted buddy algorithm;
weighted buddy method",
oldlabel = "ShenP74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShenP74",
}
@Article{Slutz:1974:NCA,
author = "Donald R. Slutz and Irving L. Traiger",
title = "A note on the calculation of average working set
size",
journal = j-CACM,
volume = "17",
number = "10",
pages = "563--565",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SlutzT74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Finite-length reference string of arbitrary structure
are considered, and an exact expression for average
working set size in terms of ``corrected'' interference
interval statistics is derived. An example is
discussed; upper and lower bounds are obtained; and the
average working set size function is shown to be
efficiently obtained for a set of page sizes, in a
single pass of the reference string. This work follows
the developments of a paper by Denning and Schwartz,
who consider infinite-length reference strings which
satisfy certain statistical properties and who derive
an expression relating the asymptotic average working
set size to the asymptotic missing page rate function
under working set replacement.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "IBM, San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrary structure; average working set size;
computer operating systems; data structures; finite
length reference string; interference interval
statistics; operating systems (computers); page;
paging; program behaviour; sizes; storage; virtual;
working set model",
oldlabel = "SlutzT74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SlutzT74",
xxtitle = "A Note on the Calculation Working Set Size",
}
@Article{Shneiderman:1974:SDS,
author = "Ben Shneiderman and Peter Scheuermann",
title = "Structured Data Structures",
journal = j-CACM,
volume = "17",
number = "10",
pages = "566--574",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#ShneidermanS74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Programming systems which permit arbitrary linked list
structures enable the user to create complicated
structures without sufficient protection. Deletions can
result in unreachable data elements, and there is no
guarantee that additions will be performed properly. To
remedy this situation, this paper proposes a data
structure description and manipulation language which
provides for the creation of a restricted class of data
structures but ensures the correctness of the program.
This is accomplished by an explicit structure
declaration facility, a restriction on the permissible
operations, and execution-time checks.",
acknowledgement = ack-nhfb,
annote = "Operations on linked structures.",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Indiana Univ., Bloomington, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrary linked list; base management system; data;
data processing; Data Structure Description and
Manipulation; data structures; execution; explicit
structure declaration facility; Language; storage
management; structured data structures; structured
programming; structures; time checks",
oldlabel = "ShneidermanS74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShneidermanS74",
}
@Article{Canaday:1974:BEC,
author = "R. H. Canaday and R. D. Harrison and Evan L. Ivie and
J. L. Ryder and L. A. Wehr",
title = "A Back-end Computer for Data Base Management",
journal = j-CACM,
volume = "17",
number = "10",
pages = "575--582",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:25 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#CanadayHIRW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "It is proposed that the data base management function
be placed on a dedicated back-end computer which
accepts commands (in a relatively high level language
such as the CODASYL Data Base Task Group, April 1971
Report) from a host computer, accesses the data base on
secondary storage, and returns results. The advantages
of such a configuration are discussed. An experimental
implementation, called the Experimental Data Management
System, XDAMS, is described and certain conclusions
about the back-end approach are drawn from this
implementation.",
acknowledgement = ack-nhfb,
annote = "Physical separation of data base management from data
processing to gain flexibility, etc. in the XDMS
system.",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Bell Telephone Labs. Inc., Piscataway, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "back end computer; computer configurations; computer
networks; data base management; Data base Task; data
processing; digital communication systems; eXperimental
Data Management System; Group Language; host computer;
secondary storage; storage management",
oldlabel = "CanadayHIRW74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CanadayHIRW74",
}
@Article{Charnes:1974:GTP,
author = "A. Charnes and W. M. Raike and J. D. Stutz and A. S.
Walters",
title = "On Generation of Test Problems for Linear Programming
Codes",
journal = j-CACM,
volume = "17",
number = "10",
pages = "583--586",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#CharnesRSW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a theoretical justification and an
illustrative implementation of a method for generating
linear programming test problems with known solutions.
The method permits the generation of test problems that
are of arbitrary size and have a wide range of
numerical characteristics.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C6130 (Data handling techniques)",
classification = "723; 921",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accuracy; codes; computer programming; data handling;
large; linear programming; linear programming codes;
LP; LP program validation; mathematical programming,
linear; program evaluation; scale linear programming
codes; test problem generation; test problems",
oldlabel = "CharnesRSW74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CharnesRSW74",
}
@Article{Veillon:1974:AAN,
author = "Francoise Veillon",
title = "{ACM Algorithm 486}: Numerical Inversion of {Laplace}
Transform",
journal = j-CACM,
volume = "17",
number = "10",
pages = "587--589",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Veillon74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Koppelaar:1976:RNI,Veillon:1977:RNI}.",
acknowledgement = ack-nhfb,
classcodes = "B0230 (Integral transforms); C1130 (Integral
transforms); C7310 (Mathematics computing)",
corpsource = "Univ. Grenoble, France",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computers; inversion; Laplace transform; Laplace
transforms; natural sciences applications of; numerical
inversion; subroutines",
oldlabel = "Veillon74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Veillon74",
}
@Article{Koppelaar:1974:CRA,
author = "Henk Koppelaar",
title = "Certification and Remark on ``{Algorithm 191}:
Hypergeometric''",
journal = j-CACM,
volume = "17",
number = "10",
pages = "589--590",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Kopelaar74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Relph:1963:AAH}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Utrecht State Univ., Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; hypergeometric; improvements; inefficiency;
natural sciences applications of computers;
subroutines",
oldlabel = "Kopelaar74",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kopelaar74",
}
@Article{Proll:1974:RAC,
author = "L. G. Proll",
title = "Remark on ``{Algorithm 431}: {A} Computer Routine for
Quadratic and Linear Programming Problems''",
journal = j-CACM,
volume = "17",
number = "10",
pages = "590--590",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Proll74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ravindran:1972:AAC,Ravindran:1974:RAC}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "Univ. Leeds, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computer routine; computers; linear
programming; natural sciences applications of;
programming; quadratic and linear; quadratic
programming; subroutines",
oldlabel = "Proll74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Proll74",
}
@Article{Klemes:1974:RAR,
author = "Jiri Klemes and Jaroslav Klemsa",
title = "Remark on ``{Algorithm 450}: {Rosenbrock} Function
Minimization''",
journal = j-CACM,
volume = "17",
number = "10",
pages = "590--591",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#KlemesK74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Machura:1973:AAR,Bultheel:1974:RAR}.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C7310 (Mathematics computing)",
corpsource = "CHEPOS, Brno, Czechoslovakia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; minimisation; natural sciences applications
of computers; Rosenbrock function minimization",
oldlabel = "KlemesK74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KlemesK74",
}
@Article{Krogh:1974:EEI,
author = "Fred T. Krogh",
title = "Errata: ``{Efficient Implementation of a Variable
Projection Algorithm for Nonlinear Least Squares}''",
journal = j-CACM,
volume = "17",
number = "10",
pages = "591--591",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue May 28 14:52:27 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Krogh:1974:EIV}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Gilchrist:1974:EFT,
author = "Bruce Gilchrist and Richard E. Weber",
title = "Enumerating Full-Time Programmers",
journal = j-CACM,
volume = "17",
number = "10",
pages = "592--593",
month = oct,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#GilchristW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Data from the 1970 Census and the Department of
Labor's Area Wage Surveys are used to derive estimates
of the number of full-time programmers employed during
the years 1969 through 1973. The 1973 figure of 180,000
is considerably less than suggested in earlier reports.
It is recommended that educational administrators
consider whether the many courses aimed at training
programmers are justified on a vocational basis.",
acknowledgement = ack-nhfb,
classification = "723; 912",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming",
oldlabel = "GilchristW74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GilchristW74",
}
@Article{Sterling:1974:GHC,
author = "Theodor D. Sterling",
title = "Guidelines for Humanizing Computerized Information
Systems, {A} Report from {Stanley House}",
journal = j-CACM,
volume = "17",
number = "11",
pages = "609--613",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:12 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Sterling74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This report is the result of an intensive analysis of
conditions that may humanize or dehumanize participants
in various computerized systems. The guidelines
presented here were generated during a week-long
workshop sponsored in August 1973 by Canada Council at
Canada Council's Stanley House.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C7100 (Business and
administration)",
classification = "723; 901",
corpsource = "Simon Fraser Univ., Burnaby, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computerized information systems; economic and
sociological effects; guidelines; humanizing;
information retrieval systems; management information;
systems",
oldlabel = "Sterling74",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sterling74",
}
@Article{Ferrari:1974:ILC,
author = "Domenico Ferrari",
title = "Improving Locality by Critical Working Sets",
journal = j-CACM,
volume = "17",
number = "11",
pages = "614--620",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/cache.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ferrari74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new approach to program locality improvement via
restructuring is described. The method is particularly
suited to those systems where primary memory is managed
according to a working set strategy. It is based on the
concept of critical working set, a working set which
does not contain the next memory reference. The data
the method operates upon are extracted from a trace of
the program to be restructured. It is shown that,
except in some special cases, the method is not
optimum. However, the experimental results obtained by
using the method to restructure an interactive text
editor and the file system module of an operating
system have shown its substantial superiority over the
other methods proposed in the literature.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; critical working set;
dynamic restructuring; file organisation; improvement;
locality; memory hierarchies; multiprogramming; program
restructuring; program segmentation; restructuring;
restructuring techniques; static; virtual memory;
working set strategy",
oldlabel = "Ferrari74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ferrari74",
}
@Article{Miller:1974:LOP,
author = "Perry Lowell Miller",
title = "A Locally-Organized Parser for Spoken Input",
journal = j-CACM,
volume = "17",
number = "11",
pages = "621--630",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Miller74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes LPARS, a locally-organized
parsing system, designed for use in a continuous speech
recognizer. LPARS processes a string of phonemes which
contains ambiguity and error. The system is
locally-organized in the sense that it builds local
parse structures from reliable word candidates
recognized anywhere in an input utterance. These local
structures are used as ``islands of reliability'' to
guide the search for more highly garbled words which
might complete the utterance.",
acknowledgement = ack-nhfb,
classcodes = "C5530 (Pattern recognition and computer vision
equipment)",
classification = "723; 751",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "augmented; local parsing; parsing; speech recognition;
speech understanding; transition networks",
oldlabel = "Miller74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Miller74",
}
@Article{Rader:1974:MCS,
author = "Gary M. Rader",
title = "Method for Composing Simple Traditional Music by
Computer",
journal = j-CACM,
volume = "17",
number = "11",
pages = "631--638",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:14:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Rader74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is described for composing musical rounds by
computer. This method uses some music theory plus
additional heuristics. Fundamental to the method is a
set of productions together with sets of applicability
rules and weight rules which operate on the productions
deciding when and to what extent they are available for
use. Several rounds generated by the computer
implementation of the method are presented. Generally,
the resultant music sounds mediocre to the professional
although usually pleasing to the layman. It appears
that full-blown music theory is not needed for rounds
--- all the hardware required for structural levels is
not necessary for these pieces. The author has tried to
address both musicians and computer scientists.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7820 (Humanities
computing)",
classification = "461; 723; 912",
corpsource = "Univ. Pennsylvania, Philadelphia, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; computer composition;
computer music; formal; heuristic programming;
humanities; languages; models of cognitive processes;
music theory; probabilistic grammars; systems science
and cybernetics; traditional musical rounds",
oldlabel = "Rader74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rader74",
}
@Article{Freiburghouse:1974:RAU,
author = "R. A. Freiburghouse",
title = "Register Allocation Via Usage Counts",
journal = j-CACM,
volume = "17",
number = "11",
pages = "638--642",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Freiburghouse74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper introduces the notion of usage counts,
shows how usage counts can be developed by algorithms
that eliminate redundant computations, and describes
how usage counts can provide the basis for register
allocation. The paper compares register allocation
based on usage counts to other commonly used register
allocation techniques, and presents evidence which
shows that the usage count technique is significantly
better than these other techniques.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation)",
classification = "723",
corpsource = "Honeywell Information Systems Inc., Cambridge, MA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "common subexpressions; compilers; computations;
computer programming; demand paging; languages;
optimization; programming; redundant; register
allocation; storage allocation; usage counts; virtual
memory",
oldlabel = "Freiburghouse74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Freiburghouse74",
}
@Article{Dijkstra:1974:SSS,
author = "Edsger W. Dijkstra",
title = "Self-stabilizing Systems in Spite of Distributed
Control",
journal = j-CACM,
volume = "17",
number = "11",
pages = "643--644",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:08 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/traces.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Dijkstra74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4220 (Automata theory); C6150J (Operating systems)",
corpsource = "Burroughs Corp., Nuenen, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(computers); automata theory; distributed control;
error recovery; fault tolerant computing; harmonious
cooperation; multiprocessing; mutual exclusion;
networks; operating systems; robustness; self repair;
self stabilization; sharing; synchronization",
oldlabel = "Dijkstra74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dijkstra74",
}
@Article{Brown:1974:SDM,
author = "J. A. Brown and Bernard Werner",
title = "An On-Site Data Management System Application in Field
Archaeology",
journal = j-CACM,
volume = "17",
number = "11",
pages = "644--646",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#BrownW74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7820 (Humanities
computing)",
corpsource = "Northwestern Univ., Evanston, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "APL-PLUS; archaeology; data management system; field
archaeology; file organisation; on site; prehistoric
site; retrieval systems",
oldlabel = "BrownW74",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BrownW74",
}
@Article{Hanson:1974:STR,
author = "David R. Hanson",
title = "A simple technique for representing strings in
{Fortran IV}",
journal = j-CACM,
volume = "17",
number = "11",
pages = "646--647",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:24 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Hanson74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation); C6140D (High level languages)",
corpsource = "Univ. Arizona, Tucson, AZ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structures; FORTRAN; FORTRAN IV; programming;
representing strings; string processing; structured",
oldlabel = "Hanson74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hanson74",
}
@Article{VanRijsbergen:1974:BMP,
author = "C. J. {Van Rijsbergen}",
title = "The Best-Match Problem in Document Retrieval",
journal = j-CACM,
volume = "17",
number = "11",
pages = "648--649",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Rijsbergen74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
corpsource = "Monash Univ., Clayton, Vic., Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "best match; classification; clustering; dissimilarity;
document retrieval; file searching; hierarchy;
information retrieval; matching",
oldlabel = "Rijsbergen74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rijsbergen74",
xxauthor = "C. J. {van Rijsbergen}",
}
@Article{Evans:1974:MEL,
author = "R. V. Evans",
title = "Multiple exits from a loop using neither {GO TO} nor
labels",
journal = j-CACM,
volume = "17",
number = "11",
pages = "650--650",
month = nov,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:15 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Evans74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "ICL Dataskil, Reading, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "control structures; exit statement; GO TO; go to free
programming; labels; multiple exits from loops;
programming",
oldlabel = "Evans74",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Evans74",
}
@Article{Knuth:1974:CPA,
author = "Donald E. Knuth",
title = "Computer Programming as an Art",
journal = j-CACM,
volume = "17",
number = "12",
pages = "667--673",
month = dec,
year = "1974",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/361604.361612",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Knuth74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "French translation, with three supplementary
paragraphs, in {\sl L'Informatique Nouvelle}, No.\ 64
(June 1975), 20--27. Japanese translation by Makoto
Arisawa in {\sl bit\/ \bf 7} (1975), 434--444;
reprinted in {\sl Kunusu Sensei no Program-Ron\/} (see
under Books), 2--19. English version reprinted with the
supplementary paragraphs in {\sl ACM Turing Award
Lectures: The First Twenty Years} (New York: ACM Press,
1987), 33--46; reprinted with corrections in
\cite[pp.~1--16]{Knuth:1992:LP}. Russian translation by
V. V. Martyn\t iuk in {\sl Lektsii laureatov premii
T'\t\i uringa\/} (Moscow: Mir, 1993), 48--64.",
abstract = "Discussion emphasizes that computer programming is an
art as well as a science.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "art; computer; computer programming; programming;
quality",
oldlabel = "Knuth74",
remark = "This is the 1974 ACM Turing Award Lecture.",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knuth74",
}
@Article{Press:1974:AMC,
author = "Laurance I. Press",
title = "Arguments for a Moratorium on the Construction of a
Community Information Utility",
journal = j-CACM,
volume = "17",
number = "12",
pages = "674--678",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:13:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Press74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this article the author urges a prudent and
decentralized approach to the question of the design
and desirability of computerized community information
utilities. Current proposals for community information
utilities are examined in this framework, and the
conclusion is drawn that society is not yet in a
position to justify either the construction of an
information utility in a prototype community or the
acceptance of a policy in favor of its widespread
implementation.",
acknowledgement = ack-nhfb,
classcodes = "C7210 (Information services and centres)",
classification = "723",
corpsource = "Univ. Southern California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "community information utility; construction;
decentralized; demand; design; desirability; effects;
feasibility; information services; side; techniques;
users; world view",
oldlabel = "Press74",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Press74",
xxauthor = "Larry Press",
}
@Article{Strauss:1974:AMH,
author = "Jon C. Strauss",
title = "An analytic model of the {Hasp} execution task
monitor",
journal = j-CACM,
volume = "17",
number = "12",
pages = "679--685",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:41 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Strauss74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple analytic model has been developed for
investigating the effects of the HASP Execution Task
Monitor on the performance of a multiprogramming
system. A specific example is worked through in detail,
and numerical results are reported. The model
demonstrates the effect of the HETM priority algorithm
and permits the evaluation of possible modifications to
the algorithm.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems); C6150J (Operating systems)",
classification = "723",
corpsource = "Washington Univ., St. Louis, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(computers); analytic model; computer selection and
evaluation; computer systems programming; dispatching;
execution task monitor; HASP; hasp execution task
monitor; operating systems; OS/360; performance
evaluation; scheduling",
oldlabel = "Strauss74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Strauss74",
}
@Article{Adam:1974:CLS,
author = "Thomas L. Adam and K. Mani Chandy and J. R. Dickson",
title = "A Comparison of List Schedules for Parallel Processing
Systems",
journal = j-CACM,
volume = "17",
number = "12",
pages = "685--690",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:31 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/OVR.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#AdamCD74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem of scheduling two or more processors to
minimize the execution time of a program which consists
of a set of partially ordered tasks is studied. Cases
where task execution times are deterministic and others
in which execution times are random variables are
analyzed. It is shown that different algorithms
suggested in the literature vary significantly in
execution time and that the B-schedule of Coffman and
Graham is near-optimal. A dynamic programming solution
for the case in which execution times are random
variables is presented.",
acknowledgement = ack-nhfb,
classcodes = "C5400 (Analogue and digital computers and systems);
C6150J (Operating systems)",
classification = "722",
corpsource = "Univ. Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "comparison; computer systems, digital; dynamic
programming; list schedules; list scheduling;
optimisation; optimization; parallel processing;
parallel processing systems; precedence graphs;
scheduling",
oldlabel = "AdamCD74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AdamCD74",
}
@Article{Wallace:1974:CGG,
author = "N. D. Wallace",
title = "Computer Generation of Gamma Random Variates with
Non-Integral Shape Parameters",
journal = j-CACM,
volume = "17",
number = "12",
pages = "691--695",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "51 11920",
MRreviewer = "R. R. Coveyou",
bibdate = "Mon Jan 22 07:27:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Wallace74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "When the shape parameter, alpha, is integral,
generating gamma random variables with a digital
computer is straightforward. There is no simple method
for generating gamma random variates with non-integral
shape parameters. A common procedure is to
approximately generate such random variables by the use
of the so-called probability switch method. Another
procedure, which is exact, is due to Joehnk. This paper
presents a rejection method for exactly generating
gamma random variables when alpha is greater than 1.
The efficiency of the rejection method is shown to be
better than the efficiency of M. D. Joehnk's method.
The paper concludes that when alpha is non-integral,
the following mix of procedures yields the best
combination of accuracy and efficiency: (1) when alpha
is less than 1, use Joehnk's method; (2) when 1 is less
than alpha and alpha is less than 5, use the rejection
method; (3) when alpha is greater than 5, use the
probability switch method.",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
classification = "922",
corpsource = "Southern Illinois Univ., Edwardsville, IL, USA",
country = "USA",
descriptors = "RVG",
enum = "8007",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer generation; gamma random variables;
probability; probability distribution; random number
generation; random numbers; simulation",
language = "English",
location = "SEL: Wi",
oldlabel = "Wallace74",
references = "0",
revision = "16/01/94",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wallace74",
}
@Article{Salazar:1974:GFS,
author = "A. Salazar and R. V. Oakford",
title = "A Graph Formulation of a School Scheduling Algorithm",
journal = j-CACM,
volume = "17",
number = "12",
pages = "696--698",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35",
MRnumber = "51 12313",
MRreviewer = "I. Gh. Ciobanu",
bibdate = "Mon Jan 22 07:17:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#SalazarO74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Korfhage:1975:SO,Korfhage:1975:MSO,Garey:1975:SO}.",
abstract = "The problem classically titled ``The Examination
Schedule Problem'' takes various forms in the
literature. Most of these formulations can be presented
in the terminology of classical Network Theory.
\par
One such formulation is: Given a nondirected network,
partition its nodes into a minimal number of subsets
such that no two members of the same subset are
connected by an arc. An obvious lower limit to this
number is the size of the largest strongly connected
subgraph. Kirchgassner proved that an upper limit is
this size plus one. One logical extension of the
previous work is the introduction of variable length
examinations where $W(I)$ is the number of periods for
exam $I$. The object of this paper is to generalize the
definition of largest strongly connected subgraph to
include the weighting of nodes, to present an
approximate algorithm which usually finds the largest
strongly connected subgraph, and to discuss the
application of this algorithm to the solution of school
scheduling and exam scheduling problems.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C1290F (Systems theory applications in
industry)C7110 (Educational administration)",
classification = "723; 921",
corpsource = "Stanford Univ., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; data processing;
educational administrative data processing;
examination; examination scheduling; graph; graph
coloring; graph theory; mathematical techniques ---
Graph Theory; nondirected network; scheduling; school;
school scheduling; strongly connected; strongly
connected subgraph; subgraph",
oldlabel = "SalazarO74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SalazarO74",
}
@Article{Chu:1974:EMS,
author = "Sherwood C. Chu and Mones Berman",
title = "An Exponential Method for the Solution of Systems of
Ordinary Differential Equations",
journal = j-CACM,
volume = "17",
number = "12",
pages = "699--702",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65L99",
MRnumber = "51 4685",
MRreviewer = "W. H. Enright",
bibdate = "Mon Jan 22 06:31:11 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#ChuB74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An explicit, coupled, single-step method for the
numerical solution of initial value problems for
systems of ordinary differential equations is
presented. \par
The method was designed to be general purpose in nature
but to be especially efficient when dealing with stiff
systems of differential equations. It is, in general,
second order except for the case of a linear system
with constant coefficients and linear forcing terms; in
that case, the method is third order. It has been
implemented and put to routine usage in biological
applications-where stiffness frequently appears-with
favorable results. When compared to a standard fourth
order Runge--Kutta implementation, computation time
required by this method has ranged from comparable for
certain nonstiff problems to better than two orders of
magnitude faster for some highly stiff systems.",
acknowledgement = ack-nhfb,
classcodes = "B0290P (Differential equations); C4170 (Differential
equations)",
classification = "921",
corpsource = "Nat. Cancer Inst., Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "boundary-value problems; initial; initial value
problems; mathematical techniques; numerical methods;
numerical solution; ordinary differential equations;
stiff systems; value problems",
oldlabel = "ChuB74",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChuB74",
}
@Article{Pomeranz:1974:AAE,
author = "John Pomeranz",
title = "{ACM Algorithm 487}: Exact Cumulative Distribution of
the {Kolmogorov--Smirnov} Statistic for Small Samples",
journal = j-CACM,
volume = "17",
number = "12",
pages = "703--704",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:56 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Pomeranz74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Pomeranz:1976:REC}.",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Purdue Univ., West Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; exact cumulative distribution; FORTRAN;
Kolmogorov Smirnov test; natural sciences applications
of computers; small samples; statistic; statistics;
subroutines",
oldlabel = "Pomeranz74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pomeranz74",
}
@Article{Brent:1974:AAG,
author = "Richard P. Brent",
title = "{ACM Algorithm 488}: {A} {Gaussian} pseudo-random
number generator [{G5}]",
journal = j-CACM,
volume = "17",
number = "12",
pages = "704--706",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:05 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Brent74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7890 (Other special applications of computing)",
corpsource = "Australian Nat. Univ., Canberra, Australia",
country = "USA",
descriptors = "RVG",
enum = "7061",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "distribution; FORTRAN; Gaussian; generator; GRAND;
normal distribution; pseudo random numbers; random
number generation; random numbers; subroutines",
language = "English",
location = "SEL: Wi",
oldlabel = "Brent74",
references = "0",
revision = "16/01/94",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brent74",
}
@Article{Bron:1974:RAM,
author = "C. Bron",
title = "Remark on ``{Algorithm 426}: Merge Sort Algorithm''",
journal = j-CACM,
volume = "17",
number = "12",
pages = "706--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:11 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Bron74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Bron:1972:AAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Bron74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bron74",
}
@Article{Ellis:1974:RAHb,
author = "T. M. R. Ellis",
title = "Remark on ``{Algorithm 420}: Hidden-Line Plotting
Program''",
journal = j-CACM,
volume = "17",
number = "12",
pages = "706--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:51 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Ellis74a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remarks
\cite{Williamson:1972:AAH,Macleod:1973:RAH,Williamson:1973:RAH,Ellis:1974:RAHa,Gaither:1974:RAH,Gautschi:1964:AAI}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Ellis74a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ellis74a",
}
@Article{Tesch:1974:RAR,
author = "Gerhard Tesch",
title = "Remark on ``{Algorithm 456}: Routing Problem''",
journal = j-CACM,
volume = "17",
number = "12",
pages = "706--??",
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Tesch74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Fencl:1973:AAR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Tesch74",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tesch74",
}
@Article{Skinner:1974:HAI,
author = "C. William Skinner",
title = "Heuristic Approach to Inductive Inference in Fact
Retrieval Systems",
journal = j-CACM,
volume = "17",
number = "12",
pages = "707--712",
month = dec,
year = "1974",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:17 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm17.html#Skinner74;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Heuristic procedures are presented which have been
developed to perform inferences by generalizing from
available information. The procedures make use of a
similarity structure which is imposed on the data base
using nonnumerical clustering algorithms. They are
implemented in a model fact retrieval system which uses
a formal query language and a property-list data
structure. A program of experiments is described
wherein the procedures are used with test data bases
which are altered by deleting part of the data and by
purposely introducing false data. It is found that the
system can infer the correct response under a variety
of conditions involving incomplete and inconsistent
data.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7100 (Business and
administration); C7250 (Information storage and
retrieval)",
classification = "723; 901",
corpsource = "North Carolina State Univ., Raleigh, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "clustering; fact retrieval; file organisation; formal
query language; heuristic programming; heuristics;
inductive; inference; information; information
retrieval systems; management information systems;
retrieval systems",
oldlabel = "Skinner74",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Skinner74",
}
@Article{Willoughby:1975:SIH,
author = "Ralph A. Willoughby",
title = "Special Issue Honoring {Alston S. Householder} ---
{Editor}'s Foreword",
journal = j-CACM,
volume = "18",
number = "1",
pages = "3--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Willoughby75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Willoughby75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Willoughby75",
}
@Article{Finerman:1975:PCF,
author = "Aaron Finerman",
title = "Professionalism in the Computing Field",
journal = j-CACM,
volume = "18",
number = "1",
pages = "4--9",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Finerman75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Each of the four types of institutions --- academic,
industry, government, and the professional society ---
that educate, employ, regulate, and mold the
practitioner contributes to the ``nonprofessional''
status of the computing practitioner. The roles of
these institutions are examined, various shortcomings
are noted, and recommended changes are suggested.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
classification = "723; 912",
corpsource = "State Univ. of New York, Stony Brook, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "academic; computers; computing; computing
practitioner; economic and sociological effects;
education; educational programmes; employment;
government; industry; professional society;
professionalism; social standards; technical
standards",
oldlabel = "Finerman75",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Finerman75",
}
@Article{Bauer:1975:PN,
author = "Friedrich L. Bauer",
title = "Positivity and Norms",
journal = j-CACM,
volume = "18",
number = "1",
pages = "9--13",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F35 (15A60 47A30)",
MRnumber = "54 6476",
bibdate = "Mon Jan 22 06:23:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Bauer75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}.",
abstract = "Following some lines of joint work with A. S.
Householder, the character and use of algebraic methods
in the theory of norms is demonstrated. New results
concerning norms with values in an Archimedian vector
lattice (not necessarily being totally ordered) are
given, in particular for the generalization of order
unit norms, L-norms and M-norms. An example of
application to operator norms is given concerning
contraction properties of positive operators.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "Math. Inst., Tech. Univ. of Munich, Munich, West
Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "absolute; algebraic methods; Archimedian vector
lattice; contraction; L norms; M norms; mathematical
techniques; matrices; matrix algebra; methods;
monotonic; norms; numerical; numerical methods;
numerical range; operator norms; order; positive
operators; positivity; positivity cones; properties;
unit norms; vector lattice; vectors",
oldlabel = "Bauer75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bauer75",
}
@Article{Todd:1975:LC,
author = "John Todd",
title = "The Lemniscate Constants",
journal = j-CACM,
volume = "18",
number = "1",
pages = "14--19",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D20",
MRnumber = "51 11935",
MRreviewer = "L. Fox",
bibdate = "Mon Jan 22 07:26:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Todd75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}. See corrigendum \cite{Todd:1975:CLC}.",
abstract = "The lemniscate constants, and indeed some of the
methods used for actually computing them, have played
an enormous part in the development of mathematics. An
account is given here of some of the methods used ---
most of the derivations can be made by elementary
methods. This material can be used for teaching
purposes, and there is much relevant and interesting
historical material. The acceleration methods developed
for the purpose of evaluating these constants are
useful in other problems.",
acknowledgement = ack-nhfb,
classcodes = "B0290D (Functional analysis); B0290Z (Other numerical
methods); C4120 (Functional analysis); C4190 (Other
numerical methods)",
classification = "921",
corpsource = "California Inst. of Technol., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "acceleration; acceleration methods; elliptic
functions; Euler transformation; function evaluation;
lemniscate; lemniscate constants; mathematical
techniques; mathematics; transforms",
oldlabel = "Todd75",
treatment = "B Bibliography; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Todd75",
}
@Article{Peters:1975:SGJ,
author = "G. Peters and James Hardy Wilkinson",
title = "On the Stability of {Gauss--Jordan} Elimination with
Pivoting",
journal = j-CACM,
volume = "18",
number = "1",
pages = "20--24",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F05 (65G05)",
MRnumber = "51 7261",
MRreviewer = "L. B. Rall",
bibdate = "Mon Jan 22 07:12:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#PetersW75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}",
abstract = "The stability of the Gauss--Jordan algorithm with
partial pivoting for the solution of general systems of
linear equations is commonly regarded as suspect.
\par
It is shown that in many respects suspicions are
unfounded, and in general the absolute error in the
solution is strictly comparable with that corresponding
to Gaussian elimination with partial pivoting plus back
substitution. However, when A is ill conditioned, the
residual corresponding to the Gauss--Jordan solution
will often be much greater than that corresponding to
the Gaussian elimination solution.",
acknowledgement = ack-nhfb,
classcodes = "B0290B (Error analysis in numerical methods); B0290H
(Linear algebra); C4110 (Error analysis in numerical
methods); C4140 (Linear algebra)",
classification = "921",
corpsource = "Nat. Phys. Lab., Teddington, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "absolute error; back-substitution; backward error
analysis; bound for residual; bounds for error in
solution; elimination; error analysis; Gauss Jordan
algorithm; Gauss--Jordan algorithm; Gauss/Jordan;
Gaussian elimination; linear algebra; linear equations;
mathematical techniques; numerical methods; stability",
oldlabel = "PetersW75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PetersW75",
}
@Article{Birkhoff:1975:THN,
author = "Garrett Birkhoff",
title = "Two {Hadamard} Numbers for Matrices",
journal = j-CACM,
volume = "18",
number = "1",
pages = "25--29",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F35",
MRnumber = "51 9464",
MRreviewer = "John Todd",
bibdate = "Mon Jan 22 06:26:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Birkhoff75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}.",
abstract = "A discussion is given of two functions of the entries
of a square matrix, both related to Hadamard's
determinant theorem, which have some merits as
alternatives to norm-bound ``condition numbers''. One
(for linear systems) is known; the other (for
eigensystems) seems to be new.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "condition numbers; eigen systems; eigenvalues; error
analysis; Gram--Schmidt orthogonalization; Gram/Schmidt
organisation; Hadamard numbers; Hadamard's determinant;
linear systems; mathematical techniques; matrices;
matrix algebra; norm bound 'condition numbers'; norms;
square matrix; theorem",
oldlabel = "Birkhoff75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Birkhoff75",
}
@Article{vanderSluis:1975:PEN,
author = "A. {van der Sluis}",
title = "Perturbations of Eigenvalues of Non-Normal Matrices",
journal = j-CACM,
volume = "18",
number = "1",
pages = "30--36",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F15",
MRnumber = "51 9457a",
MRreviewer = "Jan Zitko",
bibdate = "Mon Jan 22 07:22:32 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/gvl.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Sluis75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}. See corrigendum
\cite{vanderSluis:1975:CPE}.",
abstract = "The problem considered is to give bounds for finite
perturbations of simple and multiple eigenvalues
$lambda_i$ of nonnormal matrices, where these bounds
are in terms of the eigenvalues $\{\lambda_i\}$, the
departure from normality $\sigma$, and the Frobenius
norm of the perturbation matrix, but not in terms of
the eigensystem. The bounds which are derived are shown
to be almost attainable for any set of all matrices of
given $\{\lambda_i\}$ and $\sigma$.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "Univ. of Utrecht, Utrecht, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "circles; departure from normality; eigenvalues;
eigenvalues and eigenfunctions; Frobenius norm;
Gershgorin; Gershgorin circles; mathematical
techniques; matrix algebra; non-normal matrices;
nonnormal matrices; perturbation of eigenvalues;
perturbations",
oldlabel = "Sluis75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sluis75",
}
@Article{Marcus:1975:EDT,
author = "Marvin Marcus and Herbert Robinson",
title = "Elementary Divisors of Tensor Products",
journal = j-CACM,
volume = "18",
number = "1",
pages = "36--39",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "15A69",
MRnumber = "51 571",
MRreviewer = "George P. Barker",
bibdate = "Mon Jan 22 07:01:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#MarcusR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The elementary divisors of a tensor product of linear
transformations have been known for 40 years. This
paper provides a short, easily accessible proof of
these results, and points out an interesting
combinatorial consequence of the proof.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "Univ. of California, Santa Barbara, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial; combinatorial mathematics; consequence;
elementary divisors; linear transformations;
mathematical techniques; matrix algebra; tensor
products; tensors",
oldlabel = "MarcusR75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MarcusR75",
}
@Article{Hestenes:1975:PCG,
author = "Magnus R. Hestenes",
title = "Pseudoinverses and Conjugate Gradients",
journal = j-CACM,
volume = "18",
number = "1",
pages = "40--43",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F20",
MRnumber = "51 2269",
MRreviewer = "G. Maess",
bibdate = "Mon Jan 22 06:49:43 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Hestenes75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}",
abstract = "This paper is devoted to the study of connections
between pseudoinverses of matrices and conjugate
gradients and conjugate direction routines.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cg; conjugate direction routines; conjugate gradients;
ginv; hermitian matrix; mathematical techniques;
matrices; matrix algebra; minimisation; minimization;
nla; pseudoinverse; pseudoinverses",
oldlabel = "Hestenes75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hestenes75",
}
@Article{Mills:1975:NMC,
author = "Harlan D. Mills",
title = "The New Math of Computer Programming",
journal = j-CACM,
volume = "18",
number = "1",
pages = "43--48",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "51 2333a",
MRreviewer = "E. Ikaunieks",
bibdate = "Mon Jan 22 07:04:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/softeng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Mills75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}. See corrigendum \cite{Mills:1975:CNM}.",
abstract = "Structured programming has proved to be an important
methodology for systematic program design and
development. Structured programs are identified as
compound function expressions in the algebra of
functions. The algebraic properties of these function
expressions permit the reformulation (expansion as well
as reduction) of a nested subexpression independently
of its environment, thus modeling what is known as
stepwise program refinement as well as program
execution. Finally, structured programming is
characterized in terms of the selection and solution of
certain elementary equations defined in the algebra of
functions. These solutions can be given in general
formulas, each involving a single parameter, which
display the entire freedom available in creating
correct structure programs.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723; 921",
corpsource = "IBM Federal Systems Div., Owego, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algebraic properties; compound; computer metatheory;
computer programming; function expressions;
mathematical techniques; program correctness; program
execution; programming; programming theory; structured;
systematic program design",
oldlabel = "Mills75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mills75",
}
@Article{Chen:1975:SER,
author = "Tien Chi Chen and Irving T. Ho",
title = "Storage-Efficient Representation of Decimal Data",
journal = j-CACM,
volume = "18",
number = "1",
pages = "49--52",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94A15 (68A20)",
MRnumber = "50 16105",
MRreviewer = "R. N. Goss",
bibdate = "Mon Jan 22 06:30:44 MST 2001",
bibsource = "Compendex database;
ftp://garbo.uwasa.fi/pc/doc-soft/fpbibl18.zip;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ChenH75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}. See comment \cite{Smith:1975:CPC}.",
abstract = "Usually n decimal digits are represented by 4n bits in
computers. Actually, two BCD digits can be compressed
optimally and reversibly into 7 bits, and three digits
into 10 bits, by a very simple algorithm based on the
fixed-length combination of two variable field-length
encodings. In over half of the cases the compressed
code results from the conventional BCD code by simple
removal of redundant 0 bits. A long decimal message can
be subdivided into three-digit blocks, and separately
compressed; the result differs from the asymptotic
minimum length by only 0.34 percent. The hardware
requirement is small, and the mappings can be done
manually.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "722; 921",
corpsource = "IBM San Jose Res. Lab., CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "asymptotic minimum; binary coded decimal; codes;
compressed code; data compression; data storage units;
decimal data; fixed length combination; hardware;
length; length encodings; mathematical techniques ---
Digital Arithmetic; representation; storage efficient;
variable field",
oldlabel = "ChenH75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChenH75",
}
@Article{Liniger:1975:CBA,
author = "Werner Liniger",
title = "Connections Between Accuracy and Stability Properties
of Linear Multistep Formulas",
journal = j-CACM,
volume = "18",
number = "1",
pages = "53--56",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65L05",
MRnumber = "51 2291",
MRreviewer = "Ian Gladwell",
bibdate = "Mon Jan 22 06:59:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Liniger75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}",
abstract = "This paper is concerned with stability and accuracy of
families of linear $k$-step formulas depending on
parameters, with particular emphasis on the numerical
solution of stiff ordinary differential equations.
\par
An upper bound, $p=k$, is derived for the order of
accuracy of $A(\infty)$-stable formulas. Three criteria
are given for A$(0)$-stability. It is shown that (1)
for $p=k$, $k$ arbitrary, $A(\infty)$-stability implies
certain necessary conditions for $A(0)$-stability and
for strict stability (meaning that the extraneous roots
of $p(\psi)$ satisfy $|\psi|<1$); (2) for $p=k=2,3,4,
\mbox{and} 5$, $A(\infty)$-stability (for $k=5$
together with another constraint) implies strict
stability; and (3) for certain one-parameter classes of
formulas with $p=k=3,4,\mbox{and/or} 5$,
$A(\infty)$-stability implies $A(0)$-stability.",
acknowledgement = ack-nhfb,
classcodes = "B0290B (Error analysis in numerical methods); B0290P
(Differential equations); C4110 (Error analysis in
numerical methods); C4170 (Differential equations)",
classification = "921",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "A(0)-stability; A(inf)-stability; accuracy;
differential equations; error analysis; linear
multistep formulas; mathematical techniques; numerical;
numerical methods; order of accuracy; parametrised
linear multistep formulae; parametrized linear
multistep formulas; solution; stability; stiff
equations; stiff ordinary differential equations;
strict stability",
oldlabel = "Liniger75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Liniger75",
}
@Article{Hanson:1975:SUM,
author = "Richard J. Hanson",
title = "Stably Updating Mean and Standard Deviation of Data",
journal = j-CACM,
volume = "18",
number = "1",
pages = "57--58",
month = jan,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "62-04",
MRnumber = "51 7064",
MRreviewer = "D. J. Evans",
bibdate = "Mon Jan 22 06:48:25 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Hanson75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Collection of articles honoring {Alston S.
Householder}. See remark \cite{Cotton:1975:RSU}.",
abstract = "By considering the (sample) mean of a set of data as a
fit to this data by a constant function, a
computational method is given based on a matrix
formulation and Givens transformations. The (sample)
mean and standard deviation can be updated as data
accumulates. The procedure is numerically stable and
does not require storage of the data. Methods for
dealing with weighted data and data removal are
presented. When updating the mean and square of the
standard deviation, the process requires no square
roots.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
classification = "921",
corpsource = "Washington State Univ., Pullman, WA, USA",
country = "USA",
descriptors = "Simulation; statistics; numeric calculation",
enum = "7357",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "data removal; estimation; function approximation;
Givens; iterative methods; least squares approximation;
mathematical statistics; mathematical techniques;
matrix formulation; mean; stably updating; standard
deviation; theory; transformations; weighted data",
language = "English",
oldlabel = "Hanson75",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hanson75",
}
@Article{Burnett:1975:AIM,
author = "G. J. Burnett and Edward G. {Coffman, Jr.}",
title = "Analysis of Interleaved Memory Systems Using Blockage
Buffers",
journal = j-CACM,
volume = "18",
number = "2",
pages = "91--95",
month = feb,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#BurnettC75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A model of interleaved memory systems is presented,
and the analysis of the model by Monte Carlo simulation
is discussed. The simulations investigate the
performance of various system structures, i.e., schemes
for sending instruction and data requests to the memory
system. Performance is measured by determining the
distribution of the number of memory modules in
operation during a memory cycle.",
acknowledgement = ack-nhfb,
classcodes = "C5310 (Storage system design); C6120 (File
organisation)",
classification = "723",
corpsource = "Index Systems Inc., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "blockage buffers; data requests; data storage,
digital; file organisation; interleaved memory systems;
memory cycle; memory modules; Monte Carlo methods;
Monte Carlo simulation; simulation; storage;
structures; system; units",
oldlabel = "BurnettC75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BurnettC75",
}
@Article{Goldman:1975:SPC,
author = "Neil M. Goldman",
title = "Sentence Paraphrasing from a Conceptual Base",
journal = j-CACM,
volume = "18",
number = "2",
pages = "96--106",
month = feb,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Goldman75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A model of natural language generation based on an
underlying language-free representation of meaning is
described. A program based on this model is able to
produce sentence paraphrases which demonstrate
understanding with respect to a given context. This
generator operates in conjunction with a natural
language analyzer and a combined memory and inference
model. In generating sentences from meaning structures,
the program employs both the information retrieval and
deduction capabilities of the memory model.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7820 (Humanities
computing)",
classification = "721",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; automata theory; conceptual
base; conceptual properties; dictionary; discrimination
nets; formal grammar; information retrieval; knowledge;
language translation and; linguistics; memory and
inference; model; natural language; sentence
paraphrasing; surface grammatical; syntactic roles;
systems science and cybernetics --- Artificial
Intelligence; word sense",
oldlabel = "Goldman75",
treatment = "X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Goldman75",
}
@Article{VanderBrug:1975:SSP,
author = "Gordon J. van der Brug and Jack Minker",
title = "State-Space, Problem-Reduction, and Theorem Proving
--- Some Relationships",
journal = j-CACM,
volume = "18",
number = "2",
pages = "107--115",
month = feb,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A45",
MRnumber = "54 9192",
MRreviewer = "Walter Oberschelp",
bibdate = "Mon Jan 22 06:28:35 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/nonmono.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#BrugM75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper suggests a bidirectional relationship
between state-space and problem-reduction
representations. It presents a formalism based on
multiple-input and multiple-output operators which
provides a basis for viewing the two types of
representations in this manner. A representation of the
language recognition problem which is based on the J.
Cocke parsing algorithm is used as an illustration. A
method for representing problems in first-order logic
in such a way that the inference system employed by a
resolution-based theorem prover determines whether the
set of clauses is interpreted in the state-space mode
or in the problem-reduction mode is presented.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C1310 (Control system
analysis and synthesis methods)",
classification = "461; 731",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; Cocke parsing algorithm;
first order logic; inference; input-resolution;
language recognition problem; linear resolution;
multiple input operators; multiple output; operators;
problem reduction; proving; resolution based theorem
prover; state space; state-space methods; system;
systems science and cybernetics; theorem; theorem
proving",
oldlabel = "BrugM75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BrugM75",
}
@Article{Skovgaard:1975:RAJ,
author = "Ove Skovgaard",
title = "Remark on ``{Algorithm 332}: {Jacobi} Polynomials''",
journal = j-CACM,
volume = "18",
number = "2",
pages = "116--117",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Skovgaard75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Witte:1968:AAJ}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Skovgaard75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Skovgaard75",
}
@Article{Knight:1975:CAC,
author = "William J. Knight",
title = "Certification of ``{Algorithm 451}: {Chi-Square}
Quantiles''",
journal = j-CACM,
volume = "18",
number = "2",
pages = "116--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Knight75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Goldstein:1973:AAC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Knight75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knight75",
}
@Article{Hancock:1975:RAE,
author = "T. W. Hancock",
title = "Remark on ``{Algorithm 434}: Exact Probabilities for
{$R \times C$} Contingency Tables''",
journal = j-CACM,
volume = "18",
number = "2",
pages = "117--119",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Hancock75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Boulton:1974:RAE,March:1972:AAE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Hancock75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hancock75",
}
@Article{Magnuski:1975:RAM,
author = "H. S. Magnuski",
title = "Remark on ``{Algorithm 479}: {A} Minimal Spanning Tree
Clustering Method''",
journal = j-CACM,
volume = "18",
number = "2",
pages = "119--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:00 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Magnuski75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Page:1974:AAM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Magnuski75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Magnuski75",
}
@Article{Syslo:1975:RAE,
author = "Maciej M. Syslo",
title = "Remark on ``{Algorithm 459}: The Elementary Circuits
of a Graph''",
journal = j-CACM,
volume = "18",
number = "2",
pages = "119--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Syslo75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Syslo:1973:AAE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Syslo75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Syslo75",
}
@Article{Kimme:1975:FCA,
author = "Carolyn Kimme and Dana Ballard and Jack Sklansky",
title = "Finding Circles by an Array of Accumulators",
journal = j-CACM,
volume = "18",
number = "2",
pages = "120--122",
month = feb,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:49 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Reverse.eng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#KimmeBS75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient procedure for detecting approximate
circles and approximately circular arcs of varying gray
levels in an edge-enhanced digitized picture is
described.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C5530
(Pattern recognition and computer vision equipment);
C7330 (Biology and medical computing)",
classification = "723; 741",
corpsource = "Univ. of California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximate circles; array of accumulators; biomedical
applications of computers; circle finding; circular
arcs; curve detection; edge enhanced digitised; grey
levels; Haugh straight line finder; line fitting;
pattern recognition; pattern recognition systems;
picture; picture processing",
oldlabel = "KimmeBS75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KimmeBS75",
}
@Article{McCarthy:1975:AFP,
author = "John McCarthy",
title = "{ACM Forum}: {Proposed} Criterion for a Cipher to be
Probable-Word-Proof",
journal = j-CACM,
volume = "18",
number = "2",
pages = "131--132",
month = feb,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Jul 26 10:24:13 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/prng.bib",
note = "See \cite{Friedman:1974:ETR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Johnston:1975:MRE,
author = "H. C. Johnston and C. A. R. Hoare",
title = "Matrix Reduction --- an Efficient Method (school
timetables)",
journal = j-CACM,
volume = "18",
number = "3",
pages = "141--150",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65K05",
MRnumber = "52 2203",
MRreviewer = "P. Brock",
bibdate = "Mon Jan 22 06:53:01 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#JohnstonH75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes an efficient method for reduction
of the binary matrices which arise in some school
time-tabling problems. It is a development of that
described by John Lions. It has been generalized and
adapted to fit into the complete timetabling process;
to use a more compact data representation and more
efficient processing techniques; to take fuller
advantage of possible available previous knowledge
about the matrix. And it is designed as a structured
program, which can readily be coded by the reader in
the high level or low level programming language of his
choice. Practical tests of the method have shown it to
be a good basis for a realistic timetabling
algorithm.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C7110
(Educational administration)",
classification = "921",
corpsource = "Queen's Univ. of Belfast, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary matrices; data representation; educational
administrative data processing; high level programming
language; low level programming language; mathematical
techniques; matrix algebra; matrix reduction; problems;
processing techniques; school time tabling; school
timetable construction; structured program; structured
programming; tight set; timetabling algorithm",
oldlabel = "JohnstonH75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JohnstonH75",
}
@Article{Kernighan:1975:STM,
author = "Brian W. Kernighan and Lorinda L. Cherry",
title = "A System for Typesetting Mathematics",
journal = j-CACM,
volume = "18",
number = "3",
pages = "151--157",
month = mar,
year = "1975",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360680.360684",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:33 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#KernighanC75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/unix.bib",
abstract = "This paper describes the design and implementation of
a system for typesetting mathematics.\par
The language has been designed to be easy to learn and
to use by people (for example, secretaries and
mathematical typists) who know neither mathematics nor
typesetting. Experience indicates that the language can
be learned in an hour or so, for it has few rules and
fewer exceptions. For typical expressions, the size and
font changes, positioning, line drawing, and the like
necessary to print according to mathematical
conventions are all done automatically. For example,
the input {\tt sum from i = 0 to infinity x sub i = pi
over 2} produces $ \sum_{i = 0}^\infty x_i = \pi / 2
$. The syntax of the language is specified by a small
context-free grammar; a compiler-compiler is used to
make a compiler that translates this language into
typesetting commands. Output maybe produced on either a
phototypesetter or on a terminal with forward and
reverse half-line motions. The system interfaces
directly with text formatting programs, so mixtures of
text and mathematics may be handled simply. This paper
was typeset by the authors using the system
described.",
acknowledgement = ack-nhfb,
author-dates = "Lorinda L. Cherry (18 November 1944--February 2022)",
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages); C7230 (Publishing and reproduction); C7310
(Mathematics computing)",
classification = "723; 745",
corpsource = "Bell Labs., Holmdel, NJ, USA",
country = "USA",
date = "15/05/84",
descriptors = "Design; realization; command language; graphics
language; text processing; graphics; interactive mode",
enum = "1645",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compiler-compiler; computer controlled typesetting;
computer graphics; computer programming languages;
graphics; mathematics; oriented languages;
photocomposition; phototypesetter; printing; problem;
syntax; terminal; text formatting programs; text
processing.; typesetting; typesetting mathematics",
language = "English",
oldlabel = "KernighanC75",
references = "7",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KernighanC75",
xxpages = "151--157",
}
@Article{Lawrie:1975:GPL,
author = "Duncan H. Lawrie and T. Layman and D. Baer and J. M.
Randal",
title = "{GLYPNIR} --- {A} programming language for {Illiac
IV}",
journal = j-CACM,
volume = "18",
number = "3",
pages = "157--164",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#LawrieLBR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "GLYPNIR is one of the earliest existing languages
designed for programming the Illiac IV computer. The
syntax of the language is based on ALGOL 60, but has
been extended to allow the programmer explicitly to
specify the parallelism of his algorithm in terms of
64-word vectors. This paper describes the
characteristics, goals, and philosophy of the language,
and discusses some of the problems associated with
parallel computer architectures.",
acknowledgement = ack-nhfb,
classcodes = "C5400 (Analogue and digital computers and systems);
C6140B (Machine-oriented languages)",
classification = "723",
corpsource = "Univ. of Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ALGOL 60; algorithm; computer programming languages;
GLYPNIR; GLYPNIR programming; Illiac IV computer;
language; machine oriented languages; parallel computer
architectures; parallel processing; parallelism;
programming language; syntax",
oldlabel = "LawrieLBR75",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LawrieLBR75",
}
@Article{Floyd:1975:ETB,
author = "Robert W. Floyd and Ronald L. Rivest",
title = "Expected Time Bounds for Selection",
journal = j-CACM,
volume = "18",
number = "3",
pages = "165--172",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#FloydR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new selection algorithm is presented which is shown
to be very efficient on the average, both theoretically
and practically. The number of comparisons used to
select the $i$-th smallest of $n$ numbers is $n +
\min(i,n-i) + o(n)$. A lower bound within 9 percent of
the above formula is also derived.",
acknowledgement = ack-nhfb,
author-dates = "Robert W. Floyd (8 June 1936--25 September 2001)",
classcodes = "C4240 (Programming and algorithm theory); C7310
(Mathematics computing)",
classification = "723",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; bound; computational complexity;
computer programming; mathematics; medians; quantiles;
selection; selection algorithm; time bounds",
oldlabel = "FloydR75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FloydR75",
}
@Article{Floyd:1975:AAA,
author = "Robert W. Floyd and Ronald L. Rivest",
title = "{ACM Algorithm 489}: The Algorithm {SELECT} --- for
Finding the $i$th Smallest of $n$ Elements [{M1}]",
journal = j-CACM,
volume = "18",
number = "3",
pages = "173--173",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:04 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#FloydR75a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See also \cite{Brown:1976:RAS}.",
acknowledgement = ack-nhfb,
author-dates = "Robert W. Floyd (8 June 1936--25 September 2001)",
classcodes = "C7310 (Mathematics computing)",
corpsource = "Computer Sci. Dept., Stanford Univ., Stanford, CA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm SELECT; Hoare's algorithm FIND; mathematics;
sampling; subroutines",
oldlabel = "FloydR75a",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FloydR75a",
}
@Article{Whitt:1975:ASA,
author = "Jerry D. Whitt and A. Gale Sullenberger",
title = "The Algorithm Sequential Access Method: An Alternative
to Index Sequential",
journal = j-CACM,
volume = "18",
number = "3",
pages = "174--176",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#WhittS75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "WhittS75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WhittS75",
}
@Article{Karp:1975:RGM,
author = "Richard Alan Karp",
title = "A Reply to {Gentleman} and {Marovich}",
journal = j-CACM,
volume = "18",
number = "3",
pages = "174--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Karp75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Karp75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Karp75",
}
@Article{Erisman:1975:CCE,
author = "A. M. Erisman and W. F. Tinney",
title = "On Computing Certain Elements of the Inverse of a
Sparse Matrix",
journal = j-CACM,
volume = "18",
number = "3",
pages = "177--179",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F05",
MRnumber = "51 14540",
MRreviewer = "L. Hageman",
bibdate = "Mon Jan 22 06:38:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ErismanT75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A recursive algorithm for computing the inverse of a
matrix from the LU factors based on relationships in
Takahashi, et al., is examined. The formulas for the
algorithm are given; the dependency relationships are
derived; the computational costs are developed; and
some general comments on application and stability are
made.",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
classification = "921",
corpsource = "Boeing Computer Services, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "application; computational costs; computing; covar;
dependency relationships; elements of inverse; inverse;
inverse matrix; mathematical techniques; matrix
algebra; nla; recursive algorithm; sensitivities;
sparse; sparse matrices; sparse matrix; stability;
triangular factorization; tridiagonal matrix",
oldlabel = "ErismanT75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ErismanT75",
}
@Article{Shampine:1975:DLS,
author = "L. F. Shampine",
title = "Discrete Least Squares Polynomial Fits",
journal = j-CACM,
volume = "18",
number = "3",
pages = "179--180",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65D10",
MRnumber = "51 2247",
MRreviewer = "S. F. McCormick",
bibdate = "Mon Jan 22 07:20:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Shampine75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The recurrence relation between orthogonal polynomials
is widely used for discrete least squares data fitting.
A variant of the classical algorithm which has better
numerical properties is presented and the reason for
its improved performance is explained.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation)",
classification = "921",
corpsource = "Sandia Labs., Albuquerque, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; data fitting; least squares; least squares
approximations; least squares polynomial fits; lud;
mathematical techniques; orthogonal polynomials;
polynomials; recurrence relation between orthogonal
polynomials; residual; scale",
oldlabel = "Shampine75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shampine75",
}
@Article{vanderSluis:1975:CPE,
author = "A. {van der Sluis}",
title = "Corrigendum: {``Perturbations of eigenvalues of
non-normal matrices''}",
journal = j-CACM,
volume = "18",
number = "3",
pages = "180",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65F15",
MRnumber = "51 9457b",
MRreviewer = "Jan Zitko",
bibdate = "Tue May 28 16:24:24 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{vanderSluis:1975:PEN}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Parnas:1975:SCS,
author = "David Lorge Parnas",
title = "On a Solution to the Cigarette Smoker's Problem
(Without Conditional Statements)",
journal = j-CACM,
volume = "18",
number = "3",
pages = "181--183",
month = mar,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:22 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Parnas75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This report discusses a problem first introduced by
Patil, who has claimed that the cigarette smoker's
problem cannot be solved using the $P$ and $V$
operations introduced by Dijkstra unless conditional
statements are used. An examination of Patil's proof
shows that he has established this claim only under
strong restrictions on the use of $P$ and $V$. These
restrictions eliminate programming techniques used by
Dijkstra and others since the first introduction of the
semaphore concept. This paper contains a solution to
the problem. It also discusses the need for the
generalized operators suggested by Patil.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Tech. Hochschule Darmstadt, Darmstadt, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cigarette smoker's problem; co-operating processes;
computer operating systems; conditional statements;
generalized; operating systems; operating systems
(computers); operators; process synchronization
primitives; programming techniques; semaphore concept;
synchronisation",
oldlabel = "Parnas75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Parnas75",
}
@Article{Chambers:1975:CNH,
author = "Jack A. Chambers and Ray V. Poore",
title = "Computer Networks in Higher Education:
Socio-Economic-Political Factors",
journal = j-CACM,
volume = "18",
number = "4",
pages = "193--199",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:11 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ChambersP75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This study presents the results of a nationwide survey
of computer networks in higher education conducted
during 1971-73. Five major and 18 minor networks were
identified. The five major networks included: the ARPA
Net, the California State College network, the
University of Iowa\slash Iowa State University network,
the Michigan Educational Research Information Triad,
Inc., and the Triangle Universities Computation Center
network in North Carolina. In-depth studies were
conducted of the latter two nets. Based on the
experiences of these operating networks, a number of
factors are identified for consideration in developing
networks. Finally, recommendations are advanced
regarding the development of networks in higher
education in the future.",
acknowledgement = ack-nhfb,
classcodes = "C5400 (Analogue and digital computers and systems);
C7110 (Educational administration); C7810C
(Computer-aided instruction)",
classification = "722; 723; 901",
corpsource = "Univ. of South Florida, Tampa, FL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative data processing; ARPA; California
State; College network; computer aided instruction;
computer networking; computer networks; computer
systems, digital --- Time Sharing; data processing;
educational; higher education; Michigan Education
Research Information Triad Inc; nationwide survey; net;
network; social economic and political factors;
Triangle; Universities Computation Centre network;
University of Iowa/Iowa State University",
oldlabel = "ChambersP75",
treatment = "E Economic",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChambersP75",
}
@Article{Ginsberg:1975:AAD,
author = "E. S. Ginsberg and Dorothy Zaborowski",
title = "{ACM Algorithm 490}: The Dilogarithm Function of a
Real Argument [{S22}]",
journal = j-CACM,
volume = "18",
number = "4",
pages = "200--202",
month = apr,
year = "1975",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360715.360722",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#GinsbergZ75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/elefunt.bib",
note = "See also \cite{Morris:1976:RDF}.",
acknowledgement = ack-nhfb,
citedby = "Fullerton:1980:BEM",
classcodes = "B0290D (Functional analysis); C4120 (Functional
analysis); C7310 (Mathematics computing)",
corpsource = "Dept. of Phys., Univ. of Massachusetts, Boston, MA,
USA",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dilogarithm function; electrodynamics; ferromagnets;
function evaluation; function subroutine; ideal;
library; network analysis; polymers; quantum; real
argument; subprograms; subroutines; thermodynamics",
oldlabel = "GinsbergZ75",
remark = "Fullerton: FORTRAN routine accurate to 15 digits for
evaluating $ \operatorname {Li}_2 (x) = - \int_0^\infty
\frac {\ln (1 z)z} \, d z $.",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GinsbergZ75",
}
@Article{Shen:1975:CWB,
author = "K. K. Shen and J. L. Peterson",
title = "Corrigendum: ``{A Weighted Buddy Method for Dynamic
Storage Allocation}''",
journal = j-CACM,
volume = "18",
number = "4",
pages = "202--202",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:14:25 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Shen:1974:WBM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Frederick:1975:RA,
author = "Lawrence W. Frederick",
title = "Remark on ``{Algorithm 475}'': Visible Surface
Plotting Program [{J6}]",
journal = j-CACM,
volume = "18",
number = "4",
pages = "202--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:40 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Frederick75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Wright:1974:AAV,Doran:1975:RAV,Mashburn:1975:RAV}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Frederick75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Frederick75",
}
@Article{Smith:1975:MOL,
author = "Graham Smith",
title = "On Maintenance of the Opportunity List for
Class-Teacher Timetable Problems",
journal = j-CACM,
volume = "18",
number = "4",
pages = "203--208",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35",
MRnumber = "51 12314",
MRreviewer = "I. Gh. Ciobanu",
bibdate = "Mon Jan 22 07:22:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Smith75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "One of the principal components of procedures for the
solution of class-teacher timetable problems is that
for maintenance of the opportunity list. Opportunity
list maintenance methods are based on necessary
conditions for the existence of a solution. A general
framework for necessary conditions, together with four
specific sets of necessary conditions, is given.",
acknowledgement = ack-nhfb,
classcodes = "C7110 (Educational administration)",
classification = "723; 901",
corpsource = "Univ. of New South Wales, Kensington, NSW, Australia",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "class teacher; combinatorial; data processing;
educational administrative data processing; necessary
conditions; opportunity list; schedule; scheduling;
school timetable; timetable; timetable problems",
oldlabel = "Smith75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smith75",
}
@Article{Braid:1975:SSB,
author = "I. C. Braid",
title = "The Synthesis of Solids Bounded by Many Faces",
journal = j-CACM,
volume = "18",
number = "4",
pages = "209--216",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Braid75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A technique is presented which allows a class of solid
objects to be synthesized and stored using a computer.
Synthesis begins with primitive solids like a cube,
wedge, or cylinder. Any solid can be moved, scaled, or
rotated. Solids may also be added together or
subtracted. Two algorithms to perform addition are
described. For practical designers, the technique has
the advantage that operations are concise, readily
composed, and are given in terms of easily imagined
solids. Quite short sequences of operations suffice to
build up complex solids bounded by many faces.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130 (Data
handling techniques); C7440 (Civil and mechanical
engineering computing)",
classification = "723",
corpsource = "Univ. of Cambridge, Cambridge, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; computer graphics; computer-aided design;
image processing; many faced solids; simulation;
synthesis",
oldlabel = "Braid75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Braid75",
}
@Article{Batagelj:1975:QHM,
author = "Vladimir Batagelj",
title = "Quadratic Hash Method When the Table Size is not a
Prime Number",
journal = j-CACM,
volume = "18",
number = "4",
pages = "216--217",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Batagelj75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Previous work on quadratic hash methods is limited
mainly to the case where the table size is a prime
number. Here, certain results are derived for composite
numbers. It is shown that all composite numbers
containing at least the square of one of the component
primes have full-period integer-coefficient quadratic
hash functions.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques); C6130 (Data handling techniques)",
classification = "723",
corpsource = "Jozef Stefan Inst., Univ. of Ljubljana, Ljubljana,
Yugoslavia",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "component primes; composite; computer programming;
full period integer coefficient; numbers; prime number;
quadratic hash functions; quadratic hash method;
quadratic programming; table lookup; table size",
oldlabel = "Batagelj75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Batagelj75",
}
@Article{Warren:1975:MWA,
author = "Henry S. {Warren, Jr.}",
title = "A Modification of {Warshall}'s Algorithm for the
Transitive Closure of Binary Relations",
journal = j-CACM,
volume = "18",
number = "4",
pages = "218--220",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "51 2340",
MRreviewer = "E. M. Reingold",
bibdate = "Mon Jan 22 07:28:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Warren75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Warren75.html",
abstract = "An algorithm is given for computing the transitive
closure of a binary relation that is represented by a
Boolean matrix. The algorithm is similar to Warshall's
although it executes faster for sparse matrices on most
computers, particularly in a paging environment.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM18/P218.pdf",
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra); C4210
(Formal logic)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary relation; binary relations; Boolean algebra;
Boolean matrix; computer programming; digraph; directed
graph; matrix algebra; paging environment; reachability
matrix; sparse matrices; transitive closure; Warshall's
algorithm",
oldlabel = "Warren75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Warren75",
}
@Article{Hinds:1975:ALA,
author = "James A. Hinds",
title = "Algorithm for Locating Adjacent Storage Blocks in the
Buddy System",
journal = j-CACM,
volume = "18",
number = "4",
pages = "221--222",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:04 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Hinds75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple scheme for the determination of the location
of a block of storage relative to other blocks is
described. This scheme is applicable to the buddy type
storage allocation systems.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "State Univ. of New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; buddy system; computer programming;
locating adjacent storage blocks; storage allocation;
storage allocation systems",
oldlabel = "Hinds75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hinds75",
}
@Article{Vaucher:1975:CSE,
author = "Jean G. Vaucher and Pierre Duval",
title = "A Comparison of Simulation Event List Algorithms",
journal = j-CACM,
volume = "18",
number = "4",
pages = "223--230",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:27:09 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#VaucherD75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Vaucher:1975:CCS}.",
abstract = "Four algorithms are considered which can be used to
schedule events in a general purpose discrete
simulation system. Two of the algorithms are new, one
is based on an end-order tree structure for event
notices, and another uses an indexed linear list. The
algorithms are tested with a set of typical stochastic
scheduling distributions especially chosen to show the
advantages and limitations of the algorithms. \par
The end-order tree algorithm is shown to be an
advantageous, immediate replacement for the algorithm
in use with current simulation languages. The most
promising algorithm uses the indexed list concept.
\par
It will require an adaptive routine before it can be
employed in general purpose simulators,but its
performance is such that further study would be
fruitful.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C7800 (Other
computer applications)",
classification = "723",
corpsource = "Univ. de Montreal, Que., Canada",
country = "USA",
descriptors = "Simulation; event list control; time control",
enum = "3193",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "adaptive routine; computer programming; current
simulation; discrete system simulation; end order tree
structure; event list algorithm; event scheduling
routine; indexed linear list; languages; scheduling;
simulation; simulation event list algorithms;
simulation executive; sorting; stochastic scheduling
distributions; time flow mechanisms",
language = "English",
oldlabel = "VaucherD75",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/VaucherD75",
}
@Article{Korfhage:1975:SO,
author = "Robert R. Korfhage and David W. Matula",
title = "On {Salazar} and {Oakford}",
journal = j-CACM,
volume = "18",
number = "4",
pages = "240--240",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:08:07 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Salazar:1974:GFS,Korfhage:1975:MSO,Garey:1975:SO}",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "graph coloring",
}
@Article{Garey:1975:SO,
author = "Michael R. Garey and David S. Johnson",
title = "On {Salazar} and {Oakford}",
journal = j-CACM,
volume = "18",
number = "4",
pages = "240--241",
month = apr,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Salazar:1974:GFS,Korfhage:1975:SO,Korfhage:1975:MSO}",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "graph coloring",
}
@Article{Fisher:1975:CCL,
author = "David A. Fisher",
title = "Copying Cyclic List Structures in Linear Time Using
Bounded Workspace",
journal = j-CACM,
volume = "18",
number = "5",
pages = "251--252",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:45 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Fisher75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A bounded workspace copying algorithm for arbitrary
list structures is given. This algorithm operates in
linear time and does not require tag bits. The best
previous bounded workspace copying algorithms achieved
n**2 time without tag bits and n log n time with one
tag. The only restriction on the algorithm given here
is that the copy must be placed into a contiguous
section of memory. The method is applicable to fixed or
variable size nodes.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Inst. for Defense Analyses, Arlington, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bounded workspace; computer programming; computer
programming languages --- List Processing; copying
algorithm; cyclic list structures; linear time; list
processing; nodes; tag bits",
oldlabel = "Fisher75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fisher75",
}
@Article{Cardenas:1975:API,
author = "Alfonso F. Cardenas",
title = "Analysis and Performance of Inverted Data Base
Structures",
journal = j-CACM,
volume = "18",
number = "5",
pages = "253--263",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:34 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Cardenas75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Cardenas75.html",
abstract = "The need to envision and architecture data base
systems in a hierarchical level by level framework is
stressed. The inverted data base (file) organization is
then analyzed, considering implementation oriented
aspects. The inverted directory is viewed realistically
as another large data base which itself is subjected to
inversion. Formulations are derived to estimate average
access time (read only) and storage requirements,
formalizing the interaction of data base content
characteristics, logical complexity of queries, and
machine timing and blocking specifications identified
as having a first-order effect on performance. The
formulations presented are necessary to be used in
conjunction with any index selection criteria to
determine the optimum set of index keys.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM18/P253.pdf",
classcodes = "C6120 (File organisation); C7100 (Business and
administration); C7250 (Information storage and
retrieval)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "access; data processing; data structures; file
organisation; index keys; index selection criteria;
indexing; indices; information retrieval; information
retrieval systems; information storage; inverted data
base structures; inverted directory; machine timing;
management information systems; time",
oldlabel = "Cardenas75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cardenas75",
}
@Article{Wilks:1975:IAU,
author = "Yorick Wilks",
title = "An intelligent analyzer and understander of
{English}",
journal = j-CACM,
volume = "18",
number = "5",
pages = "264--274",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Wilks75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes a working analysis and generation
program for natural language, which handles paragraph
length input. Its core is a system of preferential
choice between deep semantic patterns, based on what we
call ``semantic density.'' The system is contrasted:
(1) with syntax oriented linguistic approaches, and (2)
with theorem proving approaches to the understanding
problem.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C4290 (Other computer
theory); C7820 (Humanities computing)",
classification = "721; 731",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; automata theory ---
Computational Linguistics; computational linguistics;
deep semantic patterns; generation program; intelligent
analyzer; language; natural language; paragraph length;
semantic density; syntax oriented linguistic
approaches; systems science and cybernetics;
translation and linguistics",
oldlabel = "Wilks75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wilks75",
}
@Article{Gibbs:1975:AAB,
author = "Norman E. Gibbs",
title = "{ACM Algorithm 491}: Basic Cycle Generation [{H}]",
journal = j-CACM,
volume = "18",
number = "5",
pages = "275--276",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:58 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Gibbs75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C7310 (Mathematics
computing)",
corpsource = "Dept. of Math., Coll. of William and Mary,
Williamsburg, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "basic; BASIC GENERATOR; cycle generation; finite
undirected graph; graph theory; Paton's algorithm;
PL/I; subroutines; vertex adjacency matrix",
oldlabel = "Gibbs75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gibbs75",
}
@Article{Piessens:1975:RCA,
author = "Robert Piessens and Irene Mertens",
title = "Remark and Certification on ``{Algorithm 446}: Ten
Subroutines for the Manipulation of {Chebyshev}
Series''",
journal = j-CACM,
volume = "18",
number = "5",
pages = "276--276",
year = "1975",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360762.360782",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:46 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#PiessensM75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Broucke:1973:AAT}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "PiessensM75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PiessensM75",
}
@Article{Mashburn:1975:RAV,
author = "R. G. Mashburn",
title = "Remark on ``{Algorithm 475}: Visible Surface Plotting
Program''",
journal = j-CACM,
volume = "18",
number = "5",
pages = "276--277",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:06 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Mashburn75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Wright:1974:AAV,Frederick:1975:RA,Doran:1975:RAV}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Mashburn75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mashburn75",
}
@Article{Doran:1975:RAV,
author = "C. J. Doran",
title = "Remark on ``{Algorithm 475}: Visible Surface Plotting
Program''",
journal = j-CACM,
volume = "18",
number = "5",
pages = "277--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:36 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Doran75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Wright:1974:AAV,Frederick:1975:RA,Mashburn:1975:RAV}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Doran75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Doran75",
}
@Article{Fritsch:1975:RAS,
author = "Fred N. Fritsch and Alan C. Hindmarsh",
title = "Remark on ``{Algorithm 478}: Solution of an
Overdetermined System of Equations in the {$L_1$}
Norm''",
journal = j-CACM,
volume = "18",
number = "5",
pages = "277--??",
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#FritschH75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Barrodale:1974:AAS}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "FritschH75",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FritschH75",
}
@Article{Evans:1975:NLF,
author = "D. J. Evans and Michael Hatzopoulos",
title = "A note on the {LU} factorization of a symmetric
matrix",
journal = j-CACM,
volume = "18",
number = "5",
pages = "278--279",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "15A21 (65F30)",
MRnumber = "52 8154",
MRreviewer = "Marvin Marcus",
bibdate = "Mon Jan 22 06:38:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#EvansH75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0290H (Linear algebra); C4140 (Linear algebra)",
corpsource = "Univ. of Technol., Loughborough, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "factorization; inversion programs; linear equations;
LU factorisation; matrix; matrix algebra; matrix
inversion; separable systems; symmetric matrices;
symmetric matrix; test matrices",
oldlabel = "EvansH75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EvansH75",
}
@Article{Fox:1975:MKS,
author = "B. L. Fox",
title = "More on $k$th Shortest Paths",
journal = j-CACM,
volume = "18",
number = "5",
pages = "279--279",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Fox75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); B0260 (Optimisation
techniques); C1160 (Combinatorial mathematics); C1180
(Optimisation techniques)",
corpsource = "Univ. of Montreal, Montreal, Que., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "graph theory; kth shortest paths; N node network;
networks; nodes; optimisation",
oldlabel = "Fox75",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fox75",
}
@Article{Wasserman:1975:PLP,
author = "Anthony I. Wasserman",
title = "A Problem-List of Public Policy Issues Concerning
Computers and Health Care",
journal = j-CACM,
volume = "18",
number = "5",
pages = "279--280",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:22 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Wasserman75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C7190 (Other fields
of business and administrative computing); C7330
(Biology and medical computing)",
corpsource = "Univ. of California, San Francisco, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "biomedical applications of computers; computers and
health care; economic and; medicine; public policy
issues; sociological effects",
oldlabel = "Wasserman75",
treatment = "A Application; E Economic; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wasserman75",
}
@Article{Mills:1975:CNM,
author = "Harlan D. Mills",
title = "Corrigendum: {``The New Math of Computer
Programming''}",
journal = j-CACM,
volume = "18",
number = "5",
pages = "280--280",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "51 2333b",
MRreviewer = "E. Ikaunieks",
bibdate = "Tue May 28 16:26:36 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Mills:1975:NMC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Horowitz:1975:SAP,
author = "Steven L. Horowitz",
title = "Syntactic Algorithm for Peak Detection in Waveforms
with Applications to Cardiography",
journal = j-CACM,
volume = "18",
number = "5",
pages = "281--285",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Horowitz75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Peaks in a digitized waveform are detected by an
algorithm incorporating piecewise linear approximation
and tabular parsing techniques. Several parameters
serve to identify the waveform context enabling
accurate measurement of peak amplitude, duration, and
shape. The algorithm is of sufficient speed to allow
on-line real-time processing. An example of its
application is demonstrated on an electrocardiogram.",
acknowledgement = ack-nhfb,
classcodes = "A8770E (Patient diagnostic methods and
instrumentation); B0290F (Interpolation and function
approximation); B7510D (Bioelectric signals); C4130
(Interpolation and function approximation); C4210
(Formal logic); C7330 (Biology and medical computing)",
classification = "723",
corpsource = "Princeton Univ., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "amplitude; applications; biomedical engineering ---
Electrocardiography; context-free grammars; duration;
electrocardiogram; electrocardiography; parsing
techniques; pattern recognition systems; peak
detection; piecewise linear approximation;
piecewise-linear; shape; syntactic algorithm; tabular;
techniques; to cardiography; waveform analysis;
waveforms",
oldlabel = "Horowitz75",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Horowitz75",
}
@Article{Pfefferkorn:1975:HPS,
author = "Charles E. Pfefferkorn",
title = "Heuristic Problem Solving Design System for Equipment
or Furniture Layouts",
journal = j-CACM,
volume = "18",
number = "5",
pages = "286--297",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:29 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Pfefferkorn75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The Designer Problem Solver (DPS) demonstrates that
the computer can perform simple design tasks. In
particular, it designs furniture and equipment layouts.
This task was chosen because it is simple, well
defined, and characteristic of many design tasks in
architecture, engineering, urban planning, and natural
resource management. These space planning tasks usually
involve manipulating two-dimensional representations of
objects to create feasible or optimal solutions for
problems involving topological and metric spatial
constraints. The paper describes extensive tests
performed on the program.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C7800 (Other computer
applications)",
classification = "731; 901",
corpsource = "Evans and Sutherland Computer Corp., Sunnyvale, CA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "architecture; computer graphics; computer-aided
design; design; engineering; equipment layout;
furniture layouts; heuristic; heuristic problem solving
design system; management; metric; natural resource;
optimal solutions; problem solver; program;
programming; space planning tasks; spatial constraints;
systems science and cybernetics --- Heuristic
Programming; urban planning",
oldlabel = "Pfefferkorn75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pfefferkorn75",
}
@Article{Korfhage:1975:MSO,
author = "Robert R. Korfhage and David W. Matula",
title = "More on the {Salazar} and {Oakford} Paper",
journal = j-CACM,
volume = "18",
number = "5",
pages = "303--303",
month = may,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:08:07 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Salazar:1974:GFS,Korfhage:1975:SO,Garey:1975:SO}",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "graph coloring",
}
@Article{Gibbs:1975:AAG,
author = "Norman E. Gibbs",
title = "{ACM Algorithm 492}: Generation of All the Cycles of a
Graph from a Set of Basic Cycles [{H}]",
journal = j-CACM,
volume = "18",
number = "6",
pages = "310--310",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:59 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Gibbs75a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Dept. of Math., Coll. of William and Mary,
Williamsburg, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "basic cycles; cycles; generation; graph; graph theory;
PL/I; subroutines",
oldlabel = "Gibbs75a",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gibbs75a",
}
@Article{Phong:1975:ICG,
author = "Bui Tuong Phong",
title = "Illumination for Computer Generated Pictures",
journal = j-CACM,
volume = "18",
number = "6",
pages = "311--317",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:37 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.75.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Phong75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The quality of computer generated images of
three-dimensional scenes depends on the shading
technique used to paint the objects on the cathode-ray
tube screen. The shading algorithm itself depends in
part on the method for modeling the object, which also
determines the hidden surface algorithm. The various
methods of object modeling, shading, and hidden surface
removal are thus strongly interconnected. Several
shading techniques corresponding to different methods
of object modeling and the related hidden surface
algorithms are presented here. Human visual perception
and the fundamental laws of optics are considered in
the development of a shading rule that provides better
quality and increased realism in generated images.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays)",
classification = "723; 741",
corpsource = "Univ. of Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer generated images; computer graphics; hidden
surface algorithm; image processing; Phong; shading;
shading algorithm; technique; three dimensional
scenes",
oldlabel = "Phong75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Phong75",
}
@Article{Lum:1975:COA,
author = "Vincent Y. Lum and Michael E. Senko and C. P. Wang and
H. Ling",
title = "A Cost Oriented Algorithm for Data Set Allocation in
Storage Hierarchies",
journal = j-CACM,
volume = "18",
number = "6",
pages = "318--322",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:16 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#LumSWL75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The trend in computer systems is toward the use of
multilevel storage hierarchy systems. In this kind of
system, data set allocation is usually based on
qualitative, ad hoc decisions. If automatic data
migration is used at all, the data sets are allocated
to slower level memories simply on the basis of an ad
hoc threshold against a time interval since the last
use. To achieve quantitative, more optimal allocation,
both storage cost and access time cost must be
carefully analyzed. This paper presents an appropriate
automatic algorithm which includes many significant
details of both costs.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer operating systems; cost oriented;
data migration; data set allocation; data staging; data
storage; hierarchies; storage; storage allocation",
oldlabel = "LumSWL75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LumSWL75",
}
@Article{Babich:1975:SES,
author = "Alan F. Babich and John Grason and David Lorge
Parnas",
title = "Significant Event Simulation",
journal = j-CACM,
volume = "18",
number = "6",
pages = "323--329",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:29 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#BabichGP75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper compares a new method of simulation
organization, called the significant event method, with
an old one, called the clock pulse method, using as
examples two automobile traffic models. The significant
event method is found to be more efficient than the
clock pulse method at low levels of system interaction
and less efficient at high levels. A simple
mathematical model for the trade-off in the relative
running time of the two methods is developed. The model
aids in choosing between the two simulation methods for
a particular experiment. It is concluded that the
significant event method can be of value in the
simulation of some systems when computational
efficiency is of sufficient importance.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C7800 (Other
computer applications)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburg, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "clock pulse models; computational efficiency; computer
simulation; efficient; significant event method;
simulation",
oldlabel = "BabichGP75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BabichGP75",
}
@Article{Dewar:1975:ITC,
author = "Robert B. K. Dewar",
title = "Indirect Threaded Code",
journal = j-CACM,
volume = "18",
number = "6",
pages = "330--331",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:54 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Dewar75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient arrangement for interpretive code is
described. It is related to Bell's notion of threaded
code but requires less space and is more amenable to
machine independent implementations.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150C
(Compilers, interpreters and other processors)",
classification = "723",
corpsource = "Illinois Inst. of Technol., Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "code generation; codes, symbolic; implementations;
indirect threaded code; interpretive code;
interpretors; machine independent; program
interpreters; programming; SNOBOL; SNOBOL4; SPITBOL;
threaded code",
oldlabel = "Dewar75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dewar75",
}
@Article{Cranston:1975:SRS,
author = "Ben Cranston and Rick Thomas",
title = "Simplified Recombination Scheme for the {Fibonacci}
Buddy System",
journal = j-CACM,
volume = "18",
number = "6",
pages = "331--332",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:33:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#CranstonT75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simplified recombination scheme for the Fibonacci
buddy system which requires neither tables nor
repetitive calculations and uses only two additional
bits per buffer is presented.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; dynamic storage
allocation; Fibonacci buddy system; simplified
recombination scheme; storage allocation",
oldlabel = "CranstonT75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CranstonT75",
}
@Article{Aho:1975:ESM,
author = "Alfred V. Aho and Margaret J. Corasick",
title = "Efficient String Matching: an Aid to Bibliographic
Search",
journal = j-CACM,
volume = "18",
number = "6",
pages = "333--340",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "51 7393",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:20:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#AhoC75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib;
https://www.math.utah.edu/pub/tex/bib/unix.bib",
abstract = "This paper describes a simple, efficient algorithm to
locate all occurrences of any of a finite number of
keywords in a string of text. The algorithm consists of
constructing a finite state pattern matching machine
from the keywords and then using the pattern matching
machine to process the text string in a single pass.
Construction of the pattern matching machine takes time
proportional to the sum of the lengths of the keywords.
The number of state transitions made by the pattern
matching machine in processing the text string is
independent of the number of keywords. The algorithm
has been used to improve the speed of a library
bibliographic search program by a factor of 5 to 10.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "721; 723",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; automata theory --- Finite Automata;
bibliographic search; computational complexity.;
efficient; finite state machines; finite state pattern
matching; information retrieval; information retrieval
systems; keywords; keywords and phrases; patterns UNIX
searching; string matching; string pattern matching;
text; text editing; text-editing",
oldlabel = "AhoC75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AhoC75",
}
@Article{Hirschberg:1975:LSA,
author = "Daniel S. Hirschberg",
title = "A Linear Space Algorithm for Computing Maximal Common
Subsequences",
journal = j-CACM,
volume = "18",
number = "6",
pages = "341--343",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (68A20)",
MRnumber = "51 12019",
MRreviewer = "Claude Benzaken",
bibdate = "Mon Jan 22 06:50:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Hirschberg75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem of finding a longest common subsequence of
two strings has been solved in quadratic time and
space. An algorithm is presented which will solve this
problem in quadratic time and in linear space.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
comment = "Algorithms are given that solve the longest common
subsequence problem in quadratic time and linear space.
Previously algorithms for this problem used quadratic
time and quadratic space.",
corpsource = "Princeton Univ., Princeton, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; computing; data handling;
editing; linear space; linear space algorithm; longest
common subsequence; maximal common; quadratic time;
string correction; subsequence; subsequences; two
strings",
oldlabel = "Hirschberg75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hirschberg75",
}
@Article{Soule:1975:AAB,
author = "Stephen Soule",
title = "Addition in an Arbitrary Base Without Radix
Conversion",
journal = j-CACM,
volume = "18",
number = "6",
pages = "344--346",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:30 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Soule75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a generalization of an old
programming technique; using it, one may add and
subtract numbers represented in any radix, including a
mixed radix, and stored one digit per byte in bytes of
sufficient size. Radix conversion is unnecessary, no
looping is required, and numbers may even be stored in
a display (I/O) format. Applications to Cobol, MIX, and
hexadecimal sums are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods); C6130 (Data
handling techniques)",
classification = "723; 921",
corpsource = "Univ. of Calgary, Calgary, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "add; addition; arbitrary base; arbitrary radix
arithmetic; Cobol display arithmetic; computer systems
programming; data handling; decimal arithmetic; digital
arithmetic; mathematical techniques --- Digital
Arithmetic; MIX arithmetic; mixed radix arithmetic;
numbers; programming; radix conversion; subtract;
subtraction; without radix conversion",
oldlabel = "Soule75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Soule75",
}
@Article{Harper:1975:S,
author = "L. H. Harper and T. H. Payne and John E. Savage and E.
Straus",
title = "Sorting {$X + Y$}",
journal = j-CACM,
volume = "18",
number = "6",
pages = "347--349",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "51 14641",
MRreviewer = "Forbes D. Lewis",
bibdate = "Mon Jan 22 06:48:41 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#HarperPSS75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6130 (Data
handling techniques)",
corpsource = "MIT, Dept. of Math., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary comparisons; computation time; computational
complexity; computing models; data modeling; merge
sorting; merging; sets of numbers; sorting",
oldlabel = "HarperPSS75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HarperPSS75",
}
@Article{Wyman:1975:IES,
author = "F. Paul Wyman",
title = "Improved Event-Scanning Mechanisms for Discrete Event
Simulation",
journal = j-CACM,
volume = "18",
number = "6",
pages = "350--353",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:06 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Wyman75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Simulation models of large, complex ``real-world''
applications have occasionally earned the reputation of
eating up hours of computer time. This problem may be
attributed in part to difficulties such as slow
stochastic convergence. However, an additional problem
lies in the fact that a significant amount of
bookkeeping time is required to keep future events in
their proper sequence. This paper presents a method for
significantly reducing the time spent scanning future
event lists in discrete event simulations. \par
There models are presented, all of which improve in
effectiveness as the events-list scan problem becomes
more burdensome.",
acknowledgement = ack-nhfb,
classcodes = "C7800 (Other computer applications)",
classification = "723",
corpsource = "Bechtel Inc., San Francisco, CA, USA",
country = "USA",
descriptors = "Simulation; time control",
enum = "3352",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bookkeeping time; computer simulation; discrete event
simulation; event scanning mechanisms; scanning;
simulation",
language = "English",
oldlabel = "Wyman75",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wyman75",
}
@Article{Knuth:1975:ICU,
author = "Donald E. Knuth and Charles T. {Zahn, Jr.}",
title = "Ill-Chosen Use of ``Event''",
journal = j-CACM,
volume = "18",
number = "6",
pages = "360--360",
month = jun,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Sep 20 23:34:24 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Courtois:1975:DIS,
author = "P. J. Courtois",
title = "Decomposability, Instabilities, and Saturation in
Multiprogramming Systems",
journal = j-CACM,
volume = "18",
number = "7",
pages = "371--377",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:53 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Courtois75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A step-by-step approach to model the dynamic behavior
and evaluate the performance of computing systems is
proposed. It is based on a technique of variable
aggregation and the concept of nearly decomposable
systems, both borrowed from Econometrics. This approach
is taken in order to identify in multiprogramming
paging systems (i) unstable regimes of operations and
(ii) critical computing loads which bring the system
into states of saturation. This analysis leads to a
more complete definition of the circumstances in which
``thrashing'' can set in.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "MBLE Res. Lab., Brussels, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer selection and evaluation; computer systems
programming; computing systems; decomposable;
instabilities; multiprogramming; multiprogramming
systems; performance; saturation; storage; virtual",
oldlabel = "Courtois75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Courtois75",
}
@Article{Lauesen:1975:LSB,
author = "S{\o}ren Lauesen",
title = "A Large Semaphore Based Operating System",
journal = j-CACM,
volume = "18",
number = "7",
pages = "377--389",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:51 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Lauesen75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper describes the internal structure of a large
operating system as a set of cooperating sequential
processes. The processes synchronize by means of
semaphores and extended semaphores (queue semaphores).
The number of parallel processes is carefully
justified, and the various semaphore constructions are
explained. The system is proved to be free of ``deadly
embrace'' (deadlock). The design principle is an
alternative to Dijkstra's hierarchical structuring of
operating systems. The project management and the
performance are discussed, too. The operating system is
the first large one using the RC 4000 multiprogramming
system.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Nordisk Brown Boveri, Copenhagen, Denmark",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; large; multiprogramming
system; operating system; operating systems
(computers); parallel; parallel processing; processes;
RC 4000; semaphore based",
oldlabel = "Lauesen75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lauesen75",
}
@Article{Sager:1975:RLC,
author = "Naomi Sager and Ralph Grishman",
title = "Restriction Language for Computer Grammars of Natural
Language",
journal = j-CACM,
volume = "18",
number = "7",
pages = "390--400",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:54 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#SagerG75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a programming language designed
specifically for the compact and perspicuous statement
of restrictions of a natural language grammar. It is
based on ten years' experience parsing text sentences
with the comprehensive English grammar of the N. Y. U.
Linguistic String Project, and embodies in its syntax
and routines the relations which were found to be
useful and adequate for computerized natural language
analysis. The language is used in the current
implementation of the Linguistic String Parser.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6130 (Data handling
techniques); C6140D (High level languages); C7820
(Humanities computing)",
classification = "721; 723",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; computational linguistics; computer
grammars; computer programming languages; grammars;
literature; natural language; oriented languages;
parsing; problem; programming language; Restriction
Language; text; text editing",
oldlabel = "SagerG75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SagerG75",
}
@Article{Parnas:1975:UCT,
author = "David Lorge Parnas and Daniel P. Siewiorek",
title = "Use of the Concept of Transparency in the Design of
Hierarchically Structured Systems",
journal = j-CACM,
volume = "18",
number = "7",
pages = "401--408",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:29 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/softeng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ParnasS75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper deals with the design of hierarchically
structured programming systems. It develops a method
for evaluating the cost of requiring programmers to
work with an abstraction of a real machine. A number of
examples from hardware and software are given as
illustrations of the method.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Tech. Hochschule Darmstadt, Darmstadt, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstraction; computer systems programming; cost;
design; hierarchically structured systems; programming;
real machine; transparency",
oldlabel = "ParnasS75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ParnasS75",
}
@Article{Freeman:1975:DMA,
author = "Herbert Freeman and Ruth Shapira",
title = "Determining the Minimum-Area Encasing Rectangle for an
Arbitrary Closed Curve",
journal = j-CACM,
volume = "18",
number = "7",
pages = "409--413",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (52A40)",
MRnumber = "51 12018",
MRreviewer = "Jacques Dubois",
bibdate = "Mon Jan 22 06:41:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#FreemanS75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a method for finding the
rectangle of minimum area in which a given arbitrary
plane curve can be contained. The method is of interest
in certain packing and optimum layout problems. It
consists of first determining the minimal-perimeter
convex polygon that encloses the given curve and then
selecting the rectangle of minimum area capable of
containing this polygon. Three theorems are introduced
to show that one side of the minimum-area rectangle
must be colinear with an edge of the enclosed polygon
and that the minimum-area encasing rectangle for the
convex polygon is also the minimum-area rectangle for
the curve.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); C1180 (Optimisation
techniques)",
classification = "921; 922",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrary closed curve; encasing rectangle; enclosed
curve; minimisation; minimum area; minimum-area
encasing rectangle; optimization; optimum layout;
optimum packing; packing",
oldlabel = "FreemanS75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FreemanS75",
}
@Article{Bobrow:1975:NHL,
author = "Daniel G. Bobrow",
title = "A Note on Hash Linking",
journal = j-CACM,
volume = "18",
number = "7",
pages = "413--415",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Bobrow75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Hash searching is a technique in which a key is mapped
into a unique address associated with that key. Most
applications of this technique are for insertion and
fast retrieval of data records containing key fields.
In the use of hash search described in this paper, the
key field is the virtual address of a machine cell with
which additional information is associated. An address
to auxiliary data not contained in that cell is called
hash linking. (A hash link function is one which maps
any machine virtual address into another unique address
where additional information can be stored. ) This note
describes several nonobvious applications of this
technique.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; hash linking; information
retrieval systems; LISP; locations; machine address;
storage; storage allocation",
oldlabel = "Bobrow75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bobrow75",
}
@Article{Weber:1975:DEW,
author = "Richard E. Weber and Bruce Gilchrist",
title = "Discrimination in the employment of women in the
computer industry",
journal = j-CACM,
volume = "18",
number = "7",
pages = "416--418",
month = jul,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:35 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#WeberG75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Rutgers Univ., New Brunswick, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer industry; discrimination; employment; women",
oldlabel = "WeberG75",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WeberG75",
}
@Article{Shore:1975:ESF,
author = "John E. Shore",
title = "On the External Storage Fragmentation Produced by
First-Fit and Best-Fit Allocation Strategies",
journal = j-CACM,
volume = "18",
number = "8",
pages = "433--440",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Shore75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Report on some experiments whose results have helped
to understand differences in the performance of two
well-known storage-allocation strategies, first-fit and
best-fit. For exponential and hyperexponential
distributions of requests, first-fit outperformed
best-fit; but for normal and uniform distributions, and
for exponential distributions distorted in various
ways, best-fit outperformed first-fit. It is
hypothesized that when first-fit outperforms best-fit,
it does so because first-fit, by preferentially
allocating toward one end of memory, encourages large
blocks to grow at the other end. Sufficient contiguous
space is thereby more likely to be available for
relatively large requests. Results of simulation
experiments supported this hypothesis and showed that
the relative performance of first-fit and best-fit
depends on the frequency of requests that are large
compared to the average request. when the coefficient
of variation of the request distribution is greater
than or approximately equal to unity, first-fit
outperformed best-fit.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "Naval Res. Lab., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "allocation strategies; best fit; computer operating
systems; dynamic memory allocation; encountered block;
external storage fragmentation; first fit; pending
storage; starting addresses; storage allocation",
oldlabel = "Shore75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shore75",
}
@Article{Aho:1975:DPA,
author = "Alfred V. Aho and Stephen C. Johnson and Jeffrey D.
Ullman",
title = "Deterministic Parsing of Ambiguous Grammars",
journal = j-CACM,
volume = "18",
number = "8",
pages = "441--452",
month = aug,
year = "1975",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360933.360969",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A25",
MRnumber = "51 12033",
MRreviewer = "S. Ginsburg",
bibdate = "Mon Jan 22 06:20:50 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#AhoJU75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/unix.bib",
abstract = "Methods of describing the syntax of programming
languages in ways that are more flexible and natural
than conventional BNF descriptions are considered.
These methods involve the use of ambiguous context-free
grammars together with rules to resolve syntactic
ambiguities. It is shown how efficient LR and LL
parsers can be constructed directly from certain
classes of these specifications.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ambiguities; ambiguous grammars; computer programming
languages; context free grammars; context-free
grammars; LL parsers; LR parsing; parser generation;
programming languages; syntactic; translator writing
systems",
oldlabel = "AhoJU75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AhoJU75",
}
@Article{Dijkstra:1975:GCN,
author = "Edsger W. Dijkstra",
title = "Guarded Commands, Nondeterminacy and Formal Derivation
of Programs",
journal = j-CACM,
volume = "18",
number = "8",
pages = "453--457",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "52 4688",
MRreviewer = "John Kam",
bibdate = "Mon Jan 22 06:36:09 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.synch.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Dijkstra75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "So-called ``guarded commands'' are introduced as a
building block for alternative and repetitive
constructs that allow nondeterministic program
components for which at least the activity evoked, but
possibly even the final state, is not necessarily
uniquely determined by the initial state. For the
formal derivation of programs expressed in terms of
these constructs, a calculus is shown.",
acknowledgement = ack-nhfb,
annote = "Yet another ancient paper which is occasionally
cited",
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Burroughs Corp., Nuenen, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "calculus; computer programming languages; constructs;
correctness proof; derivation; guarded commands;
k-guarded-commands; nondeterministic program
components; programming language semantics; programming
languages; programming methodology; sequencing
primitives",
oldlabel = "Dijkstra75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Dijkstra75",
}
@Article{Cotton:1975:RSU,
author = "Ira W. Cotton",
title = "Remark on stably updating mean and standard deviation
of data",
journal = j-CACM,
volume = "18",
number = "8",
pages = "458--458",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:48 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Cotton75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Hanson:1975:SUM}.",
acknowledgement = ack-nhfb,
classcodes = "B0290F (Interpolation and function approximation);
C4130 (Interpolation and function approximation); C7310
(Mathematics computing)",
corpsource = "Nat. Bur. of Stand., Washington, DC, USA",
country = "USA",
descriptors = "Simulation; statistics; numeric calculation",
enum = "7158",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; Hanson's article; new; numbers; numerical
methods; remark; sequentially recomputing; series;
stably updating mean; standard deviation of data;
statistics",
kwds = "stat, updating, mean, standard deviation, variance",
language = "English",
location = "SEL: Wi",
oldlabel = "Cotton75",
references = "0",
revision = "16/01/94",
treatment = "A Application; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cotton75",
}
@Article{Shapiro:1975:ICN,
author = "Stuart C. Shapiro and Stanley C. Kwasny",
title = "Interactive Consulting via Natural Language",
journal = j-CACM,
volume = "18",
number = "8",
pages = "459--462",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/expert.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#SharoK75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Interactive programming systems often contain help
commands to give the programmer on-line instruction
regarding the use of the various systems commands. It
is argued that it would be relatively easy to make
these help commands significantly more helpful by
having them accept requests in natural language. As a
demonstration, Weizenbaum's ELIZA program has been
provided with a script that turns it into a natural
language system consultant.",
acknowledgement = ack-nhfb,
annote = "Help commands are significantly more useful in an
interactive environment if they accept commands in a
natural language. As a demonstration, Weizenbaum's
ELIZA program has been provided with a script that
turns into a natural language system consultant.",
classcodes = "C6110 (Systems analysis and programming); C6140
(Programming languages); C6150J (Operating systems)",
classification = "723",
corpsource = "Indiana Univ., Bloomington, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer aided instruction; computer assisted
instruction; computer programming languages; ELIZA;
help commands; instruction; interactive programming;
natural language; natural language processing; natural
language system consultant; on line; program;
programming languages; sharing programs; systems
commands; time sharing systems; time-; time-sharing
systems",
oldlabel = "SharoK75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SharoK75",
xxauthor = "Stuart C. Sharo and Stanley C. Kwasny",
}
@Article{Todd:1975:CLC,
author = "John Todd",
title = "Corrigendum: {``The Lemniscate Constants''}",
journal = j-CACM,
volume = "18",
number = "8",
pages = "462--462",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Dec 26 18:42:09 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Todd:1975:LC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Vaucher:1975:CCS,
author = "J. G. Vaucher and P. Duval",
title = "Corrigendum: ``{A comparison of simulation event list
algorithms}''",
journal = j-CACM,
volume = "18",
number = "8",
pages = "462--462",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:17:34 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Vaucher:1975:CSE}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Smith:1975:CPC,
author = "Alan Jay Smith",
title = "Comments on a paper by {T. C. Chen} and {I. T. Ho}",
journal = j-CACM,
volume = "18",
number = "8",
pages = "463--463",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:40 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Smith75a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Chen:1975:SER}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "advantages; alternatives; binary coded decimal; codes;
coding; compression of numbers; data handling; decimal
data; decoding; deletions; Huffman codes; insertions;
permutations; storage efficient representation;
variable length codes",
oldlabel = "Smith75a",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smith75a",
}
@Article{Smith:1975:CPT,
author = "A. J. Smith",
title = "Comments on a paper by {T. C. Chen} and {I. T. Ho}",
journal = j-CACM,
volume = "18",
number = "8",
pages = "463--463",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "advantages; alternatives; binary coded decimal; codes;
coding; compression of numbers; data handling; decimal
data; decoding; deletions; Huffman codes; insertions;
permutations; storage efficient representation;
variable length codes",
treatment = "G General Review; T Theoretical or Mathematical",
}
@Article{Ghosh:1975:CSR,
author = "Sakti P. Ghosh",
title = "Consecutive Storage of Relevant Records with
Redundancy",
journal = j-CACM,
volume = "18",
number = "8",
pages = "464--471",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "52 4743",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:43:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Ghosh75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper studies the properties of a new class of
file organizations (CRWR) where records relevant to
every query are stored in consecutive storage locations
but the organizations contain redundancy. Some theorems
which provide tools for reducing redundancy in CRWR
organizations have been also developed. Redundancies
obtained by the application of these theorems are
compared with that of query-inverted file
organizations. Some CRWR organizations with minimum
redundancy have also been developed for queries which
specify sets of keys.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "consecutive storage; data processing; file
organisation; file organizations; keys; query; records;
redundancy; retrieval",
oldlabel = "Ghosh75",
treatment = "N New Development; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ghosh75",
}
@Article{Lamport:1975:MBP,
author = "Leslie Lamport",
title = "Multiple Byte Processing with Full-Word Instructions",
journal = j-CACM,
volume = "18",
number = "8",
pages = "471--475",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:15 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Lamport75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is described which allows parallel processing
of packed data items using only ordinary full-word
computer instructions, even though the processing
requires operations whose execution is contingent upon
the value of a datum. It provides a useful technique
for processing small data items such as alphanumeric
characters.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Massachusetts Computer Associates, Inc., Wakefield,
MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "alphanumeric characters; byte processing; character
processing; data processing; datum; full-word
instructions; packed data; parallel; parallel
processing; processing; programming",
oldlabel = "Lamport75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport75",
}
@Article{Shwayder:1975:CDR,
author = "Keith Shwayder",
title = "Combining Decision Rules in a Decision Table",
journal = j-CACM,
volume = "18",
number = "8",
pages = "476--480",
month = aug,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:32 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Shwayder75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The techniques for minimizing logic circuits are
applied to the simplification of decision tables by the
combining of decision rules. This method is logically
equivalent to the Quine-McCluskey method for finding
prime implicants. If some of the decision rules implied
in the ELSE Rule occur with low frequency, then the
ELSE Rule can be used to further simplify the decision
table. Several objectives merit consideration in
optimizing a decision table. (1) reducing machine
execution time; (2) reducing preprocessing time; (3)
reducing required machine memory; (4) reducing the
number of decision rules. Objectives (3) and (4) can be
furthered with the above methods. Objective (1) is also
attained if overspecified decision rules are not
combined. Objective (2) must be compared against the
potential benefits of objectives (1), (3), and (4) in
deciding whether to use the above methods.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Samsonite Corp., Furniture Div., Denver, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Boolean method; coding; computer systems programming;
decision rules; decision table; decision tables;
flowcharting; minimisation; minimizing logic circuits;
prime implicants; Quine McCluskey method; sorting",
oldlabel = "Shwayder75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shwayder75",
}
@Article{Steele:1975:MCG,
author = "Guy L. {Steele, Jr.}",
title = "Multiprocessing Compactifying Garbage Collection",
journal = j-CACM,
volume = "18",
number = "9",
pages = "495--508",
month = sep,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:02 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Steele75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Steele:1976:CMC}.",
abstract = "Algorithms for a multiprocessing compactifying garbage
collector are presented and discussed. \par
The simple case of two processors, one performing
LISP-like list operations and the other performing
garbage collection continuously, is thoroughly
examined. The necessary capabilities of each processor
are defined, as well as interprocessor communication
and interlocks. Complete procedures for garbage
collection and for standard list processing primitives
are presented and thoroughly explained. Particular
attention is given to the problems of marking and
relocating list cells while another processor may be
operating on them. The primary aim throughout is to
allow the list processor to run unimpeded while the
other processor reclaims list storage. The more complex
cases involving several list processors and one or more
garbage collection processors are also briefly
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "capabilities; compactification; computer systems
programming; data structures; free storage; garbage
collection; gc processor; interlocks; interprocessor
communication; LISP; list; list processing; list
storage; management; multiprocessing; multiprocessing
compactifying garbage collector; multiprocessing
programs; operations; parallel processing; pointers;
reclaimer; relocation; semaphores; storage; storage
allocation; storage reclamation; synchronization",
oldlabel = "Steele75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Steele75",
}
@Article{Bentley:1975:MBS,
author = "Jon Louis Bentley",
title = "Multidimensional Binary Search Trees Used for
Associative Searching",
journal = j-CACM,
volume = "18",
number = "9",
pages = "509--517",
month = sep,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:54 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/database.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Bentley75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Bentley75.html",
abstract = "This paper develops the multidimensional binary search
tree (or k-d tree, where k is the dimensionality of the
search space) as a data structure for storage of
information to be retrieved by associative searches.
The k-d tree is defined and examples are given. It is
shown to be quite efficient in its storage
requirements. A significant advantage of this structure
is that a single data structure can handle many types
of queries very efficiently. Various utility algorithms
are developed.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM18/P509.pdf",
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 901",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; content-addressable storage; data
structures; efficient; homogeneous splitting;
information; information retrieval; information
retrieval systems; intersection query; K-D trees;
multidimensional binary search tree; partial match;
queries; retrieval; running times; single data;
structure; trees (mathematics); utility algorithms",
oldlabel = "Bentley75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bentley75",
}
@Article{Claudson:1975:DSR,
author = "R. Mark Claudson",
title = "Digital Simulation of River Plankton Population
Dynamics",
journal = j-CACM,
volume = "18",
number = "9",
pages = "517--523",
month = sep,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Claudson75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper deals with the development of a
mathematical model for and the digital simulation in
Fortran IV of phytoplankton and zooplankton population
densities in a river using previously developed rate
expressions. As an investigation of the accuracy of the
simulation methods, a simulation of the actual
population dynamics of Asterionella in the Columbia
River was made based on approximations of conditions in
that river. The study demonstrates the usefulness of
digital simulations in the examinations of certain
aquatic ecosystems, as well as in environmental
planning involving such examinations.",
acknowledgement = ack-nhfb,
classcodes = "C7330 (Biology and medical computing); C7440 (Civil
and mechanical engineering computing)",
classification = "723; 901",
corpsource = "Hanford High School, Richland, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximations; aquatic ecosystems; computer
simulation; digital simulation; ecological mechanisms;
ecology; environmental engineering; environmental
simulation; expressions; FORTRAN; mathematical
modelling; mathematical models; pollution; rate; river
plankton population dynamics; simulation; velocity
cycle",
oldlabel = "Claudson75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Claudson75",
}
@Article{Piepmeier:1975:OBR,
author = "William F. Piepmeier",
title = "Optimal Balancing of {I/O} Requests to Disks",
journal = j-CACM,
volume = "18",
number = "9",
pages = "524--527",
month = sep,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Piepmeier75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Determining a policy for efficient allocation and
utilization of a set of disk drives with differing
operational characteristics is examined using
analytical techniques. Using standard queueing theory,
each disk drive is characterized by a queueing model
with service time of a disk drive represented by the
probability density function of the sum of two uniform
distributions. Total response time of the set of disk
models is then minimized under varying load conditions.
The results indicate that faster devices should have
higher utilization factors and that the number of
different device types utilized tends to decrease with
decreasing load. Specific examples using 2314 and 3330
combinations are examined.",
acknowledgement = ack-nhfb,
annote = "Determining a policy for efficient allocation and
utilization of a set of disk drives with differing
operational characteristics is examined using
analytical techniques. Using standard queueing theory,
each disk drive is characterized by a queueing model
with service time of a disk drive represented by the
probability density function of the sum of two uniform
distributions. Total resp. time of the set of disk is
minim. under vary. load. cond.",
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "921; 922",
corpsource = "Washington Univ., Saint Louis, MO, USA",
country = "USA",
descriptors = "Analysis; queueing theory; queueing system; model;
disk; system evaluation; scheduling; distribution",
enum = "3649",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "allocation; analytical techniques; balancing;
characteristics; device assignment; disc; drives;
efficient allocation; file organisation; input/output;
modelling; operational; optimization; probability ---
Queueing Theory; probability density function; queueing
theory; scheduling; storage; utilization factors",
language = "English",
oldlabel = "Piepmeier75",
references = "5",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Piepmeier75",
}
@Article{Wegbreit:1975:MPA,
author = "Ben Wegbreit",
title = "Mechanical Program Analysis",
journal = j-CACM,
volume = "18",
number = "9",
pages = "528--539",
month = sep,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "53 9701",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 07:28:38 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Wegbreit75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "One means of analyzing program performance is by
deriving closed-form expressions for their execution
behavior. This paper discusses the mechanization of
such analysis, and describes a system, Metric, which is
able to analyze simple Lisp programs and produce, for
example, closed-form expressions for their running time
expressed in terms of size of input. This paper
presents the reasons for mechanizing program analysis,
describes the operation of Metric, explains its
implementation, and discusses its limitations.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6140D (High
level languages); C6150G (Diagnostic, testing,
debugging and evaluating systems)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algebraic manipulation; analysis; computer programming
languages; execution behaviour; functional lisp;
generating functions; LISP; lisp; list; mechanization;
mechanizing program; metric; performance; processing;
program analysis; programming; programming languages;
programs; running time; size of input",
oldlabel = "Wegbreit75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wegbreit75",
}
@Article{Gerritsen:1975:PSD,
author = "Rob Gerritsen",
title = "A Preliminary System for the Design of {DBTG} Data
Structures",
journal = j-CACM,
volume = "18",
number = "10",
pages = "551--557",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:52 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Gerritsen75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The functional approach to database design is
introduced. In this approach the goal of design is to
derive a data structure which is capable of supporting
a set of anticipated queries rather than a structure
which ``models the business'' in some other way. An
operational computer program is described which
utilizes the functional approach to design data
structures conforming to the Data Base Task Group
specifications. The automatic programming technology
utilized by this program, although typically used to
generate procedure, is here used to generate
declaratives.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Pennsylvania, Philadelphia, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic programming; Data Base; data processing;
data structures; database design; functional approach;
nonprocedural languages; operational computer program;
preliminary system; Task Group; translation",
oldlabel = "Gerritsen75",
review = "ACM CR 7604-??",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gerritsen75",
}
@Article{Shu:1975:CHL,
author = "Nan C. Shu and Barron C. Housel and Vincent Y. Lum",
title = "{CONVERT}: {A} High Level Translation Definition
Language for Data Conversion",
journal = j-CACM,
volume = "18",
number = "10",
pages = "557--567",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ShuHL75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: 19 ACM SIGMOD Conf. on the
Management of Data, King(ed), May.1975.",
abstract = "This paper describes a high level and nonprocedural
translation definition language, CONVERT, which
provides very powerful and highly flexible data
restructuring capabilities. Its design is based on the
simple underlying concept of a form which enables the
users to visualize the translation processes, and thus
makes data translation a much simpler task.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; convert; data; data
conversion; data handling; data processing --- Data
Structures; data translation; database reorganisation;
nonprocedural translation definition language; problem
oriented languages; programming languages;
restructuring; translation definition language; utility
program",
oldlabel = "ShuHL75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShuHL75",
}
@Article{Sterling:1975:CHL,
author = "T. Sterling and V. Lum and N. Shu and B. Housel",
title = "{\em CONVERT\/}: {A} High Level Translation Definition
Language for Data Conversion",
journal = j-CACM,
volume = "18",
number = "10",
pages = "557--567",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Feb 12 14:34:00 1996",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/database.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a high level and nonprocedural
translation definition language, CONVERT, which
provides very powerful and highly flexible data
restructuring capabilities. Its design is based on the
simple underlying concept of a form which enables the
users to visualize the translation processes, and thus
makes data translation a much simpler task. ``CONVERT''
has been chosen for conveying the purpose of the
language and should not be confused with any other
language or program bearing the same name.",
acknowledgement = ack-nhfb,
annote = "A full description of the CONVERT language is given.
It is fairly complete, and dealt well with record
oriented systems. A good set of examples is given.",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data conversion; data restructuring; data translation;
database reorganization; nonprocedural languages;
programming languages; translation definition; utility
program",
owner = "curtis",
}
@Article{Smith:1975:OPR,
author = "John Miles Smith and Philip Yen-Tang Chang",
title = "Optimizing the Performance of a Relational Algebra
Data Base Interface",
journal = j-CACM,
volume = "18",
number = "10",
pages = "568--579",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#SmithC75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/SmithC75.html",
abstract = "A relational algebra interface, called SQUIRAL, is
described in detail. SQUIRAL seeks to minimize query
response time and space utilization by: (1) performing
global query optimization, (2) exploiting disjoint and
pipelined concurrency, (3) coordinating sort orders in
temporary relations, (4) employing directory analysis,
and (5) maintaining locality in page references.
Algorithms for implementing the operators of E. F.
Codd's relational algebra are presented, and a
methodology for composing them to optimize the
performance of a particular user query is described.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM18/P568.pdf",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic; data; data processing; directory analysis;
file; global query optimisation; inverted; manipulation
language; optimisation; pipelined concurrency;
programming; query response; query specification;
relational algebra database interface; sort orders;
space utilization; SQUIRAL; time; very high level
language",
oldlabel = "SmithC75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SmithC75",
}
@Article{Astrahan:1975:ISE,
author = "Morton M. Astrahan and Donald D. Chamberlin",
title = "Implementation of a {Structured English Query
Language}",
journal = j-CACM,
volume = "18",
number = "10",
pages = "580--588",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#AstrahanC75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: 19 ACM SIGMOD Conf. on the
Management of Data, King(ed), May.1975",
URL = "http://dblp.uni-trier.de/db/journals/cacm/AstrahanC75.html",
abstract = "SEQUEL is a nonprocedural language which does not make
use of quantifiers or other mathematical concepts;
rather, SEQUEL uses a block structured format of
English key words (hence the acronym ``Structured
English Query Language'' ). SEQUEL is intended for
interactive, problem solving use by people who have
need for interaction with a large database but who are
not trained programmers. This class of users includes
urban planners, sociologists, accountants, and other
professionals. The objective of the language is to
provide a simple, easy-to-learn means of expressing the
primitive actions used by people to obtain information
from tables, such as ``look up a value in a column.''
SEQUEL and its companion language, SQUARE, have been
shown to be relationally complete, i.e. equivalent in
power to Codd's relational calculus.",
acknowledgement = ack-nhfb,
annote = "Description of implementation of SEQUEL interpreter,
especially optimizer, which uses indexes to simplify
queries.",
cdrom = "CACMs1/CACM18/P580.pdf",
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages); C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "IBM Res. Div., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACM; data accessing; data handling; data
organisation; data processing; data structure; data
structures; data sublanguage; database; nonprocedural
language; operations; optimisation algorithms; problem
oriented languages; program interpreters; prototype
interpreter; relation database IBM San Jose; relational
model; SEQUEL; structured English query language",
oldlabel = "AstrahanC75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AstrahanC75",
}
@Article{Gavril:1975:MPP,
author = "Fanica Gavril",
title = "Merging with Parallel Processors",
journal = j-CACM,
volume = "18",
number = "10",
pages = "588--591",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Gavril75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Consider two linearly ordered sets A, B, vertical A
vertical equals m, vertical B vertical equals n, m less
than equivalent to n, and p,p less than equivalent to
m, parallel processors working synchronously. The paper
presents an algorithm for merging A and B with the p
parallel processors, which requires at most 2 left
bracket log//2(2m plus 1) right bracket plus left
bracket 3m/p right bracket plus left bracket m/p right
bracket left bracket log//2(n/m) right bracket steps.
If n equals 2** beta m ( beta an integer), the
algorithm requires at most 2 left bracket log//2(m plus
1) right bracket plus left bracket m/p right bracket (2
plus beta ) steps. In the case where m and n are of the
same order of magnitude, i.e. n equals km with k being
a constant, the algorithm requires 2 left bracket
log//2(m plus 1) right bracket plus right bracket m/p
right bracket (3 plus k) steps. These performances
compare very favorably with the previous best parallel
merging algorithm, Batcher's algorithm, which requires
n/p plus ((m plus n)/2p)log//2m steps in the general
case and km/p plus ((k plus l)/2)(m/p)log//2m in the
special case where n equals km.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "722; 723",
corpsource = "Univ. of Illinois, Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Batcher's algorithm; computer systems programming ---
Sorting; computer systems, digital; linearly ordered
sets; merging; parallel binary insertion; parallel
processing; parallel processors; programming theory",
oldlabel = "Gavril75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gavril75",
}
@Article{Reiser:1975:HRE,
author = "Martin Reiser and H. Kobayashi",
title = "{Horner}'s Rule for the Evaluation of General Closed
Queueing Networks",
journal = j-CACM,
volume = "18",
number = "10",
pages = "592--593",
month = oct,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1975.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#ReiserK75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The solution of separable closed queueing networks
requires the evaluation of homogeneous multinomial
expressions. The number of terms in those expressions
grows combinatorially with the size of the network such
that a direct summation may become impractical. An
algorithm is given which does not show a combinatorial
operation count. The algorithm is based on a
generalization of Horner's rule for polynomials. It is
also shown how mean queue size and throughput can be
obtained at negligible extra cost once the
normalization constant is evaluated.",
acknowledgement = ack-nhfb,
annote = "An algorithm is given which makes it possible to solve
separable closed queueing networks independent from the
size of the network. The algorithm does not show a
combinatorial operation count; it is based on a
generalization of Horner's rule for polynomials. Also
is shown how mean queue size and throughput can be
obtained at negligible extra cost once the
normalization constant is evaluated.",
classcodes = "B0240C (Queueing theory); C1140C (Queueing theory)",
classification = "723; 912; 922",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
country = "USA",
descriptors = "Closed queueing network; algorithm; evaluation",
enum = "3660",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "closed queueing networks; combinatorial operation
count; expressions; homogeneous multinomial; Horner's
rule; load dependent service rate; multinomial sums;
operations research --- Computer Applications;
probability; queueing theory",
language = "English",
oldlabel = "ReiserK75",
references = "8",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ReiserK75",
}
@Article{Salton:1975:VSM,
author = "Gerard Salton and A. Wong and C. S. Yang",
title = "A Vector Space Model for Automatic Indexing",
journal = j-CACM,
volume = "18",
number = "11",
pages = "613--620",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:07 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#SaltonWY75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In a document retrieval, or other pattern matching
environment where stored entities (documents) are
compared with each other or with incoming patterns
(search requests), it appears that the best indexing
(property) space is one where each entity lies as far
away from the others as possible; in these
circumstances the value of an indexing system may be
expressible as a function of the density of the object
space; in particular, retrieval performance may
correlate inversely with space density. An approach
based on space density computations is used to choose
an optimum indexing vocabulary for a collection of
documents. Typical evaluation results are shown,
demonstrating the usefulness of the model.",
acknowledgement = ack-nhfb,
annote = "Optimizing of relationship strength based data
access.",
classcodes = "C6130 (Data handling techniques); C7240 (Information
analysis and indexing)",
classification = "723; 901",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic indexing; content analysis; density;
document retrieval; incoming patterns; indexing;
information science; library mechanisation; pattern
matching environment; space; vector space model",
oldlabel = "SaltonWY75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SaltonWY75",
}
@Article{Boyce:1975:SQR,
author = "Raymond F. Boyce and Donald D. Chamberlin and W. Frank
{King III} and Michael M. Hammer",
title = "Specifying Queries as Relational Expressions: The
{SQUARE} Data Sublanguage",
journal = j-CACM,
volume = "18",
number = "11",
pages = "621--628",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#BoyceCKH75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/sqlbooks.bib",
note = "Also published in/as: in Douque74 (IFIP TC-2), 1974.
Also published in/as: ACM SIGPLAN-SIGIR 1974, Nance
(ed), pp. 31--47. Also published in/as: IBM, San Jose
Research Report RJ1291, October 1973.",
URL = "http://dblp.uni-trier.de/db/journals/cacm/BoyceCKH75.html",
abstract = "This paper presents a data sublanguage called SQUARE,
intended for use in ad hoc, interactive problem solving
by non-computer specialists. SQUARE is based on the
relational model of data, and is shown to be
relationally complete; however, it avoids the
quantifiers and bound variables required by languages
based on the relational calculus. Facilities for query,
insertion, deletion, and update on tabular data bases
are described. A syntax is given, and suggestions are
made for alternative syntaxes, including a syntax based
on English key words for users with limited
mathematical background.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM18/P621.pdf",
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "casual user; data processing; data sublanguage;
database; English key words; interactive problem;
nonprocedural language; problem oriented languages;
query languages; relational calculus; relational
expressions; SQUARE (Specifying Queries As Relational
Expressions); square; tabular data",
oldlabel = "BoyceCKH75",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BoyceCKH75",
}
@Article{Ledgard:1975:GCS,
author = "Henry F. Ledgard and Michael Marcotty",
title = "A Genealogy of Control Structures",
journal = j-CACM,
volume = "18",
number = "11",
pages = "629--639",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:09 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#LedgardM75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The classic result of Bohm and Jacopini on the
theoretical completeness of if-then-else and while-do
is discussed. Several recent ideas on control
structures are then explored. These include a review of
various other control structures, results on time\slash
space limitations, and theorems relating the relative
power of control structures under several notions of
equivalence. In conclusion, the impact of theoretical
results on the practicing programmer and the importance
of one-in, one-out control structures as operational
abstractions are discussed. It is argued further that
there is insufficient evidence to warrant more than
if-then-else, while-do, and their variants.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6110 (Systems analysis
and programming)",
classification = "723",
corpsource = "Univ. of Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; go to statements;
language design; operational abstractions; PASCAL;
program control structures; programming; structured
programming",
oldlabel = "LedgardM75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LedgardM75",
}
@Article{Graham:1975:PSE,
author = "Susan L. Graham and Steven P. Rhodes",
title = "Practical Syntactic Error Recovery",
journal = j-CACM,
volume = "18",
number = "11",
pages = "639--650",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:46:00 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#GrahamR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a recovery scheme for syntax
errors which provides automatically-generated high
quality recovery with good diagnostic information at
relatively low cost. Previous recovery techniques are
summarized and empirical comparisons are made.
Suggestions for further research on this topic conclude
the paper.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150C
(Compilers, interpreters and other processors); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compilers; computer programming languages; correction;
debugging; diagnostic information; error; error
compensation; error correction; parsing; program
compilers; program debugging; simple precedence;
syntactic error recovery; system recovery",
oldlabel = "GrahamR75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GrahamR75",
}
@Article{Bitner:1975:BPT,
author = "James R. Bitner and Edward M. Reingold",
title = "Backtrack Programming Techniques",
journal = j-CACM,
volume = "18",
number = "11",
pages = "651--656",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:37 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/graph.coloring.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#BitnerR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The purpose of this paper is twofold. First, a brief
exposition of the general backtrack technique and its
history is given. Second, it is shown how the use of
macros can considerably shorten the computation time in
many cases. In particular, this technique has allowed
the solution of two previously open combinatorial
problems, the computation of new terms in a well-known
series, and the substantial reduction in computation
time for the solution to another combinatorial
problem.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6100
(Software techniques and systems)",
classification = "723",
corpsource = "Univ. of Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "backtrack; combinatorial computing; combinatorial
problems; computer programming; depth first search;
depth-first search; difference-preserving codes;
exhaustive; exhaustive search; graph coloring related
algorithms; macros; non-attacking queen's problem;
nonattacking queen's problem; pentominoes; problems;
programming theory; search; shorten the computation
time; squaring the square; tiling; tiling problems",
oldlabel = "BitnerR75",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BitnerR75",
}
@Article{Kou:1975:NSB,
author = "Lawrence T. Kou and C. K. Wong",
title = "A Note on the Set Basis Problem Related to the
Compaction of Character Sets",
journal = j-CACM,
volume = "18",
number = "11",
pages = "656--657",
month = nov,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "52 7196",
MRreviewer = "Dorothy Bollman",
bibdate = "Mon Jan 22 06:55:57 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#KouW75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This note discusses the reduction of the set basis
problem to the clique cover problem.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "character sets; clique; compaction of character sets;
computational complexity; computer programming; cover
problem; data compression; polynomial completeness; set
basis problem; set covering",
oldlabel = "KouW75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KouW75",
}
@Article{Naur:1975:PLN,
author = "Peter Naur",
title = "Programming Languages, Natural Languages, and
Mathematics",
journal = j-CACM,
volume = "18",
number = "12",
pages = "676--683",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (68A30)",
MRnumber = "56 13752",
bibdate = "Mon Jan 22 07:07:29 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Naur75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Second {ACM} Symposium on Principles
of Programming Languages (Palo Alto, Calif., 1975).",
abstract = "Some social aspects of programming are illuminated
through analogies with similar aspects of mathematics
and natural languages. The split between pure and
applied mathematics is found similarly in programming.
The development of natural languages toward
flexionless, word-order based language types speaks for
programming language design based on general, abstract
constructs. By analogy with incidents of the history of
artificial, auxiliary languages it is suggested that
Fortran and Cobol will remain dominant for a long time
to come. The most promising avenues for further work of
wide influence are seen to be high quality program
literature (i.e. programs) of general utility and
studies of questions related to program style.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Datalogisk Inst., Copenhagen Univ., Copenhagen,
Denmark",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract constructs; artificial; auxiliary languages;
computer programming languages; descriptive and;
literature; prescriptive attitudes; programming
language; programming languages; pure and applied
mathematics; social aspects of automation; social
aspects of programming; style",
oldlabel = "Naur75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Naur75",
}
@Article{Goodenough:1975:EHI,
author = "John B. Goodenough",
title = "Exception Handling: Issues and a Proposed Notation",
journal = j-CACM,
volume = "18",
number = "12",
pages = "683--696",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Goodenough75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper defines exception conditions, discusses the
requirements exception handling language features must
satisfy, and proposes some new language features for
dealing with exceptions in an orderly and reliable way.
The proposed language features serve to highlight
exception handling issues by showing how deficiencies
in current approaches can be remedied.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "SofTech Inc., Waltham, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; conditions; error;
exception conditions; exception handling; goto
statement; language features; multilevel exit; ON
conditions; programming; programming languages;
proposed notation; structured programming",
oldlabel = "Goodenough75",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Goodenough75",
}
@Article{Jazayeri:1975:IEC,
author = "Mehdi Jazayeri and William F. Ogden and William C.
Rounds",
title = "The Intrinsically Exponential Complexity of the
Circularity Problem for Attribute Grammars",
journal = j-CACM,
volume = "18",
number = "12",
pages = "697--706",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "52 16115",
MRreviewer = "I. Hal Sudborough",
bibdate = "Mon Jan 22 06:52:45 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/AG.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#JazayeriOR75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Second {ACM} Symposium on Principles
of Programming Languages (Palo Alto, Calif., 1975)",
abstract = "Attribute grammars are an extension of context-free
grammars devised by Knuth as a mechanism for including
the semantics of a context-free language with the
syntax of the language. The circularity problem for a
grammar is to determine whether the semantics for all
possible sentences (programs) in fact will be well
defined. It is proved that this problem is, in general,
computationally intractable. Specifically, it is shown
that any deterministic algorithm which solves the
problem must for infinitely many cases use an
exponential amount of time. An improved version of
Knuth's circularity testing algorithm is also given,
which actually solves the problem within exponential
time.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4240 (Programming and algorithm
theory)",
classification = "721; 723",
corpsource = "Univ. of North Carolina, Chapel Hill, NC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "attribute grammars; automata theory; circ; circularity
problem; computational complexity; computer programming
languages; context free grammars; context-free
grammars; deterministic algorithm; exponential time;
intrinsically exponential complexity; semantics",
oldlabel = "JazayeriOR75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JazayeriOR75",
}
@Article{Hunt:1975:CLK,
author = "Harry B. {Hunt, III} and Thomas G. Szymanski and
Jeffrey D. Ullman",
title = "On the Complexity of {LR(k)} Testing",
journal = j-CACM,
volume = "18",
number = "12",
pages = "707--716",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (68A30)",
MRnumber = "52 12402",
MRreviewer = "Pavel Strnad",
bibdate = "Mon Jan 22 06:51:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#HuntSU75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Second ACM Symposium on Principles of
Programming Languages (Palo Alto, Calif., 1975).",
abstract = "The problem of determining whether an arbitrary
context-free grammar is a member of some easily parsed
subclass of grammars such as the LR(k) grammars is
considered. The time complexity of this problem is
analyzed both when k is considered to be a fixed
integer and when k is considered to be a parameter of
the test. In the first case, it is shown that for every
k there exists an O(n**k** plus **2) algorithm for
testing the LR(k) property, where n is the size of the
grammar in question. On the other hand, if both k and
the subject grammar are problem parameters, then the
complexity of the problem depends very strongly on the
representation chosen for k. More specifically, it is
shown that this problem is NP-complete when k is
expressed in unary. When k is expressed in binary the
problem is complete for nondeterministic exponential
time. These results carry over to many other
parameterized classes of grammars, such as the LL(k),
strong LL(k), SLR(k), and strong LC(k) grammars.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4240 (Programming and algorithm
theory)",
classification = "721; 723",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; computational complexity; computer
programming languages; context free grammar;
context-free grammars; LR(k) grammars; nondeterministic
exponential time; NP complete; parsing; problems; time
complexity",
oldlabel = "HuntSU75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HuntSU75",
}
@Article{Graham:1975:FUL,
author = "Susan L. Graham and Mark N. Wegman",
title = "A Fast and Usually Linear Algorithm for Global Flow
Analysis (Abstract)",
journal = j-CACM,
volume = "18",
number = "12",
pages = "716--716",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:46:01 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#GrahamW75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Graham:1976:FUL} for full paper.",
abstract = "A new algorithm for global flow analysis on reducible
graphs is presented. The algorithm is shown to treat a
very general class of function spaces. \par
For a graph of $e$ edges, the algorithm has a worst
case time bound of $O(e \log e)$ function operations.
\par
It is also shown that in programming terms, the number
of operations is proportional to $e$ plus the number of
exits from program loops. Consequently a restriction to
one-entry one-exit control structures linearity. The
algorithm can be extended to yet larger classes of
function spaces and graphs by relaxing the time bound.
Examples are given of code improvement problems which
can be solved using the algorithm.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics)",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "bound; code optimisation; code optimization; common;
common subexpression elimination; compression; data
flow; depth-first search; flow graph; function spaces;
global flow analysis; go-to-less programming; graph
theory; information propagation; live-dead analysis;
path; path compression; reducibility; reducible graphs;
subexpression elimination; worst case time",
oldlabel = "GrahamW75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GrahamW75",
}
@Article{Lipton:1975:RMP,
author = "Richard J. Lipton",
title = "Reduction: {A} Method of Proving Properties of
Parallel Programs",
journal = j-CACM,
volume = "18",
number = "12",
pages = "717--721",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "53 4599",
MRreviewer = "O. A. Leticevskii",
bibdate = "Mon Jan 22 06:59:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Lipton75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Second {ACM} Symposium on Principles
of Programming Languages (Palo Alto, Calif., 1975).",
abstract = "When proving that a parallel program has a given
property it is often convenient to assume that a
statement is indivisible, i.e. that the statement
cannot be interleaved with the rest of the program.
Here sufficient conditions are obtained to show that
the assumption that a statement is indivisible can be
relaxed and still preserve properties such as halting.
Thus correctness proofs of a parallel system can often
be greatly simplified.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Yale Univ., New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computation sequence; computer metatheory; deadlock;
free; halting; indivisible; interruptible; parallel
processing; parallel programs; process; programming
theory; reduction; semaphore; verification method",
oldlabel = "Lipton75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lipton75",
}
@Article{Schwartz:1975:ADS,
author = "Jacob T. Schwartz",
title = "Automatic Data Structure Choice in a Language of Very
High Level",
journal = j-CACM,
volume = "18",
number = "12",
pages = "722--728",
month = dec,
year = "1975",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:06 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/opt.compiler.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm18.html#Schwartz75;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "SETL is a set-theoretically oriented language of very
high level whose repertoire of semantic objects
includes finite sets, ordered n-tuples, and sets of
ordered n-tuples usable as mappings. This paper
describes the structure of an optimizer for this
language. Among other methods of interest, the
optimizer uses techniques which allow relations of
inclusion and membership to be established, the domains
and ranges of (tabulated) mappings to be estimated from
above and below, and the single-valuedness of
(tabulated) mappings to be proved. Once facts of this
kind have been established, automatic choice of data
structures becomes possible. The methods employed are
based upon, and extend, known techniques of data flow
analysis.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6140D (High
level languages)",
classification = "723",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic programming; computer programming languages;
data flow analysis; data processing --- Data
Structures; data structure choice; data structures;
language; mappings; optimisation; program; programming
languages; programming theory; set theoretically
oriented; SETL",
oldlabel = "Schwartz75",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schwartz75",
}
@Article{Kleinrock:1976:SLO,
author = "Leonard Kleinrock and William E. Naylor and Holger
Opderbeck",
title = "A Study of Line Overhead in the {ARPANET}",
journal = j-CACM,
volume = "19",
number = "1",
pages = "3--13",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1976.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#KleinrockNO76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The form, extent, and effect of the communication line
overhead in the ARPANET are considered. The source of
this overhead is separated into various levels of
protocol hierarchy and the characteristics of each
level are summarized. Then the line efficiency for
various models of system use is studied. Some
measurements of line efficiency for the ARPANET are
presented and by extrapolation these measurements are
used to anticipate overhead in a heavily loaded
network. Similar results are derived for a recently
proposed network protocol and compared with those for
the current system.",
acknowledgement = ack-nhfb,
annote = "The form, extend, and effect of the communication line
overhead in the Arpanet are considered.",
classcodes = "C5620 (Computer networks and techniques)",
classification = "723",
corpsource = "Univ. of California, Los Angeles, CA, USA",
country = "USA",
date = "08/12/80",
descriptors = "ARPANET; packet switching; performance evaluation;
OVERHEAD",
enum = "1703",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ARPANET; communication line; computer networks;
computer systems, digital --- Time Sharing; computers;
heavily loaded network; hierarchy; line efficiency;
line overhead; protocol",
language = "English",
oldlabel = "KleinrockNO76",
references = "23",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KleinrockNO76",
}
@Article{Wilhelm:1976:ADS,
author = "Neil C. Wilhelm",
title = "An Anomaly in Disk Scheduling: {A} Comparison of
{FCFS} and {SSTF} Seek Scheduling Using an Empirical
Model for Disk Accesses",
journal = j-CACM,
volume = "19",
number = "1",
pages = "13--17",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Wilhelm76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A model for disk accesses based on published
measurements is developed. The model is used to show
that under highly probable conditions, FCFS seek
scheduling is superior to SSTF scheduling in the sense
of having a lower mean queue length. A simple example
of an arrival sequence illustrating this anomaly is
presented.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "721; 722",
corpsource = "Univ. of Rochester, Rochester, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(computers); comparison; data storage, magnetic; disc
accesses; disc scheduling; empirical model; FCFS;
magnetic disc and drum storage; operating systems; seek
scheduling; SSTF",
oldlabel = "Wilhelm76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wilhelm76",
}
@Article{Agnew:1976:QAR,
author = "Carson E. Agnew",
title = "On Quadratic Adaptive Routing Algorithms",
journal = j-CACM,
volume = "19",
number = "1",
pages = "18--22",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:42 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1976.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Agnew76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two analytic models of a store-and-forward
communications network are constructed, one to find the
optimal message routing and the other to illustrate the
equilibrium (stationary state) maintained by an
adaptive routing algorithm. These models show that
adaptive routing does not satisfy the necessary
conditions for an optimal routing. Adaptive routing
tends to overuse the direct path and underuse alternate
routes because it does not consider the impact of its
current routing decision on the future state of the
network. The form of the optimality conditions suggests
that a modification of the adaptive algorithm will
result in optimality. The modification requires the
substitution of a quadratic bias term instead of a
linear one in the routing table maintained at each
network node. Simulation results are presented which
confirm the theoretical analysis for a simple
network.",
acknowledgement = ack-nhfb,
annote = "Two analytic models of a store-and-forward
communications network are constructed, one to find the
optimal message routing and the other to illustrate the
equilibrium maintained by an adaptive routing
algorithm. These models show that adaptive routing does
not satisfy the necessary conditions for an optimal
routing. Adaptive routing tends to overuse the direct
path and underuse alternate routes because it does not
consider the impact of the ro",
classcodes = "B6210Z (Other data transmission); C5600 (Data
communication equipment and techniques)",
classification = "723",
corpsource = "Stanford Univ., Stanford, CA, USA",
country = "USA",
descriptors = "Routing algorithm; adaptive routing; quadratic
routing; alternate routing; store-and-forward; computer
network; distributed computing system; message
switching",
enum = "37",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "adaptive routing; algorithms; alternate routing;
communications network; computer network; computer
programming; digital communication systems; distributed
network; equilibrium; forward; message switching;
optimal message; quadratic adaptive routing; quadratic
routing; routing; routing algorithms; store-and-forward
network",
language = "English",
oldlabel = "Agnew76",
references = "0",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Agnew76",
}
@Article{Karlton:1976:PHB,
author = "Philip L. Karlton and Samuel H. Fuller and R. E.
Scroggs and E. B. Kaehler",
title = "Performance of Height-Balanced Trees",
journal = j-CACM,
volume = "19",
number = "1",
pages = "23--28",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#KarltonFSK76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents the results of simulations that
investigate the performance of height-balanced (HB left
bracket k right bracket ) trees. It is shown that the
only statistic of HB left bracket 1 right bracket trees
(AVL trees) that is a function of the size of the tree
is the time to search for an item in the tree. For
sufficiently large trees, the execution times of all
procedures for maintaining HB left bracket 1 right
bracket trees are independent of the size of the
tree.",
acknowledgement = ack-nhfb,
annote = "Binary tree balancing when inserting and deleting.",
classcodes = "C4290 (Other computer theory); C6120 (File
organisation)",
classification = "723; 921",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "deletion; execution times; file organisation; height
balanced trees; information retrieval systems;
mathematical techniques; performance; search;
traceback; trees (mathematics)",
oldlabel = "KarltonFSK76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KarltonFSK76",
}
@Article{Florentin:1976:IRC,
author = "J. J. Florentin",
title = "Information Reference Coding",
journal = j-CACM,
volume = "19",
number = "1",
pages = "29--33",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:58 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Florentin76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Items in business systems have to be identified by
reference codes, which can later be used as data codes
and file keys in an associated data processing system.
In business systems associated with large collections
of integrated files (databases) it is vital to assign
codes in a methodical way so as to control future
extension and changes while maintaining correct program
action. The principles of methodical coding are
discussed, and the way in which logical connections
between data items must be reflected in the reference
code framework is shown through a set-theoretic
information model.",
acknowledgement = ack-nhfb,
annote = "Codes to denote associative tuples.",
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Birkbeck Coll., Univ. of London, London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "business systems; data codes; data handling; data
processing system; data processing, business;
databases; file keys; file organisation; information
model; integrated files; logical connections;
methodical coding; reference codes",
oldlabel = "Florentin76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Florentin76",
}
@Article{Litecky:1976:SEE,
author = "Charles R. Litecky and Gordon B. Davis",
title = "Study of Errors, Error-Proneness, and Error Diagnosis
in {Cobol}",
journal = j-CACM,
volume = "19",
number = "1",
pages = "33--37",
month = jan,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#LiteckyD76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper provides data on Cobol error frequency for
correction of errors in student-oriented compilers,
improvement of teaching, and changes in programming
language. Cobol was studied because of economic
importance, widespread usage, possible error-inducing
design, and lack of research.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6140D (High
level languages); C6150G (Diagnostic, testing,
debugging and evaluating systems)",
classification = "723",
corpsource = "Univ. of Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "COBOL; computer programming languages; error
diagnosis; errors; misspellings; program diagnostics;
programming",
oldlabel = "LiteckyD76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LiteckyD76",
}
@Article{vonBochmann:1976:SEL,
author = "Gregor von Bochmann",
title = "Semantic Evaluation from Left to Right",
journal = j-CACM,
volume = "19",
number = "2",
pages = "55--62",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "55 13879",
MRreviewer = "V. N. Agafonov",
bibdate = "Mon Jan 22 06:27:08 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/AG.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/dbase.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Bochmann76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes attribute grammars and their use
for the definition of programming languages and
compilers; a formal definition of attribute grammars
and a discussion of some of its important aspects are
included. The paper concentrates on the evaluation of
semantic attributes in a few passes from left to right
over the derivation tree of a program. A condition for
an attribute grammar is given which assures that the
semantics of any program can be evaluated in a single
pass over the derivation tree, and an algorithm is
discussed which decides how many passes from left to
right are in general necessary, given the attribute
grammar. These notions are explained in terms of an
example grammar which describes the scope rules of
Algol 60. Practical questions, such as the relative
efficiency of different evaluation schemes, and the
ease of adapting the attribute grammar of a given
programming language to the left-to-right evaluation
scheme are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Univ. of Montreal, Montreal, Que., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Algol 60; attribute grammars; compilers; computer
programming languages; context free grammar;
context-free grammars; context-free languages;
derivation tree; eval class; left to right; multipass;
programming languages; semantic attributes",
oldlabel = "Bochmann76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bochmann76",
}
@Article{Rivest:1976:SOS,
author = "Ronald L. Rivest",
title = "On Self-Organizing Sequential Search Heuristics",
journal = j-CACM,
volume = "19",
number = "2",
pages = "63--67",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (68A20)",
MRnumber = "53 12068",
MRreviewer = "Robert Wagner",
bibdate = "Mon Jan 22 07:16:16 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Rivest76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper examines a class of heuristics for
maintaining a sequential list in approximately optimal
order with respect to the average time required to
search for a specified element, assuming that each
element is searched for with a fixed probability
independent of previous searches performed. The ``move
to front'' and ``transposition'' heuristics are shown
to be optimal to within a constant factor, and the
transposition rule is shown to be the more efficient of
the two. Empirical evidence suggests that transposition
is in fact optimal for any distribution of search
probabilities.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C6120 (File organisation);
C6130 (Data handling techniques)",
classification = "723; 922",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial mathematics; computer systems
programming; list processing; probability; rule; self
organising; sequential search heuristics; sorting;
transposition",
oldlabel = "Rivest76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rivest76",
}
@Article{Ives:1976:PEF,
author = "F. M. Ives",
title = "Permutation Enumeration: Four New Permutation
Algorithms",
journal = j-CACM,
volume = "19",
number = "2",
pages = "68--72",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Ives76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Classical permutation enumeration algorithms encounter
special cases requiring additional computation every
nth permutation when generating the n! permutations on
n marks. Four new algorithms have the attribute that
special cases occur every n(n minus 1) permutations.
Two of the algorithms produce the next permutation with
a single exchange of two marks. The other two
algorithms infrequently exchange more than two marks,
but the rules for generating the next permutation are
very simple. Performance tests which have counted
execution of assignment statements, comparisons,
arithmetic operations, and subscripted array references
have shown superiority of the new algorithms compared
to Boothroyd's implementation of M. B. Wells' algorithm
and Erlich's implementation of the Johnson-Trotter
algorithm.",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics)",
classification = "723",
corpsource = "Western Washington State Coll., Bellingham, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial mathematics; computer programming;
enumeration; loop free algorithms; permutation",
oldlabel = "Ives76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ives76",
}
@Article{Martelli:1976:AHS,
author = "Alberto Martelli",
title = "Application of Heuristic Search Methods to Edge and
Contour Detection",
journal = j-CACM,
volume = "19",
number = "2",
pages = "73--83",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Martelli76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a method for detecting edges and
contours in noisy pictures. The properties of an edge
are embedded in a figure of merit and the edge
detection problem becomes the problem of minimizing the
given figure of merit. This problem can be represented
as a shortest path problem on a graph and can be solved
using well-known graph search algorithms. The relations
between this representation of the minimization problem
and a dynamic programming approach are discussed,
showing that the graph search method can lead to
substantial improvements in computing time. Moreover,
if heuristic search methods are used, the computing
time will depend on the amount of noise in the picture.
Some experimental results are given; these show how
various information about the shape of the contour of
an object can be embedded in the figure of merit, thus
allowing the extraction of contours from noisy pictures
and the separation of touching objects.",
acknowledgement = ack-nhfb,
classcodes = "B0260 (Optimisation techniques); B6140C (Optical
information, image and video signal processing); C1180
(Optimisation techniques); C1230 (Artificial
intelligence); C1250 (Pattern recognition); C5530
(Pattern recognition and computer vision equipment);
C7490 (Computing in other engineering fields)",
classification = "723; 921",
corpsource = "Istituto di Elaborazione della Informazione Consiglio
Nazionale delle Ricerche, Piza, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "contours; dynamic programming; edge and contour
detection; extraction of; heuristic programming;
heuristic search; image processing; mathematical
programming, dynamic; noisy; pattern; pattern
recognition; pattern recognition systems; picture
processing; pictures; problem; recognition; shortest
path; solving",
oldlabel = "Martelli76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Martelli76",
}
@Article{Siler:1976:SEM,
author = "Kenneth F. Siler",
title = "A Stochastic Evaluation Model for Database
Organization in Data Retrieval Systems",
journal = j-CACM,
volume = "19",
number = "2",
pages = "84--95",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Siler76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses a simulation model of a data
retrieval system which has the effect of significantly
reducing the cost of experimentation and enabling
research never attempted before. The model is designed
to estimate the retrieval workload of alternative data
retrieval systems. These data retrieval systems can be
organized under several database organizations,
including inverted list, threaded list, and cellular
list organizations and hybrid combinations of these
systems. Effectiveness of the methodology is
demonstrated by using the model to study the effect of
database organizations in data retrieval systems.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 922",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cellular list; data processing; data retrieval
systems; database management systems; database
organisations; information retrieval systems; inverted
list; list; mathematical models; physical database
design; simulation; stochastic evaluation model;
stochastic processes; threaded",
oldlabel = "Siler76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Siler76",
xxtitle = "A Stochastic Evaluation Model for Database
Organizations in Data Retrieval Systems",
}
@Article{Fagin:1976:CEC,
author = "Ronald Fagin",
title = "A Counterintuitive Example of Computer Paging",
journal = j-CACM,
volume = "19",
number = "2",
pages = "96--97",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 7000a",
MRreviewer = "W. Kwasowiec",
bibdate = "Mon Jan 22 06:38:28 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Fagin76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Fagin:1976:CCE}.",
abstract = "A counterexample is exhibited to a natural conjecture
concerning the optimal way to group records into pages
in the independent reference model of computer paging
(an organization is said to be optimal if the ``least
recently used'' miss ratio is minimized).",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "allocation; computer operating systems; computer
paging; independent reference model; least recently;
most likely together; record; storage organisation;
used; virtual storage",
oldlabel = "Fagin76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fagin76",
}
@Article{Artzy:1976:FDT,
author = "Ehud Artzy and James A. Hinds and Harry J. Saal",
title = "A Fast Division Technique for Constant Divisors",
journal = j-CACM,
volume = "19",
number = "2",
pages = "98--101",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (10A10)",
MRnumber = "54 1707",
MRreviewer = "C. F. Kelemen",
bibdate = "Mon Jan 22 06:22:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#ArtzyHS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A fast algorithm for division by constant divisors is
presented. The method has proved very useful
implemented as microcode on a binary machine, and can
be adapted directly into hardware. The mathematical
foundations of the algorithm are presented as well as
some performance measures.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723",
corpsource = "State Univ. of New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bit addressable memory; computer programming; constant
divisors; digital arithmetic; fast division;
microprogram",
oldlabel = "ArtzyHS76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ArtzyHS76",
}
@Article{Knuth:1976:EAB,
author = "Donald E. Knuth",
title = "Errata: {``Ancient Babylonian algorithms''}",
journal = j-CACM,
volume = "19",
number = "2",
month = feb,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "108.01A15",
MRnumber = "52 13133",
bibdate = "Tue Dec 26 13:35:07 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Knuth:1972:ABA}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Newell:1976:CSE,
author = "Allen Newell and Herbert A. Simon",
title = "Computer Science as Empirical Inquiry: Symbols and
Search",
journal = j-CACM,
volume = "19",
number = "3",
pages = "113--126",
month = mar,
year = "1976",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/360018.360022",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68-01",
MRnumber = "57 4555",
bibdate = "Mon Jan 22 07:09:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#NewellS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C6130 (Data handling
techniques)",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; cognition; computer science;
empirical inquiry; heuristic programming; heuristic
search; list; list processing; physical symbol systems;
problem solving; processing; symbols; Turing",
oldlabel = "NewellS76",
remark = "This is the 1975 ACM Turing Award Lecture.",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NewellS76",
}
@Article{Babad:1976:JPM,
author = "Jair M. Babad and Mario M. Modiano",
title = "Joining Policies in a Multipriority Multiclass Batch
Computer System",
journal = j-CACM,
volume = "19",
number = "3",
pages = "127--136",
month = mar,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35 (68A99)",
MRnumber = "53 7429",
MRreviewer = "Erol Gelenbe",
bibdate = "Mon Jan 22 06:22:28 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#BabadM76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A multipriority batch computer system which users from
several different classes may join, with toll, service,
and waiting charges is formulated here as a semi-Markov
decision process, in which the aim of arriving users is
to minimize their expected loss. The optimal joining
policy of arriving users who may join the system at
some of its queues is a control limit policy, with a
single control number for any possible queue and the
user's class; a newly arriving user will join a queue
that is not filled up to the control number
corresponding to this queue and the user's class. In
this paper control numbers, as well as lower and upper
bounds for the control numbers and the capacities of
the system's queues are derived.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723; 922",
corpsource = "Univ. of Chicago, Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "batch processing (computers); control number; data
processing; Markov processes; multipriority batch
computer system; operating system; operations;
operations research; optimal joining policy; price;
priority queues; probability --- Queueing Theory;
research; scheduling; semi Markow process",
oldlabel = "BabadM76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BabadM76",
}
@Article{Allen:1976:PDF,
author = "Frances E. Allen and John Cocke",
title = "A Program Data Flow Analysis Procedure",
journal = j-CACM,
volume = "19",
number = "3",
pages = "137--147",
month = mar,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:08 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#AllenC76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The global data relationships in a program can be
exposed and codified by the static analysis methods
described in this paper. A procedure is given which
determines all the definitions which can possibly
``reach'' each mode of the control flow graph of the
program and all the definitions that are ``live'' on
each edge of the graph. The procedure uses an
``interval'' ordered edge listing data structure and
handles reducible and irreducible graphs
indistinguishably.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compilers; data flow analysis; data processing; edge
listing data; flow graphs; optimisation; program
optimisation; programming theory; static analysis;
structure",
oldlabel = "AllenC76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AllenC76",
}
@Article{Minsky:1976:IRP,
author = "Naftaly H. Minsky",
title = "Intentional Resolution of Privacy Protection in
Database Systems",
journal = j-CACM,
volume = "19",
number = "3",
pages = "148--159",
month = mar,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:39 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Minsky76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper is concerned with the control over what a
user is allowed to do with a piece of information
supplied to him by the database. The ability to
condition the supply of information on its intended use
is called here ``intentional resolution'' of privacy
protection. The practical importance of intentional
resolution is demonstrated by several examples, and its
realization is discussed. It appears to be necessary
for the database to impose a certain amount of control
over the internal behavior of users' programs which
interact with it. A model for user-database interaction
which admits such a control is developed.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C6120 (File
organisation); C7100 (Business and administration)",
classification = "723",
corpsource = "Rutgers Univ., New Brunswick, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "data base systems; data processing; database
management systems; intentional; interaction with
databases; privacy protection; protection in
programming languages; resolution; security; security
of data",
oldlabel = "Minsky76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Minsky76",
}
@Article{Diffie:1976:CPD,
author = "Whitfield Diffie and Martin E. Hellman",
title = "A critique of the proposed {Data Encryption
Standard}",
journal = j-CACM,
volume = "19",
number = "3",
pages = "164--165",
month = mar,
year = "1976",
DOI = "https://doi.org/10.1145/360018.360031",
bibdate = "Sat Jun 10 11:27:35 2023",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cryptography.bib",
URL = "https://dl.acm.org/doi/pdf/10.1145/360018.360031",
abstract = "[From the first paragraph:] ``Motivated by the growing
need for cryptographic protection of computerized data,
the National Bureau of Standards has proposed a data
encryption standard. The purpose of such a standard is
to foster compatibility among users and to ensure that
the algorithm used is of high quality. We believe that
the proposed standard fails to meet these criteria in
its current form and should be modified prior to its
adoption.''",
acknowledgement = ack-nhfb,
}
@Article{Smoot:1976:DIS,
author = "Oliver R. Smoot",
title = "Development of an international system for legal
protection of computer programs",
journal = j-CACM,
volume = "19",
number = "4",
pages = "171--174",
month = apr,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Smoot76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Computer and Business Equipment Mfg. Assoc.,
Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer programs; informal report; international
system; legal protection; legislation; market data;
security of data; software protection; technological
predictions",
oldlabel = "Smoot76",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smoot76",
}
@Article{Lientz:1976:CEV,
author = "Bennet P. Lientz",
title = "A Comparative Evaluation of Versions of {BASIC}",
journal = j-CACM,
volume = "19",
number = "4",
pages = "175--181",
month = apr,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Lientz76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "From its inception, the BASIC language has grown in
terms of its usage, scope of usage, and its features.
This article compares ten of the current versions of
BASIC with each other, with two earlier versions, and
with the proposed standard for minimal BASIC. The
comparison is arranged by the features of the versions
and by computational comparison of computation and
times and processing costs.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "BASIC; computer programming languages; interpretive
language summary",
oldlabel = "Lientz76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lientz76",
}
@Article{Raymond:1976:LLA,
author = "J. Raymond",
title = "{LG}: {A} Language for Analytic Geometry",
journal = j-CACM,
volume = "19",
number = "4",
pages = "182--187",
month = apr,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "50-04 50D15 68A05",
MRnumber = "57 7341",
MRreviewer = "Wolfgang Bohm",
bibdate = "Mon Jan 22 07:15:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.76.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Raymond76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A conversational programming language for analytic
geometry is described, together with some aspects of
its implementation. The language allows the flexible
definition of geometric objects and elements, computes
their parameters, and displays the results. It also
provides the capability of specifying a geometric
figure via a collection of parameters and displaying
various loci corresponding to these parameters. A third
characteristic consists of the possibility of using
this language to design other user oriented languages.
LG has been specifically designed for use by
nonprogrammers; it is easy to learn and very close to
the natural language used in geometry.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6140D (High
level languages)",
classification = "723",
corpsource = "Univ. of Ottawa, Ottawa, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analytic geometry; computer; computer graphics;
computer programming languages; conventional
programming language; geometry; graphics; interactive
programming; LG; problem oriented language; problem
oriented languages",
oldlabel = "Raymond76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Raymond76",
}
@Article{Fagin:1976:CCE,
author = "Ronald Fagin",
title = "Corrigendum: {``A Counterintuitive Example of Computer
Paging''}",
journal = j-CACM,
volume = "19",
number = "4",
pages = "187",
month = apr,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 7000b",
MRreviewer = "W. Kwasowiec",
bibdate = "Tue Dec 26 13:35:07 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Fagin:1976:CEC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Katz:1976:LAP,
author = "Shmuel Katz and Zohar Manna",
title = "Logical Analysis of Programs",
journal = j-CACM,
volume = "19",
number = "4",
pages = "188--206",
month = apr,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "56 17183",
bibdate = "Mon Jan 22 06:54:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#KatzM76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Most present systems for verification of computer
programs are incomplete in that intermediate inductive
assertions must be provided manually by the user,
termination is not proven, and incorrect programs are
not treated. As a unified solution to these problems,
this paper suggests conducting a logical analysis of
programs by using invariants which express what is
actually occurring in the program. Techniques for the
automatic generation of invariants are examined.
Criteria for using the invariants to check
simultaneously for correctness (including termination)
or incorrectness are provided. Implications of the
approach for the automatic diagnosis and correction of
logical errors are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems)",
classification = "723; 921",
corpsource = "Weizmann Inst. of Sci., Rehovoth, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic diagnosis; computer programming languages;
correctness; incorrectness; invariants; logical
analysis; mathematical techniques; program debugging;
program testing; program verification",
oldlabel = "KatzM76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KatzM76",
}
@Article{Denning:1976:LMS,
author = "Dorothy E. Denning",
title = "A Lattice Model of Secure Information Flow",
journal = j-CACM,
volume = "19",
number = "5",
pages = "236--243",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A25",
MRnumber = "55 1821",
MRreviewer = "George I. Davida",
bibdate = "Mon Jan 22 06:35:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Denning76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Fifth ACM Symposium on Operating
Systems Principles (Univ. Texas, Austin, Tex., 1975).",
abstract = "Mechanisms that guarantee secure information flow in a
computer system are discussed. These mechanisms are
examined within a mathematical framework suitable for
formulating the requirements of secure information flow
among security classes. The central component of the
model is a lattice structure derived from the security
classes and justified by the semantics of information
flow. The model provides a unifying view of all systems
that restrict information flow, enables a
classification of them according to security
objectives, and suggests some new approaches. It also
leads to the construction of automatic program
certification mechanisms for verifying the secure flow
of information through a program.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C6120 (File
organisation); C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; data processing; lattice;
mathematical models; program certification; secure
information flow; security; security classes; security
of data",
oldlabel = "Denning76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Denning76",
}
@Article{Millen:1976:SKV,
author = "Jonathan K. Millen",
title = "Security Kernel Validation in Practice",
journal = j-CACM,
volume = "19",
number = "5",
pages = "243--250",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:22 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Millen76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A security kernel is a software and hardware mechanism
that enforces access controls within a computer system.
The correctness of a security kernel on a PDP-11\slash
45 is being proved. This paper describes the technique
used to carry out the first step of the proof:
validating a formal specification of the program with
respect to axioms for a secure system. Application of
the kernel will be in providing normally responsive
multiprogrammed or time-shared service to computer
system users, while restricting access to data to those
users with permission for it.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "MITRE Corp., Bedford, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer systems, digital
--- Time Sharing; correctness; data processing; formal
specification; operating systems (computers);
protection; security kernel; security of data;
validation; verification",
oldlabel = "Millen76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Millen76",
}
@Article{Lampson:1976:ROS,
author = "Butler W. Lampson and Howard E. Sturgis",
title = "Reflections on an Operating System Design",
journal = j-CACM,
volume = "19",
number = "5",
pages = "251--265",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:23 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#LampsonS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The main features of a general purpose multiaccess
operating system developed for the CDC 6400 at Berkeley
are presented, and its good and bad points are
discussed as they appear in retrospect. Distinctive
features of the design were the use of capabilities for
protection, and the organization of the system into a
sequence of layers, each building on the facilities
provided by earlier ones and protecting itself from the
malfunctions of later ones. There were serious problems
in maintaining the protection between layers when
levels were added to the memory hierarchy. These
problems are discussed and a new solution is
described.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "capabilities; CDC 6400; computer operating systems;
faults; hierarchy; layering domains; memory; memory
hierarchy; operating system; operating systems
(computers); protection; security of data; sharing
programs; time-",
oldlabel = "LampsonS76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LampsonS76",
}
@Article{Habermann:1976:MHF,
author = "A. Nico Habermann and Lawrence Flon and Lee W.
Cooprider",
title = "Modularization and Hierarchy in a Family of Operating
Systems",
journal = j-CACM,
volume = "19",
number = "5",
pages = "266--272",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#HabermannFC76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes the design philosophy used in the
construction of a family of operating systems.
Fundamental to the design are the concepts of level and
module. Further, the system design is structured
hierarchically based upon functions. Family members can
share much of the software as a result of the
implementation of run-time modules at the lowest system
level. The system is expected to produce several family
members --- including batch and timesharing system ---
with widely differing storage management strategies.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "address space; computer operating systems; data;
incremental machine design; module; operating systems;
operating systems (computers); type; virtual memory;
virtual storage",
oldlabel = "HabermannFC76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HabermannFC76",
}
@Article{Howard:1976:PM,
author = "John H. Howard",
title = "Proving Monitors",
journal = j-CACM,
volume = "19",
number = "5",
pages = "273--279",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Howard76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Monitors are devices for defining shared abstract
objects in a multiprogramming system and for scheduling
access to them. It is shown that scheduling and
sequential properties of monitors can be proved by
using state variables which record the monitors'
history and by defining extended proof rules for their
wait and signal operations. These two techniques are
defined, discussed, and applied to examples to prove
properties such as freedom from indefinitely repeated
overtaking or unnecessary waiting, upper bounds on
queue lengths, and historical behavior.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. of Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "alarm; bounded buffer; clocks; computer metatheory;
computer operating systems; computer systems
programming --- Multiprogramming; concurrency;
correctness; disc head; historical; monitors;
multiprogramming; operating systems (computers); proof
rules; scheduling; semaphores; variables",
oldlabel = "Howard76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Howard76",
}
@Article{Owicki:1976:VPP,
author = "Susan S. Owicki and David Gries",
title = "Verifying Properties of Parallel Programs: An
Axiomatic Approach",
journal = j-CACM,
volume = "19",
number = "5",
pages = "279--285",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (68A40)",
MRnumber = "55 6925",
MRreviewer = "Derek C. Oppen",
bibdate = "Mon Jan 22 07:10:54 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#OwickiG76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the {Fifth {ACM} Symposium on Operating
Systems Principles (Univ. Texas, Austin, Tex.,
1975)}.",
abstract = "An axiomatic method for proving a number of properties
of parallel programs is presented. A deductive system
which is in some sense complete for partial correctness
is defined. A crucial axiom provides for the use of
auxiliary variables, which are added to a parallel
program as an aid to proving it correct. The
information in a partial correctness proof can be used
to prove such properties as mutual exclusion, freedom
from deadlock, and program termination. Techniques for
verifying these properties are presented and
illustrated by application to the dining philosophers
problem. The language and axioms offered give guides
for the construction of correct and comprehensible
programs.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems); C6150J (Operating systems)",
classification = "723",
corpsource = "Computer Sci. Dept., Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "axiomatic method; computer metatheory; computer
operating systems; computer systems programming;
concurrent processes; correctness proofs; deadlock;
multiprogramming; mutual exclusion; parallel
processing; parallel programs; program testing; program
verification; structured; synchronisation",
oldlabel = "OwickiG76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OwickiG76",
}
@Article{Madison:1976:CPL,
author = "A. Wayne Madison and Alan P. Batson",
title = "Characteristics of Program Localities",
journal = j-CACM,
volume = "19",
number = "5",
pages = "285--294",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#MadisonB76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The term ``locality'' is used to denote that subset of
a program's segments which are referenced during a
particular phase of its execution. In this paper the
concept of a locality is made more explicit through a
formal definition of what constitutes a phase of
localized reference behavior, and by a corresponding
mechanism for the detection of localities in actual
reference strings. This definition provides for the
existence of a hierarchy of localities at any given
time. empirical data from a sample of production Algol
60 programs is used to display distributions of
locality sizes and lifetimes. These results are
discussed in terms of their implications for the
modeling of program behavior and memory management in
virtual memory systems.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Dept. of Appl. Math. and Computer Sci., Univ. of
Virginia, Charlottesville, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bounded locality intervals; computer operating
systems; computer programming languages; locality;
memory; memory management; program behaviour; storage
management; virtual; virtual storage",
oldlabel = "MadisonB76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MadisonB76",
}
@Article{Prieve:1976:VOV,
author = "Barton G. Prieve and Robert S. Fabry",
title = "{VMIN} --- an Optimal Variable-Space Page Replacement
Algorithm",
journal = j-CACM,
volume = "19",
number = "5",
pages = "295--297",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:13:59 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#PrieveF76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A criterion for comparing variable space page
replacement algorithms is presented. An optimum page
replacement algorithm, called VMIN, is described and
shown to be optimum with respect to this criterion. The
results of simulating VMIN, Denning's working set, and
the page partitioning replacement algorithms on five
virtual memory programs are presented to demonstrate
the improvement possible over the known realizable
variable space algorithms.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Bell Labs., Naperville, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer systems
programming --- Supervisory and Executive Programs;
demand paging; multilevel memory; optimal page
replacement; page replacement algorithms; performance
measurement; systems; virtual memory programs; virtual
storage; VMIN; working set",
oldlabel = "PrieveF76",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PrieveF76",
}
@Article{Chu:1976:APR,
author = "Wesley W. Chu and Holger Opderbeck",
title = "Analysis of the {PFF} Replacement Algorithm via a
{Semi-Markov} Model",
journal = j-CACM,
volume = "19",
number = "5",
pages = "298--304",
month = may,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "54 9194",
MRreviewer = "U. M. Von Maydell",
bibdate = "Mon Jan 22 06:31:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#ChuO76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Papers from the Fifth ACM Symposium on Operating
Systems Principles (Univ. Texas, Austin, Tex., 1975).
See corrigendum \cite{Chu:1976:CAP}.",
abstract = "An analytical model is presented to estimate the
performance of the Page Fault Frequency (PFF)
replacement algorithm. In this model, program behavior
is represented by the LRU stack distance model and the
PFF replacement algorithm is represented by a
semi-Markov model. Using these models, such parameters
as the inter-page-fault interval distribution, the
probability of the number of distinct pages being
referenced during an inter-page-fault interval, etc.,
may be analytically determined. Using these models to
evaluate these parameter values permits study of the
performance of the replacement algorithm by simulating
the page fault events rather than every page reference
event. This significantly reduces the required
computation time in estimating the performance of the
PFF algorithm.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "behaviour; computer operating systems; computer
systems programming --- Supervisory and Executive
Programs; mathematical models; of replacement
algorithm; page fault events; Page Fault Frequency; PFF
replacement algorithm; program; semi Markov model;
simulation; virtual storage",
oldlabel = "ChuO76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChuO76",
}
@Article{Taulbee:1976:PEP,
author = "Orrin E. Taulbee and Samuel D. Conte",
title = "Production and employment of {Ph.D.}'s in computer
science",
journal = j-CACM,
volume = "19",
number = "6",
pages = "311--313",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:42 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#TaulbeeC76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics)",
corpsource = "Univ. of Pittsburgh, Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; employment; faculty; production;
salaries",
oldlabel = "TaulbeeC76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TaulbeeC76",
}
@Article{Severance:1976:PGA,
author = "Dennis G. Severance and Ricardo A. Duhne",
title = "A {Practitioner}'s Guide To Addressing Algorithms",
journal = j-CACM,
volume = "19",
number = "6",
pages = "314--326",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:37 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#SeveranceD76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper consolidates a number of popular rules of
thumb which have been suggested for the design of
record addressing algorithms, and discusses the
applicability of these rules to large commercial
databases. Guidelines for selecting identifier
transformations, overflow techniques, loading factors,
bucket sizes, and loading order are considered.
Particular attention is focused on the reasonableness
of common heuristics for determining primary or
secondary bucket sizes. A mathematical model which
explicitly considers storage device characteristics and
time\slash space cost tradeoffs is used to analyze the
effect of design parameters on overall system costs. A
specific design example is presented and solved.",
acknowledgement = ack-nhfb,
annote = "This paper consolidates a number of popular rules of
thumb which have been suggested for the design of
record addressing algorithms, and discusses the
applicability of these rules to large commercial
databases.",
classcodes = "C6120 (File organisation); C7100 (Business and
administration)",
classification = "823; 901",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bucket; computer systems programming --- Utility
Programs; data management; data processing; database
management systems; file organisation; file retrieval;
functions; hashing; information; information retrieval
systems --- Evaluation; loading factors; record
addressing; retrieval; rules of thumb; searching;
sizes; synonym resolution",
oldlabel = "SeveranceD76",
treatment = "A Application; E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SeveranceD76",
xxauthor = "Dennis G. Severance and Richardo Duhne",
}
@Article{Baskett:1976:IMC,
author = "Forest Baskett and Alan Jay Smith",
title = "Interference in Multiprocessor Computer Systems with
Interleaved Memory",
journal = j-CACM,
volume = "19",
number = "6",
pages = "327--334",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:45 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#BaskettS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The memory interference caused by several processors
simultaneously using several memory modules is
analyzed. Exact results are computed for a simple model
of such a system. The limiting value is derived for the
relative degree of memory interference as the system
size increases. The assumptions and results of the
simple model are tested against some measurements of
program behavior and simulations of systems using
memory references from real programs. The model results
provide a good indication of the performance that
should be expected from real systems of this type.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C5400 (Analogue and
digital computers and systems)",
classification = "722",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems; computer systems, digital;
interference; interleaved memory; memory;
multiprocessing; multiprocessing systems;
multiprocessor; trace driven simulation",
oldlabel = "BaskettS76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BaskettS76",
}
@Article{Frieder:1976:PDA,
author = "Gideon Frieder and Harry J. Saal",
title = "Process for the Determination of Addresses in Variable
Length Addressing",
journal = j-CACM,
volume = "19",
number = "6",
pages = "335--338",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:16 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#FriederS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is presented for the assignment of
instruction addresses and formats under the following
conditions: the length of the instruction varies as a
function of the distance of the instruction from its
target; there exists an optimality criterion which
implies some preferential choices subject to the
addressing constraints. This may be, for example,
achieving the smallest number of long instructions, in
which case the total code length is minimized, or
minimizing the assigned address of a specified point in
the program. The algorithm is suitable for arbitrary
program structure and a choice of optimization
criteria.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation)",
classification = "723",
corpsource = "IBM Israel Sci. Center, Haifa, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "assembler; computer operating systems; formats;
instruction addresses; paging; programming; variable
length addressing; virtual storage",
oldlabel = "FriederS76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FriederS76",
}
@Article{Wise:1976:RLE,
author = "David S. Wise",
title = "Referencing Lists by an Edge",
journal = j-CACM,
volume = "19",
number = "6",
pages = "338--342",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:31 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Wise76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An edge reference into a list structure is a pair of
pointers to adjacent nodes. Such a reference often
requires little additional space, but its use can yield
efficient algorithms. For instance, a circular link
between the ends of a list is redundant if the list is
always referenced by that edge, and list traversal is
easier when that link is null. Edge references also
allow threading of nonrecursive lists, can replace some
header cells, and enhance the famous exclusive-or trick
to double-link lists.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation); C6130 (Data handling techniques)",
classification = "723",
corpsource = "Indiana Univ., Bloomington, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "circular link; computer programming --- Subroutines;
computer programming languages; cursor; data
structures; doubly linked; edge reference; header
cells; list; list processing; list structure;
overlapping sublist; pointer; traversal",
oldlabel = "Wise76",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wise76",
}
@Article{Schumacher:1976:SAD,
author = "Helmut Schumacher and Kenneth C. Sevcik",
title = "The Synthetic Approach to Decision Table Conversion",
journal = j-CACM,
volume = "19",
number = "6",
pages = "343--351",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:04 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#SchumacherS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Previous approaches to the problem of automatically
converting decision tables to computer programs have
been based on decomposition. An optimal program is
located only through implicit enumeration of all
possible decision trees using a technique such as
branch-and-bound. The new approach described in this
paper uses dynamic programming to synthesize an optimal
decision tree from which a program can be created.
Using this approach, the efficiency of creating an
optimal program is increased substantially, permitting
generation of optimal programs for decision tables with
as many as ten to twelve conditions.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723; 921",
corpsource = "Univ. of Toronto, Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; decision table
conversion; decision tables; decision trees; dynamic
programming; mathematical techniques --- Combinatorial
Mathematics; optimal program; programming theory",
oldlabel = "SchumacherS76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SchumacherS76",
}
@Article{Clark:1976:ELM,
author = "Douglas W. Clark",
title = "An Efficient List Moving Algorithm Using constant
Workspace",
journal = j-CACM,
volume = "19",
number = "6",
pages = "352--354",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Clark76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient algorithm is presented for moving
arbitrary list structures, using no storage (apart from
program variables) other than that required to hold the
original list and the copy. The original list is
destroyed as it is moved. No mark bits are necessary,
but pointers to the copy must be distinguishable from
pointers to the original. The algorithm is superior in
execution speed to previous algorithms for the same
problem. Some variations and extensions of the
algorithm are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "complexity; computer programming --- Subroutines;
computer programming languages; constant workspace;
data processing --- Data Structures; LISP; list
copying; list moving; list processing; space; storage
management",
oldlabel = "Clark76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Clark76",
}
@Article{Steele:1976:CMC,
author = "Guy L. {Steele, Jr.}",
title = "Corrigendum: {``Multiprocessing Compactifying Garbage
Collection''}",
journal = j-CACM,
volume = "19",
number = "6",
pages = "354--354",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:29:03 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1976.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Steele:1975:MCG}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Knott:1976:NSP,
author = "Gary D. Knott",
title = "A Numbering System for Permutations of Combinations",
journal = j-CACM,
volume = "19",
number = "6",
pages = "355--356",
month = jun,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:20 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1976.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Knott76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C7310 (Mathematics
computing)",
corpsource = "Nat. Inst. of Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Algol procedures; coding systems; combinatorial
mathematics; combinatorics; inverse; permuted
combination numbering system; storage mapping
functions",
oldlabel = "Knott76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knott76",
}
@Article{Conte:1976:TCC,
author = "Samuel D. Conte and Maurice H. Halstead",
title = "Technology of Computer Center Management: a Proposed
Course for Graduate Professional Programs in Computer
Science or in Information Systems",
journal = j-CACM,
volume = "19",
number = "7",
pages = "369--370",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#ConteH76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper is a report on a course entitled, ``The
Technology of Computer Center Management,'' which has
been offered at Purdue for the past four years. The
course is suitable either for graduate professional
programs in information systems or for graduate
professional programs in computer science. Although
there are currently no suitable textbooks for this
course, a selected bibliography is included which
covers various course topics.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901; 912",
corpsource = "Purdue Univ., West Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administration; computer centre management; computer
science; computer system; data processing; education;
educational courses; graduate professional programs;
information science; information systems; management;
management science; performance",
oldlabel = "ConteH76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ConteH76",
}
@Article{Keller:1976:FVP,
author = "Robert M. Keller",
title = "Formal Verification of Parallel Programs",
journal = j-CACM,
volume = "19",
number = "7",
pages = "371--384",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "54 14430",
MRreviewer = "W. D. Maurer",
bibdate = "Mon Jan 22 06:54:16 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Keller76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two formal models for parallel computation are
presented: an abstract conceptual model and a
parallel-program model. The former model does not
distinguish between control and data states. The latter
model is includes the capability for the representation
of an infinite set of control states by allowing there
to be arbitrarily many instruction pointers (or
processes) executing the program. An induction
principle is presented which treats the control and
data state sets on the same ground. Through the use of
``place variables'', it is observed that certain
correctness conditions can be expressed without
enumeration of the set of all possible control states.
Examples are presented in which the induction principle
is used to demonstrate proofs of mutual exclusion. Also
discussed is an extension of the program model which
allows each process to have its own local variables and
permits shared global variables. Correctness of certain
forms of implementation is also discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C5400 (Analogue and
digital computers and systems); C6150G (Diagnostic,
testing, debugging and evaluating systems); C6150J
(Operating systems)",
classification = "722; 723",
corpsource = "Princeton Univ., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "assertions; computer metatheory --- Programming
Theory; computer systems, digital; correctness; data
state sets; deadlock; exclusion; mutual; operating
systems (computers); parallel processing; parallel
programs; Petri net; program; testing; transition
system; verification",
oldlabel = "Keller76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Keller76",
}
@Article{King:1976:SEP,
author = "James C. King",
title = "Symbolic Execution and Program Testing",
journal = j-CACM,
volume = "19",
number = "7",
pages = "385--394",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "54 6541",
MRreviewer = "P. W. Baker",
bibdate = "Mon Jan 22 06:54:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#King76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes the symbolic execution of
programs. Instead of supplying the normal inputs to a
program (e.g. numbers) one supplies symbols
representing arbitrary values. The execution proceeds
as in a normal execution except that values may be
symbolic formulas over the input symbols. The
difficult, yet interesting issues arise during the
symbolic execution of conditional branch type
statements. A particular system called EFFIGY which
provides symbolic execution for program testing and
debugging is also described. It interpretively executes
programs written in a simple PL/I style programming
language. It includes many standard debugging features,
the ability to manage and to prove things about
symbolic expressions, a simple program testing manager,
and a program verifier. A brief discussion of the
relationship between symbolic execution and program
proving is also included.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory --- Formal Logic; computer
programming languages; debugging; EFFIGY; effigy;
interpretation; PL/I; program debugging; program
proving; program testing; program verification;
symbolic; symbolic execution",
oldlabel = "King76",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/King76",
}
@Article{Metcalfe:1976:EDP,
author = "Robert M. Metcalfe and David R. Boggs",
title = "{Ethernet}: Distributed Packet Switching for Local
Computer Networks",
journal = j-CACM,
volume = "19",
number = "7",
pages = "395--404",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:09 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/Ai.misc.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/misc.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#MetcalfeB76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Ethernet is a branching broadcast communication system
for carrying digital data packets among locally
distributed computing stations. The packet transport
mechanism provided by Ethernet has been used to build
systems which can be viewed as either local computer
networks or loosely coupled multiprocessors. \par
An Ethernet's shared communication facility, its Ether,
is a passive broadcast medium with no central control.
Coordination of access to the Ether for packet
broadcasts is distributed among the contending
transmitting stations using controlled statistical
arbitration. \par
Switching of packets to their destinations on the Ether
is distributed among the receiving stations using
packet address recognition. Design principles and
implementation are described, based on experience with
an operating Ethernet of 100 nodes along a kilometer of
coaxial cable. A model for estimating performance under
heavy loads and a packet protocol for error controlled
communication are included for completeness.",
acknowledgement = ack-nhfb,
classcodes = "B6210L (Computer communications); C5620 (Computer
networks and techniques)",
classification = "718; 722; 723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "broadcast; broadcast communication; communication;
computer networks; computer systems, digital --- Real
Time Operation; computers --- Data Communication
Systems; data transmission; digital communication
systems; distributed communication; distributed
computing; distributed control; Ethernet; LANs;
multiprocessing; multiprocessors; networks; operating;
packet switching; statistical arbitration; switching
systems",
oldlabel = "MetcalfeB76",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MetcalfeB76",
}
@Article{Cheng:1976:SDR,
author = "Cheng-Wen Cheng and Jonas Rabin",
title = "Synthesis of Decision Rules",
journal = j-CACM,
volume = "19",
number = "7",
pages = "404--406",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:49 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#ChengR76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Decision tables can be used as an effective tool
during an interview to record the logic of processes to
be automated. The result of such an interview is not a
structure of complete decision tables but rather sets
of decision rules. The purpose of this paper is to
provide a procedure for synthesizing the decision rules
and thus provide an aid in developing a structure of
complete decision tables.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C7100
(Business and administration)",
classification = "723; 922",
corpsource = "Western Electric Res. Center, Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; data processing ---
Security of Data; decision rules; decision tables;
decision theory and analysis; interview; logical
design; logical tables; management; specification
language; system design",
oldlabel = "ChengR76",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChengR76",
}
@Article{Fishman:1976:SGD,
author = "George S. Fishman",
title = "Sampling from the {Gamma-distribution} on a computer",
journal = j-CACM,
volume = "19",
number = "7",
pages = "407--409",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "54 6449",
MRreviewer = "Artenio De Matteis",
bibdate = "Mon Jan 22 06:39:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1976.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Fishman76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a new technique for sampling from
the gamma distribution on a digital computer and
compares it with an alternative technique. The method
suggested uses the rejection technique.",
acknowledgement = ack-nhfb,
classcodes = "B0240 (Probability and statistics); C1140 (Probability
and statistics); C7100 (Business and administration);
C7310 (Mathematics computing)",
classification = "912; 922",
corpsource = "Univ. of North Carolina, Chapel Hill, NC, USA",
country = "USA",
descriptors = "RNG; simulation",
enum = "951",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "gamma distribution; gamma variates; operations
research; probability; probability --- Random
Processes; rejection technique; sampling; shape
parameter; Wallace's method",
language = "English",
oldlabel = "Fishman76",
references = "0",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fishman76",
}
@Article{Maly:1976:CT,
author = "Kurt Maly",
title = "Compressed Tries",
journal = j-CACM,
volume = "19",
number = "7",
pages = "409--415",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "54 9195",
MRreviewer = "Fabrizio Luccio",
bibdate = "Mon Jan 22 07:01:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Maly76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a new data structure, called a
compressed trie or C-trie, to be used in information
retrieval systems. It has the same underlying m-ary
tree structure as a trie, where m is a parameter of the
trie, but whereas the fields of the nodes in a trie
have to be large enough to hold a key or at least a
pointer, the fields in a C-trie are only one bit long.
First, the C-trie is analyzed as a data structure, and
then several methods of its use for relatively static
data bases are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval)",
classification = "723; 901",
corpsource = "Univ. of Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "data processing --- Data Structures; data storage,
digital; data structure; data structures; database
management systems; databases; information; information
retrieval systems; key; m ary; retrieval systems;
retrieval time; storage requirement; tree; trie",
oldlabel = "Maly76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Maly76",
}
@Article{Burton:1976:BSV,
author = "Warren Burton",
title = "A Buddy System Variation for Disk Storage Allocation",
journal = j-CACM,
volume = "19",
number = "7",
pages = "416--417",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:00 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Burton76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A generalization of the buddy system for storage
allocation is described. It is shown how limitations on
block sizes make it possible to force logical storage
blocks to coincide with physical storage blocks, such
as tracks and cylinders. This new variation of the
buddy system has been developed for allocating storage
for geometrical data items (polygons, sets of points,
etc. ).",
acknowledgement = ack-nhfb,
classcodes = "C5320C (Storage on moving magnetic media); C6120 (File
organisation)",
classification = "722; 723",
corpsource = "Univ. of East Anglia, Norwich, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "buddy system; computer operating systems; computer
systems programming --- Supervisory and Executive
Programs; data storage, magnetic --- Disk; disc
storage; integral valued function; magnetic disc and
drum storage; storage allocation",
oldlabel = "Burton76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Burton76",
}
@Article{Gonnet:1976:HAE,
author = "Gaston H. Gonnet",
title = "Heaps Applied to Event Driven Mechanisms",
journal = j-CACM,
volume = "19",
number = "7",
pages = "417--418",
month = jul,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:45:19 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1976.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Gonnet76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6120 (File
organisation)",
corpsource = "Univ. of Waterloo, Waterloo, Ont., Canada",
country = "USA",
descriptors = "Simulation; event set",
enum = "7331",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm theory; data structures; discrete event
simulation; event; heaps; priority queue; scanning
mechanisms",
language = "English",
oldlabel = "Gonnet76",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gonnet76",
}
@Article{Donovan:1976:TPS,
author = "John J. Donovan",
title = "Tools and Philosophy for Software Education",
journal = j-CACM,
volume = "19",
number = "8",
pages = "430--436",
month = aug,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:35 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Donovan76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a set of tools and a philosophy
for teaching software that have been found very useful
in course at MIT over the past seven years. \par
The tools include programs such as simulators, graders,
compilers, and monitor. These allow the instructor to
augment the basic concepts with relevant, exciting, and
economical student project activities.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming)",
classification = "723; 901",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; computer software; education;
grading; grading programs; philosophy; programs;
simulators; software education; student assignments;
tools",
oldlabel = "Donovan76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Donovan76",
}
@Article{Tennent:1976:DSP,
author = "Robert D. Tennent",
title = "The Denotational Semantics of Programming Languages",
journal = j-CACM,
volume = "19",
number = "8",
pages = "437--453",
month = aug,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "55 1791",
MRreviewer = "Gianni Aguzzi",
bibdate = "Mon Jan 22 07:25:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Tennent76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper is a tutorial introduction to the theory of
programming language semantics developed by D. Scott
and C. Strachey. The application of the theory to
formal language specification is demonstrated and other
applications are surveyed. The first language
considered, LOOP, is very elementary and its definition
merely introduces the notation and methodology of the
approach. Then the semantic concepts of environments,
stores, and continuations are introduced to model
classes of programming language features and the
underlying mathematical theory of computation due to
Scott is motivated and outlined. Finally, the paper
presents a formal definition of the language
GEDANKEN.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "721; 723",
corpsource = "Queen's Univ., Kingston, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "applicative; automata theory --- Context Free
Languages; computer metatheory; computer programming
languages --- Analysis; continuation; environment;
formal language; formal languages; function;
functional; GEDANKEN; gedanken; higher order;
higher-order function; imperative; loop; LOOP;
mathematical theory of computation; pl-semantics
binder; programming language; programming languages;
recursive definition; semantics; store; theory of
computation",
oldlabel = "Tennent76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tennent76",
}
@Article{Clark:1976:DSD,
author = "James H. Clark",
title = "Designing Surfaces in {3-D}",
journal = j-CACM,
volume = "19",
number = "8",
pages = "454--460",
month = aug,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A99 (50D15 65D10)",
MRnumber = "54 4216",
MRreviewer = "Wolfgang Bohm",
bibdate = "Mon Jan 22 06:31:22 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/virtual.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Clark76a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An experimental system for computer-aided design of
free-form surfaces in three dimensions is described.
The surfaces are represented in the system as
parametric basis splines. The principal features of the
system are: the surfaces are rendered as isoparametric
line drawings on a head-mounted display, and they are
designed with the aid of a three-dimensional ``wand,''
which allows 3-D movements of the points controlling
the shapes of the surfaces; all of the interactions
with the surfaces are in real-time; and the
mathematical formulations used assume no knowledge of
them by the user of the system. Also examined are some
of the features that should be part of a practical 3-D
system for designing space-forms.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays)",
classification = "722; 723; 901",
corpsource = "Univ. of Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "3D displays; B splines; CAD; computer graphics;
computer peripheral equipment --- Light Pens; computer
systems, digital --- Real Time Operation;
computer-aided design; engineering --- Computer Aided
Design; free form surfaces; image processing;
isoparametric line drawings; picture processing; real;
surface design; surfaces; three dimensional surfaces;
time graphics",
oldlabel = "Clark76a",
treatment = "A Application; P Practical; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Clark76a",
}
@Article{Harrison:1976:POS,
author = "Michael A. Harrison and Walter L. Ruzzo and Jeffrey D.
Ullman",
title = "Protection in Operating Systems",
journal = j-CACM,
volume = "19",
number = "8",
pages = "461--471",
month = aug,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A99",
MRnumber = "54 14474",
MRreviewer = "George I. Davida",
bibdate = "Mon Jan 22 06:48:45 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/security.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#HarrisonRU76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A model of protection mechanisms in computing systems
is presented and its appropriateness is argued. The
``safety'' problem for protection systems under this
model is to determine in a given situation whether a
subject can acquire a particular right to an object. In
restricted cases, it can be shown that this problem is
decidable; i.e., there is an algorithm to determine
whether a system in a particular configuration is safe.
In general, and under surprisingly weak assumptions, it
cannot be decided if a situation is safe. Various
implications of this fact are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4220 (Automata theory); C6150J
(Operating systems)",
classification = "721; 723",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(computers); automata theory --- Turing Machines;
computability and decidability; computer operating
systems --- Design; computer security; data processing;
decidability; operating systems; protection; protection
systems; security model; security of data; Turing
machine; Turing machines",
oldlabel = "HarrisonRU76",
ort = "ordner sicherheit",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HarrisonRU76",
}
@Article{Hirschberg:1976:ITO,
author = "Daniel S. Hirschberg",
title = "An Insertion Technique for One-Sided Height-Balanced
Trees",
journal = j-CACM,
volume = "19",
number = "8",
pages = "471--473",
month = aug,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:11 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Hirschberg76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A restriction on height-balanced binary trees is
presented. It is seen that this restriction reduces the
extra memory requirements by half (from two extra bits
per node to one) and maintains fast search capabilities
at a cost of increased time requirements for inserting
new nodes.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "723",
corpsource = "Princeton Univ., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "balanced; balanced trees; binary; binary trees;
computer programming; data processing; insertion
technique; one sided height; search; trees; trees
(mathematics)",
oldlabel = "Hirschberg76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hirschberg76",
}
@Article{Wadler:1976:AAR,
author = "Philip L. Wadler",
title = "Analysis of an Algorithm for Real Time Garbage
Collection",
journal = j-CACM,
volume = "19",
number = "9",
pages = "491--500",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "54 14473",
MRreviewer = "George I. Davida",
bibdate = "Mon Jan 22 07:27:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Wadler76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See erratum \cite{Gries:1977:BPB}.",
abstract = "List processing systems often use a method called
garbage collection for reclaiming unused memory space.
A real time garbage collection system avoids suspending
the operations of a list processor for the long times
that garbage collection normally requires by performing
garbage collection on a second processor in parallel
with list processing operations, or on a single
processor time-shared with them. Algorithms for
recovering discarded list structures in this manner are
presented and analyzed to determine sufficient
conditions under which the list processor never need to
wait on the collector. These techniques are shown to
require at most twice as much processing power as
regular garbage collectors, if they are used
efficiently. The average behavior of the program is
shown to be very nearly equal to the worst-case
performance, so that the sufficient conditions are also
suitable for measuring the typical behavior of the
algorithm.",
acknowledgement = ack-nhfb,
classcodes = "C5400 (Analogue and digital computers and systems);
C6120 (File organisation)",
classification = "723",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; computer
programming languages --- lisp; computer systems
programming; data processing --- Data Structures; data
structure; data structures; garbage collection; Lisp;
list; list processor; multiprocessing; parallel
processing; processing; real time; storage management;
storage reclamation; time change",
oldlabel = "Wadler76",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wadler76",
}
@Article{Yap:1976:NUB,
author = "Chee K. Yap",
title = "New Upper Bounds for Selection",
journal = j-CACM,
volume = "19",
number = "9",
pages = "501--508",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "54 6559",
MRreviewer = "Thomas G. Szymanski",
bibdate = "Mon Jan 22 07:31:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Yap76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The worst-case, minimum number of comparisons
complexity V//i (n) of the i-th selection problem is
considered. A new upper bound for V//i (n) improves the
bound given by the standard Hadian-Sobel algorithm by a
generalization of the Kirkpatrick-Hadian-Sobel
algorithm, and extends Kirkpatrick's method to a much
wider range of application. This generalization
compares favorably with a recent algorithm by L.
Hyafil.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Dept. of Computer Sci., Yale Univ., New Haven, CT,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "comparison problems; computational complexity;
computer metatheory; concrete computational complexity;
selection problem; upper bounds; worst case analysis",
oldlabel = "Yap76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Yap76",
}
@Article{Loui:1976:WDT,
author = "Michael C. Loui",
title = "Weighted Derivation Trees",
journal = j-CACM,
volume = "19",
number = "9",
pages = "509--513",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "54 1727",
MRreviewer = "Stephen Soule",
bibdate = "Mon Jan 22 06:59:44 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Loui76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The nodes of a weighted derivation tree are associated
with weighting functions over the vocabulary of a
context-free grammar. An algorithm is presented for
constructing the optimal derivation tree having the
same structure as a given weighted derivation tree. In
addition, the correctness of the algorithm is
established. The method may be applied to problems
involving probabilistic parsing or combinatorial
optimization.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "721; 723; 921",
corpsource = "Dept. of Computer Sci., Yale Univ., New Haven, CT,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ambiguity; automata theory; combinatorial
optimisation; computer programming --- Subroutines;
context free grammars; context-free grammars;
derivation trees; mathematical programming; parse tree;
parsing; probabilistic; structural; trees
(mathematics); weighting functions",
oldlabel = "Loui76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Loui76",
}
@Article{Walter:1976:RAC,
author = "Kenneth G. Walter",
title = "Recursion Analysis for Compiler Optimization",
journal = j-CACM,
volume = "19",
number = "9",
pages = "514--516",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Walter76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A relatively simple method for the detection of
recursive use of procedures is presented for use in
compiler optimization. Implementation considerations
are discussed, and a modification of the algorithm is
given to further improve optimization. This analysis
can also be used to determine what possible subset of
values could be assumed by variables which can only
take on a relatively small discrete set of values. The
most common are parameters of variables assuming values
of label, procedure, or Pascal's enumerated type.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "Computing and Information Sci. Dept., Case Western
Reserve Univ., Cleveland, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compiler optimisation; computer operating systems;
nonrecursion; optimisation; program compilers;
recursion analysis; relative",
oldlabel = "Walter76",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Walter76",
}
@Article{Bitner:1976:EGB,
author = "James R. Bitner and Gideon Ehrlich and Edward M.
Reingold",
title = "Efficient Generation of the Binary Reflected {Gray}
Code and Its Applications",
journal = j-CACM,
volume = "19",
number = "9",
pages = "517--521",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94A10 (68A10)",
MRnumber = "54 12349",
MRreviewer = "B. D. Sharma",
bibdate = "Mon Jan 22 06:26:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#BitnerER76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Algorithms are presented to generate the n-bit binary
reflected Gray code and codewords of fixed weight in
that code. Both algorithms are efficient in that the
time required to generate the next element from the
current one is constant. Applications to the generation
of the combinations of n things taken k at a time, the
compositions of integers, and the permutations of a
multiset are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723; 921",
corpsource = "Dept. of Computer Sci., Univ. of Illinois,
Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; codes, symbolic; combinations;
combinatorial computing; compositions; computer
programming --- Subroutines; fixed weight; Gray code;
mathematical techniques; subsets",
oldlabel = "BitnerER76",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BitnerER76",
}
@Article{Deutsch:1976:EIA,
author = "L. Peter Deutsch and Daniel G. Bobrow",
title = "An Efficient, Incremental, Automatic Garbage
Collector",
journal = j-CACM,
volume = "19",
number = "9",
pages = "522--526",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:46 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#DeutschB76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a new way of solving the storage
reclamation problem for a system such as Lisp that
allocates storage automatically from a heap, and does
not require the programmer to give any indication that
particular items are no longer useful or accessible. A
reference count scheme for reclaiming
non-self-referential structures, and a linearizing,
compacting, copying scheme to reorganize all storage at
the users discretion are proposed. The algorithms are
designed to work well in systems which use multiple
levels of storage, and large virtual address space.
They depend on the fact that most cells are referenced
exactly once, and that reference counts need only be
accurate when storage is about to be reclaimed. A
transaction file stores changes to reference counts,
and a multiple reference table stores the count for
items which are referenced more than once.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
comment = "Transaction-based reference counting; interesting
blend of marking and ref-counting collection",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "address space; computer operating systems --- Storage
Allocation; computer programming; computer programming
languages --- lisp; garbage collector; Lisp; multiple
reference; olit memory lisp; storage management;
storage reclamation; table stores; transaction file
stores; virtual",
oldlabel = "DeutschB76",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DeutschB76",
}
@Article{Wegbreit:1976:FRC,
author = "Ben Wegbreit",
title = "Faster Retrieval from Context Trees",
journal = j-CACM,
volume = "19",
number = "9",
pages = "526--529",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Wegbreit76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Context trees provide a convenient way of storing data
which is to be viewed as a hierarchy of contexts. This
note presents an algorithm which improves on previous
context tree retrieval algorithms. It is based on the
observation that in typical uses context changes are
infrequent relative to retrievals, so that data can be
cached to speed up retrieval. A retrieval is started
from the position of the previous retrieval and
auxiliary structures are built up to make the search
rapid. Algorithms for addition and deletion of data and
for garbage collection are outlined.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6120 (File
organisation)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; context tree; context trees;
data processing --- Data Structures; data structure;
data structures; frame problem; garbage collection;
retrieval algorithms; storage management; trees
(mathematics); variable bindings",
oldlabel = "Wegbreit76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wegbreit76",
}
@Article{Chu:1976:CAP,
author = "Wesley W. Chu and Holger Opderbeck",
title = "Corrigendum: {``Analysis of the PFF replacement
algorithm via a semi-Markov model''}",
journal = j-CACM,
volume = "19",
number = "9",
month = sep,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "529.68A50",
MRnumber = "55 6998",
bibdate = "Tue Dec 26 13:35:07 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Chu:1976:APR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Pooch:1976:PSI,
author = "Udo W. Pooch",
title = "Papers from {SIGGRAPH} 76 --- Introduction",
journal = j-CACM,
volume = "19",
number = "10",
pages = "541--??",
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:57 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Pooch76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Pooch76",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Pooch76",
}
@Article{Blinn:1976:TRC,
author = "James F. Blinn and Martin E. Newell",
title = "Texture and Reflection in Computer Generated Images",
journal = j-CACM,
volume = "19",
number = "10",
pages = "542--547",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.76.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#BlinnN76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In 1974 E. A. Catmull developed a new algorithm for
rendering images of bivariate surface patches. This
paper describes extensions of this algorithm in the
areas of texture simulation and lighting models. The
parametrization of a patch defines a coordinate system
which is used as a key for mapping patterns onto the
surface. The intensity of the pattern at each picture
element is computed as a weighted average of regions of
the pattern definition function. The shape and size of
this weighting function are chosen using digital signal
processing theory. The patch rendering algorithm allows
accurate computation of the surface normal to the patch
at each picture element, permitting the simulation of
mirror reflections. Several examples of images
synthesized using these new techniques are included.",
acknowledgement = ack-nhfb,
annote = "early paper on texture mapping, discusses spherical
sky textures",
classcodes = "C5540 (Terminals and graphic displays); C6130B
(Graphics techniques)",
classification = "723",
corpsource = "Univ. of Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACM; computer graphics; computerised picture
processing; graphic display; hidden surface removal;
image processing; reflection of light; shading; texture
environment; texture mapping; texture simulation",
oldlabel = "BlinnN76",
treatment = "A Application; P Practical; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BlinnN76",
}
@Article{Clark:1976:HGM,
author = "James H. Clark",
title = "Hierarchical Geometric Models for Visible Surface
Algorithms",
journal = j-CACM,
volume = "19",
number = "10",
pages = "547--554",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:23 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.76.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Clark76b;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "By using an extension of traditional structure
information, or a geometric hierarchy, five significant
improvements to current techniques of computer picture
production are possible. First, the range of complexity
of an environment is greatly increased while the
visible complexity of any given scene is kept within a
fixed upper limit. Second, a meaningful way is provided
to vary the amount of detail presented in a scene.
Third, ``clipping'' becomes a very fast logarithmic
search for the resolvable parts of the environment
within the field of view. Fourth, frame to frame
coherence and clipping define a graphical ``working
set,'' or fraction of the total structure that should
be present in primary store for immediate access by the
visible surface algorithm. Finally, the geometric
structure suggests a recursive descent, visible surface
algorithm in which the computation time potentially
grows linearly with the visible complexity of the
scene.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130B
(Graphics techniques)",
classification = "723; 921",
corpsource = "Univ. of California, Santa Cruz, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; computer graphics; geometric models;
hidden surface; hierarchical data structures; image
processing; mathematical techniques --- Combinatorial
Mathematics; model; visible surface algorithms",
oldlabel = "Clark76b",
treatment = "A Application; P Practical; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Clark76b",
}
@Article{Levin:1976:PAD,
author = "Joshua Z. Levin",
title = "A Parametric Algorithm for Drawing Pictures of Solid
Objects Composed of Quadric Surfaces",
journal = j-CACM,
volume = "19",
number = "10",
pages = "555--563",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "55 13867",
MRreviewer = "Wolfgang Bohm",
bibdate = "Mon Jan 22 06:58:37 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/graphics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Levin76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm for drawing pictures of three-dimensional
objects, with surfaces made up of patches of quadric
surfaces, is described. The emphasis of this algorithm
is on calculating the intersections of quadric
surfaces. A parameterization scheme is used. Each
quadric surface intersection curve (QSIC) is
represented as a set of coefficients and parameter
limits. Each value of the parameter represents at most
two points, and these may easily be distinguished. This
scheme can find the coordinates of points of even
quartic (fourth-order) intersection curves, using
equations of no more than second order. Methods of
parameterization for each type of QSIC are discussed,
as well as surface bounding and hidden surface
removal.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130B
(Graphics techniques)",
classification = "723; 921",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; computer graphics; curves and surfaces;
graphics; hidden; intersections; mathematical
techniques --- Function Evaluation; parametric
algorithm; quadric surface intersection curve; quadric
surfaces; quadrics; scanline algorithms; solid objects;
surface bounding; surface removal; surfaces; three
dimensional",
oldlabel = "Levin76",
treatment = "A Application; P Practical; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Levin76",
}
@Article{Burtnyk:1976:IST,
author = "N. Burtnyk and M. Wein",
title = "Interactive Skeleton Techniques for Enhancing Motion
Dynamics in Key Frame Animation",
journal = j-CACM,
volume = "19",
number = "10",
pages = "564--569",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:59 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.76.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#BurtnykW76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A significant increase in the capability for
controlling motion dynamics in key frame animation is
achieved through skeleton control. This technique
allows an animator to develop a complex motion sequence
by animating a stick figure representation of an image.
This control sequence is then used to drive an image
sequence through the same movement. \par
The simplicity of the stick figure image encourages a
high level of interaction during the design stage. Its
compatibility with the basic key frame animation
technique permits skeleton control to be applied
selectively to only those components of a composite
image sequence that require enhancement.",
acknowledgement = ack-nhfb,
classcodes = "C5540 (Terminals and graphic displays); C6130B
(Graphics techniques)",
classification = "723; 742",
corpsource = "Nat. Res. Council of Canada, Ottawa, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer generated animation; computer graphics;
computerised picture processing; figure animation;
image processing; interactive graphics; interactive
skeleton; interactive skeleton control; key frame
animation; motion analysis and motion dynamics; motion
pictures --- Animation; skeleton control; stick; stick
figure animation",
oldlabel = "BurtnykW76",
treatment = "A Application; P Practical; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BurtnykW76",
}
@Article{Frane:1976:BBS,
author = "James W. Frane",
title = "The {BMD} and {BMDP} Series of Statistical Computer
Programs",
journal = j-CACM,
volume = "19",
number = "10",
pages = "570--576",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:23 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/siggraph/76.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Frane76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The BMD and BMDP series are the results of
methodological research and programming effort at the
UCLA Health Sciences Computing Facility since 1957. The
original users of the BMD and BMDP programs were
intended to be researchers in the health sciences.
However, the programs have been used for a wide variety
of biological and behavioral applications. The programs
are also used for problems in the physical sciences,
although they are not intended to solve highly
ill-conditioned problems which are sometimes
encountered there. Control language, graphics
capabilities, statistical features, data management and
limitations are discussed.",
acknowledgement = ack-nhfb,
classcodes = "B0240 (Probability and statistics); C1140 (Probability
and statistics); C6130 (Data handling techniques);
C7310 (Mathematics computing); C7330 (Biology and
medical computing); C7810 (Social and behavioural
sciences computing)",
classification = "723; 922",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis; analysis of; biology computing; BMD; BMDP;
cluster analysis; computing; contingency tables; data;
data processing; discriminant analysis; factor
analysis; graphics; mathematical statistics ---
Computer Applications; outlines; regression; social and
behavioural sciences; statistical analysis; statistical
computer programs; statistics; time series; variance",
oldlabel = "Frane76",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Frane76",
}
@Article{Duong-Kien:1976:IMA,
author = "C. Duong-Kien and Hans-J{\"u}rgen Hoffmann and D.
Muth",
title = "An improvement to {Martin}'s algorithm for computation
of linear precedence functions",
journal = j-CACM,
volume = "19",
number = "10",
pages = "576--577",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "54 9176",
MRreviewer = "Daniel J. Rosenkrantz",
bibdate = "Mon Jan 22 06:36:55 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Duong-KienHM76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
corpsource = "Tech. Hochschule Darmstadt, Darmstadt, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Boolean; Boolean algebra; linear precedence functions;
matrices; syntax analysis",
oldlabel = "Duong-KienHM76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Duong-KienHM76",
}
@Article{Montanelli:1976:SWM,
author = "Richard G. {Montanelli, Jr.} and Sandra A. Mamrak",
title = "Status of Women and Minorities in Academic Computer
Science",
journal = j-CACM,
volume = "19",
number = "10",
pages = "578--581",
month = oct,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:32 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#MontanelliM76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The results of a survey concerning women and minority
students and faculty in computer science during the
years 1971 to 1975 are presented. Analysis of the data
indicates that effective affirmative action programs
for recruitment into graduate degree programs are
needed to enlarge the number of women and minorities
qualified for later employment in computer science.
Also, possible discrimination in employment of women
and minority graduate students is revealed.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901",
corpsource = "Dept. of Computer Sci., Univ. of Illinois, Urbana, IL,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "academic employment; affirmative action; computer
programming; computer science; computer science
education; data processing; discrimination against;
discrimination against women; education; employment;
faculty; graduate students; minorities",
oldlabel = "MontanelliM76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MontanelliM76",
}
@Article{Ross:1976:HHS,
author = "Douglas T. Ross",
title = "Homilies for humble standards (computer
applications)",
journal = j-CACM,
volume = "19",
number = "11",
pages = "595--600",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Ross76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C7000 (Computer
applications)",
corpsource = "SofTech. Inc., Waltham, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer applications; standards; systems
methodology",
oldlabel = "Ross76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ross76",
}
@Article{Ledgard:1976:CUC,
author = "Henry F. Ledgard and William C. Cave",
title = "{Cobol} Under Control",
journal = j-CACM,
volume = "19",
number = "11",
pages = "601--608",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#LedgardC76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A sample set of Cobol programming standards is
offered. These standards constrain code to be developed
in a ``structured'' form for both data and control
structures. They do not require syntax beyond the
existing Cobol language and in fact utilize a typical
limited subset of the 1974 ANS Cobol standard. This
approach has reduced the cost and time to produce and
maintain large software systems.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6140D (High
level languages)",
classification = "723; 912",
corpsource = "Univ. of Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "COBOL; computer programming --- Structured
Programming; computer programming languages; computer
programs --- Standardization; control structures; data
structure; live; management; multiple customer
environments; programming standards; sample set;
standards; structured programming",
oldlabel = "LedgardC76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LedgardC76",
}
@Article{Wilcox:1976:DIT,
author = "Thomas R. Wilcox and Alan M. Davis and Michael H.
Tindall",
title = "Design and Implementation of a Table Driven,
Interactive Diagnostic Programming System",
journal = j-CACM,
volume = "19",
number = "11",
pages = "609--616",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#WilcoxDT76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "CAPS is a highly interactive diagnostic compiler\slash
interpreter that allows beginning programmers to
prepare, debug, and execute fairly simple programs at a
graphics display terminal. Complete syntax checking and
most semantic analysis is performed as the program is
entered and as it is subsequently edited. Analysis is
performed character by character. The most remarkable
feature of CAPS is its ability to automatically
diagnose errors both at compile time and at run time.
Errors are not automatically corrected. Instead, CAPS
interacts with the student to help him find the cause
of his error. Most components of CAPS are table driven,
both to reduce the space needed for implementation and
to increase the flexibility of the multilingual system.
Over 500 students have used CAPS to learn Fortran,
PL/I, or Cobol in conjunction with a computer assisted
course on introductory computer science.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming); C6150C (Compilers,
interpreters and other processors)",
classification = "722; 723; 901",
corpsource = "Univ. of Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "caps; CAPS; compiler/interpreter; compilers; computer
operating systems --- Program Compilers; computer
programming languages --- Procedure Orientation;
computer science education; computer systems, digital;
data processing --- Educational Applications; design;
education --- Computer Applications; implementation;
interactive diagnostic; interactive programming; Plato
IV; program; program interpreters; programming system;
student; table driven",
oldlabel = "WilcoxDT76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WilcoxDT76",
}
@Article{Rubin:1976:ETF,
author = "Frank Rubin",
title = "Experiments in Text File Compression",
journal = j-CACM,
volume = "19",
number = "11",
pages = "617--623",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Rubin76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A system for the compression of data files, viewed as
strings of characters, is presented. \par
The method is general, and applies equally well to
English, to PL/I, or to digital data. The system
consists of an encoder, an analysis program, and a
decoder. \par
Two algorithms for encoding a string differ slightly
from earlier proposals. The analysis program attempts
to find an optimal set of codes for representing
substrings of the file. Four new algorithms for this
operation are described and compared. Various
parameters in the algorithms are optimized to obtain a
high degree of compression for sample texts.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "IBM, Poughkeepsie, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis program; comparison of algorithms; computer
programming --- Subroutines; data file compaction; data
processing; decoder; encoder; Huffman codes; N-gram
encoding; strings of characters; text compression; text
editing; text file compression",
oldlabel = "Rubin76",
treatment = "P Practical; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rubin76",
}
@Article{Eswaran:1976:NCP,
author = "Kapali P. Eswaran and Jim N. Gray and Raymond A. Lorie
and Irving L. Traiger",
title = "The notions of consistency and predicate locks in a
database system",
journal = j-CACM,
volume = "19",
number = "11",
pages = "624--633",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "57 2005",
MRreviewer = "W. W. Armstrong",
bibdate = "Mon Jan 22 06:38:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#EswarranGLT76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: IBM Research Report RJ1487, San
Jose, CA, December, 1974.",
URL = "http://dblp.uni-trier.de/db/journals/cacm/EswarranGLT76.html",
abstract = "In database systems, users access shared data under
the assumption that the data satisfies certain
consistency constraints. This paper defines the
concepts of transaction, consistency and schedule and
shows that consistency requires that a transaction
cannot request new locks after releasing a lock. Then
it is argued that a transaction needs to lock a logical
rather than a physical subset of the database. These
subsets may be specified by predicates. An
implementation of predicate locks which satisfies the
consistency condition is suggested.",
acknowledgement = ack-nhfb,
annote = "If transactions are well-formed (they obtain and
release all locks required to avoid conflicts) and
2-phase (they don't obtain locks after having released
one), they maintain consistency. Original 2-phase
protocol. Serializability? Definitions of transactions,
permissible locking sequence in transactions, the
importance and complexity of predicate locks. Two-phase
transactions.",
cdrom = "CACMs1/CACM19/P624.pdf",
classcodes = "C6120 (File organisation); C7100 (Business and
administration)",
classification = "723; 913",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems --- Scheduling; computer
systems programming --- Multiprocessing Programs;
consistency; data base systems; database management
systems; database system; predicate locks; relation
database IBM San Jose CACM; schedule; shared data;
transaction",
oldlabel = "EswarranGLT76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EswarranGLT76",
}
@Article{Maruyama:1976:ORD,
author = "K. Maruyama and S. E. Smith",
title = "Optimal Reorganization of Distributed Space Disk
Files",
journal = j-CACM,
volume = "19",
number = "11",
pages = "634--642",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:04 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Os/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#MaruyamaS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A basic problem in database maintenance is to
establish the proper tradeoff between performance,
storage costs, and reorganization costs. This paper
considers the optimum points at which to reorganize
database. A disk file organization which allows for
distributed free space is described. The file is called
a DSDF (Distributed Space Disk File). A cost function
describing the excess costs due to physical
disorganization is defined, and this function is
minimized to obtain the optimum reorganization points.
Numerical examples based on the characteristics of
existing disk storage devices are given.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "722; 723; 901",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accessing; cost; data base systems --- Optimization;
data processing --- File Organization; data storage,
magnetic; database organizations; disc files;
distributed space; DSDF; file organisation; information
retrieval systems; insertions; magnetic disc and drum
storage; memory hierarchy; performance; reorganizing;
updates",
oldlabel = "MaruyamaS76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MaruyamaS76",
}
@Article{Hamlet:1976:HLB,
author = "Richard G. Hamlet",
title = "High-Level Binding with Low-Level Linkers",
journal = j-CACM,
volume = "19",
number = "11",
pages = "642--644",
month = nov,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Hamlet76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An easy to implement scheme is described by which a
compiler can enforce agreement between complex data
types in separately compiled modules. The scheme is
designed to work with any existing link editor or
linking loader, no matter how deficient. Obscure
run-time errors caused by inconsistent usages are
forestalled by static errors detected at linking
time.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "agreement; compiler; complex data types; computer
operating systems; computer programming languages; high
level binding; link editor; low level linkers; modules;
program compilers; separately compiled",
oldlabel = "Hamlet76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hamlet76",
}
@Article{Sammet:1976:RPL,
author = "Jean E. Sammet",
title = "Roster of Programming Languages for 1974--75",
journal = j-CACM,
volume = "19",
number = "12",
pages = "655--669",
month = dec,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:23 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Sammet76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This roster contains a list of 167 currently existing
higher-level languages which have been developed or
reported in the United States; have been implemented on
at least one general-purpose computer; and are believed
to be in use in the United States by someone other than
the developer. A programming ( equals higher-level)
language is defined as a set of characters and rules
for combining them which has the following
characteristics: the language requires no knowledge of
machine code by the user; the language is significantly
independent of a particular computer; there is a
one-many translation of instructions from source code
to object code; and the notation of the language is
fairly natural to its problem area and is not a fixed
tabular format. Of the total of 167 languages, 79 are
in categories: numerical scientific, business data
processing, list processing, string processing, formula
manipulation, and multipurpose. The remaining 88 are in
various specialized application areas.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "IBM, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; computer programming languages;
higher level language; programming languages",
oldlabel = "Sammet76",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sammet76",
}
@Article{Arden:1976:CSE,
author = "Bruce W. Arden",
title = "The Computer Science and Engineering Research Study
({COSERS})",
journal = j-CACM,
volume = "19",
number = "12",
pages = "670--673",
month = dec,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:51 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#Arden76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The Computer Science and Engineering Research Study
(COSERS) is briefly described. The motivation,
organization, and schedule for this NSF supported study
are given. For possible further reference, the subject
area panel chairmen and the members of the Steering
Committee are identified.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
classification = "901; 912",
corpsource = "Princeton Univ., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer engineering research; computer science
research; computers --- Research; COSERS; engineering
research; national research study; research and
development management",
oldlabel = "Arden76",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Arden76",
}
@Article{Nunamaker:1976:CAA,
author = "Jay F. {Nunamaker, Jr.} and Benn R. {Konsynski, Jr.}
and Thomas Ho and Carl Singer",
title = "Computer-Aided Analysis and Design of Information
Systems",
journal = j-CACM,
volume = "19",
number = "12",
pages = "674--687",
month = dec,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:10:09 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#NunamakerKHS76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes the use of computer-aided
analysis for the design and development of an
integrated financial management system by the Navy
Material Command Support Activity (NMCSA).
Computer-aided analysis consists of a set of procedures
and computer programs specifically designed to aid in
the process of applications software design, computer
selection and performance evaluation. There are four
major components: Problem Statement Language, Problem
Statement Analyzer, Generator of Alternative Designs,
and Performance Evaluator. The statement of
requirements was written in ADS (Accurately Defined
Systems) and analyzed by a Problem Statement Analyzer
for ADS. The analyzed problem statement was translated
to the form necessary for use by the SODA (Systems
Optimization and Design Algorithm) program for the
generation of alternative specifications of program
modules and logical database structures.",
acknowledgement = ack-nhfb,
classcodes = "B7900 (Military systems and equipment); B7990 (Other
military topics); C6110 (Systems analysis and
programming); C7120 (Financial computing); C7150
(Military computing)",
classification = "723; 901",
corpsource = "Univ. of Arizona, Tucson, AZ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accurately defined systems; ads; analysis; CAD;
computer aided analysis; computer systems, digital ---
Computer Aided Design; computer-aided analysis; data
base systems --- Computer Aided Design; data processing
--- Financial Applications; financial data processing;
financial management system; information retrieval
systems; information systems; integrated; logic design
--- Computer Aids; logical database structures;
management information systems; military computing;
performance evaluator; problem statement analyser;
problem statement language; soda; systems",
oldlabel = "NunamakerKHS76",
treatment = "A Application; E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NunamakerKHS76",
}
@Article{Stockman:1976:SPR,
author = "George Stockman and Laveen N. Kanal and M. C. Kyle",
title = "Structural Pattern Recognition of Carotid Pulse Waves
Using a General Waveform Parsing System",
journal = j-CACM,
volume = "19",
number = "12",
pages = "688--695",
month = dec,
year = "1976",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:31 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm19.html#StockmanKK76;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A general waveform parsing system (WPS) with
application to structural pattern recognition of
carotid pulse waves is described. The carotid arterial
pulse wave is of medical importance because of
variation in its structure induced by arterial aging
and cardiovascular disease. The syntax-driven waveform
analysis system has been applied with good results to
these pulse waves to detect and measure structural
variations. The waveform applied with good results to
these pulse waves to detect and measure structural
variations. The waveform parsing system is modeled on a
compiler-compiler system and allows the user to enter
application specific information as data. It is thus
general enough to be applicable to other waveforms.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1120 (Mathematical analysis); C1250
(Pattern recognition); C1290L (Systems theory
applications in biology and medicine); C7330 (Biology
and medical computing)",
classification = "461; 721; 723",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory --- Context Free Languages; biomedical
engineering --- Computer Aided Diagnosis;
cardiovascular disease; carotid pulse waves; data
processing --- Medical Information; medical computing;
pattern recognition; pattern recognition systems;
structural pattern recognition; waveform analysis;
waveform parsing system",
oldlabel = "StockmanKK76",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/StockmanKK76",
}
@Article{vanGelder:1977:SPC,
author = "Allen {van Gelder}",
title = "Structured programming in {COBOL}: an approach for
application programmers",
journal = j-CACM,
volume = "20",
number = "1",
pages = "2--12",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:33 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Gelder77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Techniques for designing and writing Cobol programs
are presented. Previous work in structured programming
is drawn upon and adapted. The presentation is
informal: the terminology is nonmathematical as far as
possible, no theorems are proved, and examples are used
frequently. Top-down program design is implemented
through the use of structured flowcharts, disciplined
specifications, and step by step verification. A
well-formed Cobol program is defined. The proper use of
the GO TO and other Cobol coding practices are
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6140D (High
level languages)",
classification = "723",
corpsource = "ACM, Seattle, WA, USA",
country = "USA",
descriptors = "Program construction; COBOL; standard",
enum = "3174",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "application; application programming; COBOL; Cobol;
computer metatheory --- Programming Theory; computer
programming; computer programming languages --- Cobol;
flowchart; GO TO; GO TO statement; program
verification; programming; repeat statement; software
reliability; structured flowcharts; structured
programming; top down; top-down; well formed program;
well-formed program",
language = "English",
oldlabel = "Gelder77",
references = "24",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gelder77",
xxauthor = "Allen Van Gelder",
}
@Article{Austing:1977:SLC,
author = "Richard H. Austing and Bruce H. Barnes and Gerald L.
Engel",
title = "A Survey of the Literature in Computer Science
Education Since {Curriculum '68}",
journal = j-CACM,
volume = "20",
number = "1",
pages = "13--21",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:21 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#AustingBE77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A bibliography of approximately two hundred references
in computer science education appearing in the
literature since the publication of ``Curriculum '68''
is presented. The bibliography itself is preceded by
brief descriptive materials organizing the references
into the categories of survey reports, activities of
professional organizations, philosophy of programs,
description of programs, description of courses and
other materials.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901; 912",
corpsource = "ACM, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bibliography; computer science; computer science
curricula; computer science education; computers;
curricula; education; education --- Bibliographies",
oldlabel = "AustingBE77",
treatment = "B Bibliography",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AustingBE77",
}
@Article{Babad:1977:RFP,
author = "Jair M. Babad",
title = "A Record and File Partitioning Model",
journal = j-CACM,
volume = "20",
number = "1",
pages = "22--30",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:26 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Babad77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a model in which several requests
access a file system, and each request requires
information from one or more variable length
data-items. The file system uses one or more storage
devices, and each record may be partitioned into
subrecords that are stored on different devices. One of
the subrecords is designated as the primary record;
when a request for a record is made, the primary record
is first accessed, and other subrecords are accessed
only if the pertinent information is not stored in the
primary record. The model that is presented in this
paper, both as a nonlinear programming model and a
mixed integer programming model, is a very general one;
several types of file systems may be derived from it by
an appropriate selection of its parameters. This model
has already been used in the optimization of library
routines' storage at a large scale operating system.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "722; 723; 901; 921",
corpsource = "Univ. of Chicago, Chicago, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "data processing; data storage, digital ---
Mathematical Models; file design; file organisation;
file partitioning; file systems; information retrieval
systems --- Optimization; integer programming; integer
programming model; mixed; nonlinear; nonlinear
programming model; partitioning; programming; record",
oldlabel = "Babad77",
treatment = "A Application; P Practical; T Theoretical or
Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Babad77",
xxpages = "22--31",
}
@Article{Zobrist:1977:DCO,
author = "Albert L. Zobrist and Frederick R. {Carlson, Jr.}",
title = "Detection of Combined Occurrences",
journal = j-CACM,
volume = "20",
number = "1",
pages = "31--35",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:46 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ZobristC77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this paper it is supposed that the variables
x//1,\ldots{},x//n each have finite range with the
variable x//i taking on p//i possible values and that
the values of the variables are changing with time. It
is supposed further that it is desired to detect
occurrences in which some subset of the variables
achieve particular values. Finally, it is supposed that
the problem involves the detection of a large number of
combined occurrences for a large number of changes of
values of variables. Two efficient solutions for this
problem are described. Both methods have the unusual
property of being faster for systems where the sum p//1
plus\ldots{} plus p//n is larger. A chess playing
application of the second solution algorithm is
provided.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming); C6130 (Data
handling techniques)",
classification = "461; 723; 912",
corpsource = "Jet Propulsion Lab., Pasadena, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "$n$ tuples; artificial; artificial intelligence;
chess; coding; combined occurrences; computer
programming; error analysis; hash coding; intelligence;
pattern recognition; pattern recognition systems;
programming; retrieval; secondary keys; sorting;
systems science and cybernetics --- Artificial
Intelligence; theory",
oldlabel = "ZobristC77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ZobristC77",
}
@Article{Batson:1977:SSL,
author = "Alan P. Batson and Robert E. Brundage",
title = "Segment Sizes and Lifetimes in {Algol 60} Programs",
journal = j-CACM,
volume = "20",
number = "1",
pages = "36--44",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Heaps.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BatsonB77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The characteristics of the virtual memory requirements
of a sample of Algol 60 programs have been measured.
Distributions are presented for the sizes of memory
requests and for their holding times (lifetimes). The
results are presented in terms of J. B. Johnston's
contour model and a simple abstract machine. They
provide new empirical evidence of certain aspects of
the construction and behavior of real programs, and
some of their implications for the design of virtual
memory systems are presented and discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "722; 723",
corpsource = "Univ. of Virginia, Charlottesville, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract; ALGOL; ALGOL 60; computer operating systems
--- Storage Allocation; computer programming languages
--- Algol; computer systems, digital; data storage,
digital; Johnston's contour model; machine; program
behaviour; segmentation; storage allocation; virtual
memory; virtual storage",
oldlabel = "BatsonB77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BatsonB77",
}
@Article{Gries:1977:BPB,
author = "David Gries",
title = "On Believing Programs to be Correct",
journal = j-CACM,
volume = "20",
number = "1",
pages = "49--50",
month = jan,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:25:42 1999",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Wadler:1976:AAR}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Muller:1977:AMD,
author = "Mervin E. Muller",
title = "An Approach to Multidimensional Data Array Processing
by Computer",
journal = j-CACM,
volume = "20",
number = "2",
pages = "63--77",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:37 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Muller77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Attention is first given to some of the general
problems of multidimensional table and array
processing. This is followed by a summary of some
recent developments in array processing capabilities at
the World Bank, in particular, the system identified as
WRAPS (World Bank Retrieval and Array Processing
System).",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723; 901",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "array processing; arrays; computer; data processing;
information retrieval systems; multidimensional data;
table lookup; World Bank Retrieval and Array Processing
System; WRAPS; wraps",
oldlabel = "Muller77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Muller77",
}
@Article{Clark:1977:ESL,
author = "Douglas W. Clark and C. Cordell Green",
title = "An Empirical Study of List Structure in {Lisp}",
journal = j-CACM,
volume = "20",
number = "2",
pages = "78--87",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ClarkG77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Static measurements of the list structure of five
large Lisp programs are reported and analyzed. These
measurements reveal substantial regularity, or
predictability, among pointers to atoms and especially
among pointers to lists. Pointers to atoms are found to
obey, roughly, Zipf's law, which governs word
frequencies in natural languages; pointers to lists
usually point to a location physically nearby in
memory. The use of such regularities in the
space-efficient representation of list structure is
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6140D (High level
languages)",
classification = "723",
comment = "Great paper; evidence pro CDR-coding, con fancy CONS",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; data processing ---
Data Structures; empirical study; LISP; list structure;
measurements; regularity",
oldlabel = "ClarkG77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ClarkG77",
}
@Article{Preparata:1977:CHF,
author = "Franco P. Preparata and S. J. Hong",
title = "Convex Hulls of Finite Sets of Points in Two and Three
Dimensions",
journal = j-CACM,
volume = "20",
number = "2",
pages = "87--93",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (52A25)",
MRnumber = "58 8475",
MRreviewer = "V. Medek",
bibdate = "Mon Jan 22 07:13:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#PreparataH77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The convex hulls of sets of n points in two and three
dimensions can be determined with O(n log n)
operations. The presented algorithms use the ``divide
and conquer'' technique and recursively apply a merge
procedure for two nonintersecting convex hulls. Since
any convex hull algorithm requires at least O(n log n)
operations, the time complexity of the proposed
algorithms is optimal within a multiplicative
constant.",
acknowledgement = ack-nhfb,
annote = "$O(n \log n)$ time",
classcodes = "C6130B (Graphics techniques)",
classification = "723; 931",
corpsource = "Univ. of Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "complexity; computational complexity; computer
graphics; computer programming; convex hull algorithm;
divide-and-conquer; finite sets of points; structural
analysis --- Computer Applications; time; worst-case
analysis",
oldlabel = "PreparataH77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PreparataH77",
}
@Article{Easton:1977:TFW,
author = "Malcolm C. Easton and B. T. Bennett",
title = "Transient-Free Working-Set Statistics",
journal = j-CACM,
volume = "20",
number = "2",
pages = "93--99",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "58 25108",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 06:37:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#EastonB77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Transient free-average working-set size and
transient-free missing-page rate for a finite sample of
a reference string are defined. Use of these statistics
is appropriate if the contents of the working set at
the start of the recorded string are unknown. If a
certain stationarity condition holds, these statistics
provide unbiased estimates of expected working-set
sizes, missing-page probabilities, and interference
distance probabilities. Two other pairs of estimators
are shown to be biased. Expressions for the
transient-free statistics are obtained in terms of
interval statistics. Methods are described for handling
long strings containing many distinct page names.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723; 922",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; missing page rate;
programming; statistical methods; statistics; transient
free; working set",
oldlabel = "EastonB77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EastonB77",
}
@Article{Bresenham:1977:LAI,
author = "Jack Bresenham",
title = "A Linear Algorithm for Incremental Digital Display of
Circular Arcs",
journal = j-CACM,
volume = "20",
number = "2",
pages = "100--106",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:07 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bresenham77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Circular arcs can be drawn on an incremental display
device such as a cathode ray tube, digital plotter, or
matrix printer using only sign testing and elementary
addition and subtraction. This paper describes
methodology for producing dot or step patterns closest
to the true circle.",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "IBM System Communications Div., Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "addition; arc generation; arcs; circle drawing;
circular; computer graphics; computer programming ---
Subroutines; dot generation; imaging techniques;
incremental digital display; linear algorithm; raster
display; sign testing; subtraction",
oldlabel = "Bresenham77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bresenham77",
}
@Article{Kotiah:1977:OCO,
author = "Thoddi C. T. Kotiah and David I. Steinberg",
title = "Occurrences of Cycling and Other Phenomena Arising in
a Class of Linear Programming Models",
journal = j-CACM,
volume = "20",
number = "2",
pages = "107--112",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:52 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#KotiahS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An investigation into the average queue size for a
certain class of queues has resulted in the formulation
of linear programming problems which are
ill-conditioned in some cases. In attempting to solve
these linear programming models, using IBM's MPS
package, instances of cycling were encountered. Small
perturbations in the input data resulted in problems
which did not cycle. This fact, plus several other
observed phenomena suggest that the primary reason that
cycling is not known to occur more frequently is that
round-off errors in the computations perturb the
problem sufficiently to prevent cycling (or at least to
prevent indefinite cycling).",
acknowledgement = ack-nhfb,
classcodes = "C1140C (Queueing theory); C1180 (Optimisation
techniques)",
classification = "723; 921; 922",
corpsource = "Southern Illinois Univ., Edwardsville, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "average queue size; cycling; linear programming;
mathematical programming, linear; MPS package;
phenomena; probability --- Queueing Theory; queueing
theory",
oldlabel = "KotiahS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KotiahS77",
}
@Article{Knott:1977:NSB,
author = "Gary D. Knott",
title = "A Numbering System for Binary Trees",
journal = j-CACM,
volume = "20",
number = "2",
pages = "113--115",
month = feb,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:21 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Knott77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B0250 (Combinatorial mathematics); C1160
(Combinatorial mathematics); C4240 (Programming and
algorithm theory)",
corpsource = "Nat. Inst. of Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary search trees; binary trees; numbering system;
permutations; ranking function; trees (mathematics)",
oldlabel = "Knott77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Knott77",
}
@Article{Clapson:1977:IAT,
author = "Philip Clapson",
title = "Improving the Access Time for Random Access Files",
journal = j-CACM,
volume = "20",
number = "3",
pages = "127--135",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Clapson77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Clustering in the key set is decreased by smoothing
the key-to-address transformation, and by adding shadow
buckets to an open chaining file. The keys are
pre-hashed before the address division, to remove the
effect of sequential properties in the key set. Shadow
buckets in the key search sequence reduce the effect of
nonuniformity in file loading, and decrease the number
of maximum probes needed to locate a record. The
combined effects of these techniques lead to improved
file performance for secondary storage devices, as
shown by empirical studies.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "IBM United Kingdom Ltd., Feltham, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "access time; chaining file; data processing --- File
Organization; data storage, digital; file loading; file
organisation; improved file; information retrieval
systems --- Design; key search sequence; maximum
probes; nonuniformity; open; performance; random access
files; secondary storage devices; sequential
properties; shadow buckets",
oldlabel = "Clapson77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Clapson77",
}
@Article{Yu:1977:EIR,
author = "Clement T. Yu and Gerard Salton",
title = "Effective Information Retrieval Using Term Accuracy",
journal = j-CACM,
volume = "20",
number = "3",
pages = "135--142",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 7012",
MRreviewer = "Fujio Nishida",
bibdate = "Mon Jan 22 07:31:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#YuS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Evaluation of a retrieval system in this study is
based on optimizing the performance of a specific user
query. The concept of query term accuracy is introduced
as the probability of occurrence of a query term in the
documents relevant to that query. By relating term
accuracy to the frequency of occurrence of the term in
the documents of a collection it is possible to give
formal proofs of the effectiveness with respect to a
given user query of a number of automatic indexing
systems that have been used successfully in
experimental situations. Among these are inverse
document frequency weighting, thesaurus construction,
and phrase generation.",
acknowledgement = ack-nhfb,
classcodes = "C7250 (Information storage and retrieval)",
classification = "723; 901",
corpsource = "Univ. of Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic indexing; concept; evaluation; formal
proofs; information retrieval; information retrieval
system evaluation; information retrieval systems;
information science --- Indexing; performance; query
term accuracy",
oldlabel = "YuS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/YuS77",
}
@Article{Lunde:1977:EES,
author = "{\AA}mund Lunde",
title = "Empirical Evaluation of Some Features of Instruction
Set Processor Architectures",
journal = j-CACM,
volume = "20",
number = "3",
pages = "143--153",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/risc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Lunde77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents methods for empirical evaluation
of features of Instruction Set Processors (ISPs). ISP
features are evaluated in terms of the time used or
saved by having or not having the feature. \par
The methods are based on analysis of traces of program
executions. The concept of a register life is in
troduced, and used to answer questions like: How many
registers are used simultaneously? How many would be
sufficient all of the time? Most of the time? What
would the overhead be if the number of registers were
reduced? What are registers used for during their
lives? The paper also discusses the problem of
detecting desirable but non-existing instructions.
Other problems are briefly discussed. Experimental
results are presented, obtained by analyzing 41
programs running on the DEC system 10 ISP.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "722; 723",
corpsource = "Carnegie-Mellon Univ., Pittsburg, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "architectures; computer architecture; computer
programming languages --- Machine Orientation; computer
selection and evaluation; computers, digital ---
General Purpose Application; evaluation; execution
time; instruction set processor; instruction sets;
instruction tracing; microcoding; MIPS; op code
utilization; pipelining; program behavior; reduced;
register life; register structures; register
utilization; restricted instruction set computer
architecture; RISC; simultaneous register lives",
oldlabel = "Lunde77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lunde77",
}
@Article{Brown:1977:MMR,
author = "R. M. Brown and James C. Browne and K. Mani Chandy",
title = "Memory Management and Response Time",
journal = j-CACM,
volume = "20",
number = "3",
pages = "153--165",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50 (60K30)",
MRnumber = "55 6996",
MRreviewer = "Jacek Blazewicz",
bibdate = "Mon Jan 22 06:28:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/simulan.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BrownBC77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a methodology for including the
effects of finite memory size and workload memory
requirements in queueing network models of computer
systems. Empirical analyses and analytic studies based
on applying this methodology to an actual multiaccess
interactive system are reported. A multiphase,
analytically soluble model is proposed as being broadly
applicable to the analysis of interactive computer
systems which use nonpaged memories.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "722; 723; 922",
corpsource = "Univ. of Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems --- Storage Allocation;
computer systems, digital; distribution; interactive
computer; job swap time; memory; memory requirement;
model; multi-access systems; multiphase; nonpaged
memories; performance measures; probability ---
Queueing Theory; response time; storage management;
systems; utilization; workload variables",
oldlabel = "BrownBC77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BrownBC77",
}
@Article{Burton:1977:RMS,
author = "Warren Burton",
title = "Representation of Many-Sided Polygons and Polygonal
Lines for Rapid Processing",
journal = j-CACM,
volume = "20",
number = "3",
pages = "166--171",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:01 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/siggraph/77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Burton77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A representation for polygons and polygonal lines is
described which allows sets of consecutive sides to be
collectively examined. The sets of sides are arranged
in a binary tree hierarchy by inclusion. A fast
algorithm for testing the inclusion of a point in a
many-sided polygon is given. It is shown that the
points of intersection of two polygonal lines can be
located by what is essentially a binary tree search.
The algorithm and a practical example are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques)",
classification = "723; 921",
corpsource = "Michigan Tech. Univ., Houghton, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary tree hierarchy; computer graphics; computer
programming --- Subroutines; data processing ---
Natural Sciences Applications; fast algorithm; image
processing; inclusion; mathematical techniques ---
Trees; polygonal lines; polygons; rapid processing;
representation; speed",
oldlabel = "Burton77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Burton77",
}
@Article{Hunt:1977:OSR,
author = "Harry B. {Hunt III} and Thomas G. Szymanski and
Jeffrey D. Ullman",
title = "Operations on Sparse Relations",
journal = j-CACM,
volume = "20",
number = "3",
pages = "171--176",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (68A30)",
MRnumber = "55 4774",
MRreviewer = "Armin Cremers",
bibdate = "Mon Jan 22 06:51:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#HuntSU77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Various computations on relations, Boolean matrices,
or directed graphs, such as the computation of
precedence relations for a context-free grammar, can be
done by a practical algorithm that is asymptotically
faster than those in common use. The heart of the
algorithms is a general theorem giving sufficient
conditions under which an expression whose operands are
sparse relations and whose operators are composition,
transitive closure, union, and inverse, can be computed
efficiently.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic)",
classification = "721; 723",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory --- Grammars; computational
complexity; computations; computer metatheory ---
Programming Theory; computer programming; context free
grammar; context-free grammars; precedence relations;
sparse relations",
oldlabel = "HuntSU77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HuntSU77",
}
@Article{Nolan:1977:ECU,
author = "Richard L. Nolan",
title = "Effects of Chargeout on User\slash Manager Attitudes",
journal = j-CACM,
volume = "20",
number = "3",
pages = "177--185",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:45 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Nolan77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The relationship of internal pricing systems for
computer services (chargeout systems) and user
management attitudes about their computer-based
information systems is investigated. Development and
maintenance of computer-based systems is asserted to be
a category of organizational change. A ``felt need''
for the change on the part of the user\slash manager is
prerequisite to any change taking place. The research
methods of behavioral science are applied to
investigate the user\slash manager environment and the
effects of chargeout.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
classification = "723",
corpsource = "Harvard Univ., Boston, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "attitudes; chargeout; computer facilities; computer
services; data processing, business; DP management;
internal pricing systems; user/manager attitudes",
oldlabel = "Nolan77",
treatment = "E Economic",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nolan77",
}
@Article{Borovits:1977:CUM,
author = "Israel Borovits and Phillip Ein-Dor",
title = "Cost\slash utilization: {A} measure of system
performance",
journal = j-CACM,
volume = "20",
number = "3",
pages = "185--191",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BorovitsE77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is presented for evaluating computer system
performance in terms of a cost\slash utilization factor
and a measure of imbalance. These coefficients indicate
the extent to which the total system cost is
effectively utilized. The method includes a technique
for the visual representation of system performance.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C6150G (Diagnostic, testing,
debugging and evaluating systems)",
classification = "723; 911",
corpsource = "Tel-Aviv Univ., Tel-Aviv, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer; computer selection and evaluation; computer
systems, digital; cost; cost accounting;
cost/utilization factor; evaluating; measure; measure
of imbalance; system performance; total system",
oldlabel = "BorovitsE77",
treatment = "E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BorovitsE77",
}
@Article{Bays:1977:CNF,
author = "Carter Bays",
title = "A Comparison of Next-fit, First-fit, and Best-fit",
journal = j-CACM,
volume = "20",
number = "3",
pages = "191--192",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:07 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bays77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. of South Carolina, Columbia, SC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "best; comparison; first fit; fit; next fit; storage
allocation",
oldlabel = "Bays77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bays77",
}
@Article{Bertsch:1977:SRP,
author = "Eberhard Bertsch",
title = "The Storage Requirement in Precedence Parsing",
journal = j-CACM,
volume = "20",
number = "3",
pages = "192--194",
month = mar,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:06 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bertsch77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Precedence tables and linear precedence functions have
been used and extensively studied as aids for
syntax-directed compiling. If a precedence table exists
but cannot be reshaped into a pair of precedence
functions, several techniques for eliminating blank
entries may be used. In that case, all nonblank entries
have to be kept, however. Thus, there is a considerable
gap between the storage requirements of precedence
functions and precedence tables. The purpose of this
paper is to show that the gap between precedence
functions and precedence tables can be closed in a
natural way.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "Univ des Saarlandes, Saarbrucken, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory --- Programming Theory; computer
operating systems; computer programming ---
Subroutines; precedence parsing; program compilers;
storage requirement; value table",
oldlabel = "Bertsch77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bertsch77",
}
@Article{Morris:1977:SI,
author = "James H. {Morris, Jr.} and Ben Wegbreit",
title = "Subgoal Induction",
journal = j-CACM,
volume = "20",
number = "4",
pages = "209--222",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "56 4222",
MRreviewer = "Andrea Maggiolo-Schettini",
bibdate = "Mon Jan 22 07:06:13 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#MorrisW77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A proof method, subgoal induction, is presented as an
alternative or supplement to the commonly used
inductive assertion method. Its major virtue is that it
can often be used to prove a loop's correctness
directly from its input-output specification without
the use of an invariant. The relation between subgoal
induction and other commonly used induction rules is
explored and, in particular, it is shown that subgoal
induction can be viewed as a specialized form of
computation induction.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory --- Programming Theory; computer
programming; computer programming languages --- Program
Debugging; functional verification correctness; program
proving; programming theory; subgoal induction",
oldlabel = "MorrisW77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MorrisW77",
}
@Article{Tanimoto:1977:EPS,
author = "Steven L. Tanimoto and Theodosios Pavlidis",
title = "Editing of Picture Segmentations Using Local Analysis
of Graphs",
journal = j-CACM,
volume = "20",
number = "4",
pages = "223--229",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#TanimotoP77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A major problem in picture processing is the
elimination of the large number of spurious regions
that result from an initial segmentation by region
growing techniques. This paper describes a nonsemantic
editing scheme which performs eliminations on the basis
of local properties of the region adjacency graph. The
scheme is based on definitions of graph properties
which are satisfied when a spurious region is present;
then editing is equivalent to fast graph operations. A
number of examples are shown.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
classification = "723; 921",
corpsource = "Univ. of Connecticut, Storrs, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "editing; graphs; image processing; local analysis;
mathematical techniques --- Graph Theory; pattern
recognition systems; picture processing; picture
segmentations",
oldlabel = "TanimotoP77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TanimotoP77",
}
@Article{Findler:1977:SMC,
author = "Nicholas V. Findler",
title = "Studies in Machine Cognition Using the Game of Poker",
journal = j-CACM,
volume = "20",
number = "4",
pages = "230--245",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:34 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Findler77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A progress report is presented of on-going research
efforts concerning human decision-making under
uncertainty and risk and human problem-solving and
learning processes on the one hand, and machine
learning, large scale programming system, and novel
programming techniques on the other. There has also
been interest in how humans make deductive and
inductive inferences and form and optimize heuristic
rules, and how machines can reach similar results.
Although the vehicle of these investigations has been
the game of poker, a conceptual framework has been
provided that should have a fairly wide range of
applicability.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
classification = "461; 723; 912; 922",
corpsource = "State Univ. of New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "artificial intelligence; data processing ---
Psychology Applications; decision theory and analysis;
human decision making; human problem solving; large
scale programming systems; learning; machine cognition;
machine learning; poker; probability; processes; risk;
systems science and cybernetics; uncertainty",
oldlabel = "Findler77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Findler77",
}
@Article{Maruyama:1977:ADA,
author = "K. Maruyama and S. E. Smith",
title = "Analysis of Design Alternatives for Virtual Memory
Indexes",
journal = j-CACM,
volume = "20",
number = "4",
pages = "245--254",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#MaruyamaS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A class of index structures modeled after the
structure of VSAM --- similar to B-trees but biased
toward sequential processing --- is described. Design
alternatives within this class of index structures are
analyzed. These alternatives include a choice of search
strategy, whether or not pages in the index are
structured, and whether or not keys are compressed. The
average cost of retrieving entries from these indexes
is expressed as a weighted sum of the cost of a basic
key comparison and the cost of crossing a page boundary
in the index structure. Formulas for the retrieval
costs for possible combinations of design alternatives
are given.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compressed; costs; data processing --- Data Handling;
data storage, digital; design alternatives; index
structures; pages; retrieval; search strategy;
structured; virtual memory; virtual storage",
oldlabel = "MaruyamaS77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MaruyamaS77",
}
@Article{Lucas:1977:SHC,
author = "Henry C. {Lucas, Jr.} and Jimmy A. Sutton",
title = "The Stage Hypothesis and the {S}-Curve: Some
Contradictory Evidence",
journal = j-CACM,
volume = "20",
number = "4",
pages = "254--259",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#LucasS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The s-shaped budget curve of R. Nolan's stage model of
computer development in an organization (Comm ACM v 16
n 7 Jul 1973 p 399) is tested. Research on the data
processing budgets of California counties fails to
support the s-shaped curve or the use of budgets as a
basis for a stage model. However, the results do not
invalidate the concept of a stage model. The analysis
suggests an alternative model of budget growth and a
separation between models of budgeting growth and
growth stages in the development of the computer
resource.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management)",
classification = "723; 911; 912",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "budget curve; computer development; data; data
processing; DP management; management --- Applications;
processing budgets; stage hypothesis",
oldlabel = "LucasS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LucasS77",
}
@Article{Yao:1977:ANA,
author = "S. Bing Yao",
title = "Approximating the Number of Accesses in Database
Organizations",
journal = j-CACM,
volume = "20",
number = "4",
pages = "260--261",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:10 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Yao77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/Yao77.html",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM20/P260.pdf",
classcodes = "C6120 (File organisation)",
corpsource = "Purdue Univ., West Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "approximating; block accesses; database organizations;
file organisation; inverted file; selectivity
estimation I/O cost query optimization CACM",
oldlabel = "Yao77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Yao77",
xxtitle = "Approximating block accesses in database
organizations",
}
@Article{Hollander:1977:RUI,
author = "Clifford R. Hollander",
title = "Remark on Uniform Insertion in Structured Data
Structures",
journal = j-CACM,
volume = "20",
number = "4",
pages = "261--262",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Hollander77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "IBM Sci. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data structures; structured data structures; uniform
insertion",
oldlabel = "Hollander77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hollander77",
xxtitle = "Remark on uniform insertion on structured data
structures",
}
@Article{Bandypadhyay:1977:CWI,
author = "S. K. Bandypadhyay",
title = "Comment on Weighted Increment Linear Search for
Scatter Tables",
journal = j-CACM,
volume = "20",
number = "4",
pages = "262--263",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:06 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bandypadhyay77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Aeronautical Dev. Establ., Bangalore, India",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "address; file organisation; hash; primary clustering;
scatter tables; weighted increment linear search",
oldlabel = "Bandypadhyay77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bandypadhyay77",
xxauthor = "S. K. Bandyopadhyay",
}
@Article{Thompson:1977:SMC,
author = "C. D. Thompson and H. T. Kung",
title = "Sorting on a Mesh-Connected Parallel Computer",
journal = j-CACM,
volume = "20",
number = "4",
pages = "263--271",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (68A20)",
MRnumber = "55 11693",
MRreviewer = "Jo Ann Howell",
bibdate = "Mon Jan 22 07:26:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.comm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ThompsonK77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two algorithms are presented for sorting $n^2$
elements on an $n \times n$ mesh-connected processor
array that require $O(n)$ routing and comparison steps.
The best previous algorithm takes time $O(n \log n)$.
The algorithms are shown to be optimal in time within
small constant factors. Extensions to
higher-dimensional arrays are also given.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "722; 723",
corpsource = "Carnegie-Mellon Univ., Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; computer systems
programming --- Sorting; computer systems, digital;
mesh connected; parallel computer; parallel processing;
sorting",
oldlabel = "ThompsonK77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ThompsonK77",
}
@Article{Robinson:1977:PTH,
author = "Lawrence Robinson and Karl N. Levitt",
title = "Proof Techniques for Hierarchically Structured
Programs",
journal = j-CACM,
volume = "20",
number = "4",
pages = "271--283",
month = apr,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "57 14584",
MRreviewer = "Franco Sirovich",
bibdate = "Mon Jan 22 07:16:38 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#RobinsonL77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method for describing and structuring programs that
simplifies proofs of their correctness is presented.
The method formally represents a program in terms of
levels of abstraction, each level of which can be
described by a self-contained nonprocedural
specification. The proofs, like the programs, are
structured by levels. Although only manual proofs are
described, the method is also applicable to
semiautomatic and automatic proofs. Preliminary results
indicate that the method can be applied to large
programs, such as operating systems.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "461; 723; 912",
corpsource = "Stanford Res. Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory --- Programming Theory; computer
programming; correctness; hierarchically structured
programs; program testing; proofs; structured
programming; systems science and cybernetics ---
Hierarchical Systems",
oldlabel = "RobinsonL77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RobinsonL77",
}
@Article{Holt:1977:SKS,
author = "Richard C. Holt and David B. Wortman and David T.
Bardnard and James R. Cordy",
title = "{SP/k}: {A} System for Teaching Computer Programming",
journal = j-CACM,
volume = "20",
number = "5",
pages = "301--309",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:43 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#HoltWBC77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "SP/k, a compatible subset of the PL/I language, is a
sequence of language subsets called SP/1, SP/2,\ldots{}
SP/8. Each subset introduces new programming language
constructs while retaining all the constructs of
preceding subsets. The features of the SP/k language
were chosen to encourage structured problem solving by
computers, to make the language easy to learn and use,
to eliminate confusing and redundant constructs, and to
make the language easy to compile. Language features,
processor design, and system experience are
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming); C6140D (High level
languages)",
classification = "723; 901",
corpsource = "Univ. of Toronto, Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compatible subset; computer programming; computer
programming languages; computer science education;
education; PL/1; PL/I language; programming; SP/k;
teaching",
oldlabel = "HoltWBC77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HoltWBC77",
}
@Article{Fishman:1977:ASA,
author = "George S. Fishman",
title = "Achieving Specific Accuracy in Simulation Output
Analysis",
journal = j-CACM,
volume = "20",
number = "5",
pages = "310--315",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Fishman77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper extends the use of the regenerative
property of queueing systems in the analysis of
simulation output. In particular, it describes a
sequential estimation method which when used with the
regenerative property allows results to be obtained
with specified statistical accuracy. This method
includes a test to check the normality assumption on
which the sequential procedure relies. The paper
illustrates the method using the empty and idle state
as the regenerative state. A second example then
describes how using the most frequently entered state
as the regenerative state reduces the chance of making
a costly error in a preliminary simulation run. The
paper also described how a variance reduction method
due to Page [9] can be used to obtain a specified
accuracy with considerably fewer job completions than
are required when no variance reduction technique is
applied.",
acknowledgement = ack-nhfb,
classcodes = "C1220 (Simulation, modelling and identification)",
classification = "723; 912; 922",
corpsource = "Univ. of North Carolina, Chapel Hill, NC, USA",
country = "USA",
descriptors = "Simulation; time series analysis",
enum = "952",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "accuracy; computer simulation; confidence in terval;
mathematical statistics; operations research ---
Computer Applications; probability --- Queueing Theory;
queueing systems; queueing theory; ratio estimator;
regenerative property; sequential estimation method;
sequential estimator; simulation; simulation output
analysis; stopping rule; variance reduction",
language = "English",
oldlabel = "Fishman77",
references = "0",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fishman77",
}
@Article{Morgan:1977:OPD,
author = "Howard L. Morgan and K. Dan Levin",
title = "Optimal Program and Data Locations in Computer
Networks",
journal = j-CACM,
volume = "20",
number = "5",
pages = "315--322",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:05:58 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#MorganL77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An optimization procedure for the allocation of
program and data files in a computer network is
presented. This algorithm takes into account the
dependencies between files and programs such as occur
in real heterogeneous computer networks. A search
procedure for the file location problem is described,
along with an example and a possible application of the
model.",
acknowledgement = ack-nhfb,
classcodes = "C5620 (Computer networks and techniques); C6120 (File
organisation)",
classification = "723",
corpsource = "Univ. of Pennsylvania, Philadelphia, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer networks; computer programming ---
Subroutines; computers --- Data Communication Systems;
data base systems --- Optimization; data locations;
data processing --- Data Handling; mathematical models;
optimization procedure; program; storage allocation",
oldlabel = "MorganL77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MorganL77",
}
@Article{Baer:1977:CTB,
author = "Jean-Loup Baer and B. Schwab",
title = "A Comparison of Tree-Balancing Algorithms",
journal = j-CACM,
volume = "20",
number = "5",
pages = "322--330",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:37 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BaerS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Several algorithms-height-balance (i.e. AVL and
extensions), weight-balance (i.e. BB and WB), and total
restructuring-for building balanced binary search trees
are compared. The criteria for comparison encompass
theoretical aspects (e.g. path lengths) and
implementation independent and
machine/algorithm-dependent measures (e.g. run time). A
detailed analysis of code is also presented at a level
believed to be language-and compiler-independent. The
quality of the resulting trees and the overhead spent
on building them are analyzed, and some guidelines are
given for an efficient use of the methods. If insertion
and subsequent queries are the only operations of in
terest, then ``pure'' AVL trees present the overall
best qualities.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723; 901; 921",
corpsource = "Univ. of Washington, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; analysis of algorithms; AVL trees;
balance; balanced binary search; binary search trees;
comparison; computer programming --- Subroutines; data
processing; height balance; information retrieval
systems; information storage and retrieval;
mathematical techniques --- Trees; path length; total
restructuring; tree balancing algorithms; trees;
weight; weight-balanced trees",
oldlabel = "BaerS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BaerS77",
}
@Article{Stillman:1977:CHS,
author = "Neil J. Stillman and P. Bruce Berra",
title = "A Comparison of Hardware and Software Associative
Memories in the Context of Computer Graphics",
journal = j-CACM,
volume = "20",
number = "5",
pages = "331--339",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#StillmanB77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The Associative Processing of Line Drawings (APLD)
System utilizes a hardware associative memory and
creates, modifies, deletes, stores, and retrieves
two-dimensional line drawings consisting of points,
lines, rectangles, and triangles. The APLD functions
were duplicated on the TX-2 computer at M. I. T. 's
Lincoln Laboratory under the LEAP Language and Data
Structure. A comparison of the hardware approach with
the software simulation illustrates the advantages of
the hardware associative memory.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130B (Graphics
techniques)",
classification = "722; 723",
corpsource = "Defense Communications Agency, Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "associative and memory; associative memories;
associative processing of line drawings; comparison;
computer graphics; computer systems, digital ---
Parallel Processing; content-addressable storage; data
storage, digital --- Associative; hardware; image
processing; software",
oldlabel = "StillmanB77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/StillmanB77",
}
@Article{Shapiro:1977:CRP,
author = "Marvin B. Shapiro",
title = "Choice of Reference Points in Best-Match File
Searching",
journal = j-CACM,
volume = "20",
number = "5",
pages = "339--343",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:43 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Shapiro77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Improvements to the exhaustive search method of
best-match file searching have previously been achieved
by doing a preprocessing step involving the calculation
of distances from a reference point (Comm ACM, V16 n 4
April 1973 p 230). This paper discusses the proper
choice of reference points and extends the previous
algorithm to use more than one reference point. It is
shown that reference points should be located outside
of data clusters.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "Nat. Inst. of Health, Bethesda, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "best match; choice; computer programming ---
Subroutines; data processing; file organisation; file
searching; information retrieval systems; reference
points",
oldlabel = "Shapiro77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shapiro77",
}
@Article{Hanani:1977:OEB,
author = "Michael Z. Hanani",
title = "An Optimal Evaluation of {Boolean} Expressions in an
Online Query System",
journal = j-CACM,
volume = "20",
number = "5",
pages = "344--347",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 9627",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:48:13 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Hanani77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In the system discussed, in a response to a query, the
entire file containing hundreds of thousands of records
has to be searched, and the Boolean expression is
evaluated for each record. The method presented
improves the performance of such a system by speeding
up the process of computing the truth value of a
Boolean expression for an individual record. This is
done by evaluating the expression based on the values
of a subset of its components rather than the entire
expression.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6120 (File organisation)",
classification = "722; 723; 901",
corpsource = "Ben Gurion Univ., Negev, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Boolean algebra; Boolean expressions; computer
programming --- Subroutines; computer systems, digital
--- On Line Systems; data base systems; data processing
--- Data Handling; file organisation; file searching;
information retrieval systems; online query system;
optimal evaluation; order sort clauses by cost and
selectivity CACM",
oldlabel = "Hanani77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hanani77",
}
@Article{Milman:1977:AOD,
author = "Y. Milman",
title = "An Approach to Optimal Design of Storage Parameters in
Databases",
journal = j-CACM,
volume = "20",
number = "5",
pages = "347--350",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "55 7007",
MRreviewer = "Clement T. Yu",
bibdate = "Mon Jan 22 07:04:31 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Milman77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Storage and response-time requirements are
contradictory in nature, and in any real-world, the
problem, one has to attain a rational equilibrium
between them. The actual location of this equilibrium
depends on the conditions of the specific problem. The
purpose of this paper is to present a simple approach
that can be employed to locate such an equilibrium, and
to demonstrate its use in an actual application.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Contahal Ltd., Tel-Aviv, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "data base systems; data storage, digital; database
management systems; databases; optimal design; storage
parameters",
oldlabel = "Milman77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Milman77",
}
@Article{Hunt:1977:FAC,
author = "James W. Hunt and Thomas G. Szymanski",
title = "A Fast Algorithm for Computing Longest Common
Subsequences",
journal = j-CACM,
volume = "20",
number = "5",
pages = "350--353",
month = may,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10 (68A20)",
MRnumber = "55 9596",
MRreviewer = "C. L. Liu",
bibdate = "Mon Jan 22 06:51:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#HuntS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Previously published algorithms for handling the
longest common subsequence of two sequence of length n
have had a best-case running time of O(n//2). An
algorithm for this problem is presented which has a
running time O((r plus n) log n), where r is the total
number of ordered pairs of positions at which the two
sequences match. Thus in the worst case the algorithm
has a running time of O(n**2 log n).",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
comment = "``Previously published algorithms for finding the
longest common subsequence of two sequences of length
$n$ have had a best--case running time of $O(n^2)$. An
algorithm for this problem is presented which has a
running time of $O((r + n) \log n)$, where $r$ is the
total number of ordered pairs of positions at which the
two sequences match. Thus in the worst case the
algorithm has a running time of $O(n^2 \log n)$.
However, for those applications where most positions of
one sequence match relatively few positions in the
other sequence, a running time of $O(n \log n)$ can be
expected.''",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; computer programming ---
Subroutines; data processing; fast algorithm; file
searching; longest common subsequences; two sequences",
oldlabel = "HuntS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HuntS77",
}
@Article{Taulbee:1977:PEP,
author = "Orrin E. Taulbee and Samuel D. Conte",
title = "Production and Employment of {Ph.D.}'s in Computer
Science --- 1976",
journal = j-CACM,
volume = "20",
number = "6",
pages = "370--372",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:43 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#TaulbeeC77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Statistics are presented on the production and
employment of Ph. D's in computer science for the
calendar year 1975-76. Data include profiles of
graduate students and of faculty at 60 Ph. D. ---
producing departments as well as breakdown of degrees
granted by specialty areas. Significant trends are
noted and comparisons with comparable data gathered for
the 1974-75 calendar year are made.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901; 912",
corpsource = "Univ. of Pittsburgh, Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer science; computer science education; data
processing; education; employment; PhD; production;
statistics",
oldlabel = "TaulbeeC77",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TaulbeeC77",
}
@Article{Shneiderman:1977:EIU,
author = "Ben Shneiderman and Richard E. Mayer and Don McKay and
Peter Heller",
title = "Experimental Investigations of the Utility of Detailed
Flowcharts in Programming",
journal = j-CACM,
volume = "20",
number = "6",
pages = "373--381",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:19 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ShneidermanMMH77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes previous research on flowcharts
and a series of controlled experiments to test the
utility of detailed flowcharts as an aid to program
composition, comprehension, debugging, and
modification. No statistically significant difference
between flowchart and nonflowchart groups has been
shown, thereby calling into question the utility of
detailed flowcharting. A program of further research is
suggested.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Indiana Univ., Bloomington, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "aid; comprehension; computer programming; computer
programming languages; controlled experiments;
debugging; detailed flowcharts; flowcharting;
modification; program composition; utility",
oldlabel = "ShneidermanMMH77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShneidermanMMH77",
}
@Article{Ledgard:1977:TVD,
author = "Henry F. Ledgard and Robert W. Taylor",
title = "Two Views of Data Abstraction --- Introduction to the
Special Section",
journal = j-CACM,
volume = "20",
number = "6",
pages = "382--384",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:11 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#LedgardT77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. of Massachusetts, Amherst, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data abstraction; data structures; database; language;
types data abstraction",
oldlabel = "LedgardT77",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LedgardT77",
}
@Article{Zloof:1977:SBA,
author = "Mosh{\'e} M. Zloof and S. Peter {de Jong}",
title = "The System {for Business Automation} ({SBA}):
Programming Language",
journal = j-CACM,
volume = "20",
number = "6",
pages = "385--396",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:31:45 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ZloofJ77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The system for business automation (SBA) is a system
within which application experts --- nonprogrammers ---
can describe and execute their applications on a
computer. The user of SBA views the application as
manipulation of information in two-dimensional pictures
of tables, business forms, and reports on a display
terminal. The application can be automated gradually by
giving ``examples'' to the system of how the
information would be manipulated manually. The
Query-by-Example database language is a subset of the
SBA programming language.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C7100 (Business and
administration)",
classification = "723; 901",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative data processing; automatic programming;
business automation; by Example; computer programming
languages; data processing --- Data Structures; data
processing, business; database language; display
terminal; information retrieval systems;
nonprogrammers; problem oriented languages; programming
language; Query; SBA",
oldlabel = "ZloofJ77",
treatment = "E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ZloofJ77",
}
@Article{Guttag:1977:ADT,
author = "John V. Guttag",
title = "Abstract Data Types and the Development of Data
Structures",
journal = j-CACM,
volume = "20",
number = "6",
pages = "396--404",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:47:40 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Guttag77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Abstract data types can play a significant role in the
development of software that is reliable, efficient,
and flexible. This paper presents and discusses the
application of an algebraic technique for the
specification of abstract data types. Among the
examples presented is a top-down development of a
symbol table for a block structured language; a
discussion of the proof of its correctness is given. A
brief discussion of the problems involved in
constructing algebraic specifications that are both
consistent and complete is also provided.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 921",
corpsource = "Univ. of Southern California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data types; algebraic technique; computer
metatheory; computer programming --- Reliability;
computer programming languages; data processing ---
Data Structures; data structures; data types;
development; functional types olit data abstraction;
mathematical techniques --- Algebra; specification",
oldlabel = "Guttag77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Guttag77",
xxtitle = "Abstract Data Type and the Development of Data
Structures",
}
@Article{Smith:1977:DAA,
author = "John Miles Smith and Diane C. P. Smith",
title = "Database Abstractions: Aggregation",
journal = j-CACM,
volume = "20",
number = "6",
pages = "405--413",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:56 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#SmithS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://dblp.uni-trier.de/db/journals/cacm/SmithS77.html",
abstract = "A new data type, called aggregate, is developed which,
under certain criteria of ``well-definedness,''
specifies aggregation abstractions. A top-down
methodology for database design is described which
separates decisions concerning aggregate structure from
decisions concerning key identification. It is
suggested that aggregate types, and other types which
support real-world abstractions without introducing
implementation detail, should be incorporated into
programming languages.",
acknowledgement = ack-nhfb,
cdrom = "CACMs1/CACM20/P405.pdf",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Utah, Salt Lake City, UT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstractions; aggregation; computer programming
languages; data aggregates; data base systems ---
Design; data processing; data structures; data types;
databases",
oldlabel = "SmithS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SmithS77",
}
@Article{Gries:1977:SID,
author = "David Gries and Narain H. Gehani",
title = "Some Ideas on Data Types in High-Level Languages",
journal = j-CACM,
volume = "20",
number = "6",
pages = "414--420",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:46:36 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#GriesG77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A number of issues are explored concerning the notion
that a data type is a set of values together with a set
of primitive operations on those values. Among these
are the need for a notation for iterating over the
elements of any finite set (instead of the more narrow
for i: equals 1 to n notation), the use of the domain
of an array as a data type, the need for a simple
notation for allowing types of parameters to be
themselves parameters (but in a restrictive fashion),
and resulting problems with conversion of values from
one type to another.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6120 (File
organisation)",
classification = "723",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer meta theory --- Algorithmic Languages;
computer programming languages; data processing ---
Data Structures; data structures; data types; high
level languages; primitive operations; programming
theory; types olit iteration",
oldlabel = "GriesG77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GriesG77",
}
@Article{Peterson:1977:BS,
author = "James L. Peterson and Theodore A. Norman",
title = "Buddy Systems",
journal = j-CACM,
volume = "20",
number = "6",
pages = "421--431",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#PetersonN77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two algorithms are presented for implementing any of a
class of buddy systems for dynamic storage allocation.
Each buddy system corresponds to a set of recurrence
relations which relate the block sizes provided to each
other. Analyses of the internal fragmentation of the
binary buddy system, the Fibonacci buddy system, and
the weighted buddy system are given. Comparative
simulation results are also presented for internal,
external, and total fragmentation.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; buddy systems; computer operating systems;
computer programming --- Subroutines; computer
programs; data storage, digital; dynamic storage
allocation; recurrence relations; storage allocation",
oldlabel = "PetersonN77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PetersonN77",
}
@Article{Robson:1977:BSA,
author = "J. M. Robson",
title = "A Bounded Storage Algorithm for Copying Cyclic
Structures",
journal = j-CACM,
volume = "20",
number = "6",
pages = "431--433",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Robson77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new algorithm is presented which copies cyclic list
structures using bounded workspace and linear time.
Unlike a previous similar algorithm, this one makes no
assumptions about the storage allocation system in use
and uses only operations likely to be available in a
high-level language. The distinctive feature of this
algorithm is a technique for traversing the structure
twice, using the same spanning tree in each case, first
from left to right and then from right to left.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Univ. of Lancaster, Lancaster, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bounded storage algorithm; computer programming ---
Subroutines; computer programs; computer systems
programming; copying; cyclic structures; list; list
processing; structures",
oldlabel = "Robson77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Robson77",
}
@Article{Bird:1977:NRE,
author = "Richard S. Bird",
title = "Notes on Recursion Elimination",
journal = j-CACM,
volume = "20",
number = "6",
pages = "434--439",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bird77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Various methods of recursion elimination are applied
to the schematic recursive procedure: proc S(x); px
then N(x); S(fx); S(gx); M(x) fi. Procedures with this
general form arise in connection with tree traversal
and sorting algorithms. Each method of recursion
removal involves the use of one or more stacks, and the
solutions are compared on the basis of their running
time.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "721; 723",
corpsource = "Univ. of Reading, Reading, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory --- Recursive Functions; computer
programming; computer systems programming --- Sorting;
functional; programming theory; recursion elimination;
running time; sorting algorithms; stacks; tree
traversal",
oldlabel = "Bird77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bird77",
}
@Article{Warren:1977:FRW,
author = "Henry S. {Warren, Jr.}",
title = "Functions Realizable with Word-Parallel Logical and
Two's-Complement Addition Instructions",
journal = j-CACM,
volume = "20",
number = "6",
pages = "439--441",
month = jun,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94A20",
MRnumber = "58 26591",
bibdate = "Mon Jan 22 07:28:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Warren77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A theorem is given for deducing whether or not a given
function can be computed through the use of
``programming tricks'' involving binary numbers. This
is followed by an efficient implementation of sign
propagation that does not use shifting instructions or
branching instructions. The sign-propagation device and
a given expression for mixed length adds and subtracts
are used in an experimental compiler currently being
developed for translating PL/I to microcode for a
variety of machines.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods); C6130 (Data
handling techniques)",
classification = "722; 723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "addition instructions; computer architecture ---
Microprogramming; computer metatheory; computer
programming; digital arithmetic; functions realisable;
two's complement; word parallel logical instructions",
oldlabel = "Warren77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Warren77",
}
@Article{Mamrak:1977:DRT,
author = "Sandra A. Mamrak",
title = "Dynamic Response Time Prediction for Computer
Networks",
journal = j-CACM,
volume = "20",
number = "7",
pages = "461--468",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:14 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Mamrak77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Five interactive systems currently available on the
ARPA network are compared. A system environment is
defined in which response time measurements can be
made, and statistical, simulation, and analytical tools
are used to describe and then predict the response time
behavior. The effect of network queueing delays is
discussed. Finally, a dynamic response time monitor for
ARPA network users is proposed based on the success of
the response time prediction methodologies and
models.",
acknowledgement = ack-nhfb,
classcodes = "C5620 (Computer networks and techniques)",
classification = "722; 723; 922",
corpsource = "Ohio State Univ., Columbus, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ARPA; computer networks; computer simulation; computer
systems, digital --- Fast Response Capability; dynamic
prediction; mathematical models; response time;
statistical methods; time-sharing systems",
oldlabel = "Mamrak77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mamrak77",
}
@Article{Ruschitzka:1977:UAS,
author = "Manfred Ruschitzka and Robert S. Fabry",
title = "A Unifying Approach to Scheduling",
journal = j-CACM,
volume = "20",
number = "7",
pages = "469--477",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:42 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#RuschitzkaF77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a scheme for classifying
scheduling algorithms based on an abstract model of a
scheduling system which formalizes the notion of
priority. Various classes of scheduling algorithms are
defined and related to existing algorithms. A criterion
for the implementation efficiency of an algorithm is
developed and results in the definition of
time-invariant algorithms, which include most of the
commonly implemented ones. For time-invariant
algorithms, the dependence of processing rates on
priorities is derived. The abstract model provides a
framework for implementing flexible schedulers in real
operating systems. The policy-driven scheduler of
Bernstein and Sharp is discussed as an example of such
an implementation.",
acknowledgement = ack-nhfb,
classcodes = "C5420 (Mainframes and minicomputers)",
classification = "723; 922",
corpsource = "Rutgers Univ., New Brunswick, NJ, USA",
country = "USA",
descriptors = "Scheduling; queueing discipline; priority; processor
sharing; process management",
enum = "2645",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; computer operating systems --- Scheduling;
computer programming --- Subroutines; computer systems
programming; implementation efficiency; operating
systems; priority; probability --- Queueing Theory;
processor sharing; scheduling; scheduling algorithms;
scheduling models; time-sharing systems; unifying
approach",
language = "English",
oldlabel = "RuschitzkaF77",
references = "0",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RuschitzkaF77",
}
@Article{Tajibnapis:1977:CPT,
author = "William D. Tajibnapis",
title = "A Correctness Proof of a Topology Information
Maintenance Protocol for a Distributed Computer
Network",
journal = j-CACM,
volume = "20",
number = "7",
pages = "477--485",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94A20",
MRnumber = "58 4703",
MRreviewer = "Fan R. K. Chung",
bibdate = "Mon Jan 22 07:25:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Tajibnapis77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "One of the major constraints on a topology information
scheme is that it may not involve a central controller.
The Topology Information Protocol that was implemented
on the MERIT Computer Network is presented and
explained; this protocol is quite general and could be
implemented on any computer network. It is based on
Baran's ``Hot Potato Heuristic Routing Doctrine.'' A
correctness proof of this Topology Information Protocol
is also presented.",
acknowledgement = ack-nhfb,
annote = "(VBI-001559)",
classcodes = "C5620 (Computer networks and techniques)",
classification = "722; 723",
country = "USA",
descriptors = "Protocol verification",
enum = "11285",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer networks; computer programming ---
Subroutines; computer systems, digital ---
Multiprocessing; computers --- Data Communication
Systems; correctness proof; distributed computer
network; protocol; protocols; topology information
maintenance",
language = "English",
oldlabel = "Tajibnapis77",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tajibnapis77",
}
@Article{Heckel:1977:TOC,
author = "Paul G. Heckel and Butler W. Lampson",
title = "A Terminal-Oriented Communication System",
journal = j-CACM,
volume = "20",
number = "7",
pages = "486--494",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#HeckelL77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes a system for full-duplex
communication between a time-shared computer and its
terminals. The system consists of a communications
computer directly connected to the time-shared system,
a number of small remote computers to which the
terminals are attached, and connecting medium speed
telephone lines. It can service a large number of
terminals of various types. The overall system design
is presented along with the algorithms used to solve
three specific problems: local echoing, error detection
and correction on the telephone lines, and multiplexing
of character output.",
acknowledgement = ack-nhfb,
classcodes = "B6210L (Computer communications); C5600 (Data
communication equipment and techniques)",
classification = "718; 722; 723",
corpsource = "Interactive Systems Consultants, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "character output; communication system; computer
networks; computer programming --- Subroutines;
computers --- Data Communication Systems; data
communication systems; detection and correction;
digital communication systems --- Computer Interfaces;
error; full duplex; local echoing; multiplexing; system
design; terminal oriented; time sharing; time-sharing
systems",
oldlabel = "HeckelL77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HeckelL77",
}
@Article{Schneider:1977:SIT,
author = "Ben Ross {Schneider, Jr.} and Reid M. Watts",
title = "{SITAR}: an Interactive Text Processing System for
Small Computers",
journal = j-CACM,
volume = "20",
number = "7",
pages = "495--499",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#SchneiderW77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "SITAR, a System for Interactive Text-editing,
Analysis, and Retrieval, is in many ways comparable to
interactive bibliographical search and retrieval
systems, but has several additional features. It is
implemented on a PDP\slash 11 time-sharing computer
invoked by a CRT with microprogrammed editing
functions. Extensive experience with SITAR shows that
the combined powers of simple commands, string
orientation, circular file structure, a CRT with local
memory, and conversational computing produce a system
much more powerful than the sum of its parts.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C7250 (Information
storage and retrieval)",
classification = "722; 723; 901",
corpsource = "Lawrence Univ., Appleton, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "circular file structure; computer systems, digital;
computers, miniature --- Applications; conversational
computing; CRT with local memory; data processing ---
Humanities Applications; information retrieval;
information retrieval systems; interactive text
processing system; orientation; simple commands; SITAR;
small computers; string; text analysis; text editing;
text handling",
oldlabel = "SchneiderW77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SchneiderW77",
}
@Article{Kessels:1977:AEQ,
author = "Joep L. W. Kessels",
title = "Alternative to Event Queues for Synchronization in
Monitors",
journal = j-CACM,
volume = "20",
number = "7",
pages = "500--503",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:34 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Kessels77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In the monitor concept, as proposed by Brinch Hansen
and Hoare, event queues are used for synchronization.
This paper describes another synchronizing primitive
which is nearly as expressive as the conditional wait,
but can be implemented more efficiently. An
implementation of this primitive in terms of P and V
operations is given together with a correctness proof.
Two examples are presented: the readers and writers
problem and the problem of information streams sharing
a finite buffer pool.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Philips Res. Labs., Eindhoven, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "alternative; computer operating systems ---
Scheduling; computer programming --- Subroutines;
computer systems programming; event queues; monitors;
operating systems (computers); synchronization",
oldlabel = "Kessels77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kessels77",
}
@Article{Denning:1977:CPS,
author = "Dorothy E. Denning and Peter J. Denning",
title = "Certification of Programs for Secure Information
Flow",
journal = j-CACM,
volume = "20",
number = "7",
pages = "504--513",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:26 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#DenningD77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An information flow policy specifies a set of security
classes for information, a flow relation defining
permissible flows among these classes, and a method of
binding each storage object to some class. This paper
presents a compile-time mechanism that certifies a
program only if it specifies no flows in violation of
the flow policy. Because it exploits the properties of
a lattice structure among security classes, the
procedure is sufficiently simple that it can easily be
included in the analysis phase of most existing
compilers. Appropriate semantics are presented and
proved correct. An important application is the
confinement problem. The mechanism can prove that a
program cannot cause supposedly nonconfidential results
to depend on confidential input data.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "Purdue Univ., West Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "certification mechanism; compilers; computer operating
systems --- Program Compilers; data processing; lattice
structure; program compilers; programs; secure
information flow; security of data",
oldlabel = "DenningD77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DenningD77",
}
@Article{Barth:1977:SGC,
author = "Jeffrey M. Barth",
title = "Shifting Garbage Collection Overhead to Compile Time",
journal = j-CACM,
volume = "20",
number = "7",
pages = "513--518",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Barth77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The paper assumes a transaction oriented collection
scheme, as proposed by Deutsch and Bobrow, the
necessary features of which are summarized.
Implementing the described optimization requires global
flow analysis to be performed on the source program. It
is shown that at compile time certain program actions
that affect the reference counts of cells can be
deduced. This information is used to find actions that
cancel when the code is executed and those that can be
grouped to achieve improved efficiency.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic storage; compile time; computer operating
systems; computer programming languages --- List
Processing; flow analysis; garbage collection overhead;
global; optimization; reclamation; storage management;
transaction oriented collection scheme",
oldlabel = "Barth77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Barth77",
}
@Article{Ashcroft:1977:LNL,
author = "Edward A. Ashcroft and William W. Wadge",
title = "{Lucid}, a Nonprocedural Language with Iteration",
journal = j-CACM,
volume = "20",
number = "7",
pages = "519--526",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:08 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Pfpbib.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#AshcroftW77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Lucid is a formal system in which programs can be
written and proofs of programs carried out. The proofs
are particularly easy to follow and straight-forward to
produce because the statements in a Lucid program are
simply axioms from which the proof proceeds by (almost)
conventional logic reasoning, with the help of a few
axioms and rules of inference for the special lucid
functions. As a programming language, Lucid is
unconventional because, among other things, the order
of statements is irrelevant and assignment statements
are equations. Nevertheless, Lucid programs need not
look much different than iterative programs in a
conventional structured programming language using
assignment and conditional statements and loops.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6140D (High level languages)",
classification = "723",
corpsource = "Univ. of Waterloo, Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer metatheory --- Algorithmic Languages;
computer programming --- Reliability; computer
programming languages; Dataflow; formal languages;
formal system; Formal Systems; iteration; Lucid; lucid;
nonprocedural language; proofs; Proving; Semantics;
structured programming",
oldlabel = "AshcroftW77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AshcroftW77",
}
@Article{Brownlee:1977:ABI,
author = "J. Nevil Brownlee",
title = "An {Algol-based} implementation of {SNOBOL} 4
patterns",
journal = j-CACM,
volume = "20",
number = "7",
pages = "527--529",
month = jul,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:32 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Brownlee77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "When a string appears as the subject of a SNOBOL4
statement, it may be scanned to see whether or not it
contains a specified pattern. However, since the
scanner is fundamentally an interpreter (using pattern
graphs as its input code), pattern matching appears to
be a time-consuming process. This paper describes an
alternative approach in which SNOBOL4 patterns are
compiled into Algol functions, which can be combined
into larger (more complicated) patterns, and which are
directly executed. It was developed as part of the
implementation of ``Snobal\slash 67'', a Burroughs
B6700 compiler for a SNOBAL4-like language.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Univ. of Auckland, Private Bag, Auckland, New
Zealand",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ALGOL; compiled; computer operating systems ---
Program Compilers; computer programming languages;
implementation; pattern recognition systems; patterns;
procedure oriented languages; SNOBOL 4",
oldlabel = "Brownlee77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brownlee77",
}
@Article{Horning:1977:SPA,
author = "James J. Horning",
title = "Selected Papers from the {ACM} Conference on Language
Design for Reliable Software --- Introduction",
journal = j-CACM,
volume = "20",
number = "8",
pages = "539--??",
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Horning77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Horning77",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Horning77",
}
@Article{Geschke:1977:EEM,
author = "Charles M. Geschke and James H. {Morris, Jr.} and
Edwin H. Satterthwaite",
title = "Early Experience with {Mesa}",
journal = j-CACM,
volume = "20",
number = "8",
pages = "540--553",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:54 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#GeschkeMS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The experiences of Mesa's first users --- primarily
its implementors --- are discussed, and some
implications for Mesa and similar programming languages
are suggested. The specific topics addressed are:
module structure and its use in defining abstractions,
data-structuring facilities in Mesa, an equivalence
algorithm for types and type coercions, the benefits of
the type system and why it is breached occasionally,
and the difficulty of making the treatment of variant
records safe.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150 (Systems
software)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstractions; computer programming languages; computer
systems programming; data processing --- Data
Structures; data structuring; defining; equivalence
algorithm; mesa; Mesa; module structure; olit-oopl
mesa; problem oriented languages; programming
languages; systems programming; type coercions; types",
oldlabel = "GeschkeMS77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GeschkeMS77",
}
@Article{Shaw:1977:AVA,
author = "Mary Shaw and William A. Wulf and Ralph L. London",
title = "Abstraction and Verification in {Alphard}: Defining
and Specifying Iteration and Generators",
journal = j-CACM,
volume = "20",
number = "8",
pages = "553--564",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:50 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/obscure.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#ShawWL77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The Alphard ``form'' provides the programmer with a
great deal of control over the implementation of
abstract data types. In this paper the abstraction
techniques are extended from simple data representation
and function definition to the iteration statement, the
most important point of interaction between data and
the control structure of the language itself. A means
of specializing Alphard's loops to operate on abstract
entities without explicit dependence on the
representation of those entities is in troduced.
\par
Specification and verification techniques that allow
the properties of the generators for such iterations to
be expressed in the form of proof rules are developed.
\par
Results are obtained that for common special cases of
these loops are essentially identical to the
corresponding constructs in other languages. A means of
showing that a generator will terminate is also
provided.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Dept. of Computer Sci., Carnegie-Mellon Univ.,
Schenley Park, Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data types; abstraction and representation;
Alphard; assertions; computer programming; computer
programming languages; control specialization;
correctness; defining; generators; invariants;
iteration; iteration statements; language; modular
decomposition; olit lang alphard data abstraction;
program specifications; programmer; programming
languages; programming methodology; proofs of
correctness; specifying; types; verification",
oldlabel = "ShawWL77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShawWL77",
}
@Article{Liskov:1977:AMC,
author = "Barbara Liskov and Alan Snyder and Russell R. Atkinson
and Craig Schaffert",
title = "Abstraction Mechanisms in {CLU}",
journal = j-CACM,
volume = "20",
number = "8",
pages = "564--576",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#LiskovSAS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: In ``Readings in Object-Oriented
Database Systems'' edited by S.Zdonik and D.Maier,
Morgan Kaufman, 1990.",
abstract = "CLU is a new programming language designed to support
the use of abstractions in program construction. Work
in programming methodology has led to the realization
that three kinds of abstractions --- procedural,
control, and especially data abstractions --- are
useful in the programming process. Of these, only the
procedural abstraction is supported well by
conventional languages, through the procedure or
subroutine. CLU provides, in addition to procedures,
novel linguistic mechanisms that support the use of
data and control abstractions. This paper provides an
introduction to the abstractions mechanisms in CLU.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Lab. for Computer Sci., MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstractions; CLU; computer programming; computer
programming languages; construction; linguistic
mechanisms; program; programming language; programming
languages",
oldlabel = "LiskovSAS77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LiskovSAS77",
}
@Article{Wirth:1977:TDR,
author = "Niklaus Wirth",
title = "Toward a Discipline of Real-Time Programming",
journal = j-CACM,
volume = "20",
number = "8",
pages = "577--583",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:26 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Discrete.event.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Wirth77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Programming is divided into three major categories
with increasing complexity of reasoning in program
validation: sequential programming, multiprogramming,
and real-time programming. By adhering to a strict
programming discipline and by using a suitable
high-level language molded after this discipline, the
complexity of reasoning about concurrency and execution
time constraints may be drastically reduced. This may
be the only practical way to make real-time systems
analytically verifiable and ultimately reliable. A
possible discipline is outlined and expressed in terms
of the language Modula.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150J
(Operating systems)",
classification = "722; 723",
corpsource = "ETH, Zurich, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; computer systems,
digital; concurrency; discipline; execution time;
Modula; multiprogramming; online operation; program
testing; programming; real time",
oldlabel = "Wirth77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wirth77",
}
@Article{Gannon:1977:EED,
author = "John D. Gannon",
title = "An Experimental Evaluation of Data Type Conventions",
journal = j-CACM,
volume = "20",
number = "8",
pages = "584--595",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:43:09 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Gannon77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper discusses an experiment that compares the
programming reliability of subjects using a statically
typed language and a ``typeless'' language. Analysis of
the number of errors and the number of runs containing
errors shows that, at least in one environment, the use
of a statically typed language can increase programming
reliability.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Dept. of Computer Sci., Univ. of Maryland, College
Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; data type conventions;
data types; evaluation; programming languages;
programming reliability",
oldlabel = "Gannon77",
treatment = "X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gannon77",
}
@Article{Franta:1977:EDS,
author = "William R. Franta and Kurt Maly",
title = "An Efficient Data Structure for the Simulation Event
Set",
journal = j-CACM,
volume = "20",
number = "8",
pages = "596--602",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:28 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/simulan.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#FrantaM77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new event scheduling algorithm is presented which
improves on two aspects of the best of the previously
published algorithms. First, the new algorithm's
performance is quite insensitive to skewed
distributions, and second, its worst-case complexity is
O(square root of n), where n is the number of events in
the set. Furthermore, tests conducted to estimate the
average complexity showed it to be nearly independent
of n.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 913",
corpsource = "Dept. of Computer Sci., Univ. of Minnesota,
Minneapolis, MN, USA",
descriptors = "Simulation; event sequencing; method",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer programming --- Subroutines; data
processing; data structure; data structures; digital
simulation; event scheduling; scheduling; simulation
event set",
oldlabel = "FrantaM77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FrantaM77",
}
@Article{Taulbee:1977:CPE,
author = "Orrin E. Taulbee and Samuel D. Conte",
title = "Corrigendum: Production and Employment of {Ph.D.}'s in
Computer Science --- 1976",
journal = j-CACM,
volume = "20",
number = "8",
pages = "602--??",
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:44 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#TaulbeeC77a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "TaulbeeC77a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TaulbeeC77a",
}
@Article{Lawler:1977:CCS,
author = "Eugene L. Lawler",
title = "Comment on computing the $k$ shortest paths in a
graph",
journal = j-CACM,
volume = "20",
number = "8",
pages = "603--604",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (90B10)",
MRnumber = "58 19354",
MRreviewer = "Colin J. H. McDiarmid",
bibdate = "Mon Jan 22 06:57:54 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Lawler77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics)",
corpsource = "Div. of Computer Sci., Univ. of California, Berkeley,
CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "$k$ shortest paths; algorithms; computing; graph;
graph theory",
oldlabel = "Lawler77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lawler77",
}
@Article{Francez:1977:AAK,
author = "Nissim Francez",
title = "Another advantage of keyword notation for parameter
communication with subprograms",
journal = j-CACM,
volume = "20",
number = "8",
pages = "604--605",
month = aug,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Francez77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Weizmann Inst. of Sci., Rehovoth, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "advantage; keyword notation; parameter communication;
structured programming; subprograms",
oldlabel = "Francez77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Francez77",
}
@Article{Rabin:1977:CC,
author = "Michael O. Rabin",
title = "Complexity of Computations",
journal = j-CACM,
volume = "20",
number = "9",
pages = "625--633",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "56 10141",
MRreviewer = "Claus-Peter Schnorr",
bibdate = "Mon Jan 22 07:14:19 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Rabin77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Rabin:1978:CCC}.",
abstract = "The framework for research in the theory of complexity
of computations is described, emphasizing the
interrelation between seemingly diverse problems and
methods. Illustrative examples of practical and
theoretical significance are given. Directions for new
research are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "721",
corpsource = "Dept. of Maths., Hebrew Univ. of Jerusalem, Jerusalem,
Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algebraic complexity; algorithmic cost functions;
algorithms; automata theory; complexity of
computations; computational complexity; intractable
problems; probabilistic",
oldlabel = "Rabin77",
treatment = "E Economic; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rabin77",
}
@Article{Scott:1977:LPL,
author = "Dana S. Scott",
title = "Logic and Programming Languages",
journal = j-CACM,
volume = "20",
number = "9",
pages = "634--641",
month = sep,
year = "1977",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359810.359826",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "56 10114",
MRreviewer = "Horst Reichel",
bibdate = "Mon Jan 22 07:20:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Scott77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Logic has been long interested in whether answers to
certain questions are computable in principle, since
the outcome puts bounds on the possibilities of
formalization. It would seem that the understanding of
higher-level program features involves one with
infinite objects and forces one to pass through several
levels of explanation to go from the conceptual ideas
to the final simulation on a real machine. These levels
can be made mathematically exact if the right
abstractions can be found to represent the necessary
structures. In this paper, the author outlines his
approach to these problems, specifically his lambda
-calculus orientation.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6140 (Programming languages)",
classification = "721; 723",
corpsource = "Math. Inst., Univ. of Oxford, Oxford, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory --- Computability and Decidability;
computability and decidability; computability theory;
computational linguistics; computer metatheory;
computer programming languages; decision methods;
formal logic; methods of logic; programming languages;
semantical; syntactic formalization; theory",
oldlabel = "Scott77",
remark = "This is the 1976 ACM Turing Award Lecture.",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Scott77",
}
@Article{Austing:1977:GAT,
author = "Richard H. Austing",
title = "The {GRE} Advanced Test in Computer Science",
journal = j-CACM,
volume = "20",
number = "9",
pages = "642--645",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Austing77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This report describes the Advanced Test in Computer
Science which was recently introduced in the Graduate
Record Examination Program. The GRE program is
described in general, and, the events leading to the
establishment of the Advanced Computer Science Test are
discussed. Content specifications and their rationale
are given. A set of sample questions is included.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
classification = "723; 901",
corpsource = "Dept. of Computer Sci., Univ. of Maryland, College
Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Advanced Test in Computer Science; computer
programming; computer science education; education;
Examination Program; Graduate Record; questions;
rationale; sample; specifications",
oldlabel = "Austing77",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Austing77",
}
@Article{Scheifler:1977:AIS,
author = "Robert W. Scheifler",
title = "An Analysis of Inline Substitution for a Structured
Programming Language",
journal = j-CACM,
volume = "20",
number = "9",
pages = "647--654",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/compiler.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Scheifler77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An optimization technique known as inline substitution
is analyzed. The optimization consists of replacing a
procedure invocation by a modified copy of the
procedure body. The general problem of using inline
substitution to minimize execution time subject to size
constraints is formulated, and an approximate
algorithmic solution is proposed. The algorithm depends
on run-time statistics about the program to be
optimized. Preliminary results for the CLU structured
programming language indicate that, in programs with a
low degree of recursion, over 90 percent of all
procedure calls can be eliminated, with little increase
in the size of compiled code and a small savings in
execution time.",
acknowledgement = ack-nhfb,
classcodes = "C6140 (Programming languages); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithmic solution; compiled code; computational
linguistics; computer operating systems; computer
programming --- Structured Programming; computer
programming languages; execution time; inline
substitution; languages; optimization technique;
procedure calls; program compilers; programming; run
time statistics; structured programming; structured
programming language",
oldlabel = "Scheifler77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Scheifler77",
}
@Article{Gifford:1977:HEP,
author = "David K. Gifford",
title = "Hardware Estimation of a Process' Primary Memory
Requirements",
journal = j-CACM,
volume = "20",
number = "9",
pages = "655--663",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:44:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Gifford77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A minor hardware extension to the Honeywell 6180
processor is demonstrated to allow the primary memory
requirements of a process in Multics to be
approximated. The additional hardware required for this
estimate to be computed consists of a program
accessible register containing the miss rate of the
associative memory used for page table words. This
primary memory requirement estimate was employed in an
experimental version of Multics to control the level of
multiprogramming in the system and to bill for memory
usage. The resulting system's tuning parameters display
configuration insensitivity, and it is conjectured that
the system would also track shifts in the referencing
characteristics of its workload and keep the system in
tune.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6150J (Operating
systems)",
classification = "722; 723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "associative memory; computer systems programming ---
Multiprogramming; configuration insensitivity;
content-addressable storage; data storage, digital;
hardware extension; memory usage; Multics;
multiprogramming; primary memory requirements; program
accessible register; referencing characteristics;
tuning; tuning parameters; virtual storage",
oldlabel = "Gifford77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gifford77",
xxtitle = "Hardware Estimation of Process' Primary Memory
Requirements",
}
@Article{Mairson:1977:SNU,
author = "Harry G. Mairson",
title = "Some New Upper Bounds on the Generation of Prime
Numbers",
journal = j-CACM,
volume = "20",
number = "9",
pages = "664--669",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (10A25 10-04)",
MRnumber = "56 4236",
MRreviewer = "G. Wechsung",
bibdate = "Mon Jan 22 07:01:03 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Mairson77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Given an integer N, what is the computational
complexity of finding all the primes less than N? A
modified sieve of Eratosthenes using doubly linked
lists yields an algorithm of O//A(N) arithmetic
complexity. This upper bound is shown to be equivalent
to the theoretical lower bound for sieve methods
without preprocessing. Use of preprocessing techniques
involving space-time and additive-multiplicative
tradeoffs reduces this upper bound to O//A(N/log logN)
and the bit complexity to O//B(N logN log log logN). A
storage requirement is described using O//B(N
logN\slash log logN) bits as well.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods)",
classification = "723; 921",
corpsource = "Calhoun College, Yale Univ., New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computational complexity; computer programming ---
Subroutines; generation of prime numbers; mathematical
techniques; methods; number theory; preprocessing
techniques; requirement; sieve; storage; upper bound",
oldlabel = "Mairson77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mairson77",
}
@Article{McCreight:1977:PBT,
author = "Edward M. McCreight",
title = "Pagination of {B*}-Trees with Variable-Length
Records",
journal = j-CACM,
volume = "20",
number = "9",
pages = "670--674",
month = sep,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:46 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#McCreight77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A strategy is presented for pagination of B*-trees
with variable-length records. If records of each length
are uniformly distributed within the file, and if a
wide distribution of record lengths exists within the
file, then this strategy results in shallow trees with
fast access times. The performance of this strategy in
an application is presented, compared with that of
another strategy, and analyzed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901; 921",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "B* tree; data base systems; data processing --- Data
Handling; data searching; fast access times; file; file
organisation; information retrieval systems;
mathematical techniques --- Trees; pagination; shallow
trees; strategy; trees (mathematics); variable length
records",
oldlabel = "McCreight77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McCreight77",
}
@Article{Fuchs:1977:OSR,
author = "H. Fuchs and Zvi M. Kedem and Samuel P. Uselton",
title = "Optimal Surface Reconstruction from Planar Contours",
journal = j-CACM,
volume = "20",
number = "10",
pages = "693--702",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A45",
MRnumber = "58 25163",
MRreviewer = "Giorgio Balconi",
bibdate = "Mon Jan 22 06:42:32 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.77.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#FuchsKU77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper presents a general solution to the problem
of constructing a surface over a set of cross-sectional
contours. This surface, to be composed of triangular
tiles, is constructed by separately determining an
optimal surface between each pair of consecutive
contours. Determining such a surface is reduced to the
problem of finding certain minimum cost cycles in a
directed toroidal graph. A new fast algorithm for
finding such cycles is utilized. Also developed is a
closed-form expression, in terms of the number of
contour points, for an upper bound on the number of
operations required to execute the algorithm. An
illustrated example which involves the construction of
a minimum area surface describing a human head is
included.",
acknowledgement = ack-nhfb,
annote = "Also in Computer Graphics (Special issue of SIGGRAPH
'77, preliminary papers), pp. 11--24.",
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "Univ. of Texas, Dallas, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer graphics; optimal; planar contours;
reconstruction of objects; surface reconstruction;
triangular tiles",
oldlabel = "FuchsKU77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FuchsKU77",
}
@Article{Wu:1977:ICG,
author = "Sheng-Chuan C. Wu and John F. Abel and Donald P.
Greenberg",
title = "An Interactive Computer Graphics Approach to Surface
Representation",
journal = j-CACM,
volume = "20",
number = "10",
pages = "703--712",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:54 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.77.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#WuAG77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An interactive computer graphics method has been
developed for the rapid generation of arbitrary shaped
three-dimensional surfaces. The method is a synthesis
of spline theory and algorithms, an interactive means
for man-machine communication, and software for static
or dynamic graphics display. The basic technique
employed is a modified lofting method in which
sectional curves are represented by uniform B-splines
and the surface is interpolated between sections by
Cardinal splines. Among the features of this method are
algorithms which enable interactive modification of the
B-spline representation of the sectional curves. At all
stages of the process, the spatial information is
graphically displayed to the user. Complex surfaces can
be created by the combination of a number of shapes
that have been separately generated and automatically
joined. The system has been successfully interfaced to
a variety of analytical routines for structural,
medical and graphical applications.",
acknowledgement = ack-nhfb,
annote = "Also in Computer Graphics (Special issue of SIGGRAPH
'77, preliminary papers), pp. 1--10. An interactive
computer graphics method has been developed for the
rapid generation of arbitrary shaped three-dimensional
surfaces. The method is a synthesis of spline theory
and algorithms, an interactive means for man-machine
communication, and software for static or dynamic
graphics display. The basic technique employed is a
modified lofting method in which sectional curves are
represented by uniform B-splines and the surface is
interpolated",
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "Cornell Univ., Ithaca, NY, USA",
descriptors = "Graphics; two-dimensional plot; three-dimensional
plot; method; process interaction; interpolation; human
factors; spline; finite element input method",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer graphics; interactive computer graphics;
representation; representation graphic; representation
surface geometry; splines; splines (mathematics);
surface representation",
oldlabel = "WuAG77",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WuAG77",
}
@Article{Rosen:1977:HLD,
author = "Barry K. Rosen",
title = "High-Level Data Flow Analysis",
journal = j-CACM,
volume = "20",
number = "10",
pages = "712--724",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:01 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Rosen77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In contrast to the predominant use of low-level in
termediate text, high-level data flow analysis deals
with programs essentially at source level and exploits
the control flow information implicit in the parse
tree. The need for high-level flow analysis arises from
several aspects of recent work on advanced methods of
program certification and optimization. \par
This paper proposes a simple general method of
high-level data flow analysis that allows free use of
escape and jump statements, avoids large graphs when
compiling large programs, facilitates updating of data
flow information to reflect program changes, and
derives new global information helpful in solving many
familiar global flow analysis problems. An illustrative
application to live variable analysis is presented.
\par
Many of the graphs involved are constructed and
analyzed before any programs are compiled, thus
avoiding certain costs that low-level methods incur
repeatedly at compile time.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Structural Programming;
computer programming languages; control flow graph;
data flow analysis; data processing --- Data Reduction
and Analysis; escape; escapes; exits; goto statements;
high; high-level language; jump; jumps; level;
programs; statements; structured programming",
oldlabel = "Rosen77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Rosen77",
}
@Article{Montangero:1977:TLC,
author = "Carlo Montangero and Giuliano Pacini and Franco
Turini",
title = "Two-Level Control Structure for Nondeterministic
Programming",
journal = j-CACM,
volume = "20",
number = "10",
pages = "725--730",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:37 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#CarloMontangeroPT77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The basic ideas of nondeterministic programming are
critically reconsidered to single out a proper attitude
and programming style for languages allowing direct
control of nondeterministic features. The proposed
attitude aims at retaining the purity of the
nondeterministic formulation of search processes on one
level (the attempt level), deferring the coordination
of problem solving efforts to another (the choice
level). The feasibility of recognizing these two levels
is discussed, stressing that the structure to be
managed at the choice level is a tree of contexts. The
leaves are computational environments, each holding an
alternative under inspection, while the other nodes are
associated with choice points. According to the
proposed programming style, a generative function is
associated with each choice point, which expresses the
desired choice strategy. The main advantage of this
approach is the localization of the search strategies:
Each nonterminal node of the tree keeps track of the
state of the computation as it was when the choice
point was last interrogated, holding at the same time
the strategy to coordinate the available alternatives.
Examples are given in term of ND-Lisp, an extension of
Lisp designed and implemented according to these
guidelines.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Univ. of Pisa, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; control structure;
languages; nondeterministic programming; programming
theory; two level",
oldlabel = "CarloMontangeroPT77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CarloMontangeroPT77",
}
@Article{LaLonde:1977:RRP,
author = "Wilf R. LaLonde",
title = "Regular Right Part Grammars and Their Parsers",
journal = j-CACM,
volume = "20",
number = "10",
pages = "731--741",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A30",
MRnumber = "58 13974",
bibdate = "Mon Jan 22 06:56:53 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#LaLonde77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Regular right part (RRP) grammars, which resemble
PASCAL syntax diagrams, describe the syntax of
programming languages more concisely and more
understandably than is possible with CF grammars. Also
introduced is a class of parsers, RRP LR(m, k) parsers,
which includes the CF LR(k) parsers and provides the
same advantages. Informally, an RRP LR(m, k) parser can
determine the right end of each handle by considering
at most k symbols to the right of the handle and the
left end, after the right end has been found, by
considering at most m symbols to the left of the
handle. A mechanism for determining the left end is
required because there is no bound on the length of the
handle.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4220 (Automata theory)",
classification = "721; 723",
corpsource = "Carleton Univ., Ottawa, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automata theory; computer programming languages;
finite automata; finite state machines; grammars;
parsers; regular right part; regular right part
grammar; RRP grammars",
oldlabel = "LaLonde77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LaLonde77",
}
@Article{Devillers:1977:GID,
author = "Raymond R. Devillers",
title = "Game Interpretation of the Deadlock Avoidance
Problem",
journal = j-CACM,
volume = "20",
number = "10",
pages = "741--745",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:50 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Devillers77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The deadlock avoidance problem may be defined
informally as the determination, from some a priori
information about the processes, resources, operating
system, etc., of the ``safe situations'' which may be
realized without endangering the smooth running of the
system. When each process specifies its future needs by
a flowchart of need-defined steps, a global approach to
the phenomenon and its interpretation as a game between
the operating system and the processes allows
formalization of risk and safety concepts. The
bipartite graph representation of this game may then be
used to construct explicitly the set of safe states and
to study their properties.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150J
(Operating systems)",
classification = "723; 922",
corpsource = "Free Univ. of Brussels, Brussels, Belgium",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; deadlock avoidance;
multiprogramming; operating system; probability ---
Game Theory; processes; resources",
oldlabel = "Devillers77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Devillers77",
}
@Article{Ivie:1977:PWM,
author = "Evan L. Ivie",
title = "Programmer's Workbench --- a Machine for Software
Development",
journal = j-CACM,
volume = "20",
number = "10",
pages = "746--753",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:52:15 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Ivie77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In this paper it is suggested that there are many
situations where it would be advantageous to separate
the program development and maintenance function onto a
specialized computer which is dedicated to that
purpose. Such a computer is here called a Programmer's
Workbench. The four basic sections of the paper
introduce the subject, outline the general concept,
discuss areas where such an approach may prove
beneficial, and described and operational system
utilizing this concept.",
acknowledgement = ack-nhfb,
classcodes = "C5420 (Mainframes and minicomputers); C6110 (Systems
analysis and programming)",
classification = "723",
corpsource = "Bell Telephone Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer programming;
dedicated; maintenance; Programmer's Workbench;
programming; software development; special purpose
computers; specialized computer",
oldlabel = "Ivie77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ivie77",
}
@Article{Smith:1977:MMO,
author = "Alan Jay Smith",
title = "Multiprocessor Memory Organization and Memory
Interference",
journal = j-CACM,
volume = "20",
number = "10",
pages = "754--761",
month = oct,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:41 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Smith77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The structure of shared memory in a multiprocessor
computer system is examined with particular attention
to noninterleaved memory. Alternative memory
organizations are compared and it is shown that a home
memory organization, in which each processor is
associated with one or more memories in which its
address space concentrated, is quite effective in
reducing memory interference. Home memory organization
is shown to be particularly suited to certain
specialized computational problems as well as to
possess advantages in terms of interference and
reliability for general purpose computation. Results
for interleaved memory are drawn from previous work and
are used for comparison. Trace-driven simulations are
used to verify the conclusions of the analysis.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture)",
classification = "723",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer system; computer systems programming; file
organisation; memory interference; memory organization;
multiprocessing systems; multiprocessor; noninterleaved
memory; shared memory",
oldlabel = "Smith77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Smith77",
}
@Article{Schneider:1977:CSI,
author = "Ben Ross {Schneider, Jr.} and Reid M. Watts",
title = "Corrigendum: {SITAR}: An Interactive Text Processing
System for Small Computers",
journal = j-CACM,
volume = "20",
number = "10",
pages = "761--??",
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:37 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#SchneiderW77a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "SchneiderW77a",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SchneiderW77a",
}
@Article{Boyer:1977:FSS,
author = "Robert S. Boyer and J. Strother Moore",
title = "A Fast String Searching Algorithm",
journal = j-CACM,
volume = "20",
number = "10",
pages = "762--772",
month = oct,
year = "1977",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359842.359859",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:49 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BoyerM77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1990.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "See also
\cite{Knuth:1977:FPM,Sunday:1990:VFS,Baeza-Yates:1992:NAT}.",
abstract = "An algorithm is presented that searches for the
location, ``i,'' of the first occurrence of a character
string, ``pat,'' in another string, ``string.'' During
the search operation, the characters of pat are matched
starting with the last character of pat. The
information gained by starting the match at the end of
the pattern often allows the algorithm to proceed in
large jumps through the text being searched. Thus the
algorithm has the unusual property that, in most cases,
not all of the first i characters of string are
inspected. The number of characters actually inspected
(on the average) decreases as a function of the length
of pat. For a random English pattern of length 5, the
algorithm will typically inspect i/4 characters of
string before finding a match at i. Furthermore, the
algorithm has been implemented so that (on the average)
fewer than i plus patlen machine instructions are
executed. These conclusions are supported with
empirical evidence and a theoretical analysis of the
average behavior of the algorithm. The worst case
behavior of the algorithm is linear in i plus patlen,
assuming the availability of array space for tables
linear in patlen plus the size of the alphabet.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6130 (Data
handling techniques)",
classification = "723; 901",
comment = "The Boyer--Moore string matching algorithm is, in the
worst case, linear in the length of the text + length
of the pattern. The average case behavior is sublinear.
Practical efficient implementations of this algorithm
exist. By starting the comparisons at the right of the
pattern instead of the left of the pattern, large jumps
can be made in the text.",
corpsource = "Stanford Res. Inst., Stanford, CA, USA",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; Boyer--Moore; character string; computer
operating systems; computer programming; fast;
information science --- Information Retrieval; list
processing; pattern matching; string matching; string
searching; text; text editing",
oldlabel = "BoyerM77",
received = "June 1975",
revised = "April 1976",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BoyerM77",
}
@Article{Lee:1977:CFP,
author = "John A. N. Lee",
title = "Considerations for future programming language
standards activities",
journal = j-CACM,
volume = "20",
number = "11",
pages = "788--794",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Lee77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
corpsource = "Dept. of Computer Sci., Virginia Polytech. Inst. and
State Univ., Blacksburg, VA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "BASIC; COBOL; documentation; error conditions;
FORTRAN; future; PL/I; procedure oriented languages;
programming language; standards",
oldlabel = "Lee77",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lee77",
}
@Article{Turner:1977:ULS,
author = "Rollins Turner and William D. Strecker",
title = "Use of the {LRU} Stack Depth Distribution for
Simulation of Paging Behavior",
journal = j-CACM,
volume = "20",
number = "11",
pages = "795--798",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#TurnerS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Two families of probability distributions are needed
for use by a virtual memory simulation model: headway
between page fault distributions, and working set size
distributions. All members of both families can be
derived from the LRU stack depth distribution. Simple
expressions for the computation of both kinds of
distributions are given. Finally, examples are given of
both families of distributions as computed from a
published stack depth distribution.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; fault distributions;
least; LRU; memory hierarchy; paging; Performance
Evaluation: Experimental; probability; recently used;
simulation; stack depth distribution; virtual memory;
virtual storage",
oldlabel = "TurnerS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TurnerS77",
}
@Article{Crow:1977:APC,
author = "Franklin C. Crow",
title = "The Aliasing Problem in Computer-Generated Shaded
Images",
journal = j-CACM,
volume = "20",
number = "11",
pages = "799--805",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:06 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Crow77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Certain defects, such as jagged edges and disappearing
detail, have long been an annoyance in digitally
generated shaded images. Although increasing the
resolution or defocusing the display can attenuate
them, an understanding of these defects leads to more
effective methods. This paper explains the observed
defects in terms of the aliasing phenomenon inherent in
sampled signals and discusses prefiltering as a
recognized cure. A method for evaluating filters is
presented, the application of prefiltering to
hidden-surface algorithms is discussed, and an
implementation of a filtering tiler is shown
accompanied by examples of its effectiveness.",
acknowledgement = ack-nhfb,
annote = "Certain defects, such as jagged edges and disappearing
detail, have long been an annoyance in digitally
generated shaded images. Although increasing the
resolution or defocusing the display can attenuate
them, an understanding of these defects leads to more
effective methods. This paper explains the observed
defects in terms of the aliasing phenomenon inherent in
sampled signals and discusses prefiltering as a
recognized cure \ldots.",
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "Univ. of Texas, Austin, TX, USA",
descriptors = "Method; graphics; three-dimensional plot; display;
filter theory; sampling; aliasing; convolutional
filtering; hidden line algorithm",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "aliasing; antialiasing; CACM; computer graphics;
defects; filtering tiler; prefiltering; sampled
signals; shaded images",
oldlabel = "Crow77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Crow77",
}
@Article{Lamport:1977:CRW,
author = "Leslie Lamport",
title = "Concurrent Reading and Writing",
journal = j-CACM,
volume = "20",
number = "11",
pages = "806--811",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "57 4572",
MRreviewer = "Richard A. DeMillo",
bibdate = "Mon Jan 22 06:57:16 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Lamport77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem of sharing data among asynchronous
processes is considered. It is assumed that only one
process at a time can modify the data, but concurrent
reading and writing is permitted. Two general theorems
are proved, and some algorithms are presented to
illustrate their use. These include a solution to the
general problem in which a read is repeated if it might
have obtained an incorrect result, and two techniques
for transmitting messages between processes. These
solutions do not assume any synchronizing mechanism
other than data which can be written by one process and
read by other processes.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Massachusetts Computer Associates, Wakefield, MA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; asynchronous processes; computer systems
programming; concurrent; multiprocessing programs;
reading; sharing data; theorems; writing",
oldlabel = "Lamport77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport77",
}
@Article{Shore:1977:ABF,
author = "John E. Shore",
title = "Anomalous Behavior of the Fifty-Percent Rule in
Dynamic Memory Allocation",
journal = j-CACM,
volume = "20",
number = "11",
pages = "812--820",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:24 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Shore77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Simulation data are reported showing that, in dynamic
memory allocation, the average free-to-allocated-block
ratio can differ considerably and in both directions
from the predictions of the 50 percent rule. A new
derivation is given, and it is shown that previous
derivations make an assumption that may be violated
frequently. On the basis of the simulation data and the
derivation, it is hypothesized that the anomalous
behavior results from the combined effects of
systematic placement and the statistics of the release
process. Additional simulations support this
hypothesis. Systematic placement, which refers to the
natural convention of always allocating storage
requests against the same end of the free block
selected by the allocation strategy, tends to order
blocks within contiguous groups, according to their
allocation time. The degree of anomalous behavior
depends on the extent to which allocated blocks are
released in the order of their allocation. For
non-Markovian release processes, the extent of the
correlation between allocation order and release order
varies approximately inversely with the coefficient of
variation of the memory residence time distribution.
The simulations show that allocation efficiency depends
strongly on the residence time distribution; efficiency
decreases as the distribution's coefficient of
variation increases. Some practical implications are
briefly discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Naval Res. Lab., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "50 percent rule; anomalous behaviour; computer
operating systems; dynamic memory allocation; release
process; simulation; storage allocation; systematic
placement",
oldlabel = "Shore77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shore77",
xxtitle = "Anomalous Behaviour of the Fifty-Percent Rule in
Dynamic Memory Allocation",
}
@Article{Stockman:1977:EHC,
author = "G. C. Stockman and Ashok K. Agrawala",
title = "Equivalence of {Hough} curve detection to template
matching",
journal = j-CACM,
volume = "20",
number = "11",
pages = "820--822",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#StockmanA77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
corpsource = "LNK Corp., Silver Spring, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Hough; Hough curve detection; pattern recognition;
template matching; transformation",
oldlabel = "StockmanA77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/StockmanA77",
}
@Article{Wirth:1977:WCW,
author = "Niklaus Wirth",
title = "What can we do about the unnecessary diversity of
notation for syntactic definitions?",
journal = j-CACM,
volume = "20",
number = "11",
pages = "822--823",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:27 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Wirth77a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4240 (Programming and algorithm
theory); C6140D (High level languages)",
corpsource = "Federal Inst. of Technol., ETH, Zurich, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "notation; programming languages; syntactic
definitions",
oldlabel = "Wirth77a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wirth77a",
}
@Article{Roy:1977:NRP,
author = "M. K. Roy",
title = "A note on reflection-free permutation enumeration",
journal = j-CACM,
volume = "20",
number = "11",
pages = "823--823",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Mar 25 13:26:09 MST 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Jadavpur Univ., Calcutta, India",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "enumeration; permutation; programming; reflection
free",
treatment = "P Practical; T Theoretical or Mathematical",
}
@Article{Roy:1977:NRF,
author = "Mohit Kumar Roy",
title = "A Note On Refection-Free Permutation Enumeration",
journal = j-CACM,
volume = "20",
number = "11",
pages = "823--??",
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Roy77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Roy77",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Roy77",
}
@Article{Manna:1977:OAR,
author = "Zohar Manna and Adi Shamir",
title = "The Optimal Approach to Recursive Programs",
journal = j-CACM,
volume = "20",
number = "11",
pages = "824--831",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "56 13748",
MRreviewer = "Giorgio Levi",
bibdate = "Mon Jan 22 07:01:28 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#MannaS77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory) 1 Years All
Years in which items were published. 2 Type All
Publication types. 3 Language All Find only items
published in this language. In any year A hyphen or ALL
- In a certain year The four-digit year 1923 In or
after a certain year The year and a hyphen 1960- In or
before a certain year A hyphen and a year -1955 In or
between two years Both years and a hyphen 1960-1975 1
Years 1970-1979 Years in which items were published. 2
Type All Publication types. 3 Language All Find only
items published in this language.",
corpsource = "Weizmann Inst. of Sci., Rehovoth, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "optimal approach; optimal fixedpoints; programming
theory; recursive programs",
oldlabel = "MannaS77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MannaS77",
}
@Article{Hammer:1977:VHL,
author = "Michael Hammer and W. Gerry Howe and Vincent J.
Kruskal and Irving Wladawsky",
title = "Very High Level Programming Language for Data
Processing Applications",
journal = j-CACM,
volume = "20",
number = "11",
pages = "832--840",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:11 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#HammerHKW77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The structure of a very high level language designed
for use in business data processing applications is
described. The language, Business Definition Language
(BDL), has been subjected to a number of validation
studies where it was used to code parts of existing
systems. An implementation is currently under way, as
is a modeling and customization effort using BDL as the
underlying system language. This latter system will be
used to tailor predesigned application systems to an
individual's needs by means of his responses to a
questionnaire.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C7100 (Business and
administration)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative data processing; BDL; business;
business definition; business forms; calculations;
computer programming languages; data processing,
business; language; organization; problem oriented
languages; sublanguages; very high level programming
language",
oldlabel = "HammerHKW77",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HammerHKW77",
}
@Article{Sprugnoli:1977:PHF,
author = "Renzo Sprugnoli",
title = "Perfect Hashing Functions: {A} Single Probe Retrieving
Method for Static Sets",
journal = j-CACM,
volume = "20",
number = "11",
pages = "841--850",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "56 17255",
MRreviewer = "Eberhard Ludde",
bibdate = "Mon Jan 22 07:23:44 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/ProbAlgs.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Sprugnoli77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "This is the first discussion on perfect hashing;
describes heuristics for constructing perfect hash
functions. See comments in \cite{Anderson:1979:CPH}.",
abstract = "A refinement of hashing which allows retrieval of an
item in a static table with a single probe is
considered. Given a set I of identifiers, two methods
are presented for building, in a mechanical way,
perfect hashing functions, i.e. functions transforming
the elements of I into unique addresses. The first
method, the ``quotient reduction'' method, is shown to
be complete in the sense that for every set I the
smallest table in which the elements of I can be stored
and from which they can be retrieved by using a perfect
hashing function constructed by this method can be
found. However, for nonuniformly distributed sets, this
method can give rather sparse tables. The second
method, the ``remainder reduction'' method, is not
complete in the above sense, but it seems to give
minimal (or almost minimal) tables for every kind of
set. The two techniques are applicable directly to
small sets. Some methods to extend these results to
larger sets are also presented. A rough comparison with
ordinary hashing is given which shows that this method
can be used conveniently in several practical
applications.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Istituto di Elaborazione della Informazione, CNR,
Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; file organisation; functions;
perfect hashing; retrieving; single probe; static
sets",
oldlabel = "Sprugnoli77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sprugnoli77",
}
@Article{Cocke:1977:ARO,
author = "John Cocke and Ken Kennedy",
title = "An Algorithm for Reduction of Operator Strength",
journal = j-CACM,
volume = "20",
number = "11",
pages = "850--856",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:52 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#CockeK77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple algorithm which uses an indexed temporary
table to perform reduction of operator strength in
strongly connected regions is presented. Several
extensions, including linear function test replacement,
are discussed. These algorithms should fit well into an
integrated package of local optimization algorithms.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer programming; indexed temporary;
linear function test; local optimization; operator
strength; program compilers; reduction; replacement;
strongly connected regions; table",
oldlabel = "CockeK77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CockeK77",
}
@Article{Bird:1977:IPI,
author = "Richard S. Bird",
title = "Improving Programs by the Introduction of Recursion",
journal = j-CACM,
volume = "20",
number = "11",
pages = "856--863",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "56 17179",
MRreviewer = "V. Cazanescu",
bibdate = "Mon Jan 22 06:26:29 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Bird77a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new technique of program transformation, called
``recursion introduction,'' is described and applied to
two algorithms which solve pattern matching problems.
By using a recursion introduction, algorithms which
manipulate a stack are first translated into recursive
algorithms in which no stack operations occur. These
algorithms are then subjected to a second
transformation, a method of recursion elimination
called ``tabulation,'' to produce programs with a very
efficient running time. In particular, it is shown how
the fast linear pattern matching algorithm of Knuth,
Morris, and Pratt can be derived in a few steps from a
simple nonlinear stack algorithm.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Univ. of Reading, Reading, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; functional program
transformation optimization recursion elimination
pattern matching computational induction; program
transformation; programming theory; recursion
introduction; stack",
oldlabel = "Bird77a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Bird77a",
}
@Article{Nielsen:1977:DMA,
author = "Norman R. Nielsen",
title = "Dynamic Memory Allocation in Computer Simulation",
journal = j-CACM,
volume = "20",
number = "11",
pages = "864--873",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:09:25 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Nielsen77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Investigation is made of the performance of 35 dynamic
memory allocation algorithms when used to service
simulation programs as represented by 18 test cases.
Algorithm performance was measured in terms of
processing time, memory usage, and external memory
fragmentation. Algorithms maintaining separate free
space lists for each size of memory block used tended
to perform quite well compared with other algorithms.
Simple algorithms operating on memory ordered lists
(without any free list) performed surprisingly well.
Algorithms employing power-of-two block sizes had
favorable processing requirements but generally
unfavorable memory usage. Algorithms employing LIFO,
FIFO, or memory ordered free lists generally performed
poorly compared with others.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Stanford Res. Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; computer operating systems --- Storage
Allocation; computer simulation; digital simulation;
dynamic memory allocation; external memory;
fragmentation; memory usage; performance; processing
time; storage allocation",
oldlabel = "Nielsen77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nielsen77",
}
@Article{Blasgen:1977:EMM,
author = "Michael W. Blasgen and Richard G. Casey and Kapali P.
Eswaran",
title = "An Encoding Method for Multifield Sorting and
Indexing",
journal = j-CACM,
volume = "20",
number = "11",
pages = "874--878",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:26:47 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#BlasgenCE77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: IBM, Res.R., RJ 1753, IBM San
Jose, Res.Lab, Mar.1976.",
abstract = "The efficient retrieval from a database of records
that satisfy an expression involving more than one data
field is examined. Sequences of character strings with
an order relation imposed between sequences are
considered. An encoding scheme is described which
produces a single, order-preserving string from a
sequence of strings. The original sequence can be
recovered from the encoded string, and one sequence of
strings precedes another if and only if the encoding of
the first precedes the encoding of the second. The
strings may be variable length, without a maximum
length restriction, and no symbols need be reserved for
control purposes. Hence any symbol may occur in any
string. The scheme is useful for multifield sorting,
multifield indexing, and other applications where
ordering on more than one field is important.",
acknowledgement = ack-nhfb,
annote = "Coding for SYSTEM R multi-field indexes.",
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "IBM Res. Lab., San Jose, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "character; codes, symbolic; encoding method; indexing;
information science --- Information Retrieval;
multifield sorting; order relation; sorting; strings",
oldlabel = "BlasgenCE77",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BlasgenCE77",
}
@Article{Grapa:1977:STA,
author = "Enrique Grapa and Geneva G. Belford",
title = "Some Theorems to Aid in Solving the File Allocation
Problem",
journal = j-CACM,
volume = "20",
number = "11",
pages = "878--882",
month = nov,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "57 4705",
MRreviewer = "Witold Lipski",
bibdate = "Mon Jan 22 06:46:04 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#GrapaB77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C5620 (Computer networks and
techniques); C6120 (File organisation)",
corpsource = "Univ. of Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer networks; copies; DP management; file
allocation problem; network sites; storage allocation;
theorems",
oldlabel = "GrapaB77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GrapaB77",
}
@Article{Lopez:1977:SCS,
author = "A. A. Lopez and Robert Raymond and Robert Tardiff",
title = "A survey of computer science offerings in small
liberal arts colleges",
journal = j-CACM,
volume = "20",
number = "12",
pages = "902--906",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#LopezRT77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Univ. of Minnosota, Morris, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; computer science education;
curricular; development; programming courses; small
liberal arts colleges",
oldlabel = "LopezRT77",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LopezRT77",
}
@Article{Kessels:1977:CFN,
author = "Joep L. W. Kessels",
title = "A Conceptual Framework for a Nonprocedural Programming
Language",
journal = j-CACM,
volume = "20",
number = "12",
pages = "906--913",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:54:35 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Kessels77a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A sequential programming language forces the
programmer to prescribe explicitly the order in which
the operations in his program have to be executed, even
if the order is not relevant to the solution of his
problem. The requirement to indicate irrelevant
sequencing can be removed if the language provides
facilities for specifying a task in a nonprocedural
manner. In general, a program specified in this way
will allow concurrent evaluation. A conceptual
framework for a high level programming language is
described providing both nonprocedural and sequential
facilities. Within a program, nonprocedural and
sequential program modules may be nested freely.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6140D (High
level languages)",
classification = "723",
corpsource = "Philips Res. Labs., Eindhoven, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; conceptual framework;
concurrent; nonprocedural programming language;
parallel; programming languages; sequential",
oldlabel = "Kessels77a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kessels77a",
}
@Article{Carter:1977:CSN,
author = "J. Lawrence Carter",
title = "A Case Study of a New Code Generation Technique for
Compilers",
journal = j-CACM,
volume = "20",
number = "12",
pages = "914--920",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:55 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/compiler.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Carter77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Recent developments in optimizing techniques have
allowed a new design for compilers to emerge. Such a
compiler translates the parsed source code into lower
level code by a sequence of steps. Each step expands
higher level statements into blocks of lower level code
and then performs optimizations on the result. Evidence
is provided that this strategy can indeed result in
good object code. The traditionally difficult PL/I
concatenate statement was investigated as a detailed
example.",
acknowledgement = ack-nhfb,
annote = "Describes a unified system which can handle both
interpretation and compilation.",
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "case study; code generation technique; codes,
symbolic; compilers; computer operating systems;
program compilers",
oldlabel = "Carter77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Carter77",
}
@Article{Gries:1977:EPP,
author = "David Gries",
title = "An Exercise in Proving Parallel Programs Correct",
journal = j-CACM,
volume = "20",
number = "12",
pages = "921--930",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "58 3615",
MRreviewer = "Andrzej Blikle",
bibdate = "Mon Jan 22 06:46:31 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Gries77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Gries:1978:CEP}.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "correct; garbage collector; parallel processing;
parallel programs; programming theory; proving; storage
management",
oldlabel = "Gries77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Gries77",
}
@Article{Greif:1977:LFP,
author = "Irene Greif",
title = "A Language for Formal Problem Specification",
journal = j-CACM,
volume = "20",
number = "12",
pages = "931--935",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:46:24 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#Greif77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A language for specifying the intended behavior of
communicating parallel processes is described. The
specifications are constraints on the order in which
events of a computation can occur. The language is used
to write specifications of the readers\slash writers
problem and the writer priority of the second
readers\slash writers problem.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4240 (Programming and algorithm
theory)",
classification = "723",
corpsource = "Univ. of Washington, Seattle, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "communicating; computer programming languages;
constraints; formal languages; formal problem
specification; language; parallel processes; parallel
processing; readers/writers problem; writer priority",
oldlabel = "Greif77",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Greif77",
}
@Article{Abrams:1977:MIC,
author = "Marshall D. Abrams and Siegfried Treu",
title = "A Methodology for Interactive Computer Service
Measurement",
journal = j-CACM,
volume = "20",
number = "12",
pages = "936--944",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:20:21 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1977.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#AbramsT77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A measurement methodology applicable to in teractive
computer service is described. Its primary purpose is
to enable external, user-oriented assessment of
computer performance, instead of the more frequently
used in ternal system measurement techniques. \par
The NBS Network Measurement System is employed as the
external measurement tool. Example data have been
collected and analyzed. A demonstration of the
methodology, leading to a pragmatic figure-of-merit
evaluation of results, is included.",
acknowledgement = ack-nhfb,
annote = "A measurement methodology applicable to interactive
computer service is described. Its primary purpose is
to enable external, user-oriented assessment of
computer performance, instead of the more frequently
used internal system measurement techniques. The NBS
Network Measurement System is employed as the external
measurement tool. Example data have been collected and
analyzed. A demonstration of the methodology, leading
to a pragmatic figure-of\ldots.",
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems)",
classification = "722; 723",
corpsource = "Nat. Bur. of Stand., Washington, DC, USA",
country = "USA",
descriptors = "Man-machine interaction; performance measure;
measurement; method; survey",
enum = "5",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer selection and evaluation; computer service;
computer systems, digital; external; external
measurement; figure-of-merit.; in teractive system;
interactive; interactive computer systems; measurement;
measurement model; measures; methodology; network
measurement system; performance",
language = "English",
oldlabel = "AbramsT77",
references = "24",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AbramsT77",
}
@Article{Danziger:1977:CIA,
author = "James N. Danziger and William H. Dutton",
title = "Computers as an innovation in {American} local
governments",
journal = j-CACM,
volume = "20",
number = "12",
pages = "945--956",
month = dec,
year = "1977",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:34 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm20.html#DanzigerD77;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7130 (Public administration)",
corpsource = "Univ. of California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "American local governments; applications; computer
technology; EDP; financial support; government data
processing; innovation; social aspects of automation",
oldlabel = "DanzigerD77",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DanzigerD77",
}
@Article{Bell:1978:FSI,
author = "Gordon Bell and Samuel H. Fuller and Daniel P.
Siewiorek",
title = "Forword to the Special Issue on Computer
Architecture",
journal = j-CACM,
volume = "21",
number = "1",
pages = "3--??",
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:31 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#BellFS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "BellFS78",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BellFS78",
}
@Article{Lavington:1978:MMA,
author = "Simon H. Lavington",
title = "The {Manchester Mark I} and {Atlas}: a historical
perspective",
journal = j-CACM,
volume = "21",
number = "1",
pages = "4--12",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lavington78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6150J (Operating
systems)",
corpsource = "Univ. of Manchester, Manchester, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(computers); address generation; computer
architecture; computer software; operating systems;
store management",
oldlabel = "Lavington78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lavington78",
}
@Article{Ibbett:1978:DMC,
author = "R. N. Ibbett and P. C. Capon",
title = "The Development of the {MU5} Computer System",
journal = j-CACM,
volume = "21",
number = "1",
pages = "13--24",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#IbbettC78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Following a brief outline of the background of the MU5
project, the aims and ideas for MU5 are discussed. A
description is then given of the instruction set, which
includes a number of features conducive to the
production of efficient compiled code from high-level
language source programs. The design of the processor
is then traced from the initial ideas for an
associatively addressed ``name store'' to the final
multistage pipeline structure involving a prediction
mechanism for instruction prefetching and a function
queue for array element accessing. An overall view of
the complete MU5 complex is presented together with a
brief indication of its performance.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C5420 (Mainframes and
minicomputers); C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Univ. of Manchester, Manchester, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "architecture; code; computer; computer architecture;
computer systems, digital; function queue; instruction
prefetching; instruction set; MU5; name store;
operating systems (computers); pipeline processing;
pipeline structure",
oldlabel = "IbbettC78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/IbbettC78",
}
@Article{Borgerson:1978:ESU,
author = "B. R. Borgerson and M. L. Hanson and P. A. Hartley",
title = "Evolution of the {Sperry Univac 1100 Series}: a
History, Analysis, and Projection",
journal = j-CACM,
volume = "21",
number = "1",
pages = "25--43",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:29 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#BorgersonHH78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The 1100 series systems are Sperry Univac's
large-scale mainframe computer systems. Beginning with
the 1107 in 1962, the 1100 series has progressed
through a succession of eight compatible computer
models to the latest system, the 1100\slash 80,
introduced in 1977. The 1100 series hardware
architecture is based on a 36-bit word, ones complement
structure which obtains one operand from storage and
one from a high-speed register, or two operands from
high-speed registers. The 1100 Operating System is
designed to support a symmetrical multiprocessor
configuration simultaneously providing multiprogrammed
batch, timesharing, and transaction environments.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C5420 (Mainframes and
minicomputers); C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Sperry Univac, Blue Bell, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer architecture; computer systems, digital;
hardware architecture; multiprocessing systems;
operating; Sperry Univac 1100 series; symmetrical
multiprocessor configuration; systems (computers)",
oldlabel = "BorgersonHH78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BorgersonHH78",
}
@Article{Bell:1978:ED,
author = "C. Gordon Bell and A. Kotok and Thomas N. Hastings and
R. Hill",
title = "The Evolution of the {DECsystem 10}",
journal = j-CACM,
volume = "21",
number = "1",
pages = "44--63",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:24:33 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#BellKHH78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The DECsystem 10, also known as the PDP-10, evolved
from the PDP-6 (circa 1963) over five generations of
implementations to presently include systems covering a
price range of five to one. The origin and evolution of
the hardware, operating system, and languages are
described in terms of technological change, user
requirements, and user developments. The PDP-10's
contributions to computing technology include:
accelerating the transition from batch oriented to time
sharing computing systems; transferring hardware
technology within DEC (and elsewhere) to minicomputer
design and manufacturing; supporting minicomputer
hardware and software development; and serving as a
model for single user and timeshared interactive
minicomputer\slash microcomputer systems.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C5420 (Mainframes and
minicomputers); C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "architecture; computer; computer architecture;
computer systems, digital; DECsystem 10; operating
system; operating systems (computers); sharing systems;
time sharing; time-",
oldlabel = "BellKHH78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BellKHH78",
}
@Article{Russell:1978:CCS,
author = "Richard M. Russell",
title = "The {Cray-1} Computer System",
journal = j-CACM,
volume = "21",
number = "1",
pages = "63--72",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:17:44 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.misc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Russell78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper describes the CRAY-1, discusses the
evolution of its architecture, and gives an account of
some of the problems that were overcome during its
manufacture. The CRAY-1 is the only computer to have
been built to date that satisfies ERDA's Class VI
requirement (a computer capable of processing from 20
to 60 million floating point operations per second)
[1]. The CRAY-1's Fortran compiler (CFT) is designed to
give the scientific user immediate access to the
benefits of the CRAY-1's vector processing
architecture. An optimizing compiler, CFT,
``vectorizes'' innermost DO loops. Compatible with the
ANSI 1966 Fortran Standard and with many commonly
supported Fortran extensions, CFT does not require any
source program modifications or the use of additional
nonstandard Fortran statements to achieve
vectorization. \par
Thus the user's investment of hundreds of man months of
effort to develop Fortran programs for other
contemporary computers is protected.",
acknowledgement = ack-nhfb,
annote = "The original paper describing the Cray-1. This paper
is reproduced in Kuhn and Padua's (1981, IEEE) survey
``Tutorial on Parallel Processing.'' Also reproduced in
``Computer Structures: Principles and Examples'' by
Daniel P. Siewiorek, C. Gordon Bell, and Allen Newell,
McGraw-Hill, 1982, pp. 743-752. Reproduced in Dharma P.
Agrawal's (ed.) ``Advanced Computer Architecture,''
IEEE, 1986, pp.15-24. Literature search yields:
00712248 E. I. Monthly No: EI7804023850 E. I. Yearly
No: EI78014612 Title: Cray-1 Computer System. Author:
Russell, Richard M. Corporate Source: Cray Res Inc,
Minneapolis, Minn Source: Communications of the ACM v
21 n 1 Jan 1978 p 63--72 Publication Year: 1978 CODEN:
CACMA2 ISSN: 0001-0782 Language: ENGLISH Journal
Announcement: 7804 Abstract: The CRAY-1 is described,
the evolution of its architecture is discussed, and an
account is given of some of the problems that were
overcome during its manufacture. The CRAY-1 is the only
computer to have been built to date that satisfies
ERDA's Class VI requirement (a computer capable of
processing from 20 to 60 million floating point
operations per second). The CRAY-1's Fortran compiler
(CFT) is designed to give the scientific user immediate
access to the benefits of the CRAY-1's vector
processing architecture. An optimizing compiler, CFT,
``vectorizes'' innermost DO loops. Compatible with the
ANSI 1966 Fortran Standard and with many commonly
supported Fortran extensions, CFT does not require any
source program modifications or the use of additional
nonstandard Fortran statements to achieve
vectorization.",
classcodes = "C5220 (Computer architecture); C5420 (Mainframes and
minicomputers); C6150J (Operating systems);
Descriptors: *COMPUTER ARCHITECTURE; COMPUTER SYSTEMS,
DIGITAL Classification Codes: 722 (Computer Hardware);
723 (Computer Software) 72 (COMPUTERS \& DATA
PROCESSING)",
classification = "722; 723",
corpsource = "Cray Res. Inc., Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "architecture; CFT; computer architecture; computer
systems; computer systems, digital; CRAY-1 computer
system; existing classic architecture; ginsberg biblio:
bhibbard enm; grecommended91; implementation; jlb;
maeder biblio: parallel hardware and devices; operating
systems (computers); processing; vector",
oldlabel = "Russell78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Russell78",
}
@Article{Case:1978:AIS,
author = "Richard P. Case and Andris Padegs",
title = "Architecture of the {IBM System\slash 370}",
journal = j-CACM,
volume = "21",
number = "1",
pages = "73--96",
month = jan,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:56 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#CaseP78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C5420 (Mainframes and
minicomputers); C6150J (Operating systems)",
corpsource = "IBM Corp., White Plains, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Architectures; computer architecture; data
manipulation; debugging; design considerations; error
handling; input/output operations; instructions; memory
hierarchy; monitoring; multiprocessing; operating
systems (computers); program control; timing
facilities; virtual storage",
oldlabel = "CaseP78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CaseP78",
}
@Article{Mamrak:1978:CSF,
author = "Sandra A. Mamrak and Richard G. {Montanelli, Jr.}",
title = "Computer Science Faculties: The Current Status of
Minorities and Woman",
journal = j-CACM,
volume = "21",
number = "2",
pages = "115--119",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:16 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#MamrakM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Ohio State Univ., Columbus, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "academic computer science; computer science education;
discrimination; minorities; women",
oldlabel = "MamrakM78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MamrakM78",
}
@Article{Rivest:1978:MOD,
author = "Ronald L. Rivest and Adi Shamir and Leonard M.
Adleman",
title = "A Method for Obtaining Digital Signatures and
Public-Key Cryptosystems",
journal = j-CACM,
volume = "21",
number = "2",
pages = "120--126",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94A05",
MRnumber = "83m:94003",
MRreviewer = "J. L. Selfridge",
bibdate = "Mon Jan 22 07:16:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/ProbAlgs.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/nonmono.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#RivestSA78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "The basics of trap-door functions and the famous RSA
public key cryptosystem are presented in this paper.",
abstract = "An encryption method is presented with the novel
property that publicly revealing an encryption key does
not thereby reveal the corresponding decryption key.
This has two important consequences: (1) Couriers or
other secure means are not needed to transmit keys,
since a message can be enciphered using an encryption
key publicly revealed by the intended recipient. (2) A
message can be ``signed'' using a privately held
decryption key. Anyone can verify this signature using
the corresponding publicly revealed encryption key.
Signatures cannot be forged, and a signer cannot later
deny the validity of his signature.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Dept. of Math., MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; cryptography; cryptosystems;
data handling; data processing --- Security of Data;
decryption key; digital signatures; encryption key;
number theory; operating protection; RSA; security;
security of data",
oldlabel = "RivestSA78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RivestSA78",
}
@Article{Auslander:1978:SRR,
author = "Marc A. Auslander and H. Raymond Strong",
title = "Systematic Recursion Removal",
journal = j-CACM,
volume = "21",
number = "2",
pages = "127--134",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#AuslanderS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The recursion removal algorithm presented by Strong
and Walker is amplified and applied to a relatively
complex PL/I program. The aim is to demonstrate
systematic recursion-removal techniques on something
more complex than Knuth's ``sturdy toddler'' and to
obtain measurements of the cost of procedure linkage in
PL/I and the savings achievable via procedure
integration in the presence of recursion. First, the
paper describes the recursion-removal process and the
example on which it will be illustrated. Recursion
removal is then applied to the two major parts of this
example and the final result of the process is
displayed. Our performance comparison results are
presented and our conclusions are briefly discussed.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6140D (High
level languages)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; linkage; optimization; PL/1;
procedure; procedure integration; procedure linkage;
programming theory; recursion elimination; recursion
removal; recursion removal algorithm",
oldlabel = "AuslanderS78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AuslanderS78",
}
@Article{Kou:1978:CEC,
author = "Lawrence T. Kou and Larry J. Stockmeyer and C. K.
Wong",
title = "Covering Edges by Cliques with Regard to Keyword
Conflicts and Intersection Graphs",
journal = j-CACM,
volume = "21",
number = "2",
pages = "135--139",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20 (05C35)",
MRnumber = "57 4620",
MRreviewer = "A. T. Amin",
bibdate = "Mon Jan 22 06:55:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#KouSW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "E. Kellerman has presented a method for determining
keyword conflicts and described a heuristic algorithm
which solves a certain combinatorial optimization
problem in connection with this method. This
optimization problem is shown to be equivalent to the
problem of covering the edges of a graph by complete
subgraphs with the objective of minimizing the number
of complete subgraphs. A relationship between this
edge-clique-cover problem and the graph coloring
problem is established which allows algorithms for
either one of these problems to be constructed from
algorithms for the other.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C1180 (Optimisation
techniques); C4240 (Programming and algorithm theory)",
classification = "723; 921",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "clique cover problem; cliques; combinatorial
optimization problem; computational complexity;
computer programming; edge; graph colouring;
intersection graphs; keyword conflicts; optimisation;
optimization",
oldlabel = "KouSW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KouSW78",
}
@Article{Held:1978:BTR,
author = "Gerald Held and Michael Stonebraker",
title = "{B}-trees Re-examined",
journal = j-CACM,
volume = "21",
number = "2",
pages = "139--143",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HeldS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published in/as: UCB, Elec. Res. Lab,
No.ERL-M528, July 1975.",
URL = "http://dblp.uni-trier.de/db/journals/cacm/HeldS78.html",
abstract = "The B-tree and its variants have, with increasing
frequency, been proposed as a basic storage structure
for multiuser database applications. Three potential
problems which must be dealt with in such a structure
that do not arise in more traditional static directory
structures are indicated. One problem is a possible
performance penalty.",
acknowledgement = ack-nhfb,
annote = "Static versus dynamic indexes.",
cdrom = "CACMs1/CACM21/P139.pdf",
classcodes = "C1160 (Combinatorial mathematics); C6120 (File
organisation)",
classification = "723",
corpsource = "Tandem Computers Inc., Capertino, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(mathematics); B-tree; data base systems; data
structures; database; database management systems;
directory structures; Ingres ISAM CACM; storage
structure; trees",
oldlabel = "HeldS78",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HeldS78",
}
@Article{Stewart:1978:CNT,
author = "William J. Stewart",
title = "A Comparison of Numerical Techniques in {Markov}
Modeling",
journal = j-CACM,
volume = "21",
number = "2",
pages = "144--152",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1978.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Stewart78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Presentation of several numerical methods which may be
used to obtain the stationary probability vectors of
Markovian models. An example of a nearly decomposable
system is considered, and the results obtained by the
different methods examined. A post mortem reveals why
standard techniques often fail to yield the correct
results. Finally, a means of estimating the error
inherent in the decomposition of certain models is
presented.",
acknowledgement = ack-nhfb,
classcodes = "C1140Z (Other topics in statistics); C1220
(Simulation, modelling and identification); C4110
(Error analysis in numerical methods)",
classification = "912",
corpsource = "Univ. de Rennes, Rennes, France",
country = "USA",
descriptors = "Markov chain; linear equation",
enum = "7926",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "decomposable system; error analysis; management
science; Markov processes; Markovian; methods;
modelling; models; numerical; numerical methods;
operations research; stationary probability vectors",
language = "English",
oldlabel = "Stewart78",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Stewart78",
}
@Article{Herman:1978:RMI,
author = "Gabor T. Herman and Arnold Lent and Peter H. Lutz",
title = "Relaxation Methods for Image Reconstruction",
journal = j-CACM,
volume = "21",
number = "2",
pages = "152--158",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A45 (92A05)",
MRnumber = "58 19419",
MRreviewer = "J. J. Buckley",
bibdate = "Mon Jan 22 06:49:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HermanLL78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "It is shown that, for a consistent system of linear
inequalities, any sequence of relaxation parameters
lying strictly between 0 and 2 generates a sequence of
vectors which converges to a solution. Under the same
assumptions, for a system of linear equations, the
relaxation method converges to the minimum norm
solution. Previously proposed techniques are shown to
be special cases of our procedure with different
choices of relaxation parameters. The practical
consequences for image reconstruction of the choice of
the relaxation parameters are discussed. This work is
applicable to biomedical engineering and mathematical
programming.",
acknowledgement = ack-nhfb,
classcodes = "C1180 (Optimisation techniques); C1260 (Information
theory); C4140 (Linear algebra)",
classification = "461; 723; 921",
corpsource = "State Univ. of New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "biomedical engineering; convergence of numerical
methods; greyness integrals; image processing; image
reconstruction; linear inequalities; mathematical
programming; method; picture processing; relaxation",
oldlabel = "HermanLL78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HermanLL78",
xxtitle = "Relaxation Method for Image Reconstruction",
}
@Article{Manna:1978:SSB,
author = "Zohar Manna and Richard J. Waldinger",
title = "Is `Sometime' Sometimes Better Than `Always'?
(Intermittent Assertions in Proving Program
Correctness)",
journal = j-CACM,
volume = "21",
number = "2",
pages = "159--172",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "58 3630",
MRreviewer = "Franco Sirovich",
bibdate = "Mon Jan 22 07:01:31 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#MannaW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This paper explores a technique for proving the
correctness and termination of programs simultaneously.
\par
This approach, the intermittent-assertion method,
involves documenting the program with assertions that
must be true at some time when control passes through
the corresponding point, but that need not be true
every time. The method, introduced by Burstall,
promises to provide a valuable complement to the more
conventional methods. The intermittent-assertion method
is presented with a number of examples of correctness
and termination proofs. Some of these proofs are
markedly simpler than their conventional counterparts.
\par
On the other hand, it is shown that a proof of
correctness or termination by any of the conventional
techniques can be rephrased directly as a proof using
intermittent assertions. Finally, it is shown how the
intermittent-assertion method can be applied to prove
the validity of program transformations and the
correctness of continuously operating programs.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "assertions; computer programming languages;
continuously operating programs; continuously operating
programs.; correctness of programs; intermittent
assertions; intermittent-assertion method; program;
program correctness; program transformation; program
verification; programming theory; termination of
programs; termination proofs; transformations",
oldlabel = "MannaW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MannaW78",
}
@Article{Schachter:1978:SNM,
author = "Bruce J. Schachter and Azriel Rosenfeld",
title = "Some New Methods of Detecting Step Edges in Digital
Pictures",
journal = j-CACM,
volume = "21",
number = "2",
pages = "172--176",
month = feb,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:12 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#SchachterR78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Description of two operators that respond to step
edges, but not to ramps. The first is similar to the
digital Laplacian, but uses the max, rather than the
sum, of the x and y second differences. The second uses
the difference between the mean and median gray levels
in a neighborhood. The outputs obtained from these
operators applied to a set of test pictures are
compared with each other and with the standard digital
Laplacian and gradient. A third operator, which uses
the distance between the center and centroid of a
neighborhood as an edge value, is also briefly
considered; it turns out to be equivalent to one of the
standard digital approximations to the gradient.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C1260
(Information theory); C6130B (Graphics techniques)",
classification = "723",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer graphics; digital; digital pictures; edge
detection; gray levels; image processing; Laplacian;
pattern recognition; picture processing; step edges",
oldlabel = "SchachterR78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SchachterR78",
}
@Article{Lucas:1978:UII,
author = "Henry C. {Lucas, Jr.}",
title = "Use of an Interactive Information Storage and
Retrieval System in Medical Research",
journal = j-CACM,
volume = "21",
number = "3",
pages = "197--205",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lucas78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Results of a study of the use of an interactive
computerized storage and retrieval system. A monitor
built into the computer system provided usage data for
the study. Additional data on user reactions were
gathered from a questionnaire. The results show the
important role played by frequently chosen laboratory
reference leaders in influencing the use of this
system. The implications of the study for the design of
similar systems are discussed.",
acknowledgement = ack-nhfb,
classcodes = "C7220 (Generation, dissemination, and use of
information); C7250 (Information storage and
retrieval); C7330 (Biology and medical computing)",
classification = "723; 901",
corpsource = "New York Univ., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computing; information retrieval system; information
retrieval systems; information storage; information
use; interactive; laboratory reference leaders;
medical; medical research; monitor; use; user
reactions",
oldlabel = "Lucas78",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lucas78",
}
@Article{Dutton:1978:MUC,
author = "William H. Dutton and Kenneth L. Kraemer",
title = "Management Utilization of Computers in {American}
Local Governments",
journal = j-CACM,
volume = "21",
number = "3",
pages = "206--218",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DuttonK78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Traditional concepts of management information systems
(MIS) bear little relation to the information systems
currently in use by top management in most US local
governments. What exists is management-oriented
computing, involving the use of relatively
unsophisticated applications. Despite the
unsophisticated nature of these systems, management use
of computing is surprisingly common, but also varied in
its extent among local governments. Management
computing is most prevalent in those governments with
professional management practices where top management
is supportive of computing and tends to control
computing decisions and where department users have
less control over design and implementation activities.
Finally, management computing clearly has impacts for
top managers, mostly involving improvements in decision
information.",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7130 (Public administration)",
classification = "723; 901; 912; 922",
corpsource = "Public Policy Res. Organization, Univ. of California,
Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "concepts; decision information; decision theory and
analysis; government data processing; information
retrieval systems; local governments; management
information systems; management practices; management
science; management use of computing; professional;
social aspects of automation; top management; US",
oldlabel = "DuttonK78",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DuttonK78",
}
@Article{Anderson:1978:VOC,
author = "Ronald E. Anderson",
title = "Value Orientation of Computer Science Students",
journal = j-CACM,
volume = "21",
number = "3",
pages = "219--225",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Anderson78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C0230
(Economic, social and political aspects of computing)",
corpsource = "Univ. of Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science education; computer science students;
social aspects of automation; social science; students;
value structures",
oldlabel = "Anderson78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Anderson78",
}
@Article{Kosaraju:1978:IDO,
author = "S. Rao Kosaraju",
title = "Insertions and Deletions in One-Sided Height-Balanced
Trees",
journal = j-CACM,
volume = "21",
number = "3",
pages = "226--227",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "57 18210",
MRreviewer = "Fabrizio Luccio",
bibdate = "Mon Jan 22 06:55:51 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Kosaraju78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "D. S. Hischberg has established that insertions into
one-sided height-balanced trees can be done in
O(log**2N) steps. It is proved that deletions can also
be performed in O(log**2N) steps, which answers the
open problem posed by D. S. Hirschberg.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723",
corpsource = "Johns Hopkins Univ., Baltimore, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "AVL trees; balanced trees; binary search; computer
programming; deletions; dynamic balancing; insertions;
one sided height balanced trees; programming theory;
trees (mathematics)",
oldlabel = "Kosaraju78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kosaraju78",
}
@Article{DeMillo:1978:PAP,
author = "Richard A. DeMillo and Stanley C. Eisenstat and
Richard J. Lipton",
title = "Preserving Average Proximity in Arrays",
journal = j-CACM,
volume = "21",
number = "3",
pages = "228--231",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "57 8217",
MRreviewer = "Dorothy Bollman",
bibdate = "Mon Jan 22 06:34:50 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DeMilloEL78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Programmers and data structure designers are often
forced to choose between alternative structures.
\par
In storing these structures, preserving logical
adjacencies or ``proximity'' is usually an important
consideration. \par
The combinatorial problem of storing arrays as various
kinds of list structures is examined. Embeddings of
graphs are used to model the loss of proximity involved
in such storage schemes, and an elementary proof that
arrays cannot be stored as linear lists with bounded
loss of proximity is presented. Average loss of
proximity is then considered, and it is shown that
arrays cannot be stored as linear lists with only
bounded loss of average proximity, but can be so stored
in binary trees. The former result implies, for
instance, that row major order is an asymptotically
optimal storage strategy for arrays.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Georgia Inst. of Technol., Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arrays; average proximity; computer programming; data
processing; data structure; data structures; graph
embedding; linear lists; list structures; logical
adjacencies; preserving; proximity; trees",
oldlabel = "DeMilloEL78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DeMilloEL78",
xxpages = "218--231",
}
@Article{Franklin:1978:AVP,
author = "Mark A. Franklin and G. Scott Graham and R. K. Gupta",
title = "Anomalies with Variable Partition Paging Algorithms",
journal = j-CACM,
volume = "21",
number = "3",
pages = "232--236",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "57 14659",
MRreviewer = "Johnson M. Hart",
bibdate = "Mon Jan 22 06:41:27 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#FranklinGG78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Five types of anomalous behavior which may occur in
paged virtual memory operating systems are defined. One
type of anomaly, for example, concerns the fact that,
with certain reference strings and paging algorithms,
an increase in mean memory allocation may result in an
increase in fault rate. Two paging algorithms, the page
fault frequency and working set algorithms, are
examined in terms of their anomaly potential, and
reference string examples of various anomalies are
presented. Two paging algorithm properties, the
inclusion property and the generalized inclusion
property, are discussed and the anomaly implications of
these properties presented.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Washington Univ., St. Louis, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "anomalous behaviour; computer operating systems;
computer programming --- Subroutines; operating systems
(computers); page fault frequency; variable partition
paging algorithms; virtual memory operating systems;
virtual storage; working set algorithms",
oldlabel = "FranklinGG78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FranklinGG78",
}
@Article{Tanenbaum:1978:ISP,
author = "Andrew S. Tanenbaum",
title = "Implications of Structured Programming for Machine
Architecture",
journal = j-CACM,
volume = "21",
number = "3",
pages = "237--246",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:33 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/risc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Tanenbaum78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Based on an empirical study of more than 10,000 lines
of program text written in a GOTO-less language, a
machine architecture specifically designed for
structured programs is proposed. Since assignment,
CALL, RETURN, and IF statements together account for 93
percent of all executable statements, special care is
given to ensure that these statements can be
implemented efficiently. A highly compact instruction
encoding scheme is presented, which can reduce program
size by a factor of 3. Unlike a Huffman code, which
utilizes variable length fields, this method uses only
fixed length (1-byte) op code and address fields. The
most frequent instructions consist of a single 1-byte
field. As a consequence, instruction decoding time is
minimized, and the machine is efficient with respect to
both space and time.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6110 (Systems analysis
and programming)",
classification = "723",
corpsource = "Vrije Univ., Amsterdam, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer architecture; computer operating systems;
computer organization; instruction set design; machine
architecture; MIPS RISC reduced restricted instruction
set computer architecture pipelining microcoding;
program characteristics; structured programming",
oldlabel = "Tanenbaum78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tanenbaum78",
}
@Article{Rabin:1978:CCC,
author = "Michael O. Rabin",
title = "Corrigendum: {``Complexity of computations''}",
journal = j-CACM,
volume = "21",
number = "3",
month = mar,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "231.68A20",
MRnumber = "57 8156",
bibdate = "Tue Dec 26 13:35:07 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Rabin:1977:CC}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Payne:1978:OEN,
author = "W. H. Payne and K. L. McMillen",
title = "Orderly Enumeration of Nonsingular Binary Matrices
Applied to Text Encryption",
journal = j-CACM,
volume = "21",
number = "4",
pages = "259--263",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C05",
MRnumber = "80h:68031",
MRreviewer = "P. E. O'Neil",
bibdate = "Mon Jan 22 07:11:44 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#PayneM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Nonsingular binary matrices of order N, i.e.,
nonsingular over the field left brace 0,1 right brace,
and an initial segment of the natural numbers are
placed in one-to-one correspondence. Each natural
number corresponds to two intermediate vectors. These
vectors are mapped into a nonsingular binary matrix.
Examples of complete enumeration of all 2 multiplied by
2 and 3 multiplied by 3 nonsingular binary matrices
were produced by mapping the intermediate vectors to
the matrices. The mapping has application to the Vernam
encipherment method using pseudorandom number
sequences. A bit string formed from bytes of text of a
data encryption key can be used as a representation of
a natural number. This natural number is transformed to
a nonsingular binary matrix. Key leverage is obtained
by using the matrix as a ``seed'' in a shift register
sequence pseudorandom number generator.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "Washington State Univ., Pullman, WA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary sequences; bit string; computer programming;
data encryption key; encoding; enumeration; mapped;
matrix algebra; natural number; nonsingular binary
matrices; pseudorandom number; sequences; text editing;
text encryption; Vernam encipherment method",
oldlabel = "PayneM78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PayneM78",
}
@Article{Heckel:1978:TID,
author = "Paul Heckel",
title = "A Technique for Isolating Differences Between Files",
journal = j-CACM,
volume = "21",
number = "4",
pages = "264--268",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/scm.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Heckel78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple algorithm is described for isolating the
differences between two files. One application is the
comparing of two versions of a source program or other
file in order to display all differences. The algorithm
isolates differences in a way that corresponds closely
to our intuitive notion of difference, is easy to
implement, and is computationally efficient, with time
linear in the file length. For most applications the
algorithm isolates differences similar to those
isolated by the longest common subsequence. Another
application of this algorithm merges files containing
independently generated changes into a single file. The
algorithm can also be used to generate efficient
encodings of a file in the form of the differences
between itself and a given ``datum'' file, permitting
reconstruction of the original file from the difference
and datum files.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Interactive Systems Consultants, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; delta storage; encodings; file
organisation; files; independently generated changes;
isolating differences; longest common; merges; source
program; subsequence; text editing",
oldlabel = "Heckel78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Heckel78",
}
@Article{Lew:1978:OCE,
author = "Art Lew",
title = "Optimal Conversion of Extended-Entry Decision Tables
with General Cost Criteria",
journal = j-CACM,
volume = "21",
number = "4",
pages = "269--279",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C05 (49C20)",
MRnumber = "80a:68032",
MRreviewer = "C. L. Liu",
bibdate = "Mon Jan 22 06:58:42 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lew78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A general dynamic programming algorithm for converting
limited extended, or mixed entry decision tables to
optimal decision trees is presented which can take into
account rule frequencies or probabilities, minimum time
and\slash or space cost criteria, common action sets,
compressed rules and ELSE rules, sequencing constraints
on condition tests, excludable combinations of
conditions, certain ambiguities, and interrupted rule
masking.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Univ. of Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "common action sets; compressed; computer programming;
condition tests; conversion; decision tables; ELSE
rules; entry decision tables; extended entry decision
tables; frequencies; general cost criteria; interrupted
rule masking; minimum time; mixed; optimal decision
trees; rule; rules; sequencing constraints",
oldlabel = "Lew78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lew78",
}
@Article{Baker:1978:LPR,
author = "Henry G. {Baker, Jr.}",
title = "List Processing in Real Time on a Serial Computer",
journal = j-CACM,
volume = "21",
number = "4",
pages = "280--294",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Baker78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Originally appeared as MIT Artificial Intelligence
Laboratory Working Paper No. 39, February 1977",
abstract = "A real-time list processing system is one in which the
time required by the elementary list operations (e.g.
CONS CAR, CDR, RPLACA, RPLACD, EQ, and ATOM in LISP) is
bounded by a (small) constant. Classical
implementations of list processing systems lack this
property because allocating a list cell from the heap
may cause a garbage collection, which process requires
time proportional to the heap size to finish. A
real-time list processing system is presented which
continuously reclaims garbage, including directed
cycles, while linearizing and compacting the accessible
cells into contiguous locations to avoid fragmenting
the free storage pool.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6130 (Data handling
techniques)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "collection; computer programming; data processing;
garbage; list processing; list processing system; real
time; serial computer; storage management",
oldlabel = "Baker78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Baker78",
}
@Article{Merkle:1978:SCI,
author = "Ralph C. Merkle",
title = "Secure Communications Over Insecure Channels",
journal = j-CACM,
volume = "21",
number = "4",
pages = "294--299",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Merkle78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "According to traditional conceptions of cryptographic
security, it is necessary to transmit a key, by secret
means, before encrypted messages can be sent securely.
This paper shows that it is possible to select a key
over open communications channels in such a fashion
that communications security can be maintained. A
method is described which forces any enemy to expend an
amount of work which increases as the square of the
work required of the two communicants to select the
key. The method provides a logically new kind of
protection against the passive eaves dropper. It
suggests that further research on this topic will be
highly rewarding, both in a theoretical and a practical
sense.",
acknowledgement = ack-nhfb,
classcodes = "C5600 (Data communication equipment and techniques);
C6130 (Data handling techniques)",
classification = "723",
corpsource = "Dept. of Electrical Engng. and Computer Sci., Univ. of
California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "communications channels; communications security;
computer network security; cryptographic security;
cryptography; cryptology; data communication systems;
data processing; insecure channels; key distribution;
open; passive eavesdropper; passive eavesdropping;
protection; public key cryptosystem; Security; security
of data; wiretap",
oldlabel = "Merkle78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Merkle78",
}
@Article{Szymanski:1978:ACM,
author = "Thomas G. Szymanski",
title = "Assembling Code for machines with Span-Dependent
Instructions",
journal = j-CACM,
volume = "21",
number = "4",
pages = "300--308",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B05 (68C05)",
MRnumber = "82g:68015",
MRreviewer = "R. K. Shyamasundar",
bibdate = "Mon Jan 22 07:25:16 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Compiler.Lins.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Szymanski78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150C
(Compilers, interpreters and other processors)",
corpsource = "Princeton Univ., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "code assembling; computational complexity;
instructions; lengths of programs; program assemblers;
programming; span dependent; theory",
oldlabel = "Szymanski78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Szymanski78",
}
@Article{Vuillemin:1978:DSM,
author = "Jean Vuillemin",
title = "A Data Structure for Manipulating Priority Queues",
journal = j-CACM,
volume = "21",
number = "4",
pages = "309--315",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "57 18215",
MRreviewer = "Bernard H. Rosman",
bibdate = "Mon Jan 22 07:27:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Vuillemin78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A data structure is described which can be used for
representing a collection of priority queues. The
primitive operations are insertion, deletion, union,
update, and search for an item of earliest priority.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. de Paris-Sud, Orsay, France",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; data structure; data structures;
deletion; earliest priority; insertion; manipulating
priority queues; operations; primitive; search; union;
update",
oldlabel = "Vuillemin78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Vuillemin78",
}
@Article{Even:1978:EEC,
author = "Shimon Even and Michael Rodeh",
title = "Economical Encoding of Commas Between Strings",
journal = j-CACM,
volume = "21",
number = "4",
pages = "315--317",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "58 3648",
MRreviewer = "John Cherniavsky",
bibdate = "Mon Jan 22 06:38:23 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#EvenR78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Israel Inst. of Technol., Haifa, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "commas; data handling; delimiters; encoding; extra
cost; strings",
oldlabel = "EvenR78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EvenR78",
}
@Article{Cheng:1978:GBV,
author = "R. C. H. Cheng",
title = "Generating beta variates with nonintegral shape
parameters",
journal = j-CACM,
volume = "21",
number = "4",
pages = "317--322",
month = apr,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "58 13609",
MRreviewer = "George Marsaglia",
bibdate = "Mon Jan 22 06:30:47 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Cheng78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7310 (Mathematics computing)",
corpsource = "Univ. of Wales Inst. of Sci. and Technol., Cardiff,
UK",
country = "USA",
descriptors = "RVG",
enum = "7128",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "beta variates; computer timings; generating; method;
nonintegral shape parameters; random number generation;
random numbers; rejection; simplicity; speed;
statistics",
language = "English",
location = "SEL: Wi",
oldlabel = "Cheng78",
references = "0",
revision = "16/01/94",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Cheng78",
}
@Article{Clark:1978:FAC,
author = "Douglas W. Clark",
title = "A Fast Algorithm for Copying List Structures",
journal = j-CACM,
volume = "21",
number = "5",
pages = "351--357",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Clark78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is presented for copying an arbitrarily
linked list structure into a block of contiguous
storage locations without destroying the original list.
Apart from a fixed number of program variables, no
auxiliary storage, such as a stack, is used. The
algorithm needs no mark bits and operates in linear
time. It is shown to be significantly faster than
Fisher's algorithm, the fastest previous linear-time
algorithm for the same problem. Its speed comes mainly
from its efficient list-traversal technique, which
folds the processing stack into the structure being
built, and from its classification of list cells into
nine types, which enables processing operations to be
optimized for each type.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrarily linked; classification; computer
programming; contiguous storage locations; copying;
fast algorithm; linear time; list processing; list
structure; list structures; list traversal technique",
oldlabel = "Clark78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Clark78",
}
@Article{Jones:1978:LEE,
author = "Anita K. Jones and Barbara H. Liskov",
title = "A Language Extension for Expressing Constraints on
Data Access",
journal = j-CACM,
volume = "21",
number = "5",
pages = "358--367",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:09 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/obscure.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#JonesL78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Controlled sharing of information is needed and
desirable for many applications and is supported in
operating systems by access control mechanisms. This
work shows how to extend programming languages to
provide controlled sharing. The extension permits
expression of access constraints on shared data. Access
constraints can apply both to simple objects, and to
objects that are components of larger objects, such as
bank account records in a bank's data base. The
approach can be used to extend any strongly-typed
language, but is particularly suitable for extending
languages that support the notion of abstract data
types.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6140D (High level
languages)",
classification = "723",
corpsource = "Carnegie-Mellon Univ., Pittsburg, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data types; access control; computer
programming languages; constraints; data access; data
structures; language extension; mechanisms; programming
languages",
oldlabel = "JonesL78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/JonesL78",
}
@Article{Geller:1978:TDA,
author = "Matthew M. Geller",
title = "Test Data as an Aid in Proving Program Correctness",
journal = j-CACM,
volume = "21",
number = "5",
pages = "368--375",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "57 14575",
MRreviewer = "Luigia Aiello",
bibdate = "Mon Jan 22 06:43:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Geller78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Proofs of program correctness tend to be long and
tedious, whereas testing, though useful in detecting
errors, usually does not guarantee correctness. A
technique is introduced whereby test data can be used
in proving program correctness. In addition to
simplifying the process of proving correctness, this
method simplifies the process of providing accurate
specification for a program. The applicability of this
technique to procedures and recursive programs is
demonstrated.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Univ. of Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; procedures; program testing;
programming theory; proving program correctness;
recursive programs; specification; test data",
oldlabel = "Geller78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Geller78",
}
@Article{Low:1978:ADS,
author = "James R. Low",
title = "Automatic Data Structure Selection: an Example and
Overview",
journal = j-CACM,
volume = "21",
number = "5",
pages = "376--385",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:48 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/obscure.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Low78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In the past, programming systems have provided only a
single general purpose implementation for an abstract
type. Thus the programs produced using abstract types
were often inefficient in space or time. A system for
automatically choosing efficient implementations for
abstract types from a library of implementations for
abstract types from a library of implementations is
discussed. This process is discussed in detail for an
example program. General issues in data structure
selection are also reviewed.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6120 (File
organisation); C6150C (Compilers, interpreters and
other processors)",
classification = "723",
corpsource = "Univ. of Rochester, Rochester, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data types; automatic programming;
automatically; computer programming; data processing
--- Data Structures; data structure selection; data
structures; lists; program compilers; programs; sets",
oldlabel = "Low78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Low78",
}
@Article{Karr:1978:IUP,
author = "Michael Karr and David B. {Loveman III}",
title = "Incorporation of Units into Programming Languages",
journal = j-CACM,
volume = "21",
number = "5",
pages = "385--391",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:53:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/database.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#KarrL78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The issues of how a programming language might aid in
keeping track of physical units (feet, sec, etc. ) are
discussed. A method is given for the introduction of
relationships among units (a watt is volts *amps, a
yard is three feet) and subsequent automatic conversion
based upon these relationships. Various proposals for
syntax are considered.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6140D (High
level languages); C6150C (Compilers, interpreters and
other processors)",
classification = "723",
corpsource = "Massachusetts Computer Associates Inc., Wakesfield,
MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "(measurement); automatic conversion; computer
programming languages; physical units; program
compilers; programming language; programming languages;
relationships among; syntax; units",
oldlabel = "KarrL78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KarrL78",
}
@Article{Hanson:1978:SPM,
author = "David R. Hanson and Ralph E. Griswold",
title = "The {SL5} Procedure Mechanism",
journal = j-CACM,
volume = "21",
number = "5",
pages = "392--400",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HansonG78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Description of an integrated procedure mechanism that
permits procedures to be used as recursive functions or
as coroutines. This integration is accomplished by
treating procedures and their activation records
(called environments) as data objects and by
decomposing procedure invocation into three separate
components at the source-language level. In addition,
argument binding is under the control of the
programmer, permitting the definition of various
methods of argument transmission in the source language
itself. The resulting procedure mechanism, which is
part of the SL5 programming language, is well suited to
goal-oriented problems and to other problems that are
more readily programmed by using coroutines. Several
examples are given.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "Yale Univ., New Haven, CT, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "activation records; argument binding; argument
transmission; computer programming languages;
coroutines; procedure invocation; procedure mechanism;
program interpreters; programming languages; recursive
functions; SL5",
oldlabel = "HansonG78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HansonG78",
}
@Article{Hayes-Roth:1978:IMT,
author = "Frederick Hayes-Roth and John P. McDermott",
title = "An Interference Matching Technique for Inducing
Abstractions",
journal = j-CACM,
volume = "21",
number = "5",
pages = "401--410",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:49:03 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/colt.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Hayes-RothM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method for inducing knowledge by abstraction from a
sequence of training examples is described. \par
The proposed method, interference matching, induces
abstractions by finding relational properties common to
two or more exemplars. Three tasks solved by a program
that uses an interference-matching algorithm are
presented. Several problems concerning the description
of the training examples and the adequacy of
interference matching are discussed, and directions for
future research are considered.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C6140D (High level
languages)",
classification = "723",
corpsource = "Rand Corp., Santa Monica, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstraction; abstractions; artificial intelligence;
complexity; computer metatheory --- Programming Theory;
computer programming; generalization; graph matching;
inducing knowledge; induction; informal retrieval;
interference; interference matching; knowledge
acquisition; knowledge representation; language
learning; learning; partial matching; predicate
discovery.; programming languages; relational
properties; Rule induction; SPROUTER; training
examples",
oldlabel = "Hayes-RothM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hayes-RothM78",
xxpages = "401--411",
}
@Article{Fleisher:1978:NSO,
author = "J. M. Fleisher and R. R. Meyer",
title = "New Sufficient Optimality Conditions for Integer
Programming and Their Application",
journal = j-CACM,
volume = "21",
number = "5",
pages = "411--418",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90C10",
MRnumber = "58 15137",
MRreviewer = "F. Giannessi",
bibdate = "Mon Jan 22 06:39:55 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#FleisherM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Report on a new class of sufficient optimality
conditions for pure and mixed integer programming
problems. Some of the sets of sufficient conditions
presented can be thought of as generalizations of
optimality conditions based on primal-dual
complementarity in linear programming. These sufficient
conditions are particularly useful for the construction
of difficult integer programming problems with known
optimal solutions. These problems may then be used to
test and\slash or ``benchmark'' integer programming
codes.",
acknowledgement = ack-nhfb,
classcodes = "C1180 (Optimisation techniques); C1290 (Applications
of systems theory)",
classification = "723; 921",
corpsource = "Univ. of Wisconsin, Madison, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "integer programming; mathematical programming;
sufficient optimality conditions",
oldlabel = "FleisherM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FleisherM78",
}
@Article{Tadikamalla:1978:CGGa,
author = "Pandu R. Tadikamalla",
title = "Computer Generation of Gamma Random Variables",
journal = j-CACM,
volume = "21",
number = "5",
pages = "419--422",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "65C10",
MRnumber = "58 13614",
MRreviewer = "George Marsaglia",
bibdate = "Mon Jan 22 07:25:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1978.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Tadikamalla78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new method for generating random variables from the
gamma distribution with nonintegral shape parameter
alpha is proposed. This method is similar to two other
methods recently given by N. D. Wallace and G. S.
Fishman. It is compared with Fishman's and J. H. Ahrens
and U. Dieter's methods. The core storage requirements
and programming effort for this method are similar to
those of Fishman's method. The proposed method is the
same as Fishman's method for 1 less than equivalent to
alpha less than 2 and is faster than Fishman's method
for 3 less than equivalent to alpha less than
equivalent to 19. Also, the proposed method is much
simpler than Ahrens and Dieter's method and is faster
for alpha less than equivalent to 8.",
acknowledgement = ack-nhfb,
classcodes = "C1140 (Probability and statistics); C7310 (Mathematics
computing)",
classification = "723; 922",
corpsource = "Eastern Kentucky Univ., Richmond, KY, USA",
country = "USA",
date = "13/05/93",
descriptors = "RVG",
enum = "7943",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; core; gamma distribution; gamma
random variables; generating; mathematical statistics
--- Random Number Generation; programming effort;
statistics; storage requirements",
language = "English",
oldlabel = "Tadikamalla78",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tadikamalla78",
}
@Article{Sites:1978:OSS,
author = "Richard L. Sites",
title = "Optimal Shift Strategy for a Block-Transfer {CCD}
Memory",
journal = j-CACM,
volume = "21",
number = "5",
pages = "423--425",
month = may,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Sites78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "It is shown that the optimal shift strategy for an
electronic paging drum with variable but bounded
rotation speed is to shift as quickly as possible over
most of a cycle, then to shift as slowly as possible
over the rest, where the fraction of a cycle to be
covered slowly is a function of the square root of the
ratio between the maximum and minimum rotation speeds.
For a ratio of 100:1, 10\slash 11 of a full cycle
should be covered quickly and 1/11 should be covered
slowly. As device manufacturers increase this ratio,
the average latency for a block transfer will slowly
decrease. Increasing the raw shift speed will of course
directly reduce both the latency time and the block
transfer time.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "722",
corpsource = "Univ. of California, San Diego, La Jolla, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "best shift strategy; block transfer CCD memory;
charge-coupled device circuits; computer operating
systems; critical boundary; hurry up and wait; optimal;
paging drum; serial shift registers; storage
allocation; strategy",
oldlabel = "Sites78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sites78",
}
@Article{Zweben:1978:OMD,
author = "Stuart H. Zweben and M. A. McDonald",
title = "An Optimal Method for Deletion in One-Sided
Height-Balanced Trees",
journal = j-CACM,
volume = "21",
number = "6",
pages = "441--445",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68E10 (68B05 68C25)",
MRnumber = "80k:68054",
MRreviewer = "A. T. Amin",
bibdate = "Mon Jan 22 07:31:49 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#ZwebenM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A one-sided height-balanced tree is a binary tree in
which every mode's right subtree has a height which is
equal to or exactly one greater than the height of its
left subtree. It has an advantage over the more general
AVL tree in that only one bit of balancing information
is required (two bits are required for the AVL tree).
It is shown that deletion of an arbitrary node of such
a tree can be accomplished in O(log n) operations,
where n is the number of nodes in the tree. Moreover
the method is optimal in the sense that its complexity
cannot be reduced in order of magnitude. This result,
coupled with earlier results by D. S. Hirschberg,
indicates that, of the three basic problems of
insertion, deletion, and retrieval, only insertion is
adversely affected by this modification of an AVL
tree.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6120 (File
organisation)",
classification = "723",
corpsource = "Ohio State Univ., Columbus, OH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arbitrary node; binary tree; computer programming;
data structures; deletion; one; optimal method;
programming theory; sided height balanced trees; trees
(mathematics)",
oldlabel = "ZwebenM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ZwebenM78",
}
@Article{Driscoll:1978:STA,
author = "James R. Driscoll and Y. Edmund Lien",
title = "A Selective Traversal Algorithm for Binary Search
Trees",
journal = j-CACM,
volume = "21",
number = "6",
pages = "445--447",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:48 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DriscollL78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The problem of selecting data items from a binary
search tree according to a list of range conditions is
considered. The process of visiting a minimal number of
nodes to retrieve data satisfying the range conditions
is called selective traversal. Presented in this paper
is an algorithm for selective traversal which uses a
tag field for each node in the tree. The algorithm is
particularly useful and efficient when examination of
data is more time consuming than examination of a tag
field.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6120 (File
organisation)",
classification = "723",
corpsource = "Florida Technol. Univ., Orlando, FL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "binary search tree; binary search trees; computer
programming; Data retrieval; data structures;
programming theory; range conditions; retrieve;
selective traversal; selective traversal algorithm; tag
field; tree traversal; trees (mathematics)",
oldlabel = "DriscollL78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DriscollL78",
}
@Article{Cohen:1978:ADP,
author = "Jacques Cohen and Martin S. Roth",
title = "Analyses of Deterministic Parsing Algorithms",
journal = j-CACM,
volume = "21",
number = "6",
pages = "448--458",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "58 13920",
MRreviewer = "David B. Benson",
bibdate = "Mon Jan 22 06:32:10 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#CohenR78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An approach is presented for determining the minimum,
maximum, and average times to parse sentences
acceptable by a deterministic parser. These quantities
are presented in the form of symbolic formulas, called
time-formulas. The variables in these formulas
represent not only the length of the input string but
also the time to perform elementary operations such as
pushing, popping, subscripting, iterating, etc. By
binding to the variables actual numerical values
corresponding to a given compiler-machine
configuration, one can determine the execution time for
that configuration. Time-formulas are derived by
examining the grammar rules and the program
representing the algorithm one wishes to analyze. The
approach is described by using a specific grammar that
defines simple arithmetic expressions.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C4240 (Programming and algorithm
theory)",
classification = "723",
corpsource = "Brandeis Univ., Waltham, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; average times; benchmarks; bottom up
SLR(1) parser; computer programming languages;
deterministic parsing algorithms; estimates; grammars;
maximum time; minimum time; PDP 10; recursive descent
LL(1) parser; relative efficiencies; top down",
oldlabel = "CohenR78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CohenR78",
xxauthor = "Jacques Cohen and Martin A. Roth",
}
@Article{Mickunas:1978:AER,
author = "M. Dennis Mickunas and John A. Modry",
title = "Automatic Error Recovery for {LR} Parsers",
journal = j-CACM,
volume = "21",
number = "6",
pages = "459--465",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:04:17 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#MickunasM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A scheme is given for detecting and recovering from
syntax errors in programs. The scheme, which is based
on LR parsing, is driven by information which is
directly and automatically obtainable from the
information that is already present in an LR parser.
The approach, which is patterned after that of Levy and
Graham and Rhodes, appears to provide error recovery
which is both simple and powerful.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Univ. of Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatically; compilers; computer programming
languages; detecting; error correction; error recovery;
fault tolerant computing; LR parsers; program; syntax
errors; system recovery",
oldlabel = "MickunasM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MickunasM78",
}
@Article{Lientz:1978:CAS,
author = "Bennet P. Lientz and E. Burton Swanson and G. E.
Tompkins",
title = "Characteristics of Application Software Maintenance",
journal = j-CACM,
volume = "21",
number = "6",
pages = "466--471",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:04 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#LientzST78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Maintenance and enhancement of application software
consume a major portion of the total life cycle cost of
a system. Rough estimates of the total systems and
programming resources consumed range as high as 75-80
percent in each category. However, the area has been
given little attention in the literature. To analyze
the problems in this area a questionnaire was developed
and pretested. It was then submitted to 120
organizations. Respondents totaled 69. Responses were
analyzed with the SPSS statistical package. The results
of the analysis are examined in detail.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C6110 (Systems analysis and
programming)",
classification = "723",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "application software maintenance; characteristics;
computer programming; DP management; enhancement;
extension; management; programming; resources; systems;
user demands",
oldlabel = "LientzST78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LientzST78",
xxtitle = "Characteristics of Applications Software Maintenance",
}
@Article{Chrysler:1978:SBD,
author = "Earl Chrysler",
title = "Some Basic Determinants of Computer Programming
Productivity",
journal = j-CACM,
volume = "21",
number = "6",
pages = "472--483",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:31:10 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Chrysler78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Examination of the relationship between processing
characteristics of programs and experience
characteristics of programmers and program development
time. The ultimate objective was to develop a technique
for predicting the amount of time necessary to create a
computer program. The fifteen program characteristics
hypothesized as being associated with an increase in
programming time required are objectively measurable
from preprogramming specifications. The five programmer
characteristics are experience-related and are also
measurable before a programming task is begun. Nine
program characteristics emerged as major influences on
program development time, each associated with
increased program development time. All five programmer
characteristics are found to be related to reduced
program development time.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C6110 (Systems analysis and
programming)",
classification = "723",
corpsource = "Univ. of Wisconsin, Parkside, WI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "characteristics; computer programming; computer
programming productivity; determinants; DP management;
forecasting; predicting; program development time;
programmers; programming",
oldlabel = "Chrysler78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chrysler78",
}
@Article{Kling:1978:AWC,
author = "Rob Kling",
title = "Automated Welfare Client-Tracking and Service
Integration: the Political Economy of Computing",
journal = j-CACM,
volume = "21",
number = "6",
pages = "484--493",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:07 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Kling78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The impact of an automated client-tracking system on
the clients, caseworkers, administrators, and
operations of the welfare agencies that use it are
reported. The major impact of this system was to
enhance the administrative attractiveness of the using
agencies in the eyes of funders rather than to increase
their internal administrative efficiency. This impact
is a joint product of both the technical features of
the computer-based system and of the organizational
demands placed upon different agencies, administrators,
and caseworkers. It illustrates the way ``successful''
automated information systems fit the political
economies of the groups that use them.",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7130 (Public administration)",
classification = "723",
corpsource = "Univ. of California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative attractiveness; client; computing; data
processing; government data processing; impact;
political economies; service integration; social
aspects of automation; social impact; tracking; welfare
agencies",
oldlabel = "Kling78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kling78",
}
@Article{Gelenbe:1978:PRR,
author = "Erol Gelenbe and D. Derochette",
title = "Performance of Rollback Recovery Systems Under
Intermittent Failures",
journal = j-CACM,
volume = "21",
number = "6",
pages = "493--499",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68H05",
MRnumber = "80a:68113",
MRreviewer = "Menachem Dishon",
bibdate = "Mon Jan 22 06:43:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#GelenbeD78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A mathematical model of a transaction-oriented system
under intermittent failures is proposed. The system is
assumed to operate with a checkpointing and
rollback\slash recovery method to ensure reliable
information processing. The model is used to derive the
principal performance measures, including availability,
response time, and the system saturation point.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Univ. Paris-Sud, Orsay, France",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "availability; checkpointing; computer operating
systems; data base systems; intermittent failures;
mathematical model; performance measures; response
time; rollback recovery systems; system recovery;
system saturation point",
oldlabel = "GelenbeD78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GelenbeD78",
}
@Article{Teorey:1978:GEI,
author = "Toby J. Teorey",
title = "General Equations for Idealized {CPU-I/O} Overlap
Configurations",
journal = j-CACM,
volume = "21",
number = "6",
pages = "500--507",
month = jun,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05",
MRnumber = "58 3643",
MRreviewer = "A. D. Booth",
bibdate = "Mon Jan 22 07:26:00 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Teorey78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "General equations are derived for estimating the
maximum possible utilization of main storage
partitions, CPU and I/O devices under different
conditions in an idealized CPU-I/O overlap model of
multiprogrammed computer systems. The equations are
directly applicable to any configuration consisting of
sets of identical CPU's, I/O processors, main storage
partitions and user tasks. Examples are provided to
illustrate the use of the equations to compute
effective processing time per record and expected
timesharing response time under both balanced and
unbalanced resource utilization conditions.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Univ. of Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "balanced; computer systems programming; CPU; devices;
expected timesharing response time; I/O; input-output
programs; main storage partitions; multiprogrammed
computer systems; multiprogramming; overlap
configurations; per record; processing time; storage
allocation; time-sharing systems; unbalanced",
oldlabel = "Teorey78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Teorey78",
}
@Article{Waltz:1978:ELQ,
author = "David L. Waltz",
title = "An {English} Language Query Answering System for a
Large Relational Data Base",
journal = j-CACM,
volume = "21",
number = "7",
pages = "526--539",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Waltz78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "By typing requests in English, casual users will be
able to obtain explicit answers from a large relational
database of aircraft flight and maintenance data using
a system called PLANES. The design and implementation
of this system is described and illustrated with
detailed examples of the operation of system components
and examples of overall system operation. Also included
are discussions of important issues in programming
natural language systems for limited domains, and the
relationship of this system to others.",
acknowledgement = ack-nhfb,
annote = "the PLANES system.",
classcodes = "C6120 (File organisation); C7250 (Information storage
and retrieval); C7460 (Aerospace engineering
computing)",
classification = "723",
corpsource = "Univ. of Illinois, Urbana-Champaign, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "aerospace computing; aircraft; data base systems;
database management systems; English language; flight;
information retrieval; large; maintenance; PLANES;
question answering system; relational database",
oldlabel = "Waltz78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Waltz78",
xxtitle = "An {English} language question answering system for a
large relational database",
}
@Article{Fredman:1978:CCM,
author = "Michael L. Fredman and Bruce W. Weide",
title = "On the complexity of computing the measure of
{$\bigcup[a_i,b_i]$}",
journal = j-CACM,
volume = "21",
number = "7",
pages = "540--544",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A20",
MRnumber = "58 13924",
MRreviewer = "Jan van Leeuwen",
bibdate = "Mon Jan 22 06:41:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/78.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#FredmanW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The decision tree complexity of computing the measure
of the union of $n$ (possibly overlapping) intervals is
shown to be $\Omega(n \log n)$, even if comparisons
between linear functions of the interval endpoints are
allowed. The existence of an $\Omega (n \log n)$ lower
bound to determine whether any two of $n$ real numbers
are within $\epsilon$ of each other is also
demonstrated. These problems provide an excellent
opportunity for discussing the effects of the
computational model on the ease of analysis and on the
results produced.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Univ. of California, San Diego, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm theory; computational complexity;
computational model; computer metatheory; computer
programming; computing; decision tree complexity;
intervals; measure; union",
oldlabel = "FredmanW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FredmanW78",
}
@Article{Chin:1978:ADN,
author = "Francis Y. Chin",
title = "An ${O}(n)$ Algorithm for Determining a Near-Optimal
Computation Order of Matrix Chain Products",
journal = j-CACM,
volume = "21",
number = "7",
pages = "544--549",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C25 (65F05)",
MRnumber = "80a:68037",
MRreviewer = "Ondrej S{\'y}kora",
bibdate = "Mon Jan 22 06:31:00 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Chin78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Discussion of the computation of matrix chain products
of the form M//1 multiplied by M//2 multiplied
by\ldots{} multiplied by M//n where M//i's are
matrices. The order in which the matrices are computed
affects the number of operations. A sufficient
condition about the association of the matrices in the
optimal order is presented. An O(n) algorithm to find
an order of computation which takes less than 25
percent longer than the optimal time T(opt) is also
presented. In most cases, the algorithm yields the
optimal order or an order which takes only a few
percent longer than T(opt) (less than 1 percent on the
average).",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra)",
classification = "723",
corpsource = "Univ. of Alberta, Edmonton, Alta., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computation order; computer programming;
matrix algebra; matrix chain products; optimal order",
oldlabel = "Chin78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Chin78",
}
@Article{Perl:1978:ISL,
author = "Yehoshua Perl and Alon Itai and Haim Avni",
title = "Interpolation Search --- {A} Log Log {N} Search",
journal = j-CACM,
volume = "21",
number = "7",
pages = "550--553",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "58 8582",
MRreviewer = "Amitava Bagchi",
bibdate = "Mon Jan 22 07:12:14 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#PerlIA78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Interpolation search is a method of retrieving a
desired record by key in an ordered file by using the
value of the key and the statistical distribution of
the keys. It is shown that on the average log log N
file accesses are required to retrieve a key, assuming
that the N keys are uniformly distributed. The number
of extra accesses is also estimated and shown to be
very low. The same holds if the cumulative distribution
function of the keys is known. Computational
experiments confirm these results.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Bar-Ilan Univ., Ramat-Gan, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "Average number of accesses; binary search; computer
programming; database; file organisation; interpolation
search; key; log; logN file accesses; ordered file;
retrieval; retrieve; searching; statistical
distribution of the keys; uniform distribution",
oldlabel = "PerlIA78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PerlIA78",
}
@Article{Halatsis:1978:PHT,
author = "Constantine Halatsis and George Philokyprou",
title = "Pseudochaining in Hash Tables",
journal = j-CACM,
volume = "21",
number = "7",
pages = "554--557",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "58 3784",
MRreviewer = "Eberhard Ludde",
bibdate = "Mon Jan 22 06:47:53 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HalatsisP78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Presentation of pseudochaining as a new
collision-resolution method. Pseudochaining is half way
between open addressing and chaining. It owes its name
to the fact that link fields are present in each cell
of the hash table which permits ``chaining'' of the
first overflow items in the table. The efficiency of
the method is derived and a tradeoff analysis is
given.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "NRC 'Demokritos', Athens, Greece",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "collision resolution method; computer programming;
efficiency; file organisation; hash tables;
pseudochaining; tradeoff analysis",
oldlabel = "HalatsisP78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HalatsisP78",
}
@Article{Lamport:1978:TCO,
author = "Leslie Lamport",
title = "Time, Clocks, and the Ordering of Events in a
Distributed System",
journal = j-CACM,
volume = "21",
number = "7",
pages = "558--565",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:57:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.misc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lamport78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The concept of one event happening before another in a
distributed system is examined, and is shown to define
a partial ordering of the events. A distributed
algorithm is given for synchronizing a system of
logical clocks which can be used to totally order the
events. The use of the total ordering is illustrated
with a method for solving synchronization problems. The
algorithm is then specialized for synchronizing
physical clocks, and a bound is derived on how far out
of synchrony the clocks can become.",
acknowledgement = ack-nhfb,
annote = "Classic paper on logical clocks. A classic paper on
synchronization. Reproduced in ``Distributed Computing:
Concepts and Implementations'' edited by McEntire,
O'Reilly and Larson, IEEE, 1984. The concept of one
event happening before another in a distributed system
is examined, and is shown to define a partial ordering
of the events. A distributed algorithm is given for
synchronising a system of logical clocks which can be
used to totally order the events. The use of the total
ordering is illustrated with a method for solving
synchronisation problems. The algorithm is then
specialised for synchronising physical clocks, and a
bound is derived on how far out of synchrony the clocks
can become.",
classcodes = "C6150J (Operating systems)",
classification = "723",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "5.29 distributed processing computer networks
multiprocessing programs ordering of events distributed
system synchronising total ordering clocks computer
networks multiprocessing bsatya enm; clock
synchronization; clocks; computer networks; computer
operating systems; distributed computer systems;
distributed processing; distributed system; distributed
systems; dmp; grecommended91 CR categories: 4.32; jw;
multiprocess systems; multiprocessing; ordering;
ordering of events; programs; synchronising; total",
oldlabel = "Lamport78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport78",
}
@Article{Baker:1978:SBL,
author = "Henry Givens {Baker, Jr.}",
title = "Shallow Binding in {Lisp 1.5}",
journal = j-CACM,
volume = "21",
number = "7",
pages = "565--569",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 27 14:28:05 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/lisp.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Baker78a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Shallow binding is a scheme which allows the value of
a variable to be accessed in a bounded amount of
computation. An elegant model for shallow binding in
Lisp 1.5 is presented in which context-switching is an
environment tree transformation called rerooting.
Rerooting is completely general and reversible, and is
optional in the sense that a Lisp 1.5 interpreter will
operate correctly whether or not rerooting is invoked
on every context change. Since rerooting leaves ${\rm
assoc}[v, a]$ invariant, for all variables $v$ and all
environments $a$, the programmer can have access to a
rerooting primitive, shallow [], which gives him
dynamic control over whether accesses are shallow or
deep, and which affects only the speed of execution of
a program, not its semantics.",
acknowledgement = ack-nhfb,
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; context switching;
environment; LISP; LISP 1.5; rerooting; shallow
binding; tree transformation",
oldlabel = "Baker78a",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Baker78a",
}
@Article{Samet:1978:PCH,
author = "Hanan Samet",
title = "Proving the Correctness of Heuristically Optimized
Code",
journal = j-CACM,
volume = "21",
number = "7",
pages = "570--582",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:18:16 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Samet78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A system for proving that programs written in a high
level language are correctly translated to a low level
language is described. A primary use of the system is
as a postoptimization step in code generation. The low
level language programs need not be generated by a
compiler and in fact could be hand coded. Examples of
the usefulness of such a system are given. Some
interesting results are the ability to handle programs
that implement recursion by bypassing the start of the
program, and the detection and pinpointing of a wide
class of errors in the low level language programs. The
examples demonstrate that optimization of the genre of
this paper can result in a substantially faster
operation and the saving of memory in terms of program
and stack sizes.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150C
(Compilers, interpreters and other processors); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Univ. of Maryland, College Park, MO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "code generation; compiler; computer programming
languages; correctness proving; heuristically optimised
code; high level language; low level language;
postoptimisation; program compilers; program testing",
oldlabel = "Samet78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Samet78",
}
@Article{Shostak:1978:ARA,
author = "Robert E. Shostak",
title = "An Algorithm for Reasoning About Equality",
journal = j-CACM,
volume = "21",
number = "7",
pages = "583--585",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "02-04 02B10",
MRnumber = "58 4976",
MRreviewer = "A. Pliuskeviciene",
bibdate = "Mon Jan 22 07:21:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Shostak78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple technique for reasoning about equalities that
is fast and complete for ground formulas with function
symbols and equality is presented. A proof of
correctness is given as well.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Stanford Res. Inst., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer programming; correctness;
equality; program testing; reasoning; theorem proving",
oldlabel = "Shostak78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shostak78",
}
@Article{Chattergy:1978:AAC,
author = "Rahul Chattergy and Udo W. Pooch",
title = "Analysis of the Availability of Computer Systems Using
Computer-Aided Algebra",
journal = j-CACM,
volume = "21",
number = "7",
pages = "586--591",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "60K20 (68A15)",
MRnumber = "58 3091",
MRreviewer = "Ralph L. Disney",
bibdate = "Mon Jan 22 06:30:37 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#ChattergyP78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Analytical results, related to the availability of a
computer system constructed of unreliable processors,
are presented in this paper. These results are obtained
by using various computer-aided algebraic manipulation
techniques. A major purpose of this paper is to
demonstrate that the difficulties of obtaining
analytical solutions to Markov processes can be
considerably reduced by the application of symbol
manipulation programs. Since many physical systems can
be modeled by Markov and semi-Markov processes, the
potential range of application of these techniques is
much wider than the problem of availability analyzed.",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C5420 (Mainframes and
minicomputers)",
classification = "722; 723",
corpsource = "Univ. of Hawaii, Honolulu, HI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algebraic manipulation; availability; computer
systems; computer systems, digital; manipulation;
Markov processes; real-time systems; reliability;
symbol; unreliable processors",
oldlabel = "ChattergyP78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChattergyP78",
}
@Article{Snyder:1978:BRE,
author = "Lawrence Snyder",
title = "{B-Trees} Re-examined",
journal = j-CACM,
volume = "21",
number = "7",
pages = "594--594",
month = jul,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:40:20 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Snyder:1978:BTR,
author = "Lawrence Snyder",
title = "On {B}-trees Re-examined",
journal = j-CACM,
volume = "21",
number = "7",
pages = "594--??",
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:04 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Snyder78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Snyder78",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Snyder78",
}
@Article{Backus:1978:CPL,
author = "John Backus",
title = "Can Programming Be Liberated From the {von Neumann}
Style? {A} Functional Style and its Algebra of
Programs",
journal = j-CACM,
volume = "21",
number = "8",
pages = "613--641",
month = aug,
year = "1978",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359576.359579",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:32 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1978.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.misc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Backus78;
https://www.math.utah.edu/pub/bibnet/authors/v/von-neumann-john.bib;
https://www.math.utah.edu/pub/mirrors/ftp.ira.uka.de/bibliography/Compiler/bcp.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Reproduced in {\em Selected Reprints on Dataflow and
Reduction Architectures}, ed. S. S. Thakkar, IEEE,
1987, pp. 215--243, and in {\em ACM Turing Award
Lectures: The First Twenty Years}, ACM Press, 1987, pp.
63--130",
URL = "http://www.stanford.edu/class/cs242/readings/backus.pdf",
abstract = "Conventional programming languages are growing ever
more enormous, but not stronger. Inherent defects at
the most basic level cause them to be both fat and
weak: their primitive word-at-a-time style of
programming inherited from their common ancestor, the
von Neumann computer; their division of programming
into a world of expressions and a world of statements;
their inability to effectively use powerful combining
forms for building new programs from existing ones; and
their lack of useful mathematical properties for
reasoning about programs. An alternative functional
style of programming is founded on the use of combining
forms for creating programs. Functional programs deal
with structured data, are often nonrepetitive and
nonrecursive, are hierarchically constructed, do not
name their arguments, and do not require the complex
machinery of procedure declarations to become generally
applicable. Combining forms can use high level programs
to build still higher level ones in a style not
possible in conventional languages.",
acknowledgement = ack-nhfb,
annote = "Conventional programming languages are growing ever
more enormous, but not stronger. Inherent defects at
the most basic level cause them to be both fat and
weak: their primitive word-at-a-time style of
programming inherited from their common ancestor - the
von Neumann computer, their close coupling of semantics
to state transitions, their division of programming
into a world of expressions and a world of statements,
their inability to effectively \ldots{}",
classcodes = "C6140 (Programming languages)",
classification = "723",
corpsource = "IMB Res. Lab., San Jose, CA, USA",
descriptors = "Programming language; reliability; future outlook; von
Neumann computer; applicative computing system",
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "4.29; 5.20; 5.24; 5.26; algebra of programs;
applicative computing systems; combining forms;
computer metatheory; conventional languages; CR
categories: 4.20; functional style; grecommended91; Key
words and phrases: functional programming;
metacomposition; models of computing systems; program
correctness; program termination; program
transformation; programming languages; Rhighnam;
structured data; theory ak; Turing Award Lecture; von
Neuman style; von Neumann computers; von Neumann
languages",
oldlabel = "Backus78",
remark = "This is the 1977 ACM Turing Award Lecture.",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Backus78",
}
@Article{Kling:1978:VCS,
author = "Rob Kling",
title = "Value conflicts and social choice in electronic funds
transfer system developments",
journal = j-CACM,
volume = "21",
number = "8",
pages = "642--657",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:08 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Kling78a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7120 (Financial computing)",
corpsource = "Univ. of California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "EFT; EFTS; electronic funds transfer; privacy of
transactions; reliability; social choice; system",
oldlabel = "Kling78a",
treatment = "E Economic; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kling78a",
}
@Article{Hirschberg:1978:FPS,
author = "Daniel S. Hirschberg",
title = "Fast Parallel Sorting Algorithms",
journal = j-CACM,
volume = "21",
number = "8",
pages = "657--661",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C25",
MRnumber = "80c:68028",
MRreviewer = "J. Misra",
bibdate = "Mon Jan 22 06:50:12 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Hirschberg78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A parallel bucket-sort algorithm is presented that
requires time O(log n) and the use of n processors. The
algorithm makes use of a technique that requires more
space than the product of processors and time. A
realistic model is used in which no memory contention
is permitted. A procedure is also presented to sort n
numbers in time O(k log n) using n**1** plus **1**/**k
processors, for k an arbitrary integer. The model of
computation for this procedure permits simultaneous
fetches from the same memory location.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
classification = "723",
comment = "``A parallel bucket--sort algorithm is presented that
requires time $O(\log n)$ and the use of $n$
processors. The algorithm makes use of a technique that
requires more space than the product of processors and
time. A realistic model is used in which no memory
contention is permitted. A procedure is also presented
to sort $n$ numbers in time $O(k \log n)$ using
$n^{1+1/k}$ processors, for $k$ an arbitrary integer.
The model of computation for this procedure permits
simultaneous fetches from the same memory location.''",
corpsource = "Rice Univ., Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bucket sort algorithm; computer programming ---
Subroutines; computer systems programming; parallel
processing; parallel sorting algorithms; sorting",
oldlabel = "Hirschberg78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hirschberg78",
}
@Article{Morris:1978:TSE,
author = "F. Lockwood Morris",
title = "A Time- and Space-Efficient Garbage Compaction
Algorithm",
journal = j-CACM,
volume = "21",
number = "8",
pages = "662--665",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:06 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Morris78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Given an area of storage containing scattered, marked
nodes of differing sizes, one may wish to rearrange
them into a compact mass at one end of the area while
revising all pointers to marked nodes to show their new
locations. An algorithm is described which accomplishes
this task in linear time relative to the size of the
storage area, and in a space of the order of one bit
for each pointer. The algorithm operates by reversibly
encoding the situation (that a collection of locations
point to a single location) by a linear list, emanating
from the pointed-to location, passing through the
pointing locations, and terminating with the pointed-to
location's transplanted contents.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Syracuse Univ., Syracuse, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems --- Storage Allocation;
computer programming; encoding; garbage compaction
algorithm; pointers; pointing locations; reversibly;
storage; storage management",
oldlabel = "Morris78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris78",
}
@Article{Hoare:1978:CSP,
author = "C. A. R. Hoare",
title = "Communicating Sequential Processes",
journal = j-CACM,
volume = "21",
number = "8",
pages = "666--677",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:24 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.misc.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Hoare78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Hoare:1978:CCS}.",
abstract = "This paper suggests that input and output are basic
primitives of programming and that parallel composition
of communicating sequential processes is a fundamental
program structuring method. When combined with a
development of Dijkstra's guarded command, these
concepts are surprisingly versatile. \par
Their use is illustrated by sample solutions of a
variety of familiar programming exercises.",
acknowledgement = ack-nhfb,
annote = "This paper is now expanded into an excellent book
detailed by Hoare and published by Prentice-Hall. This
paper is reproduced in Kuhn and Padua's (1981, IEEE)
survey ``Tutorial on Parallel Processing.'' Reproduced
in ``Distributed Computing: Concepts and
Implementations'' edited by McEntire, O'Reilly and
Larson, IEEE, 1984. Somewhat dated.",
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Queen's Univ., Belfast, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "4.22; 4.32 maeder biblio: synchronisation and
concurrency in processes; ak; bhibbard grecommended91;
classes; computer programming; concurrency; conditional
critical regions; coroutines; CR categories: 4.20; CSP;
data representations; Dijkstra's guarded command;
guarded commands; hcc; input; iterative arrays;
k-concurrency; k-csp; k-guarded-commands; monitors;
multiple entries; multiple exits; nondeterminacy;
output; parallel composition; parallel programming;
primitives; procedures; program; program structures;
programming; Programming; programming languages;
programming primitives; recursion; sequential
processes; structured programming; structuring method",
oldlabel = "Hoare78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hoare78",
}
@Article{Brice:1978:FCR,
author = "Richard S. Brice and James C. Browne",
title = "Feedback Coupled Resource Allocation Policies in the
Multiprogramming-Multiprocessor Computer System",
journal = j-CACM,
volume = "21",
number = "8",
pages = "678--686",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#BriceB78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Model studies of some integrated, feedback-driven
scheduling systems for multiprogrammed-multiprocessor
computer systems are presented. The basic control
variables used are the data-flow rates for the
processes executing on the CPU. The model systems
feature simulated continuous-flow and preempt-resume
scheduling of input-output activity. Attention is given
to the amount of memory resource required for effective
processing of the I/O activity (buffer space
assignment). The model studies used both
distribution-driven and trace-driven techniques. Even
relatively simple dynamic schedulers are shown to
improve system performance (as measured by user CPU
time) over that given by optimal or near-optimal static
schedulers imbedded in identical system structures and
workload environments. The improvement is greatest
under a heavy I/O demand workload.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "722; 723",
corpsource = "George Washington Univ., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "buffer space assignment; computer systems programming;
computer systems, digital; dynamic schedulers; feedback
scheduling; I/O activity; multiprogramming; scheduling;
scheduling systems",
oldlabel = "BriceB78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BriceB78",
xxtitle = "Feedback Coupled Resource Allocation Policies in the
Multiprogramming-Multicomputer System",
}
@Article{Scheuermann:1978:SAP,
author = "Peter Scheuermann and C. Robert Carlson",
title = "Self-Assessment Procedure {V}: a self-assessment
procedure dealing with database systems",
journal = j-CACM,
volume = "21",
number = "8",
pages = "687--693",
month = aug,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:22 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#ScheuermannC78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "ScheuermannC78",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ScheuermannC78",
xxtitle = "Self-Assessment Procedure {V}: Database Systems",
}
@Article{Harris:1978:AUS,
author = "R. A. Harris and J. D. Zund",
title = "An algorithm using symbolic techniques for the
{Bel-Petrov} classification of gravitational fields",
journal = j-CACM,
volume = "21",
number = "9",
pages = "715--717",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:42 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HarrisZ78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "A0270 (Computational techniques); A0420C (Fundamental
problems and general formalism in general relativity);
A0430 (Gravitational waves and radiation: theory);
C6130 (Data handling techniques); C7320 (Physics and
chemistry computing)",
corpsource = "HRB-Singer Inc., State College, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Bel; classification scheme; FORMAC; general
relativity; gravitation; gravitational fields;
gravitational waves; Petrov types; physics computing;
symbol manipulation",
oldlabel = "HarrisZ78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HarrisZ78",
}
@Article{Schwetman:1978:HSM,
author = "Herbert D. Schwetman",
title = "Hybrid Simulation Models of Computer Systems",
journal = j-CACM,
volume = "21",
number = "9",
pages = "718--723",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/simulan.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Schwetman78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A description is given of the structure and operation
of a hybrid simulation model in which both
discrete-event simulation and analytic techniques are
combined to produce efficient yet accurate system
models. In an example based on a simple hypothetical
computer system, discrete-event simulation is used to
model the arrival and activation of jobs, and a
central-server queueing network models the use of
system processors. The accuracy and efficiency of the
hybrid technique are demonstrated by comparing the
result and computational costs of the hybrid model of
the example with those of an equivalent simulation-only
model.",
acknowledgement = ack-nhfb,
classcodes = "C7430 (Computer engineering)",
classification = "722; 723",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "activation of jobs; analytic techniques; arrival;
central server queueing; computer selection and
evaluation; computer simulation; computer systems;
computer systems, digital; digital simulation; discrete
event; hypothetical computer; network; simulation;
simulation model; system",
oldlabel = "Schwetman78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Schwetman78",
}
@Article{Barth:1978:PID,
author = "Jeffrey M. Barth",
title = "A Practical Interprocedural Data Flow Analysis
Algorithm",
journal = j-CACM,
volume = "21",
number = "9",
pages = "724--736",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:39 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Barth78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new interprocedural data flow analysis algorithm is
presented and analyzed. The algorithm associates with
each procedure in a program information about which
variables may be modified, which may be used, and which
are possibly preserved by a call on the procedure, and
all of its subcalls. The algorithm is sufficiently
powerful to be used on recursive programs and to deal
with the sharing of variables which arises through
reference parameters. The algorithm is unique in that
it can compute all of this information in a single
pass, not requiring a prepass to compute calling
relationships or sharing patterns. The algorithm is
asymptotically optimal in time complexity. It has been
implemented and is practical even on programs which are
quite large.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "asymptotically; computer programming; interprocedural
data flow analysis algorithm; optimal in time
complexity; program; programming theory; recursive
programs; reference parameters",
oldlabel = "Barth78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Barth78",
}
@Article{Popek:1978:MVD,
author = "Gerald J. Popek and David A. Farber",
title = "Model for Verification of Data Security in Operating
Systems",
journal = j-CACM,
volume = "21",
number = "9",
pages = "737--749",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:58 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#PopekF78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Program verification applied to kernel architectures
forms a promising method for providing uncircumventably
secure, shared computer systems. A precise definition
of data security is developed in terms of a general
model for operating systems. This model is suitable as
a basis for verifying many of those properties of an
operating system which are necessary to assure reliable
enforcement of security. The application of this
approach to the UCLA secure operating system is also
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "722; 723",
corpsource = "Univ. of California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; computer systems, digital
--- Time Sharing; data processing; data security;
kernel architectures; model; operating systems;
operating systems (computers); security of data;
verification",
oldlabel = "PopekF78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PopekF78",
}
@Article{Denning:1978:GWS,
author = "Peter J. Denning and Donald R. Slutz",
title = "Generalized Working Sets for Segment Reference
Strings",
journal = j-CACM,
volume = "21",
number = "9",
pages = "750--759",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:35:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DenningS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The working-set concept is extended for programs that
reference segments of different sizes. The generalized
working-set policy (GWS) keeps as its resident set
those segments whose retention costs do not exceed
their retrieval costs. The GWS is a model for the
entire class of demand-fetching memory policies that
satisfy a resident-set inclusion property. A
generalized optimal policy (GOPT) is also defined; at
its operating points it minimizes aggregated retention
and swapping costs. Special cases of the cost structure
allow GWS and GOPT to simulate any known stack
algorithm, the working set, and VMIN. Efficient
procedures for computing demand curves showing swapping
load as a function of memory usage are developed for
GWS and GOPT policies. Empirical data from an actual
system are included.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Purdue Univ., Lafayette, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; demand fetching memory
policies; generalised optimal policy; generalised
working set policy; operating systems (computers);
property; resident set inclusion; retention costs;
retrieval costs; segment reference strings; storage;
storage management; swapping costs; virtual",
oldlabel = "DenningS78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DenningS78",
}
@Article{Myers:1978:CEP,
author = "Glenford J. Myers",
title = "A Controlled Experiment in Program Testing and Code
Walkthroughs\slash Inspections",
journal = j-CACM,
volume = "21",
number = "9",
pages = "760--768",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Myers78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An experiment in program testing is described that
employs 59 highly experienced data processing
professionals using seven methods to test a small PL/I
program. The results show that the popular code
walkthrough\slash inspection method was as effective as
other computer-based methods in finding errors and that
the most effective methods (in terms of errors found
and cost) employed pairs of subjects who tested the
program independently and then pooled their findings.
The study also shows that there is a tremendous amount
of variability among subjects and that the ability to
detect certain types of errors varies from method to
method.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C6150G
(Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "IBM Systems Res. Inst., Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "code; computer programming; controlled experiment;
effective; errors; experienced data processing; of
subjects; pairs; professionals; program debugging;
program testing; small PL/I program; variability;
walkthroughs/inspections",
oldlabel = "Myers78",
treatment = "P Practical; X Experimental",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Myers78",
}
@Article{Ottmann:1978:RBT,
author = "Thomas Ottmann and Hans-Werner Six and Derick Wood",
title = "Right Brother Trees",
journal = j-CACM,
volume = "21",
number = "9",
pages = "769--776",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A10",
MRnumber = "58 13898",
MRreviewer = "Stephen Soule",
bibdate = "Mon Jan 22 07:10:47 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#OttmannSW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C6120 (File
organisation)",
corpsource = "Univ. of Karlsruhe, Karlsruhe, West Germany",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "balanced trees; data structures; deletion algorithms;
file organisation; insertion algorithm; one sided
height; right brother trees; trees (mathematics)",
oldlabel = "OttmannSW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/OttmannSW78",
}
@Article{Ulrich:1978:EMD,
author = "Ernst G. Ulrich",
title = "Event Manipulation for Discrete Simulations Requiring
Large Numbers of Events",
journal = j-CACM,
volume = "21",
number = "9",
pages = "777--785",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:59 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Ulrich78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An event-manipulation system is presented consisting
of two parts. The first part addresses the familiar
problem of event scheduling efficiency when the number
of scheduled events grows large. The second part deals
with the less apparent problem of providing efficiency
and flexibility as scheduled events are accessed to be
executed. Additional features and problems dealt with
include the proper handling of simultaneous events;
that certain events must be created, scheduled, and
executed at the same points in simulated time; that
infinite loops caused by the concatenation of such
``zero-time'' events are possible and must be
diagnosed; that maintaining various event counts is
practical and economical; and that a capability for
handling ``time-displaceable'' events is desirable and
possible.",
acknowledgement = ack-nhfb,
classcodes = "C1290 (Applications of systems theory)",
classification = "723; 912",
corpsource = "Digital Equipment Corp., Maynard, MA, USA",
country = "USA",
descriptors = "Simulation; event set",
enum = "7988",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming --- Subroutines; digital
simulation; discrete simulations; event; event
scheduling efficiency; large numbers of events;
manipulation system; operations research; scheduling;
scheduling algorithms; simultaneous events; time flow
mechanisms",
language = "English",
location = "SEL: Wi",
oldlabel = "Ulrich78",
references = "0",
revision = "16/01/94",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ulrich78",
}
@Article{Maly:1978:NVM,
author = "Kurt Maly",
title = "A Note on Virtual Memory Indexes",
journal = j-CACM,
volume = "21",
number = "9",
pages = "786--787",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Maly78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Univ. of Minnesota, Minneapolis, MN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "construction; linked; maintenance; representation;
retrieval cost; virtual memory indexes; virtual
storage; within a page",
oldlabel = "Maly78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Maly78",
}
@Article{Ward:1978:RTP,
author = "Stephen A. Ward",
title = "Real Time Plotting of Approximate Contour Maps",
journal = j-CACM,
volume = "21",
number = "9",
pages = "788--790",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:28:15 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/78.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Ward78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "For output to a character-oriented device, it is
generally preferable to plot a contour map in
raster-scan order (rather than to follow individual
contour lines). A technique is described for the
production of crude contour maps on a serial
character-oriented device. The method described runs in
real time in the sense that the computation required
per output character is constant. While the contours
produced exhibit local inaccuracies, they retain the
properties of not crossing and of forming closed curves
(except where they intersect the boundaries of the
map).",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques); C7340 (Geophysics
computing)",
classification = "405; 723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "approximate contour maps; cartography; computer
graphics; contour maps; contour output; geophysics
computing; maps and mapping; oriented device; plotting;
real time; serial character",
oldlabel = "Ward78",
treatment = "A Application; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ward78",
}
@Article{Tenenbaum:1978:SDS,
author = "Aaron M. Tenenbaum",
title = "Simulations of Dynamic Sequential Search Algorithms",
journal = j-CACM,
volume = "21",
number = "9",
pages = "790--791",
month = sep,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:53 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Tenenbaum78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Brooklyn Coll., New York, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "dynamic reordering; dynamic sequential search
algorithms; list; list processing; processing;
simulation",
oldlabel = "Tenenbaum78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tenenbaum78",
}
@Article{Brainerd:1978:F,
author = "Walt Brainerd",
title = "{Fortran 77}",
journal = j-CACM,
volume = "21",
number = "10",
pages = "806--820",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:57 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Brainerd78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A compiler for Fortran 77 may be larger than one for
the 1966 standard Fortran, but not much larger than
most current compilers. The compilation should be
almost as efficient as before and the code produced
should be almost as efficient, except possible for some
of the new features such as the character data type and
some of the new types of input\slash output. In several
cases, such as DO loops (due to deletion of extended
range) and IF blocks, it should be possible to generate
even more efficient code than before. Furthermore the
modest but powerful language extensions should serve to
reduce greatly the costs of developing, maintaining,
and transporting Fortran software.",
acknowledgement = ack-nhfb,
annote = "I-O and OPEN statements.",
classcodes = "C6140D (High level languages)",
classification = "723",
corpsource = "Burroughs Corp., Encino, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; FORTRAN; FORTRAN 77;
standard FORTRAN; standards",
oldlabel = "Brainerd78",
treatment = "G General Review; N New Development",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brainerd78",
}
@Article{Towsley:1978:MPP,
author = "Donald F. Towsley and K. Mani Chandy and James C.
Browne",
title = "Models for Parallel Processing Within Programs:
Application to {CPU:I/O} and {I/O:I/O} Overlap",
journal = j-CACM,
volume = "21",
number = "10",
pages = "821--831",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:26:29 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Parallel.io.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#TowsleyCB78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Approximate queueing models for internal parallel
processing by individual programs in a multiprogrammed
system are developed. The solution technique is
developed by network decomposition. The models are
formulated in terms of CPU:I/O and I/O:I/O overlap and
applied to the analysis of these problems. The
percentage performance improvement from CPU:I/O overlap
is found to be greatest for systems which are in
approximate CPU:I/O utilization balance and for low
degrees of multiprogramming. The percentage improvement
from I/O:I/O overlap is found to be greatest for
systems in which the I/O system is more utilized than
the CPU.",
acknowledgement = ack-nhfb,
annote = "Queueing models for parallel processing by improvement
from CPU:I/O overlap if found to be greatest for
systems which are in CPU:I/O balance and for low
degrees of multiprogramming. Improvement from I/O:I/O
overlap is found to be greatest for systems in which
the I/O system is more utilized than the CPU.",
classcodes = "C1140C (Queueing theory); C6150J (Operating systems)",
classification = "722; 723",
comment = "Models CPU:I/O and I/O:I/O overlap within a program.
``Overlapping is helpful only when it allows a device
to be utilized which would not be utilized without
overlapping.'' In general the overlapping seems to
help.",
corpsource = "Univ. of Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; computer systems,
digital --- Multiprocessing; internal parallel; network
decomposition; parallel I/O; parallel processing; pario
bib; processing; queueing models; queueing theory",
oldlabel = "TowsleyCB78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TowsleyCB78",
}
@Article{Shneiderman:1978:JSF,
author = "Ben Shneiderman",
title = "Jump Searching: {A} Fast Sequential Search Technique",
journal = j-CACM,
volume = "21",
number = "10",
pages = "831--834",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:21:11 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Shneiderman78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "When sequential file structures must be used and
binary searching is not feasible, jump searching
becomes an appealing alternative. An exploration is
made of variants of the classic jump searching scheme
where the optimum jump size is the square root of the
number of records. Multiple level and variable size
jump strategies are explored, appropriate applications
are discussed and performance is evaluated.",
acknowledgement = ack-nhfb,
annote = "Explores variants of the classic jump searching scheme
where the optimum jump size is the square root of the
number of records.",
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; data structures;
database structures; file management; file
organisation; index searching; jump searching; Jump
searching; jump strategies; search strategies;
sequential file structures; sequential files;
sequential search technique",
oldlabel = "Shneiderman78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shneiderman78",
}
@Article{Chang:1978:OHM,
author = "Shi-Kuo Chang and Yin-Wah Wong",
title = "Optimal Histogram Matching by Monotone Gray Level
Transformation",
journal = j-CACM,
volume = "21",
number = "10",
pages = "835--840",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:29 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#ChangW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Investigation of the problem of optimal histogram
matching using monotone gray level transformation,
which always assigns all picture points of a given gray
level i to another gray level T(i) such that if i
greater than equivalent to j, then T(i) greater than
equivalent to T(j). The objective is to find a
transformed digital picture of a given picture such
that the sum of absolute errors between the gray level
histogram of the transformed picture and that of a
reference picture is minimized. This is equivalent to
placing k1 linearly ordered objects of different sizes
one by one into k2 linearly ordered boxes of assorted
sizes, such that the accumulated error of space
underpacked or overpacked in the boxes is minimized;
the placement function is monotonic, which ensures a
polynomial time solution to this problem. A tree search
algorithm for optimal histogram matching is presented
which has time complexity O(k1 multiplied by k2). If
the monotone property is dropped, then the problem
becomes NP-complete, even if it is restricted to k2
equals 2.",
acknowledgement = ack-nhfb,
classcodes = "C1260 (Information theory)",
classification = "723; 741",
corpsource = "Univ. of Illinois at Chicago Circle, Chicago, IL,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; complete computer programs; computer
systems programming; computerised picture processing;
histogram matching; image processing; optimal histogram
matching; tree search",
oldlabel = "ChangW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChangW78",
}
@Article{Morris:1978:CLN,
author = "Robert Morris",
title = "Counting Large Numbers of Events in Small Registers",
journal = j-CACM,
volume = "21",
number = "10",
pages = "840--842",
month = oct,
year = "1978",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359619.359627",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:07 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/bin-packing.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Morris78a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/unix.bib",
abstract = "It is possible to use a small counter to keep
approximate counts of large numbers. The resulting
expected error can be rather precisely controlled. An
example is given in which 8-bit counters (bytes) are
used to keep track of as many as 130,000 events with a
relative error which is substantially independent of
the number $n$ of events. This relative error can be
expected to be 24 percent or less 95 percent of the
time. The techniques could be used to advantage in
multichannel counting hardware or software used for the
monitoring of experiments or processes.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; counting; data handling;
multichannel counting hardware",
oldlabel = "Morris78a",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Morris78a",
}
@Article{McMaster:1978:AAD,
author = "Colin L. McMaster",
title = "An Analysis of Algorithms for the {Dutch National Flag
Problem}",
journal = j-CACM,
volume = "21",
number = "10",
pages = "842--846",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:03:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#McMaster78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{McMaster:1979:CAA}.",
abstract = "Solutions to the Dutch National Flag Problem have been
given by Dijkstra [1] and Meyer [3]. \par
Dijkstra starts with a simple program and arrives at an
improved program by refinement. Both of the algorithms
given by Dijkstra are shown to have an expected number
of swaps which is $2/3N + O(1)$ and that these values
differ at most by $1/3$ of a swap and asymptotically by
$1/4$ of a swap. The algorithm of Meyer is shown to
have expected swap complexity$ 5/9N$.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Univ. of California, Berkeley, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Algorithmic analysis; algorithmic analysis; complete
computer programs; Dutch National Flag Problem; program
refinement; programming; refinement; structured
programming",
oldlabel = "McMaster78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McMaster78",
}
@Article{Sedgewick:1978:IQP,
author = "Robert Sedgewick",
title = "Implementing {Quicksort} Programs",
journal = j-CACM,
volume = "21",
number = "10",
pages = "847--857",
month = oct,
year = "1978",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359619.359631",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Sedgewick78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See corrigendum \cite{Sedgewick:1979:CIQ}.",
abstract = "This paper is a practical study of how to implement
the Quicksort sorting algorithm and its best variants
on real computers, including how to apply various code
optimization techniques. A detailed implementation
combining the most effective improvements to Quicksort
is given, along with a discussion of how to implement
it in assembly language. Analytic results describing
the performance of the programs are summarized. A
variety of special situations are considered from a
practical standpoint to illustrate Quicksort's wide
applicability as an internal sorting method which
requires negligible extra storage.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Brown Univ., Providence, RI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "analysis of algorithms; code optimisation techniques;
code optimization; computer systems programming;
internal; Quicksort; Quicksort programs; sorting;
sorting algorithm; sorting method",
oldlabel = "Sedgewick78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sedgewick78",
}
@Article{Lyon:1978:PST,
author = "Gordon Lyon",
title = "Packed Scatter Tables",
journal = j-CACM,
volume = "21",
number = "10",
pages = "857--865",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:30 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lyon78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Scatter tables for open addressing benefit from
recursive entry displacements, cutoffs for unsuccessful
searches, and auxiliary cost functions. Compared with
conventional methods, the new techniques provide
substantially improved tables that resemble
exact-solution optimal packings. The displacements are
depth-limited approximations to an enumerative
(exhaustive) optimization, although packing costs
remain linear --- O(n) --- with table size n. The
techniques are primarily suited for important fixed
(but possibly quite large) tables for which reference
frequencies may be known: op-code tables, spelling
dictionaries, access arrays. Introduction of frequency
weights further improves retrievals, but the
enhancement may degrade cutoffs.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
classification = "723",
corpsource = "Nat. Bur. of Stand., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; costs; data handling;
open addressing; optimal packings; packed scatter
tables; packing; recursion; reference frequencies;
scatter tables",
oldlabel = "Lyon78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lyon78",
}
@Article{Easton:1978:CSV,
author = "Malcolm C. Easton and Ronald Fagin",
title = "Cold-Start Vs. Warm-Start Miss Ratios",
journal = j-CACM,
volume = "21",
number = "10",
pages = "866--872",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:19 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/storage.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#EastonF78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In a two-level computer storage hierarchy, miss ratio
measurements are often made from a ``cold start'', that
is, made with the first-level store initially empty.
For large capacities the effect on the measured miss
ratio of the misses incurred while filling the
first-level store can be significant, even for long
reference strings. Use of ``warm-start'' rather than
``cold-start'' miss ratios cast doubt on the widespread
belief that the observed ``S-shape'' of lifetime
(reciprocal of miss ratio) versus capacity curve
indicates a property of behavior of programs that
maintain a constant number of pages in main storage. It
is shown how to obtain, under simple assumptions, the
cache miss ratio for multiprogramming from cold-start
miss ratio values and how to obtain approximate
cold-start miss ratios from warm-start miss ratios.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "cache miss ratio; cold start; computer operating
systems; computer systems programming ---
Multiprogramming; hierarchy; lifetime; lifetime
function; memory hierarchy; miss ratios;
multiprogramming; operating systems (computers);
Performance Evaluation: Analytic; storage; warm start",
oldlabel = "EastonF78",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EastonF78",
}
@Article{Franta:1978:CHT,
author = "William R. Franta and Kurt Maly",
title = "A comparison of heaps and the {TL} structure for the
simulation event set",
journal = j-CACM,
volume = "21",
number = "10",
pages = "873--875",
month = oct,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:41:29 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1978.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#FrantaM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1290 (Applications of systems theory); C6130 (Data
handling techniques)",
corpsource = "Univ. of Minnesota, Minneapolis, MN, USA",
country = "USA",
descriptors = "Simulation",
enum = "1005",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "data handling; event set; heaps; operations research;
Simulation; simulation event set; TL structure",
language = "English",
oldlabel = "FrantaM78",
references = "0",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FrantaM78",
}
@Article{Lyons:1978:SDE,
author = "Norman R. Lyons",
title = "Systems Design Education: {A} Gaming Approach",
journal = j-CACM,
volume = "21",
number = "11",
pages = "889--895",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:00:31 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Lyons78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "One of the problems facing managers of computer
installations is the problem of configuring the
computer system to meet the demands made by the mix of
jobs that the computer center must service. A
management game is presented that allows the player to
configure a computer system to meet a hypothetical job
mix. The job mix is under the control of a game
administrator and can be varied to simulate a variety
of real-world situations (I/O bound jobs, compute bound
jobs, etc. ). The player of the game receives a set of
detailed reports on the cost of his choices and a
simulated run of the center operating under his
choices.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C0310 (EDP
management)",
classification = "722; 723; 912",
corpsource = "Texas Tech. Univ., Lubbock, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer installation; computer installation
management; computer installations; computer science
education; computer systems, digital; configuring the
computer system; cost; DP; management; management game;
mix; of jobs",
oldlabel = "Lyons78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lyons78",
}
@Article{Wendorf:1978:SEM,
author = "J. W. Wendorf",
title = "A Simply Extended and Modified Batch Environment
Graphical System (Sembegs)",
journal = j-CACM,
volume = "21",
number = "11",
pages = "897--904",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:17 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.78.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Wendorf78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "SEMBEGS is a complete batch environment graphical
system containing components for handling graphical
data files, for displaying the contents files on a
variety of graphical hardware, and for performing
graphical batch input operations. SEMBERG is easy to
extend and modify to meet the growing needs of a large
batch environment, and is even extendable to a fully
interactive system. The paper presents the conceptual
view of graphics leading to the design of SEMBEGS and
outlines the major components of the system. The design
of SEMBEGS is founded upon the basic assumption that
the true aim of computer graphics is to describe
graphical entities, rather than, as commonly held, to
provide graphical input and output functional
capabilities. SEMBEGS is built around a Basic Graphical
Data Management System (BAGDAMS) which provides a
common means of communicating the descriptions of
graphical entities between the various components of
SEMBEGS. BAGDAMS provides facilities for storing,
retrieving, and manipulating the descriptions of
graphical entities provided by, and received by
application programs, graphics packages, and graphical
devices.",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques); C6150E (General utility
programs)",
classification = "723",
corpsource = "Univ. of Waterloo, Waterloo, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "BAGDAMS; Basic Graphical Data; batch; batch
environment; batch processing (computers); computer
graphics; displaying; extend; files; fully interactive
system; graphical batch input operations; graphical
data; graphical system; Management System; modify;
SEMBEGS",
oldlabel = "Wendorf78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Wendorf78",
}
@Article{Kumar:1978:PEH,
author = "B. Kumar and Edward S. Davidson",
title = "Performance Evaluation of Highly Concurrent Computers
by Deterministic Simulation",
journal = j-CACM,
volume = "21",
number = "11",
pages = "904--913",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:38 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#KumarD78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Simulation is presented as a practical technique for
performance evaluation of alternative configurations of
highly concurrent computers. A technique is described
for constructing a detailed deterministic simulation
model of a system. In the model a control stream
replaces the instruction and data streams of the real
system. Simulation of the system model yields the
timing resource usage statistics needed for performance
evaluation, without the necessity of emulating the
system. As a case study, the implementation of a
simulation of a model of the CPU-memory subsystem of
the IBM 360\slash 191 is described. The results of
evaluating some alternative system designs are
discussed. The experiments reveal that, for the case
study, the major bottlenecks in the system are the
memory unit and the fixed point unit. Further, it
appears that many of the sophisticated pipelining and
buffering techniques implemented in the architecture of
the IBM 360\slash 91 are of little value when
high-speed (cache) memory is used, as in the IBM
360\slash 195.",
acknowledgement = ack-nhfb,
classcodes = "C5220 (Computer architecture); C6150G (Diagnostic,
testing, debugging and evaluating systems); C7430
(Computer engineering)",
classification = "722; 723",
corpsource = "Univ. of Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer selection and evaluation; computer systems,
digital; CPU memory subsystem; deterministic
simulation; highly concurrent computers; IBM 360/91;
multiprocessing systems; performance evaluation;
virtual machines",
oldlabel = "KumarD78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KumarD78",
}
@Article{Horn:1978:USI,
author = "Berthold K. P. Horn and Brett L. Bachman",
title = "Using Synthetic Images to Register Real Images with
Surface Models",
journal = j-CACM,
volume = "21",
number = "11",
pages = "914--924",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:52 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#HornB78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A number of image analysis tasks can benefit from
registration of the image with a model of the surface
being imaged. Automatic navigation using visible light
or radar images requires exact alignment of such images
with digital terrain models. In addition, automatic
classification of terrain, using satellite imagery,
requires such alignment to deal correctly with the
effects of varying sun angle and surface slope. Even
inspection techniques for certain industrial parts may
be improved by this means. The required alignment is
achieved by matching the real image with a synthetic
image obtained from a surface model and known positions
of the light sources. The synthetic image intensity is
calculated using the reflectance map, a convenient way
of describing surface reflection as a function of
surface gradient. The technique is illustrated using
LANDSAT images and digital terrain models.",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automatic classification of terrain; computer
graphics; computerised picture processing; image
processing; industrial parts; inspection techniques;
real images; registration; satellite imagery; surface
models; synthetic images",
oldlabel = "HornB78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HornB78",
}
@Article{Tadikamalla:1978:CGGb,
author = "Pandu R. Tadikamalla",
title = "Computer Generation of Gamma Random Variables ---
{II}",
journal = j-CACM,
volume = "21",
number = "11",
pages = "925--928",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:18 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1978.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Tadikamalla78a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1140Z (Other topics in statistics); C7310
(Mathematics computing)",
corpsource = "Univ. of Pittsburgh, Pittsburgh, PA, USA",
country = "USA",
descriptors = "RVG",
enum = "7944",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computational; computer generation; core; gamma random
variables; nonintegral shape parameter; programming
effort; random processes; statistics; storage
requirements; times",
language = "English",
oldlabel = "Tadikamalla78a",
references = "0",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Tadikamalla78a",
}
@Article{Ripley:1978:SRO,
author = "G. David Ripley",
title = "A Simple Recovery-Only Procedure For Simple Precedence
Parsers",
journal = j-CACM,
volume = "21",
number = "11",
pages = "928--930",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:16:08 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Ripley78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A simple method is described enabling simple
precedence parsers to recover from syntax errors. No
attempt to repair errors is made, yet parsing and most
semantic processing can continue. The result is a good
``first approximation'' to syntax error handling with
negligible increase in parsing time, space, and
complexity of both the parser and its table
generator.",
acknowledgement = ack-nhfb,
classcodes = "C4210 (Formal logic); C6150C (Compilers, interpreters
and other processors); C6150G (Diagnostic, testing,
debugging and evaluating systems)",
classification = "723",
corpsource = "RCA Labs., Princeton, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "compilers; computer programming languages; debugging;
grammars; processing; program compilers; program
debugging; recovery; semantic; simple precedence
parsers; syntax errors; system; table generator",
oldlabel = "Ripley78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Ripley78",
}
@Article{Friedman:1978:NCE,
author = "Daniel P. Friedman and David S. Wise",
title = "A Note on Conditional Expressions",
journal = j-CACM,
volume = "21",
number = "11",
pages = "931--933",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:42:23 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#FriedmanW78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Evaluation of a conditional expression may succeed
even when the ``deciding predicate'' diverges and the
alternatives are records (or nodes) whose fields have
different content.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6140D (High
level languages)",
corpsource = "Indiana Univ., Bloomington, IN, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "ambiguous function; conditional expression;
conditional forms; functional; if-then-else; infinite
structures; LISP; Lisp; LISP; Parallel evaluation;
parallel evaluation; programming theory; suspending
cons",
oldlabel = "FriedmanW78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FriedmanW78",
}
@Article{BrinchHansen:1978:DPC,
author = "Per {Brinch Hansen}",
title = "Distributed Processes: {A} Concurrent Programming
Concept",
journal = j-CACM,
volume = "21",
number = "11",
pages = "934--941",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:48:16 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/os.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.synch.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Hansen78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A language concept for concurrent processes without
common variables is introduced. These processes
communicate and synchronize by means of procedure calls
and guarded regions. This concept is proposed for
real-time applications controlled by microcomputer
networks with distributed storage. The paper gives
several examples of distributed processes and shows
that they include procedures, coroutines, classes,
monitors, processes, semaphores, buffers, path
expressions, and input-output as special cases.",
acknowledgement = ack-nhfb,
annote = "Dated, but it's one of those papers that will always
be referenced. This is an early paper which proposes
having a Boolean guard at the start of a procedure. The
procedure is not allowed to execute until the guard
becomes true. This paper is also a reference for the
Shortest Job Next (SJN) scheduler.",
classcodes = "C4240 (Programming and algorithm theory); C6140D (High
level languages)",
classification = "723",
corpsource = "Univ. of Southern California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "buffers; classes; communication; computer programming
languages; concurrency; concurrent programming;
coroutines; distributed; distributed processes;
expressions; guarded command; guarded regions;
input/output; k-boolean-guards; k-shortest-job-next;
language concept; microcomputer networks; monitors;
operating synchronization; parallel processing; path;
path expressions; procedure calls; procedures;
processes; programming theory; semaphores; storage",
oldlabel = "Hansen78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hansen78",
}
@Article{Luccio:1978:PT,
author = "Fabrizio Luccio and Linda Pagli",
title = "Power Trees",
journal = j-CACM,
volume = "21",
number = "11",
pages = "941--947",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B10 (68C25)",
MRnumber = "80a:68018",
MRreviewer = "Stephen Soule",
bibdate = "Mon Jan 22 07:00:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#LuccioP78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The new class of PK trees is presented, where height
balance is maintained for the nodes lying on particular
paths. The number of nodes of a Pk tree asymptotically
grows as a power of the height, in the worst case. A
procedure for node insertion is given, and the class of
trees considered is restricted to IPk trees, which are
buildable by such a procedure. The average behavior of
such trees, studied by an extensive set of simulation
runs, is close to that of AVL trees. In particular, the
family of IPO trees whose main advantage is the reduced
number of restructurings required after node insertion,
is analyzed.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C4240 (Programming
and algorithm theory); C6120 (File organisation)",
classification = "723; 921",
corpsource = "Univ. of Pisa, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "AVL trees; binary search trees; computer metatheory;
computer programming; file organisation; height
balance; IP0 trees; IPk trees; mathematical techniques
--- Trees; node insertion; Pk trees; power trees; trees
(mathematics)",
oldlabel = "LuccioP78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/LuccioP78",
}
@Article{Sheil:1978:MST,
author = "B. A. Sheil",
title = "Median Split Trees: {A} Fast Lookup Technique for
Frequently Occurring Keys",
journal = j-CACM,
volume = "21",
number = "11",
pages = "947--958",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68H05",
MRnumber = "80a:68116",
bibdate = "Mon Jan 22 07:20:53 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Sheil78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Early work on minimal perfect hash functions.",
abstract = "Split trees are a new technique for searching sets of
keys with highly skewed frequency distributions. A
split tree is a binary search tree each node of which
contains two key values --- a node value which is a
maximally frequent key in that subtree, and a split
value which partitions the remaining keys (with respect
to their lexical ordering) between the left and right
subtrees. A median split tree (MST) uses the lexical
median of a node's descendents as its split value to
force the search tree to be perfectly balanced,
achieving both a space efficient representation of the
tree and high search speed. Unlike frequency ordered
binary search trees, the cost of a successful search of
an MST is $\log n$ bounded and very stable around
minimal values. Further, an MST can be built for a
given key ordering and set of frequencies in time $n
\log n$, as opposed to $n^2$ for an optimum binary
search tree. A discussion of the application of MST's
to dictionary lookup for English is presented, and the
performance obtained is contrasted with that of other
techniques.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C4240 (Programming
and algorithm theory); C6120 (File organisation)",
classification = "723; 921",
corpsource = "Harvard Univ., Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; fast lookup technique; file
organisation; frequently occurring keys; lexical
median; mathematical techniques --- Trees; median split
tree; searching; trees (mathematics)",
oldlabel = "Sheil78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sheil78",
}
@Article{Hoare:1978:CCS,
author = "C. A. R. Hoare",
title = "Corrigendum: {``Communicating Sequential
Processes''}",
journal = j-CACM,
volume = "21",
number = "11",
pages = "958--958",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:39:32 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib",
note = "See \cite{Hoare:1978:CSP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Freuder:1978:SCE,
author = "Eugene C. Freuder",
title = "Synthesizing Constraint Expressions",
journal = j-CACM,
volume = "21",
number = "11",
pages = "958--966",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68E99",
MRnumber = "80a:68074",
bibdate = "Mon Jan 22 06:42:15 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/lisp.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#Freuder78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also published as MIT AI MEMO 370, Cambridge, MA, USA,
1976",
abstract = "A constraint network representation is presented for a
combinatorial search problem: finding values for a set
of variables subject to a set of constraints. A theory
of consistency levels in such networks is formulated,
which is related to problems of backtrack tree search
efficiency. An algorithm is developed that can achieve
any level of consistency desired, in order to
preprocess the problem for subsequent backtrack search,
or to function as an alternative to backtrack search by
explicitly determining all solutions.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C4240 (Programming
and algorithm theory)",
classification = "723",
corpsource = "Univ. of New Hampshire, Durham, NH, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "combinatorial search; computer programming; constraint
network representation; graph colouring; LISP; problem;
programming theory; theory of consistency levels",
oldlabel = "Freuder78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Freuder78",
}
@Article{Dijkstra:1978:FGC,
author = "Edsger W. Dijkstra and Leslie Lamport and Alain J.
Martin and C. S. Scholten and E. F. M. Steffens",
title = "On-the-Fly Garbage Collection: An Exercise in
Cooperation",
journal = j-CACM,
volume = "21",
number = "11",
pages = "966--975",
month = nov,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:36:13 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/Heaps.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DijkstraLMSS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Also E. W. Dijkstra Note EWD496, June 1975.",
abstract = "As an example of cooperation between sequential
processes with very little mutual interference despite
frequent manipulations of a large shared data space, a
technique is developed which allows nearly all of the
activity needed for garbage detection and collection to
be performed by an additional processor operating
concurrently with the processor devoted to the
computation proper. Exclusion and synchronization
constraints have been kept as weak as could be
achieved; the severe complexities engendered by doing
so are illustrated.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
comment = "much overlooked algorithm, presented as more of a
concurrency exercise than a garbage collector",
corpsource = "Burroughs Corp., Al Nuenen, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; cooperation; functional
garbage collection multiprocessing cooperating
sequential processes minimised mutual exclusion
correctness concurrency memory; garbage detection;
multiprogramming; on the fly; sequential processes;
storage management",
oldlabel = "DijkstraLMSS78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DijkstraLMSS78",
}
@Article{Needham:1978:UEA,
author = "Roger M. Needham and Michael D. Schroeder",
title = "Using Encryption for Authentication in Large Networks
of Computers",
journal = j-CACM,
volume = "21",
number = "12",
pages = "993--999",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:33 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#NeedhamS78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Use of encryption to achieve authenticated
communication in computer networks is discussed.
Example protocols are presented for the establishment
of authenticated connections, for the management of
authenticated mail, and for signature verification and
document integrity guarantee. Both conventional and
public-key encryption algorithms are considered as the
basis for protocols.",
acknowledgement = ack-nhfb,
classcodes = "C5620 (Computer networks and techniques); C6130 (Data
handling techniques)",
classification = "723",
corpsource = "Xerox Palo Alto Res. Center, Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "authenticated communication; computer networks; data
processing --- Security of Data; document integrity;
encryption; guarantee; protocols; public key encryption
algorithms; security of data; signature verification",
oldlabel = "NeedhamS78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NeedhamS78",
}
@Article{Gries:1978:LSA,
author = "David Gries and Jayadev Misra",
title = "A Linear Sieve Algorithm for Finding Prime Numbers",
journal = j-CACM,
volume = "21",
number = "12",
pages = "999--1003",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "10A25 (68C25)",
MRnumber = "80d:10010",
MRreviewer = "D. H. Lehmer",
bibdate = "Mon Jan 22 06:46:37 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#GriesM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new algorithm is presented for finding all primes
between 2 and n. The algorithm executes in time
proportional to n (assuming that multiplication of
integers not larger than n can be performed in unit
time). The method has the same arithmetic complexity as
the algorithm presented by N. G. Mairson; however, this
version is perhaps simpler and more elegant. It is also
easily extended to find the prime factorization of all
integers between 2 and n in time proportional to n.",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C5230 (Digital
arithmetic methods)",
classification = "723",
corpsource = "Cornell Univ., Ithaca, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; linear sieve algorithm; number
theory; prime factorization; prime numbers",
oldlabel = "GriesM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GriesM78",
}
@Article{Peterson:1978:SOT,
author = "James L. Peterson and James R. Bitner and John H.
Howard",
title = "The Selection of Optimal Tab Settings",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1004--1007",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:23 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/siggraph/78.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#PetersonBH78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A new generation of computer terminals allows tab
settings to be selected and set by the computer. This
feature can be used to reduce the number of characters
that are needed to represent a document for
transmission and printing. An algorithm is given for
selecting the optimal set of tab stops for minimizing
the number of characters transmitted. An implementation
of the algorithm has reduced the number of characters
transmitted by from 7 to 30 percent, but requires a
prepass through the document to compute a matrix used
in determining the optimal set of tab stops. The use of
fixed tab stops, as a heuristic alternative, can
achieve about 80 percent of optimal with no prepass.",
acknowledgement = ack-nhfb,
classcodes = "C6130D (Document processing techniques); C6130 (Data
handling techniques)",
classification = "723",
corpsource = "Univ. of Texas, Austin, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; computer programming; computer terminals;
document; number; of characters; optimal tab settings;
printing; selection; transmission; word processing",
oldlabel = "PetersonBH78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PetersonBH78",
}
@Article{Wetherbe:1978:SPM,
author = "James C. Wetherbe and V. Thomas Dock",
title = "Strategic Planning Methodology for the Computing
Effort in Higher Education: an Empirical Evaluation",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1008--1015",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#WetherbeD78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The findings of a study designed to address the
pressing problems associated with the strategic
planning of the computing effort in higher education
are presented here. A planning methodology was
developed and tested through implementation at a
university. Two years after the methodology was
implemented, the effectiveness of the planning
methodology was assessed in terms of the improvement of
the delivery of computing services to the major
institutional roles of instruction, research, and
administration. Two control institutions were employed
to contrast the improvements at the test institution.
The results of the research indicate the planning
methodology significantly enhanced the delivery of
computing services.",
acknowledgement = ack-nhfb,
classcodes = "C0310 (EDP management); C7110 (Educational
administration)",
classification = "723; 901",
corpsource = "Univ. of Houston, Houston, TX, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administration; computing effort; DP management;
education; educational computing; higher; instruction;
research; strategic planning methodology; university",
oldlabel = "WetherbeD78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WetherbeD78",
}
@Article{Ibramsha:1978:DLE,
author = "M. Ibramsha and V. Rajaraman",
title = "Detection of Logical Errors in Decision Table
Programs",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1016--1025",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:51:40 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#IbramshaR78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm to detect logical errors in a
limited-entry decision table and in loop-free programs
with embedded decision tables is developed. All the
conditions in the decision tables are assumed to be
inequalities or equalities relating linear expressions.
It is also assumed that actions in a decision table are
linear in variables which occur in the condition stub
of the decision table (or tables) to which control is
transferred from the table. The algorithm is based on
determining whether a set of linear inequalities has or
does not have a solution. The algorithm is implemented
in Fortran IV.",
acknowledgement = ack-nhfb,
classcodes = "C6150G (Diagnostic, testing, debugging and evaluating
systems)",
classification = "723",
corpsource = "Indian Inst. of Technol., Kanpur, India",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; decision table programs;
decision tables; error diagnosis; logical errors;
program diagnostics",
oldlabel = "IbramshaR78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/IbramshaR78",
}
@Article{Martelli:1978:ODT,
author = "Alberto Martelli and Ugo Montanari",
title = "Optimizing Decision Trees Through Heuristically Guided
Search",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1025--1039",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A50",
MRnumber = "58 19444",
bibdate = "Mon Jan 22 07:01:56 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#MartelliM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Optimal decision table conversion has been tackled in
the literature using two approaches, dynamic
programming and branch-and-bound. The former technique
is quite effective, but its time and space requirements
are independent of how ``easy'' the given table is.
Furthermore, it cannot be used to produce good,
quasioptimal solutions The branch-and-bound technique
uses a good heuristic to direct the search, but is
cluttered up by an enormous search space, since the
number of solutions increases with the number of test
variables according to a double exponential. In this
paper authors suggest a heuristically guided top-down
search algorithm which, like dynamic programming,
recognizes identical subproblems but which can be used
to find both optimal and quasioptimal solutions. A
heuristic search method is introduced that combines the
positive aspects of the above two techniques.
Compressed tables with a large number of variables can
be handled without deriving expanded tables first.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "921",
corpsource = "Consiglio Nazionale delle Ricerche, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "decision table conversion; decision tables;
heuristically guided search; mathematical programming,
dynamic; optimal; programming theory",
oldlabel = "MartelliM78",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MartelliM78",
}
@Article{Dalal:1978:RPF,
author = "Yogen K. Dalal and Robert M. Metcalfe",
title = "Reverse Path Forwarding of Broadcast Packets",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1040--1048",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:25 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#DalalM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A broadcast packet is for delivery to all nodes of a
network. Algorithms for accomplishing this delivery
through a store-and-forward packet switching computer
network include (1) transmission of separately
addressed packets, (2) multidestination addressing, (3)
hot potato forwarding, (4) spanning tree forwarding,
and (5) source based forwarding. To this list of
algorithms is added (6) reverse path forwarding, a
broadcast routing method which exploits routing
procedures and data structures already available for
packet switching. Reverse path forwarding is a
practical algorithm for broadcast routing in
store-and-forward packet switching computer networks.
The algorithm is described as being practical because
it is not optimal according to metrics developed for
its analysis in this paper, and also because it can be
implemented in existing networks with less complexity
than that required for the known alternatives.",
acknowledgement = ack-nhfb,
classcodes = "C5620 (Computer networks and techniques)",
classification = "723",
corpsource = "Xerox Corp., Palo Alto, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "broadcast packets; broadcast routing; computer
networks; packet switching; reverse path forwarding",
oldlabel = "DalalM78",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DalalM78",
}
@Article{Guttag:1978:ADT,
author = "John V. Guttag and Ellis Horowitz and David R.
Musser",
title = "Abstract Data Types and Software Validation",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1048--1064",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15",
MRnumber = "80b:68030",
MRreviewer = "J. Paredaens",
bibdate = "Mon Jan 22 06:47:41 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/Functional.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#GuttagHM78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A data abstraction can be naturally specified using
algebraic axioms. The virtue of these axioms is that
they permit a representation-independent formal
specification of a data type. An example is given which
shows how to employ algebraic axioms at successive
levels of implementation. First, it is shown how the
use of algebraic axiomatizations can simplify the
process of proving the correctness of an implementation
of an abstract data type. Second, semi-automatic tools
are described which can be used both to automate such
proofs of correctness and to derive an immediate
implementation from the axioms. This implementation
allows for limited testing of programs at design time,
before a conventional implementation is accomplished.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150G (Diagnostic,
testing, debugging and evaluating systems)",
classification = "723",
corpsource = "Univ. of Southern California, Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data type; algebraic axiomatizations;
algebraic axioms; computer programming languages;
correctness; data abstraction; data structures;
functional; program testing; software validation;
testing of programs",
oldlabel = "GuttagHM78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GuttagHM78",
}
@Article{Spitzen:1978:EHD,
author = "Jay M. Spitzen and Karl N. Levitt and Lawrence
Robinson",
title = "An Example of Hierarchical Design and Proof",
journal = j-CACM,
volume = "21",
number = "12",
pages = "1064--1075",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:23:39 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/semantics.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm21.html#SpitzenLR78;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Hierarchical programming is being increasingly
recognized as helpful in the construction of large
programs. Users of hierarchical techniques claim or
predict substantial increases in productivity and in
the reliability of the programs produced. In this paper
we describe a formal method for hierarchical program
specification, implementation, and proof. We apply this
method to a significant list processing problem and
also discuss a number of extensions to current
programming languages that ease hierarchical program
design and proof.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723",
corpsource = "SRI Internat., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; computer programming languages;
data abstraction; hierarchical design; hierarchical
program; hierarchical structures; implementation; large
programs; list processing; productivity; Program
verification; programming languages; proof;
reliability; software modules; specification;
structured programming",
oldlabel = "SpitzenLR78",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SpitzenLR78",
}
@Article{Gries:1978:CEP,
author = "David Gries",
title = "Corrigendum: {``An exercise in proving parallel
programs correct''}",
journal = j-CACM,
volume = "21",
number = "12",
month = dec,
year = "1978",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "1048.68B10",
MRnumber = "80b:68022",
bibdate = "Tue Dec 26 13:35:07 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gries:1977:EPP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Boyse:1979:IDA,
author = "John W. Boyse",
title = "Interference Detection Among Solids and Surfaces",
journal = j-CACM,
volume = "22",
number = "1",
pages = "3--9",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:27:52 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.79.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Boyse79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In many industrial environments it is necessary to
determine whether there is interference among
components. There are many potential interference
problems in products made up of assemblies of
components and in product manufacturing and testing.
Typically, drawings are used in an attempt to detect
such unwanted interferences, but the two-dimensional,
static drafting medium does not always show
interferences among three-dimensional, moving parts. A
computer representation for solids and surfaces and
algorithms which carry out interference checking among
objects so represented are presented. Objects are
represented as polyhedra or as piecewise planar
surfaces. Two types of interference checking are
discussed: detection of intersections among objects in
fixed positions and detection of collisions among
objects moving along specified trajectories.",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques); C7440 (Civil and
mechanical engineering computing)",
classification = "723",
corpsource = "Computer Sci. Dept., General Motors Res. Labs.,
Warren, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CAD; collision detection graphics; components;
computer graphics; data processing --- Manufacturing
Applications; detection; drawings; industrial
environments; interference; interference checking;
intersection; manufacturing and testing; mechanical
engineering computing; Methodologies; Modeling
geometric design/modeling and Algorithmic Aspects
intersection determination and solids interface
detection; piecewise planar surfaces; polyhedra;
potential interference problems; product; solids;
surfaces; Techniques",
oldlabel = "Boyse79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Boyse79",
}
@Article{Colton:1979:IUC,
author = "Kent W. Colton",
title = "The impact and use of computer technology by the
police",
journal = j-CACM,
volume = "22",
number = "1",
pages = "10--20",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:32:19 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Colton79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Over the past decade there has been a significant
growth in the use of computer technology by U. S.
police departments. This growth, however, has been at a
slower rate than predicted in the early 1970's.
Further, when computer applications extend beyond
``routine'' uses to ``nonroutine'' efforts, such as
resource allocation or computer-aided-dispatch systems
where the machine begins to become a tool for decision
making, strategic planning and person\slash machine
interaction, the results of the technology to date have
been mixed. Case studies and surveys are discussed
which provide insights on the implementation and impact
of police computer technology and the relationship of
this technology to law enforcement and society.",
acknowledgement = ack-nhfb,
classcodes = "C7130 (Public administration)",
classification = "723",
corpsource = "Public Systems Evaluation, MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "command and control systems; computer aided dispatch;
computer technology; computers; data processing ---
Governmental Applications; decision; making;
person/machine interaction; police; police command and
control; police data processing; resource allocation;
strategic planning",
oldlabel = "Colton79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Colton79",
}
@Article{Bongiovanni:1979:PDB,
author = "Gian Carlo Bongiovanni and Fabrizio Luccio",
title = "Permutation of Data Blocks in a Bubble Memory",
journal = j-CACM,
volume = "22",
number = "1",
pages = "21--25",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15",
MRnumber = "80b:68026",
bibdate = "Mon Jan 22 06:27:18 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#BongiovanniL79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A common internal organization of bubble memories
consists of a set of (minor) loops, connected through
another (major) loop. The problem of obtaining any
given permutation of the minor loop contents in minimum
time is studied in this paper. A lower bound to the
number of steps required by a permutation algorithm is
derived, and the class of optimum algorithms is
identified.",
acknowledgement = ack-nhfb,
classcodes = "C5320E (Storage on stationary magnetic media); C6120
(File organisation)",
classification = "721; 723",
corpsource = "Univ. of Pisa, Pisa, Italy",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; bubble memory; computer programming ---
Subroutines; data block shift; data blocks; data
storage, magnetic; digital storage; file organisation;
magnetic film stores; memory loops; optimum;
permutation algorithm",
oldlabel = "BongiovanniL79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BongiovanniL79",
}
@Article{Sauer:1979:IDD,
author = "Charles H. Sauer and K. Mani Chandy",
title = "The Impact of Distributions and Disciplines on
Multiple Processor Systems",
journal = j-CACM,
volume = "22",
number = "1",
pages = "25--34",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:19:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#SauerC79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Simple queueing models are used to study the
performance tradeoffs of multiple processor systems.
Issues considered include the impact of CPU service
disciplines and distributions, level of
multiprogramming, multitasking, and job priorities.",
acknowledgement = ack-nhfb,
annote = "(VBI-000696)",
classcodes = "C5420 (Mainframes and minicomputers); C6150J
(Operating systems)",
classification = "722; 723",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
country = "USA",
descriptors = "Multiprocessor; queueing discipline",
enum = "11092",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming --- Multiprogramming;
computer systems, digital; CPU service; job; multiple
processor systems; multiprocessing systems;
multiprogramming; multitasking; performance;
priorities; queueing models; queueing theory;
tradeoffs",
language = "English",
oldlabel = "SauerC79",
references = "0",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/SauerC79",
}
@Article{Banatre:1979:EDC,
author = "Jean-Pierre P. Ban{\^a}tre and Jean-Paul P. Routeau
and L. Trilling",
title = "An Event-Driven Compiling Technique",
journal = j-CACM,
volume = "22",
number = "1",
pages = "34--42",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:23:05 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#BanatreRT79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Due to the linear structure of source text,
difficulties may arise in a one-pass compilation
process. These difficulties occur when an entity cannot
be processed because of a forward reference to
information only obtainable from subsequent entities.
Classic solutions ask for data structures appropriate
for each case. A technique is presented which uses
instead control structures, namely events and
processes. The work of the compiler-writer becomes
easier both conceptually and in practice because he can
forget these problems at the outset and he avoids
special processing for each problem. This technique has
been applied to the construction of an Algol 68
compiler. Three examples from that implementation are
described and discussed here.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150C (Compilers,
interpreters and other processors)",
classification = "723",
corpsource = "Univ. de Rennes, Rennes, France",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "ALGOL 68 compiler; compilation; computer operating
systems --- Program Compilers; computer programming
languages; control structures; data; data structures;
forward reference to information; one pass; program
compilers; semantic analysis; source text; structures",
oldlabel = "BanatreRT79",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BanatreRT79",
}
@Article{Arsac:1979:SSS,
author = "Jacques J. Arsac",
title = "Syntactic Source to Source Transforms and Program
Manipulation",
journal = j-CACM,
volume = "22",
number = "1",
pages = "43--54",
month = jan,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:02 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Arsac79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Syntactic transforms are the source to source program
transformations which preserve the history of
computation, and thus do not modify the execution time.
Combined with a small number of primitive semantic
transforms, they provide a powerful tool for program
manipulation. A complete catalogue of syntactic
transforms, and its use for solution of a system of
program equations, is given. Examples of derivation of
more complex source to source transformations are also
presented. Two case studies illustrate the way in which
syntactic and semantic source to source transformations
may be used for development of clear, simple, and
reasonably efficient programs.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6110
(Systems analysis and programming)",
classification = "723",
corpsource = "Inst. de Programmation, Univ. Pierre et Marie Curie,
Paris, France",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; program manipulation; program
transformations; programming theory; semantic
transforms; source to source; source transforms;
structured programming; syntactic; transforms",
oldlabel = "Arsac79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Arsac79",
}
@Article{Taulbee:1979:PEP,
author = "Orrin E. Taulbee and Samuel D. Conte",
title = "Production and employment of {Ph.D.s} in computer
science --- 1977 and 1978",
journal = j-CACM,
volume = "22",
number = "2",
pages = "75--76",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:25:45 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#TaulbeeC79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Univ. of Pittsburgh, Pittsburgh, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "1977; 1978; computer science; computer science
education; employment; Ph.Ds",
oldlabel = "TaulbeeC79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TaulbeeC79",
}
@Article{Fairley:1979:ECD,
author = "Richard E. Fairley",
title = "Employment characteristics of doctoral level computer
scientists",
journal = j-CACM,
volume = "22",
number = "2",
pages = "77--78",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:38:30 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Fairley79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing)",
corpsource = "Colorado State Univ., Fort Collins, CO, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "academic; business; computer scientists; doctoral;
employment; industry; opportunities; Ph.D.;
professional aspects; work activities",
oldlabel = "Fairley79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Fairley79",
}
@Article{Gull:1979:RDS,
author = "W. E. Gull and Michael A. Jenkins",
title = "Recursive data structures in {APL}",
journal = j-CACM,
volume = "22",
number = "2",
pages = "79--96",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15 (68E10 68H05)",
MRnumber = "80b:68028",
bibdate = "Mon Jan 22 06:47:16 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#GullJ79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A mathematical study of three approaches for defining
nested array in APL is presented. Theorems exhibiting
the relationships between the definitional systems are
given and illustrated through graph representations.
One of the approaches is used to define an APL array to
be a recursive data structure equivalent to a tree
structure in which all data is stored at the leaves as
homogeneous arrays of numbers and characters. An
extension of APL is proposed that includes new
primitive functions to manipulate the nesting level of
arrays and new operators to assist in the construction
of data-driven algorithms.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6140D (High level
languages)",
classification = "723",
corpsource = "Univ. Zurich, Zurich, Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "APL; computer programming languages; data structures;
functions; nested arrays; primitive; procedure oriented
languages; recursive data structure",
oldlabel = "GullJ79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GullJ79",
}
@Article{Morel:1979:GOS,
author = "{\'E}. Morel and C. Renvoise",
title = "Global Optimization by Suppression of Partial
Redundancies",
journal = j-CACM,
volume = "22",
number = "2",
pages = "96--103",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B05",
MRnumber = "80b:68016",
bibdate = "Mon Jan 22 07:05:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/opt.compiler.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#MorelR79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Data Flow Analysis",
abstract = "The elimination of redundant computations and the
moving of invariant computations out of loops are often
done separately, with invariants moved outward loop by
loop. It is proposed to do both at once and to move
each expression directly to the entrance of the
outermost loop in which it is invariant. This is done
by solving a more general problem, i.e. the elimination
of computations performed twice on a given execution
path. Such computations are termed partially redundant.
Moreover, the algorithm does not require any graphical
information or restrictions on the shape of the program
graph. Testing this algorithm has shown that its
execution cost is nearly linear with the size of the
program, and that it leads to a smaller optimizer that
requires less execution time.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory); C6150C
(Compilers, interpreters and other processors)",
classification = "723",
corpsource = "Compagnie Internat. pour l'Informatique, Honeywell
Bull, Louveciennes, France",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; execution cost; execution time;
optimizer; partial redundancies; program; program
compilers; programming theory; redundant computations",
oldlabel = "MorelR79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MorelR79",
}
@Article{Anderson:1979:CPH,
author = "M. R. Anderson and M. G. Anderson",
title = "Comments on Perfect Hashing Functions: {A} Single
Probe Retrieving Method for Static Sets",
journal = j-CACM,
volume = "22",
number = "2",
pages = "104--105",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:27 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#AndersonA79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Corrects errors in \cite{Sprugnoli:1977:PHF}. See
corrigendum \cite{Anderson:1979:CCP}.",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Dept. of Computer and Communication Sci., Univ. of
Michigan, Ann Arbor, MI, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; data handling; perfect hashing functions;
single probe retrieving method; static sets",
oldlabel = "AndersonA79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AndersonA79",
}
@Article{Cheriton:1979:TPR,
author = "David R. Cheriton and Michael A. Malcolm and Lawrence
S. Melen and Gary R. Sager",
title = "{Thoth}, a Portable Real-Time Operating System",
journal = j-CACM,
volume = "22",
number = "2",
pages = "105--115",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:53 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#CheritonMMS79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Thoth is a real-time operating system which is
designed to be portable over a large set of machines.
It is currently running on two minicomputers with quite
different architectures. Both the system and
application programs which use it are written in a
high-level language. Because the system is implemented
by the same software on different hardware, it has the
same interface to user programs. Hence, application
programs which use Thoth are highly portable. Thoth
encourages structuring programs as networks of
communicating processes by providing efficient
interprocess communication primitives.",
acknowledgement = ack-nhfb,
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Dept. of Computer Sci., Univ. of Waterloo, Waterloo,
Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "CACM synchronization communication real time; computer
operating systems; minicomputers; online; online
operation; operating system; portable; real time;
software portability; Thoth",
oldlabel = "CheritonMMS79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CheritonMMS79",
}
@Article{Reed:1979:SES,
author = "David P. Reed and Rajendra K. Kanodia",
title = "Synchronization with Eventcounts and Sequencers",
journal = j-CACM,
volume = "22",
number = "2",
pages = "115--123",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:15:20 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Parallel/par.synch.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#ReedK79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Synchronization of concurrent processes requires
controlling the relative ordering of events in the
processes. A new synchronization mechanism is proposed,
using abstract objects called eventcounts and
sequencers, that allows processes to control the
ordering of events directly, rather than using mutual
exclusion to protect manipulation of shared variables
that control ordering of events. Direct control of
ordering seems to simplify correctness arguments and
also simplifies implementation in distributed systems.
The mechanism is defined formally, and then several
examples of its uses are given. The relationship of the
mechanism to protection mechanisms in the system is
explained; in particular, eventcounts are shown to be
applicable to situations where confinement of
information matters. An implementation of eventcounts
and sequencers in a system with shared memory is
described.",
acknowledgement = ack-nhfb,
annote = "Dated, but needs to be referenced every now and
again.",
classcodes = "C6150J (Operating systems)",
classification = "723",
corpsource = "Lab. for Computer Sci., MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems programming; concurrent processes;
distributed systems; eventcounts; operating systems
(computers); protection; sequences; shared memory;
synchronization",
oldlabel = "ReedK79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ReedK79",
}
@Article{Mendelson:1979:OSA,
author = "Haim Mendelson and Joseph S. Pliskin and Uri
Yechiali",
title = "Optimal Storage Allocation for Serial Files",
journal = j-CACM,
volume = "22",
number = "2",
pages = "124--130",
month = feb,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15",
MRnumber = "80b:68032",
bibdate = "Mon Jan 22 07:03:54 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#MendelsonPY79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A computer system uses several serial files. The files
reside on a direct-access storage device in which
storage space is limited. Records are added to the
files either by jobs in batch processing mode, or by
on-line transactions. Each transaction (or job)
generates a demand vector which designates the space
required in each file for record addition. Whenever one
file runs out of space, the system must be reorganized.
This paper considers several criteria for best
allocating storage space to the files.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Dept. of Statistics, Tel Aviv Univ., Tel Aviv,
Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; optimal; serial files;
storage allocation",
oldlabel = "MendelsonPY79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MendelsonPY79",
}
@Article{Austing:1979:CRU,
author = "Richard H. Austing and Bruce H. Barnes and Della T.
Bonnette and Gerald L. Engel and Gordon Stokes",
title = "Curriculum '78: Recommendations for the Undergraduate
Program in Computer Science --- {A} Report of the {ACM}
Curriculum Committee on Computer Science",
journal = j-CACM,
volume = "22",
number = "3",
pages = "147--166",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:22:20 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#AustingBBES79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "A report of the ACM Curriculum Committee on Computer
Science. CS 5: Introduction to File Processing (3-0-3)
Prerequisite: CS 2. The objectives of this course are:
(a) to introduce concepts and techniques of structuring
data on bulk storage devices; (2) to provide experience
in the use of bulk storage devices; and (3) to provide
the foundation for applications of data structures and
file processing techniques.",
classcodes = "C0220 (Computing education and training)",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer science; computer science education; courses;
curriculum; education; educational courses; elementary
level; intermediate level; undergraduate program",
oldlabel = "AustingBBES79",
treatment = "G General Review; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/AustingBBES79",
}
@Article{Edgar:1979:FMN,
author = "Albert D. Edgar and Samuel C. Lee",
title = "{FOCUS} Microcomputer Number System",
journal = j-CACM,
volume = "22",
number = "3",
pages = "166--177",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:37:26 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#EdgarL79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "FOCUS is a number system and supporting computational
algorithms especially useful for microcomputer control
and other signal processing applications. FOCUS has the
wide-ranging character of floating-point numbers with a
uniformity of state distributions that give FOCUS
better than a twofold accuracy advantage over an equal
word length floating-point system. FOCUS computations
are typically five times faster than single precision
fixed-point or integer arithmetic for a mixture of
operations, comparable in speed with hardware
arithmetic for many applications. Algorithms for 8-bit
and 16-bit implementations of FOCUS are included.",
acknowledgement = ack-nhfb,
classcodes = "C5230 (Digital arithmetic methods); C5250
(Microcomputer techniques)",
classification = "723",
corpsource = "Univ. of Oklahoma, Norman, OK, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; arithmetic; computational; computers,
microprocessor; digital arithmetic; floating point
numbers; FOCUS; microcomputer; microcomputer control;
microcomputers; number system; signal processing",
oldlabel = "EdgarL79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/EdgarL79",
}
@Article{Slagle:1979:ESA,
author = "James R. Slagle",
title = "Experiments with Some Algorithms that Find Central
Solutions for Pattern Classification",
journal = j-CACM,
volume = "22",
number = "3",
pages = "178--183",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:22:20 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Slagle79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In two-class pattern recognition, it is a standard
technique to have an algorithm finding hyperplanes
which separates the two classes in a linearly separable
training set. The traditional methods find a hyperplane
which separates all points in one class from all points
in the other, but such a hyperplane is not necessarily
centered in the empty space between the two classes.
Since a central hyperplane does not favor one class or
the other, it should have a lower error rate in
classifying new points and is therefore better than a
noncentral hyperplane. Six algorithms for finding
central hyperplanes are tested on three data sets.
Although frequently used in practice, the modified
relaxation algorithm is very poor. Three algorithms
which are defined in the paper are found to be quite
good.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition)",
classification = "723",
corpsource = "Naval Res. Lab., Washington, DC, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithms; central solutions; pattern classification;
pattern recognition; pattern recognition systems",
oldlabel = "Slagle79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Slagle79",
}
@Article{Deliyanni:1979:LSN,
author = "Amaryllis Deliyanni and Robert A. Kowalski",
title = "Logic and Semantic Networks",
journal = j-CACM,
volume = "22",
number = "3",
pages = "184--192",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:58 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/nonmono.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#DeliyanniK79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An extended form of semantic network is defined, which
can be regarded as a syntactic variant of the clausal
form of logic. By virtue of its relationship with
logic,the extended semantic network is provided with a
precise semantics, inference rules, and a procedural
interpretation. On the other hand, by regarding
semantic networks as an abstract data structure for the
representation of clauses, we provide a theorem-prover
with a potentially useful indexing scheme and
path-following strategy for guiding the search for a
proof.",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence); C4210 (Formal
logic)",
classification = "723",
corpsource = "Univ. of Athens, Athens, Greece",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "abstract data; computer metatheory; formal logic;
inference rules; logic; semantic networks; structure;
theorem prover; theorem proving",
oldlabel = "DeliyanniK79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DeliyanniK79",
}
@Article{Motzkin:1979:UNM,
author = "Dalia Motzkin",
title = "Use of Normal Multiplication Tables for Information
Storage and Retrieval",
journal = j-CACM,
volume = "22",
number = "3",
pages = "193--207",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:22 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Motzkin79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method is described for the organization and
retrieval of attribute based information systems, using
the normal multiplication table as a directory for the
information system. Algorithms for the organization and
retrieval of information are described. This method is
particularly suitable for queries requesting a group of
information items, all of which possess a particular
set of attributes (and possibly some other attributes
as well). Several examples are given; the results with
respect to the number of disk accesses and disk space
are compared to other common approaches. Algorithms
evaluating the appropriateness of the above approach to
a given information system are described. For a certain
class of information systems, the normal multiplication
table method yields far more rapid retrieval with a
more economical space requirement than conventional
systems. Moreover this method incorporates an improved
modification of the inverted file technique.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723; 901",
corpsource = "Univ. of Haifa, Haifa, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "attribute based information systems; directory; disk
accesses; disk space; file organisation; information
retrieval; information retrieval systems; information
storage; inverted file; normal multiplication tables;
retrieval; storage allocation",
oldlabel = "Motzkin79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Motzkin79",
}
@Article{McMaster:1979:CAA,
author = "C. L. McMaster",
title = "Corrigendum: {``An Analysis of Algorithms for the
Dutch National Flag Problem''}",
journal = j-CACM,
volume = "22",
number = "3",
pages = "207--207",
month = mar,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:42:53 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McMaster:1978:AAD}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Lesk:1979:DTD,
author = "Arthur M. Lesk",
title = "Detection of Three-Dimensional Patterns of Atoms in
Chemical Structures",
journal = j-CACM,
volume = "22",
number = "4",
pages = "219--224",
month = apr,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:32 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Lesk79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm for detecting occurrences of a
three-dimensional pattern of objects within a larger
structure is presented. The search technique presented
used the geometric structure of the pattern to define
characteristics demanded of candidates for matching.
This is useful in cases where the properties of each
atom, considered individually, do not adequately limit
the number of sets of possible matchings. Several
applications of this technique in the field of
chemistry are: (1) in pharmacology: Searching for a
common constellation of atoms in molecules possessing
similar biological activities; (2) in X-ray
crystallography: fitting a structure or a structural
fragment to a set of peaks in the electron-density
distribution of a Fourier map; (3) in chemical
documentation: retrieving from a file the structures
containing specified substructures.",
acknowledgement = ack-nhfb,
classcodes = "C7320 (Physics and chemistry computing)",
classification = "462; 482; 501; 723; 804; 901",
corpsource = "Fairleigh Dickinson Univ., Teaneck, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "atoms; chemical documentation; chemical structures;
chemistry computing; crystallography; crystallography
--- X-Ray Analysis; drug products; information science
--- Information Retrieval; pattern recognition; pattern
recognition systems; pharmacology; search; three
dimensional; X-ray",
oldlabel = "Lesk79",
treatment = "A Application",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lesk79",
}
@Article{Cale:1979:PPP,
author = "E. G. Cale and Lee L. Gremillion and J. L. McKenney",
title = "Price\slash Performance Patterns of {U.S.} Computer
Systems",
journal = j-CACM,
volume = "22",
number = "4",
pages = "225--232",
month = apr,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:14 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#CaleGM79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Econometric models of the U. S. computer market have
been developed to study the relationships between
system price and hardware performance. Single measures
of price-performance such as ``Grosch's Law'' are shown
to be so oversimplified as to be meaningless.
Multiple-regression models predicting system cost as a
function of several hardware characteristics do,
however, reveal a market dichotomy. On one hand there
exists a stable, price predictable market for larger,
general purpose computer systems. The other market is
the developing one for small business computer systems,
a market which is relatively unstable with low price
predictability.",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing)",
classification = "722",
corpsource = "Harvard Univ., Boston, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer market; computer systems, digital; digital
computers; hardware performance; price predictability;
price/performance; system price; US",
oldlabel = "CaleGM79",
treatment = "E Economic",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/CaleGM79",
xxpages = "225--233",
}
@Article{Bucci:1979:MDD,
author = "Giacomo Bucci and Donald N. Streeter",
title = "Methodology for the Design of Distributed Information
Systems",
journal = j-CACM,
volume = "22",
number = "4",
pages = "233--245",
month = apr,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:28:44 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#BucciS79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A macro model of a distributed information system is
presented. The model describes the major costs of using
an information system from the perspective of the
end-user. The model is intended to provide guidance to
the system designer by making evident the effect of
various design and operating parameters on overall cost
per transaction. The technique is illustrated by
application to the design of an interactive transaction
processing system.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "722",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems, digital; costs; design; distributed
information systems; distributed processing; macro;
methodology; model; systems analysis",
oldlabel = "BucciS79",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BucciS79",
}
@Article{Hanson:1979:MPU,
author = "Richard J. Hanson and John A. Wisniewski",
title = "A Mathematical Programming Updating Method Using
Modified {Givens} Transformations and Applied to {LP}
Problems",
journal = j-CACM,
volume = "22",
number = "4",
pages = "245--251",
month = apr,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90C05 (65F35)",
MRnumber = "80c:90096",
bibdate = "Mon Jan 22 06:48:27 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#HansonW79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An efficient and numerically stable method is
presented for the problem of updating an orthogonal
decomposition of a matrix of column (or row) vectors.
The fundamental idea is to add a column (or row)
analogous to adding an additional row of data in linear
least squares problem. A column (or row) is dropped by
a formal scaling with the imaginary unit, followed by
least squares addition of the column (or row). The
elimination process for the procedure is successive
application of the Givens transformation in modified
(more efficient) form. These ideas are illustrated with
an implementation of the revised simplex method. The
algorithm is a general purpose one that does not
account for any particular structure or sparsity in the
equations. Some suggested computational tests for
determining signs of various controlling parameters in
the revised simplex algorithm are mentioned. A simple
means of constructing test cases and some sample
computing times are presented.",
acknowledgement = ack-nhfb,
classcodes = "C1180 (Optimisation techniques)",
classification = "723",
corpsource = "Sandia Labs., Albuquerque, NM, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "linear programming; mathematical programming;
mathematical programming, linear; modified Givens;
revised simplex; transformations; updating",
oldlabel = "HansonW79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HansonW79",
}
@Article{Brelaz:1979:NMC,
author = "Daniel Br{\'e}laz",
title = "New Methods to Color the Vertices of a Graph",
journal = j-CACM,
volume = "22",
number = "4",
pages = "251--256",
month = apr,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "90B35",
MRnumber = "80c:90080",
MRreviewer = "G. Berman",
bibdate = "Mon Jan 22 06:28:02 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/clique.color.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Brelaz79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Peemoller:1983:CBM,Kubale:1985:GIE}.",
abstract = "Efficient new heuristic methods to color the vertices
of a graph are described which rely upon the comparison
of the degrees and structure of a graph. A method is
developed which is exact for bipartite graphs and is an
important part of heuristic procedures to find maximal
cliques in general graphs. Finally an exact method is
given which performs better than the Randall-Brown
algorithm and is able to color larger graphs, and the
new heuristic methods, the classical methods, and the
exact method are compared.",
acknowledgement = ack-nhfb,
annote = "Successive augmentation approach to graph coloring.
DSATUR chooses the vertex adjacent to the largest
number of distinctly colored vertices. Paper also
discusses an implicit enumeration scheme for finding an
optimal coloring using some of the principles of DSATUR
to guide the search.",
classcodes = "C1160 (Combinatorial mathematics)",
classification = "912; 921",
corpsource = "Ecole Polytech. Federale de Lausanne, Lausanne,
Switzerland",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "bipartite graphs; cliques; colouring; graph; graph
colouring; heuristic; mathematical techniques --- Graph
Theory; maximal; operations research; vertices",
oldlabel = "Brelaz79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Brelaz79",
xxtitle = "New Methods to Color Vertices of a Graph",
}
@Article{DeMillo:1979:SPP,
author = "Richard A. {De Millo} and Richard J. Lipton and Alan
J. Perlis",
title = "Social Processes and Proofs of Theorems and Programs",
journal = j-CACM,
volume = "22",
number = "5",
pages = "271--280",
month = may,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:34:51 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/softeng.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#DeMilloLP79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "It is argued that formal verifications of programs, no
matter how obtained, will not play the same key role in
the development of computer science and software
engineering as proofs do in mathematics. Furthermore
the absence of continuity, the inevitability of change,
and the complexity of specification of significantly
many real programs make the formal verification process
difficult to justify and manage. It is felt that ease
of formal verification should not dominate program
language design.",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Georgia Inst. of Technol., Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming; formal verification;
philosophical aspects; program language design;
programming theory; specification",
oldlabel = "DeMilloLP79",
treatment = "G General Review; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DeMilloLP79",
}
@Article{Chang:1979:IAD,
author = "Ernest J. H. Chang and Rosemary Roberts",
title = "An improved algorithm for decentralized
extrema-finding in circular configurations of
processes",
journal = j-CACM,
volume = "22",
number = "5",
pages = "281--283",
month = may,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:27 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/ProbAlgs.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#ChangR79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "They present a deterministic distributed algorithm for
finding the largest of a set of $n$ uniquely numbered
processes in a ring. The algorithm uses $O(n \log n)$
messages on the average and $O(n^2)$ messages in the
worst case, and does not assume that $n$ is known a
priori.",
abstract = "An improvement is presented of LeLann's algorithm for
finding the largest (or smallest) of a set of uniquely
numbered processes arranged in a circle, in which no
central controller exists and the number of processes
is not known a priori. This decentralized algorithm
uses a technique of selective message extinction in
order to achieve an average number of message passes of
order (n log n) rather than O(n**2).",
acknowledgement = ack-nhfb,
classcodes = "C4290 (Other computer theory); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. of Toronto, Ont., Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; circular configurations; computer operating
systems; computer programming --- Subroutines;
decentralized; distributed processing; distributed
systems; extrema; operating systems; operating systems
(computers); processes",
oldlabel = "ChangR79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChangR79",
}
@Article{Sterling:1979:CDC,
author = "Theodor D. Sterling",
title = "Consumer Difficulties with Computerized Transactions:
an Empirical Investigation",
journal = j-CACM,
volume = "22",
number = "5",
pages = "283--289",
month = may,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:24:13 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Sterling79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Results show that with the present state of the art,
approximately 40 percent of individuals (or households)
having average contacts with different types of
accounts experience one or more errors per year. Eighty
percent relate to billing. Attempts to correct errors
often turned out to be difficult and not always
successful. There appears to be some conflict between
computer-using organizations and their public. Also the
role of poor management packages including poor
software is indicated. While most management systems
may be adequate, results of the survey raise concerns
about the timeliness and the number of designs of very
large linked program packages (as EFT for instance).",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7100 (Business and administration); C7120
(Financial computing)",
classification = "723",
corpsource = "Simon Fraser Univ., Burnaby, BC, Canada",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "administrative data processing; billing; computerized
transactions; consumers; data processing, business;
economic and sociological; effects; errors; management;
packages",
oldlabel = "Sterling79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Sterling79",
}
@Article{Reynolds:1979:RAA,
author = "John C. Reynolds",
title = "Reasoning About Arrays",
journal = j-CACM,
volume = "22",
number = "5",
pages = "290--299",
month = may,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B10 (68E05)",
MRnumber = "80f:68018",
bibdate = "Mon Jan 22 07:15:50 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Compiler/reynolds.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Reynolds79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A variety of concepts, laws, and notations are
presented which facilitate reasoning about arrays. The
basic concepts include intervals and their partitions,
functional restriction, images, pointwise extension of
relations, ordering, single-point variation of
functions, various equivalence relations for array
values, and concatenation. The effectiveness of these
ideas is illustrated by informal descriptions of
algorithms for binary search and merging, and by a
short formal proof.",
acknowledgement = ack-nhfb,
checked = "4 September 1990",
classcodes = "C4240 (Programming and algorithm theory)",
classification = "723",
corpsource = "Syracuse Univ., Syracuse, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "arrays; binary; computer programming; concatenation;
concepts; equivalence relations; extension of
relations; functional restriction; functions; imaging;
intervals; laws; merging; notations; ordering;
partitions; pointwise; programming theory; programs;
reasoning; search; single point variation of",
oldlabel = "Reynolds79",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Reynolds79",
}
@Article{Manthey:1979:MDM,
author = "Michael J. Manthey",
title = "Model for and Discussion of Multi-Interpreter
Systems",
journal = j-CACM,
volume = "22",
number = "5",
pages = "299--309",
month = may,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:01:36 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Manthey79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A multi-interpreter system is a system in which
programs execute by virtue of being interpreted by
other programs, which themselves may either be
interpreted (i.e. nested interpreters) or run directly
on the host machine. The model reveals the anatomy of
interpreters and how these differ from procedures, and
exhibits links to protection domains and multiprocessor
architectures.",
acknowledgement = ack-nhfb,
classcodes = "C6150C (Compilers, interpreters and other
processors)",
classification = "722; 723",
corpsource = "State Univ. of New York, Buffalo, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer systems, digital; multi interpreter systems;
multiprocessor; program interpreters; programs",
oldlabel = "Manthey79",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Manthey79",
}
@Article{Lemos:1979:ISW,
author = "Ronald S. Lemos",
title = "An Implementation of Structured Walk-Throughs in
Teaching {Cobol} Programming",
journal = j-CACM,
volume = "22",
number = "6",
pages = "335--340",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:58:25 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Lemos79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming)",
corpsource = "California State Univ., Los Angeles, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "COBAL programming; computer science education;
multiple covariance; programming; structured
walk-throughs; teaching",
oldlabel = "Lemos79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lemos79",
}
@Article{Busenberg:1979:APP,
author = "Stavros N. Busenberg and Wing C. Tam",
title = "An academic program providing realistic training in
software engineering",
journal = j-CACM,
volume = "22",
number = "6",
pages = "341--345",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:29:02 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#BusenbergT79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Harvey Mudd Coll., Claremont, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Clinic program; communication skills; computer science
education; methodology; realistic training; software
design; software engineering; software project
management; team work",
oldlabel = "BusenbergT79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/BusenbergT79",
}
@Article{Alter:1979:MAF,
author = "Steven Alter",
title = "Model for Automating File and Program Design in
Business Application Systems",
journal = j-CACM,
volume = "22",
number = "6",
pages = "345--353",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:21:14 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Alter79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A model is discussed for finding an efficient
implementation of a business application system whose
logical specifications have been determined in advance.
The model views file and program design as a problem of
systematically coordinating the configurations of
datasets and computations. It uses a straightforward
search technique to determine aggregations of
computations, aggregations of datasets, device,
organization, and key order for each dataset, key order
for each computation, and access method for each
dataset-computation pair. Although computational
results are presented for a sample problem involving 54
computations and 49 datasets, the main point of the
paper is that the underlying model works
computationally and is simple enough to be adapted to
many file design situations.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
classification = "723",
corpsource = "Steven Alter and Associates Inc., San Francisco, CA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "automating file; business application; computations;
computer programming; datasets; design; file; file
organisation; program design; search technique;
software engineering; systems",
oldlabel = "Alter79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Alter79",
}
@Article{Feldman:1979:HLP,
author = "Jerome A. Feldman",
title = "High Level Programming for Distributed Computing",
journal = j-CACM,
volume = "22",
number = "6",
pages = "353--368",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:10 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Object/Nierstrasz.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Feldman79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An approach to distributed computing at the level of
general purpose programming languages is described.
Based on primitive notions of module, message, and
transaction key, the methodology is shown to be
independent of particular languages and machines. It
appears to be useful for programming a wide range of
tasks. This is part of an ambitious program of
development in advanced programming languages, and
relations with other aspects of the project are also
discussed.",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
classification = "723",
corpsource = "Univ. of Rochester, Rochester, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer programming languages; distributed computing;
distributed processing; high level programming;
message; misc modules messages; module;
multiprogramming; transaction key",
oldlabel = "Feldman79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Feldman79",
}
@Article{Sedgewick:1979:CIQ,
author = "Robert Sedgewick",
title = "Corrigendum: {``Implementing {Quicksort} Programs''}",
journal = j-CACM,
volume = "22",
number = "6",
pages = "368--368",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sat Jan 18 15:43:13 1997",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/Seiferas/1979.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Sedgewick:1978:IQP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Shapira:1979:COP,
author = "Ruth Shapira and Herbert Freeman",
title = "The Cyclic Order Property of Vertices as an Aid in
Scene Analysis",
journal = j-CACM,
volume = "22",
number = "6",
pages = "368--375",
month = jun,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:20:42 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.79.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#ShapiraF79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A cyclic-order property is defined for bodies bounded
by smooth-curved faces. The property is shown to be
useful for analyzing pictures of such bodies,
particularly when the line data extracted from the
pictures are imperfect. This property augments
previously known grammatical rules that determine the
existence of three-dimensional bodies corresponding to
given two-dimensional line-structure data.",
acknowledgement = ack-nhfb,
classcodes = "B6140C (Optical information, image and video signal
processing); C1250 (Pattern recognition); C1260
(Information theory)",
classification = "723",
corpsource = "Rensselaer Polytech. Inst., Troy, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "AI; algorithmic aspects; algorithms; computer
graphics; cyclic order; grammatical; image processing;
line data; pattern; pattern recognition; picture
processing; pictures; recognition; reconstruction;
reconstruction of objects and three-dimensional
graphics; rules; scene analysis; see Section 6;
vertices",
oldlabel = "ShapiraF79",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ShapiraF79",
}
@Article{Winograd:1979:BPL,
author = "Terry Winograd",
title = "Beyond Programming Languages",
journal = j-CACM,
volume = "22",
number = "7",
pages = "391--401",
month = jul,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:20 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Winograd79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "As computer technology matures, our growing ability to
create large systems is leading to basic changes in the
nature of programming. Current programming language
concepts will not be adequate for building and
maintaining systems of the complexity called for by the
tasks we attempt. Just as high level languages enabled
the programmer to escape from the intricacies of a
machine's order code, higher level programming systems
can provide the means to understand and manipulate
complex systems and components. In order to develop
such systems, we need to shift our attention away from
the detailed specification of algorithms, towards the
description of the properties of the packages and
objects with which we build. This paper analyzes some
of the shortcomings of programming languages as they
now exist, and lays out some possible directions for
future research.",
acknowledgement = ack-nhfb,
classcodes = "C0200 (General computer topics); C6110 (Systems
analysis and programming); C6140D (High level
languages)",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "future; higher level programming systems; Programming;
programming languages; programming systems; research;
shortcomings; systems development; technological
forecasting",
oldlabel = "Winograd79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Winograd79",
}
@Article{Preparata:1979:ORT,
author = "Franco P. Preparata",
title = "An Optimal Real-Time Algorithm for Planar Convex
Hulls",
journal = j-CACM,
volume = "22",
number = "7",
pages = "402--405",
month = jul,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C05 (68C25)",
MRnumber = "80e:68075",
bibdate = "Mon Jan 22 07:13:19 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.79.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Preparata79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm is described for the construction in
real-time of the convex hull of a set of n points in
the plane. Using an appropriate data structure, the
algorithm constructs the convex hull by successive
updates, each taking time O(log n), thereby achieving a
total processing time O(n log n).",
acknowledgement = ack-nhfb,
classcodes = "C6130B (Graphics techniques)",
classification = "723",
corpsource = "Univ. of Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "algorithm; algorithmic aspects; computer graphics;
computer programming; convex hull and mathematical
aspects; data structure; optimal; planar convex hulls;
real time",
oldlabel = "Preparata79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Preparata79",
}
@Article{Fischer:1979:SRT,
author = "Patrick C. Fischer and Robert L. Probert",
title = "Storage Reorganization Techniques for Matrix
Computation in a Paging Environment",
journal = j-CACM,
volume = "22",
number = "7",
pages = "405--415",
month = jul,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B20 (65F30)",
MRnumber = "80e:68055",
bibdate = "Mon Jan 22 06:39:42 MST 2001",
bibsource = "Compendex database;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#FischerP79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "In order to multiply matrices while minimizing the
number of page fetches required, it is often more
efficient to reorganize the data into submatrix form
and to use block multiplication rather than to use the
best known algorithms which leave the matrices stored
in row-(or column-)oriented form. An efficient method
for accomplishing this reorganization is given. This
also makes possible the derivation of an asymptotically
better bound for multiplication of matrices given in
row-oriented form by adapting the technique of Strassen
to the reorganized data. The reorganization\slash block
multiplication scheme is shown to be advantageous for
matrices and pages of realistic size; the Strassen
adaptation is not. The former scheme is also shown to
be advantageous even if the transpose of one of the
matrices is available at no additional cost.",
acknowledgement = ack-nhfb,
classcodes = "C4140 (Linear algebra); C6120 (File organisation);
C6130 (Data handling techniques)",
classification = "723",
corpsource = "Pennsylvania State Univ., University Park, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "block; computer operating systems; matrix algebra;
matrix computation; multiplication; paging;
reorganization; virtual storage",
oldlabel = "FischerP79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FischerP79",
}
@Article{Hine:1979:CRT,
author = "J. H. Hine and Isi Mitrani and S. Tsur",
title = "The Control of Response Times in Multi-Class Systems
by Memory Allocation",
journal = j-CACM,
volume = "22",
number = "7",
pages = "415--424",
month = jul,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:50:05 MST 2001",
bibsource = "Compendex database;
ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#HineMT79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "The possibility of giving different quality of service
to jobs of different classes by regulating their memory
allocation is examined in the context of a paged
computer system. Two parameterized algorithms which
partition the main memory between two classes of jobs
are considered. Initially, a closed system consisting
of a processor and paging and file devices, with fixed
number of jobs, is studied to determine optimal degrees
of multiprogramming and the proportion of processor
time devoted to each class. Applying a decomposition
approach and treating the closed system as a single
server, the response times in an open system with
external arrivals are studied. The object is to
investigate the effect of the memory allocation
parameters on the expected response times under the two
algorithms. Numerical solutions and economical lower
bounds for the expected response times as functions of
the control parameters are obtained. A way of applying
the results to systems with more than two job classes
is indicated.",
acknowledgement = ack-nhfb,
annote = "The possibility of giving different quality of service
to jobs of different classes by regulating their memory
allocation is examined in the context of a paged
computer system.",
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
classification = "723",
corpsource = "Univ. of Newcastle upon Tyne, Newcastle upon Tyne,
UK",
country = "USA",
descriptors = "Queueing network; response time; memory management;
priority; performance evaluation; memory organization;
operating system",
enum = "1369",
journal-URL = "https://dl.acm.org/loi/cacm",
journalabr = "Commun ACM",
keywords = "computer operating systems; control; memory
allocation; multiclass systems; multiprogramming;
operating systems (computers); paged computer; paging;
performance control; Queueing networks; response times;
storage; storage allocation; system; virtual; virtual
memory",
language = "English",
oldlabel = "HineMT79",
references = "13",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HineMT79",
}
@Article{Kowalski:1979:ALC,
author = "Robert A. Kowalski",
title = "Algorithm = Logic + Control",
journal = j-CACM,
volume = "22",
number = "7",
pages = "424--436",
month = jul,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:01 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Ai/prolog.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Ai/prolog.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Kowalski79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
corpsource = "Imperial Coll., London, UK",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; algorithm theory; computer programs;
control; logic; programming theory; prolog; theorem
proving",
oldlabel = "Kowalski79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kowalski79",
}
@Article{Wong:1979:SAP,
author = "J. W. Wong and G. Scott Graham",
title = "Self-Assessment Procedure {VI}: a self-assessment
procedure dealing with queueing network models of
computer systems",
journal = j-CACM,
volume = "22",
number = "8",
pages = "449--454",
month = aug,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:30:45 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#WongG79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
country = "USA",
descriptors = "Queueing system; simulation; measurement;
communication network; solved exercise; bibliography",
enum = "3335",
journal-URL = "https://dl.acm.org/loi/cacm",
language = "English",
oldlabel = "WongG79",
references = "34",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/WongG79",
}
@Article{Floyd:1979:PP,
author = "Robert W. Floyd",
title = "The Paradigms of Programming",
journal = j-CACM,
volume = "22",
number = "8",
pages = "455--460",
month = aug,
year = "1979",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359138.359140",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:40:01 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Ai/constr.logic.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Floyd79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
author-dates = "Robert W. Floyd (8 June 1936--25 September 2001)",
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Dept. of Computer Sci., Stanford Univ., Stanford, CA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer programs; languages; paradigms; programming;
structural programming",
oldlabel = "Floyd79",
remark = "This is the 1978 ACM Turing Award Lecture.",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Floyd79",
}
@Article{Hirschberg:1979:CCC,
author = "Daniel S. Hirschberg and Ashok K. Chandra and Dilip V.
Sarwate",
title = "Computing Connected Components on Parallel Computers",
journal = j-CACM,
volume = "22",
number = "8",
pages = "461--464",
month = aug,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C25 (68B20 68E10)",
MRnumber = "80h:68041",
bibdate = "Mon Jan 22 06:50:13 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Parallel/Multi.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#HirschbergCS79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "We present a parallel algorithm which uses $n^2$
processors to find the connected components of an
undirected graph with $n$ vertices in time $O(log2n)$.
An $O(\log_2n)$ time bound also can be achieved using
only $n n/\log_2n$ processors. The algorithm can be
used to find the transitive closure of a symmetric
Boolean matrix. We assume that the processors have
access to a common memory. Simultaneous access to the
same location is permitted for fetch instructions but
not for store instructions.",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C6150J (Operating
systems)",
corpsource = "Dept. of Electrical Engng., Rice Univ., Houston, TX,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "(computers); algorithm; algorithms; Boolean matrix;
connected component; connected components; fetch
instructions; file organisation; Graph theory; graph
theory; operating systems; OS; parallel; parallel
computers; parallel processing; store instructions;
time bound; transitive closure; undirected graph",
oldlabel = "HirschbergCS79",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/HirschbergCS79",
}
@Article{Dershowitz:1979:PTM,
author = "Nachum Dershowitz and Zohar Manna",
title = "Proving Termination with Multiset Orderings",
journal = j-CACM,
volume = "22",
number = "8",
pages = "465--476",
month = aug,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B10",
MRnumber = "80g:68017",
bibdate = "Mon Jan 22 06:35:41 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/obscure.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#DershowitzM79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
corpsource = "Computer Sci. Dept., Stanford Univ., Stanford, CA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "multiset orderings; program variables; programming
theory; proving the termination of programs;
termination function",
oldlabel = "DershowitzM79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/DershowitzM79",
}
@Article{Denning:1979:SPC,
author = "Dorothy E. Denning",
title = "Secure Personal Computing in an Insecure Network",
journal = j-CACM,
volume = "22",
number = "8",
pages = "476--482",
month = aug,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68A05 (68B15 94A99)",
MRnumber = "80d:68010",
bibdate = "Mon Jan 22 06:35:06 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Denning79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques)",
corpsource = "Computer Sci. Dept., Purdue Univ., West Lafayette, IN,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "communication links; confidential data; confidential
files; encoding; encryption; insecure network; secure
personal computing; security of data",
oldlabel = "Denning79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Denning79",
}
@Article{Nelson:1979:FRS,
author = "Lloyd S. Nelson",
title = "Further remark on stably updating mean and standard
deviation estimates",
journal = j-CACM,
volume = "22",
number = "8",
pages = "483--483",
month = aug,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:37 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Nelson79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming); C7310
(Mathematics computing)",
corpsource = "Appl. Math. Lab., General Electric Co., Louisville,
KY, USA",
country = "USA",
descriptors = "expectation; standard deviation; moment estimation;
numerical method",
enum = "2249",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Mean; programming; standard deviation; standard
deviation estimates; statistics; updating",
language = "English",
oldlabel = "Nelson79",
references = "3",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nelson79",
}
@Article{Feldman:1979:REC,
author = "Jerome A. Feldman and William R. Sutherland",
title = "Rejuvenating Experimental Computer Science --- {A}
Report to the {National Science Foundation} and
Others",
journal = j-CACM,
volume = "22",
number = "9",
pages = "497--502",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:39:14 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#FeldmanS79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "This report is based on the results of an NSF
sponsored workshop held in Washington, DC, on November
2, 1978. The co-authors of the report are: Gordon Bell,
Digital Equipment Corporation; Bernard A. Galler,
University of Michigan; Patricia Goldberg, IBM
Corporation; John Hamblen, University of Missouri at
Rolla; Elliot Pinson, Bell Telephone Laboratories; and
Ivan Sutherland, California Institute of Technology.
Also participating in the workshop were representatives
of NSF and other government agencies. In addition to
the authors, a number of other people have contributed
to the contents of this report. In preparation for the
original workshop, all doctorate-granting computer
science departments in the nation were asked for
comments and suggestions on the problems of
experimental computer science. A version of the current
report dated January 15 was circulated to these
departments and to a number of industrial and
government groups for criticism. The editors and
authors of this final version gratefully acknowledge
the contribution of a large number of other people at
all stages in the preparation of the report. \par
Note: Following this presentation of the report, there
is a position paper on the crisis in experimental
computer science written by the ACM Executive
Committee.",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training)",
corpsource = "Univ. of Rochester, Rochester, NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "capital equipment; computer science education;
experimental computer science; investment;
universities",
oldlabel = "FeldmanS79",
treatment = "G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/FeldmanS79",
}
@Article{McCracken:1979:AAE,
author = "Daniel D. {McCracken, CCP} and Peter J. Denning and
David H. Brandin",
title = "Addendum: An {ACM} Executive Committee Position on the
Crisis in Experimental Computer Science",
journal = j-CACM,
volume = "22",
number = "9",
pages = "503--504",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:43 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#McCrackenDB79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "McCrackenDB79",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/McCrackenDB79",
xxtitle = "An {ACM} Executive Committee Position on the Crisis in
Experimental Computer Science",
}
@Article{Galil:1979:IWC,
author = "Zvi Galil",
title = "On Improving the Worse Case Running Time of the
{Boyer--Moore} String Matching Algorithm",
journal = j-CACM,
volume = "22",
number = "9",
pages = "505--508",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68H05 (68C25)",
MRnumber = "80m:68083",
MRreviewer = "Andrew Yao",
bibdate = "Mon Jan 22 06:42:55 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Galil79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "It compares the pattern with the text from the right
end of the pattern. Whenever a mismatch occurs, it
shifts the pattern according to a precomputed table. In
the case that the text character positioned against the
last character in the pattern does not appear in the
pattern, we can immediately shift the pattern right a
distance equal to the size of the pattern. Thus, we
need to inspect only about $n/m$ characters of the text
(where $n$ and $m$ are the sizes of the text
pattern).",
classcodes = "C4240 (Programming and algorithm theory); C6130 (Data
handling techniques)",
corpsource = "Tel-Aviv Univ., Tel-Aviv, Israel",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithm; computational complexity; data handling;
running time; string matching; worst case",
oldlabel = "Galil79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Galil79",
}
@Article{Raiha:1979:OIA,
author = "Kari-Jouko R{\"a}ih{\"a} and Stuart H. Zweben",
title = "An Optimal Insertion Algorithm for One-Sided
Height-Balanced Binary Search Trees",
journal = j-CACM,
volume = "22",
number = "9",
pages = "508--512",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68C25 (68E10)",
MRnumber = "80h:68044",
bibdate = "Mon Jan 22 07:14:43 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#RaihaZ79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "An algorithm for inserting an element into a one-sided
height-balanced (OSHB) binary search tree is presented.
The algorithm operates in time $O(\log n)$, where $n$
is the number of nodes in the tree. This represents an
improvement over the best previous ly known insertion
algorithms of Hirschberg and Kosaraju, which require
time $O(\log 2n)$. Moreover, the $O(\log n)$ complexity
is optimal. Earlier results have shown that deletion in
such a structure can also be performed in $O(\log n)$
time. Thus the result of this paper gives a negative
answer to the question of whether such trees should be
the first examples of their kind, where deletion has a
smaller time complexity than insertion. Furthermore, it
can now be concluded that insertion, deletion, and
retrieval in OSHB trees can be performed in the same
time as the corresponding operations for the more
general AVL trees, to within a constant factor.
However, the insertion and deletion algorithms for OSHB
trees appear much more complicated than the
corresponding algorithms for AVL trees.",
acknowledgement = ack-nhfb,
annote = "An algorithm for inserting an element into a one-sided
height-balanced (OSHB) binary search tree is presented.
The algorithm operates in time $O(\log{N})$, where $N$
is the number of nodes in the tree. This represents an
improvement over the best previously known insertion
algorithms of Hirschberg and Kosaraju, which require
time $O(\log{N}\log{N})$.",
classcodes = "C4240 (Programming and algorithm theory); C6130 (Data
handling techniques)",
corpsource = "Univ. of Helsinki, Helsinki, Finland",
country = "USA",
descriptors = "Method; information system; search tree; graph
theory",
enum = "2486",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "binary; binary trees; data handling; height balanced;
height-balanced trees; Insertion; insertion algorithm;
one; one-sided height-balanced trees; optimal; search
trees; search trees.; sided",
language = "English",
oldlabel = "RaihaZ79",
references = "13",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/RaihaZ79",
}
@Article{Hansen:1979:PAD,
author = "Wilfred J. Hansen",
title = "Progressive acyclic digraphs --- a tool for database
integrity",
journal = j-CACM,
volume = "22",
number = "9",
pages = "513--518",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15 (68C05)",
MRnumber = "80h:68011",
bibdate = "Mon Jan 22 06:48:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Hansen79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1160 (Combinatorial mathematics); C4240 (Programming
and algorithm theory); C6160 (Database management
systems (DBMS))",
corpsource = "Univ. of Illinois, Urbana, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "database integrity; database management systems;
directed graphs; progressive acyclic digraph",
oldlabel = "Hansen79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Hansen79",
}
@Article{Nagy:1979:APM,
author = "George Nagy and Sharad G. Wagle",
title = "Approximation of Polygonal Maps by Cellular Maps",
journal = j-CACM,
volume = "22",
number = "9",
pages = "518--525",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:15 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.79.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#NagyW79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7340 (Geophysics
computing)",
corpsource = "Univ. of Nebraska, Lincoln, NE, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "and Applications; approximation; cartography; cellular
maps; data structure; data structures; geographical;
mathematical aspects; polygonal maps",
oldlabel = "NagyW79",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/NagyW79",
}
@Article{Chan:1979:CSD,
author = "Tony F. Chan and John Gregg Lewis",
title = "Computing Standard Deviations: Accuracy",
journal = j-CACM,
volume = "22",
number = "9",
pages = "526--531",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:30:13 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#ChanL79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "Four algorithms for the numerical computation of the
standard deviation of (unweighted) sampled data are
analyzed. Two of the algorithms are well-known in the
statistical and computational literature; the other two
are new algorithms specifically intended for automatic
computation. Our discussion is expository, with
emphasis on reaching a suitable definition of
``accuracy.'' Each of the four algorithms is analyzed
for the conditions under which it will be accurate. We
conclude that all four algorithms will provide accurate
answers for many problems, but two of the algorithms,
one new, one old, are substantially more accurate on
difficult problems than are the other two.",
acknowledgement = ack-nhfb,
classcodes = "C1140Z (Other topics in statistics); C7310
(Mathematics computing)",
corpsource = "Stanford Univ., Stanford, CA, USA",
country = "USA",
descriptors = "Expectation; standard deviation; moment estimation;
numerical method; comparison; runtime/storage
efficiency; rounding error; computer arithmetic",
enum = "515",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "accuracy; condition number.; least squares; Mean;
numerical computation; rounding error analysis; sampled
data; standard deviation; standard deviations;
statistics; updating estimates",
language = "English",
oldlabel = "ChanL79",
references = "11",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/ChanL79",
}
@Article{West:1979:UMV,
author = "D. H. D. West",
title = "Updating mean and variance estimates: an improved
method",
journal = j-CACM,
volume = "22",
number = "9",
pages = "532--535",
month = sep,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:29:19 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Distributed/QLD/1979.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Theory/Matrix.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#West79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
abstract = "A method of improved efficiency is given for updating
the mean and variance of weighted sampled data when an
additional data value is included in the set. Evidence
is presented that the method is stable and at least as
accurate as the best existing updating method.",
acknowledgement = ack-nhfb,
annote = "A method of improved efficiency is given for updating
the mean and variance of weighted sampled data when an
additional data value is included in the set. Evidence
is presented that the method is stable and at least as
accurate as the best existing updating method.",
classcodes = "C1140Z (Other topics in statistics); C7310
(Mathematics computing)",
corpsource = "Univ. of Dublin, Dublin, Ireland",
country = "USA",
descriptors = "Expectation; standard deviation; moment estimation;
numerical method; comparison; runtime/storage
efficiency; variance",
enum = "3271",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "efficiency; estimates; mean; Mean; removing data;
sampled data; standard deviation; statistics; updating;
updating estimates; variance; weighted",
kwds = "mean, standard deviation, variance, updating",
language = "English",
oldlabel = "West79",
references = "7",
treatment = "A Application; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/West79",
}
@Article{Laird:1979:COE,
author = "Philip D. Laird",
title = "Comment on: {``An optimal evaluation of Boolean
expressions in an online query system'' [Comm. ACM, 20,
1977, no. 5, 344--347, MR 55 \#9627] by M. Z. Hanani}",
journal = j-CACM,
volume = "22",
number = "10",
pages = "549--550",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68H05 (68B15)",
MRnumber = "81b:68118",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:57:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Laird79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation); C7250L (Non-bibliographic
retrieval systems)",
corpsource = "Shared Medical Systems Corp., King of Prussia, PA,
USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Boolean expressions; Boolean functions; file
organisation; information; information retrieval;
online query system; retrieval",
oldlabel = "Laird79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Laird79",
}
@Article{Gudes:1979:NOE,
author = "Ehud Gudes and Anthony Hoffman",
title = "A note on: {``An optimal evaluation of Boolean
expressions in an online query system'' [Comm. ACM, 20,
1977, no. 5, 344--347, MR 55 \#9627] by M. Z. Hanani}",
journal = j-CACM,
volume = "22",
number = "10",
pages = "550--553",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68H05",
MRnumber = "80k:68085",
MRreviewer = "K. H. V. Booth",
bibdate = "Mon Jan 22 06:47:10 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#GudesH79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7250L (Non-bibliographic retrieval systems)",
corpsource = "Pennsylvania State Univ., University Park, PA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "Boolean expressions; Boolean functions; information
retrieval; online query system",
oldlabel = "GudesH79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/GudesH79",
}
@Article{Anderson:1979:CCP,
author = "M. R. Anderson and M. G. Anderson",
title = "Corrigendum: {``Comments on Perfect Hashing Functions:
A Single Probe Retrieving Method for Static Sets''}",
journal = j-CACM,
volume = "22",
number = "10",
pages = "553",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Wed Dec 27 08:06:10 1995",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Corrects \cite{Anderson:1979:CPH}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Lamport:1979:PCC,
author = "Leslie Lamport",
title = "On the Proof of Correctness of a Calendar Program",
journal = j-CACM,
volume = "22",
number = "10",
pages = "554--556",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B10",
MRnumber = "80f:68017",
bibdate = "Mon Jan 22 06:57:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Lamport79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C4240 (Programming and algorithm theory)",
corpsource = "SRI Internat., Menlo Part, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "calendar program; correctness; formal specification;
programming theory; proof",
oldlabel = "Lamport79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lamport79",
}
@Article{Klint:1979:LNM,
author = "Paul Klint",
title = "Line Numbers Made Cheap",
journal = j-CACM,
volume = "22",
number = "10",
pages = "557--559",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:13 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Klint79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6110 (Systems analysis and programming)",
corpsource = "Math. Centrum, Amsterdam, Netherlands",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "execution; line number administration; programming",
oldlabel = "Klint79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Klint79",
}
@Article{Lozano-Perez:1979:APC,
author = "Tom{\'a}s Lozano-P{\'e}rez and Michael A. Wesley",
title = "An Algorithm for Planning Collision-Free Paths Among
Polyhedral Obstacles",
journal = j-CACM,
volume = "22",
number = "10",
pages = "560--570",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:50 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Graphics/imager/imager.79.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Lozano-PerezW79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7490 (Computing in other engineering fields)",
corpsource = "IBM Thomas J. Watson Res. Center, Yorktown Heights,
NY, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithmic aspects; collision avoidance algorithm;
collision free; digital simulation; forbidden
positions; intersection; intersection determination;
network; path; path planning; polyhedral obstacles;
representation of objects; safe; solids;
three-dimensional graphics; vertex",
oldlabel = "Lozano-PerezW79",
ref = "VV35",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lozano-PerezW79",
}
@Article{Morris:1979:CGC,
author = "F. L. Morris",
title = "On a Comparison of Garbage Collection Techniques",
journal = j-CACM,
volume = "22",
number = "10",
pages = "571",
month = oct,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Wed Sep 21 22:40:09 1994",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Compiler/garbage.collection.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Mayer:1979:PLB,
author = "Richard E. Mayer",
title = "A Psychology of Learning {BASIC}",
journal = j-CACM,
volume = "22",
number = "11",
pages = "589--593",
month = nov,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:02:19 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Mayer79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0220 (Computing education and training); C6110
(Systems analysis and programming); C6140D (High level
languages)",
corpsource = "Univ. of California, Santa Barbara, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "BASIC; computer science education; prestatement;
programming; transaction",
oldlabel = "Mayer79",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Mayer79",
}
@Article{Morris:1979:PSC,
author = "Robert Morris and Ken Thompson",
title = "Password Security --- {A} Case History",
journal = j-CACM,
volume = "22",
number = "11",
pages = "594--597",
month = nov,
year = "1979",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/359168.359172",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:06:11 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Database/Graefe.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Misc/security.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#MorrisT79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/unix.bib",
acknowledgement = ack-nhfb,
classcodes = "C6130 (Data handling techniques); C6150J (Operating
systems)",
corpsource = "Bell Labs., Murray Hill, NJ, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "operating systems (computers); OS; password security
scheme; remotely accessed time sharing; security of
data; system; UNIX ATT operating CACM",
oldlabel = "MorrisT79",
ort = "ordner sicherheit",
treatment = "A Application; G General Review",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/MorrisT79",
}
@Article{Peleg:1979:BSC,
author = "Shmuel Peleg and Azriel Rosenfeld",
title = "Breaking Substitution Ciphers Using a Relaxation
Algorithm",
journal = j-CACM,
volume = "22",
number = "11",
pages = "598--605",
month = nov,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:12:05 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/security.1.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#PelegR79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C1230 (Artificial intelligence)",
corpsource = "Univ. of Maryland, College Park, MD, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "artificial intelligence; computer security;
cryptography; decoding; joint letter probabilities;
letters; plaintext; relaxation; relaxation algorithm;
substitution ciphers; updating scheme",
oldlabel = "PelegR79",
ort = "ordner sicherheit",
treatment = "T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/PelegR79",
}
@Article{Tarjan:1979:SST,
author = "Robert Endre Tarjan and Andrew Chi Chih Yao",
title = "Storing a Sparse Table",
journal = j-CACM,
volume = "22",
number = "11",
pages = "606--611",
month = nov,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "68B15 (68H05)",
MRnumber = "81e:68019",
MRreviewer = "Armin Cremers",
bibdate = "Mon Jan 22 07:25:39 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#TarjanY79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C6120 (File organisation)",
corpsource = "Stanford Univ., Stanford, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "hashing; LR parsing tables; sparse table; static
table; storage allocation",
oldlabel = "TarjanY79",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/TarjanY79",
}
@Article{Shamir:1979:HSS,
author = "Adi Shamir",
title = "How to Share a Secret",
journal = j-CACM,
volume = "22",
number = "11",
pages = "612--613",
month = nov,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
MRclass = "94B99 (68E99)",
MRnumber = "80g:94070",
bibdate = "Mon Jan 22 07:20:38 MST 2001",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/security.1.bib;
ftp://ftp.ira.uka.de/pub/bibliography/Database/Wiederhold.bib;
http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Shamir79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "protection against loss of keys by dividing the data
into pieces.",
classcodes = "C6130 (Data handling techniques)",
corpsource = "MIT, Cambridge, MA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "computer security; cryptographic systems;
cryptography; encoding; key management; robust key
management schemes; security breaches; security of
data",
oldlabel = "Shamir79",
ort = "ordner sicherheit",
treatment = "P Practical; T Theoretical or Mathematical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Shamir79",
}
@Article{Kling:1979:IES,
author = "Rob Kling",
title = "Introduction to the {EFT} Symposium",
journal = j-CACM,
volume = "22",
number = "12",
pages = "639--640",
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:55:09 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Kling79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Kling79",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Kling79",
}
@Article{Kraemer:1979:OES,
author = "Kenneth L. Kraemer and Kent W. Colton",
title = "Overview of the {EFT} Symposium",
journal = j-CACM,
volume = "22",
number = "12",
pages = "641--643",
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:04 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#KraemerC79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "KraemerC79",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KraemerC79",
}
@Article{Lipis:1979:CCU,
author = "Allen H. Lipis",
title = "Costs of the Current {U}.{S}. Payments System",
journal = j-CACM,
volume = "22",
number = "12",
pages = "644--647",
month = dec,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:17 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Lipis79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C7120 (Financial computing)",
corpsource = "Electronic Banking Inc., Atlanta, GA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "banking industry; cash; credit cards; EFT; EFT
transactions; EFTS; systems",
oldlabel = "Lipis79",
treatment = "E Economic; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Lipis79",
}
@Article{Long:1979:PPE,
author = "Robert H. Long",
title = "Public Protection and Education with {EFT}",
journal = j-CACM,
volume = "22",
number = "12",
pages = "648--654",
month = dec,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:59:41 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Long79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7120 (Financial computing)",
corpsource = "Bank Administration Inst., Park Ridge, IL, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "consumers; education; EFT; EFTS; social aspects of
automation",
oldlabel = "Long79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Long79",
}
@Article{Parker:1979:VEI,
author = "Donn B. Parker",
title = "Vulnerabilities of {EFTs} to intentionally caused
losses",
journal = j-CACM,
volume = "22",
number = "12",
pages = "654--660",
month = dec,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:11:18 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Parker79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7120 (Financial computing)",
corpsource = "SRI Internat., Menlo Park, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "back-up requirements; business crimes; economics;
EFTs; EFTS; electronic funds transfer systems;
legislative actions; security; security of data",
oldlabel = "Parker79",
treatment = "P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Parker79",
}
@Article{Kraemer:1979:PVE,
author = "Kenneth L. Kraemer and Kent W. Colton",
title = "Policy, values, and {EFT} research: anatomy of a
research agenda",
journal = j-CACM,
volume = "22",
number = "12",
pages = "660--671",
month = dec,
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 06:56:05 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#KraemerC79a;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
classcodes = "C0230 (Economic, social and political aspects of
computing); C7120 (Financial computing)",
corpsource = "Univ. of California, Irvine, CA, USA",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "American society; EFT research; EFTS; social aspects
of automation",
oldlabel = "KraemerC79a",
treatment = "B Bibliography; P Practical",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/KraemerC79a",
}
@Article{Nat:1979:IS,
author = "M. van der Nat",
title = "On Interpolation Search",
journal = j-CACM,
volume = "22",
number = "12",
pages = "681--??",
year = "1979",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 22 07:07:26 MST 2001",
bibsource = "http://dblp.uni-trier.de/db/journals/cacm/cacm22.html#Nat79;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
oldlabel = "Nat79",
XMLdata = "ftp://ftp.informatik.uni-trier.de/pub/users/Ley/bib/records.tar.gz#journals/cacm/Nat79",
}
@Article{Pearson:1990:FHV,
author = "Peter K. Pearson",
title = "Fast Hashing of Variable-Length Text Strings",
journal = j-CACM,
volume = "33",
number = "6",
pages = "677--680",
month = jun,
year = "1990",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:29:07 1999",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Misc/protein.pattern.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Dittmer:1976:IEP,Dittmer:1991:NFH,Litsios:1991:NFH,Pearson:1991:NFH,Savoy:1991:NFH}.",
abstract = "Tailored to variable-length text strings, this hashing
function uses very little arithmetic and can be used
where perfect hashing is desired.",
acknowledgement = ack-nhfb,
annote = "Based on exclusive OR (XOR).",
comment = "A simple fast hashing algorithm is given for variable
length text strings. Essentially an xor is done over
all of the characters of the string and the result is
the hash value. Some analysis is done and a practical
implementation is reported on.",
journal-URL = "https://dl.acm.org/loi/cacm",
review = "ACM CR 9012-0958",
}
@Article{Sunday:1990:VFS,
author = "Daniel M. Sunday",
title = "A Very Fast Substring Search Algorithm",
journal = j-CACM,
volume = "33",
number = "8",
pages = "132--142",
month = aug,
year = "1990",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Jan 09 09:26:55 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1990.bib",
note = "See also \cite{Boyer:1977:FSS} and
\cite{Knuth:1977:FPM}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Dittmer:1991:NFH,
author = "I. Dittmer",
title = "Note on Fast Hashing of Variable Length Text Strings",
journal = j-CACM,
volume = "34",
number = "11",
pages = "118",
month = nov,
year = "1991",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Sun Jul 17 19:42:16 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Points out that Pearson's hashing algorithm
\cite{Pearson:1990:FHV} was discovered fourteen years
earlier by this author \cite{Dittmer:1976:IEP}. See
also comments in
\cite{Savoy:1991:NFH,Litsios:1991:NFH,Pearson:1991:NFH}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Savoy:1991:NFH,
author = "Jacques Savoy",
title = "Note on Fast Hashing of Variable Length Text Strings",
journal = j-CACM,
volume = "34",
number = "11",
pages = "118--119",
month = nov,
year = "1991",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:29:55 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Suggests an improvement to Pearson's hashing algorithm
\cite{Pearson:1990:FHV} that avoids secondary
clustering. Exhibits a key set for which Pearson's
algorithm produces alarming clustering. See also
comments in
\cite{Dittmer:1991:NFH,Litsios:1991:NFH,Pearson:1991:NFH}
and early work \cite{Dittmer:1976:IEP}",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Litsios:1991:NFH,
author = "James Litsios",
title = "Note on Fast Hashing of Variable Length Text Strings",
journal = j-CACM,
volume = "34",
number = "11",
pages = "118--120",
month = nov,
year = "1991",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:28:20 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Suggests a simple extension of Pearson's hashing
algorithm \cite{Pearson:1990:FHV} that supports
non-character data. See also comments in
\cite{Dittmer:1991:NFH,Savoy:1991:NFH,Pearson:1991:NFH}
and early work in \cite{Dittmer:1976:IEP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Pearson:1991:NFH,
author = "Peter Pearson",
title = "Note on Fast Hashing of Variable Length Text Strings",
journal = j-CACM,
volume = "34",
number = "11",
pages = "120",
month = nov,
year = "1991",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:29:31 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Responds to several comments
\cite{Dittmer:1991:NFH,Litsios:1991:NFH,Savoy:1991:NFH}
on the author's earlier paper \cite{Pearson:1990:FHV},
and early work \cite{Dittmer:1976:IEP}.",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Baeza-Yates:1992:NAT,
author = "Ricardo Baeza-Yates and Gaston H. Gonnet",
title = "A new approach to text searching",
journal = j-CACM,
volume = "35",
number = "10",
pages = "74--82",
month = oct,
year = "1992",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu May 30 09:41:10 MDT 1996",
bibsource = "http://www.acm.org/pubs/toc/;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1990.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "This paper describes a new linear-time string search
algorithm that can handle limited regular-expression
pattern matching {\em without\/} backtracking. See also
\cite{Knuth:1977:FPM}, \cite{Boyer:1977:FSS},
\cite{Karp:1981:ERPa}, \cite{Sunday:1990:VFS}, and
\cite{Wu:1992:FTS}.",
URL = "http://www.acm.org/pubs/toc/Abstracts/0001-0782/135243.html",
acknowledgement = ack-nhfb,
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms",
subject = "{\bf F.2.2}: Theory of Computation, ANALYSIS OF
ALGORITHMS AND PROBLEM COMPLEXITY, Nonnumerical
Algorithms and Problems, Pattern matching. {\bf H.3.3}:
Information Systems, INFORMATION STORAGE AND RETRIEVAL,
Information Search and Retrieval, Retrieval models.
{\bf H.3.3}: Information Systems, INFORMATION STORAGE
AND RETRIEVAL, Information Search and Retrieval, Search
process. {\bf H.3.3}: Information Systems, INFORMATION
STORAGE AND RETRIEVAL, Information Search and
Retrieval, Selection process. {\bf I.5.4}: Computing
Methodologies, PATTERN RECOGNITION, Applications, Text
processing.",
}
@Article{Wu:1992:FTS,
author = "Sun Wu and Udi Manber",
title = "Fast text searching allowing errors",
journal = j-CACM,
volume = "35",
number = "10",
pages = "83--91",
month = oct,
year = "1992",
CODEN = "CACMA2",
DOI = "https://doi.org/10.1145/135239.135244",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Mon Jan 06 09:13:52 1997",
bibsource = "http://www.acm.org/pubs/toc/;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1990.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "This algorithm in this paper is implemented in the
\path|agrep| program, publicly available via ANONYMOUS
FTP to \path|cs.arizona.edu| in the \path|agrep|
subdirectory. See also \cite{Baeza-Yates:1992:NAT}.",
URL = "http://www.acm.org/pubs/toc/Abstracts/0001-0782/135244.html",
abstract = "The string-matching problem is a very common problem.
We are searching for a string $ P = p_1 p_2 \ldots {}
p_m $ inside a large text file $ T = t_1 t_2 \ldots {}
t_n $, both sequences of characters from a finite
character set $ \Sigma $. The characters may be English
characters in a text file, DNA base pairs, lines of
source code, angles between edges in polygons, machines
or machine parts in a production schedule, music notes
and tempo in a musical score, and so forth. We want to
find all occurrences of $P$ in $T$; namely, we are
searching for the set of starting positions $ F = \{
i|1 \leq i \leq n - m + 1$ such that $ t_i t_{i + 1}
\ldots {} t_{i + m - 1} = P \} $. The two most famous
algorithms for this problem are the Boyer--Moore
algorithm [3] and the Knuth Morris Pratt algorithm
[10]. There are many extensions to this problem; for
example, we may be looking for a set of patterns, a
pattern with ``wild cards,'' or a regular expression.
String-matching tools are included in every reasonable
text editor, word processor, and many other
application",
acknowledgement = ack-nhfb,
fjournal = "Communications of the ACM",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms",
subject = "{\bf F.2.2}: Theory of Computation, ANALYSIS OF
ALGORITHMS AND PROBLEM COMPLEXITY, Nonnumerical
Algorithms and Problems, Pattern matching. {\bf H.3.3}:
Information Systems, INFORMATION STORAGE AND RETRIEVAL,
Information Search and Retrieval, Search process. {\bf
I.5.4}: Computing Methodologies, PATTERN RECOGNITION,
Applications, Text processing.",
}
@Article{Knuth:1974:SPG,
author = "Donald E. Knuth",
title = "Structured Programming with {\bf go to} Statements",
journal = j-COMP-SURV,
volume = "6",
number = "4",
pages = "261--301",
month = dec,
year = "1974",
CODEN = "CMSVAN",
ISSN = "0360-0300 (print), 1557-7341 (electronic)",
bibdate = "Sat Aug 27 10:36:49 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Reprinted with revisions in {\sl Current Trends in
Programming Methodology}, Raymond T. Yeh, ed., {\bf 1}
(Englewood Cliffs, NJ: Prentice-Hall, 1977), 140--194;
{\sl Classics in Software Engineering}, Edward Nash
Yourdon, ed.\ (New York: Yourdon Press, 1979),
259--321. Reprinted with ``final'' revisions in
\cite[pp. 17--89]{Knuth:1992:LP}. This paper is a
response to \cite{Dijkstra:1968:GSC}.",
acknowledgement = ack-nhfb,
}
@Article{Graham:1976:FUL,
author = "Susan L. Graham and Mark Wegman",
title = "A Fast and Usually Linear Algorithm for Global Flow
Analysis",
journal = j-J-ACM,
volume = "23",
number = "1",
pages = "172--202",
month = jan,
year = "1976",
CODEN = "JACOAH",
ISSN = "0004-5411 (print), 1557-735X (electronic)",
bibdate = "Thu Apr 29 17:25:34 1999",
bibsource = "Compendex database;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Graham:1975:FUL}.",
abstract = "A new algorithm for global flow analysis on reducible
graphs is presented. The algorithm is shown to treat a
very general class of function spaces. For a graph of e
edges, the algorithm has a worst-case time bound of 0(e
log e) function operations. It is also shown that in
programming terms, the number of operations is
proportional to e plus the number of exits from program
loops. Consequently a restriction to one-entry one-exit
control structures guarantees linearity. The algorithm
can be extended to yet larger classes of function
spaces and graphs by relaxing the time bound. Examples
are given of code improvement problems which can be
solved using the algorithm.",
acknowledgement = ack-nhfb,
classification = "723; 921",
journalabr = "J Assoc Comput Mach",
keywords = "computer programming; mathematical programming",
}
@Article{Brown:1972:CSC,
author = "R. J. Brown",
title = "Chromatic scheduling and the chromatic number
problem",
journal = j-MANAGEMENT-SCIENCE,
volume = "19",
pages = "451--463",
year = "1972",
CODEN = "MSCIAM",
ISSN = "0025-1909 (print), 1526-5501 (electronic)",
bibdate = "Thu Apr 29 17:31:42 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Kubale:1985:GIE}.",
acknowledgement = ack-nhfb,
annote = "Implicit enumeration algorithm [not seen].",
}
@Article{Knuth:1977:FPM,
author = "Donald E. Knuth and J. H. Morris and V. R. Pratt",
title = "Fast pattern matching in strings",
journal = j-SIAM-J-COMPUT,
volume = "6",
number = "2",
pages = "323--350",
month = jun,
year = "1977",
CODEN = "SMJCAT",
ISSN = "0097-5397 (print), 1095-7111 (electronic)",
bibdate = "Tue Feb 6 05:29:37 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib",
note = "See also \cite{Boyer:1977:FSS} and
\cite{Sunday:1990:VFS}.",
acknowledgement = ack-nhfb,
}
@TechReport{Karp:1981:ERPa,
author = "R. M. Karp and M. O. Rabin",
title = "Efficient Randomized Pattern-Matching Algorithms",
type = "Technical report",
number = "TR-31-81",
institution = "Harvard University",
address = "Cambridge, MA, USA",
pages = "??",
month = "??",
year = "1981",
bibdate = "Sun May 02 07:50:09 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1990.bib;
https://www.math.utah.edu/pub/tex/bib/hash.bib;
https://www.math.utah.edu/pub/tex/bib/master.bib;
https://www.math.utah.edu/pub/tex/bib/string-matching.bib",
note = "An incremental hash function is described for
application to the string search problem. See
\cite{Baeza-Yates:1992:NAT}.",
acknowledgement = ack-nhfb,
}
@Article{Tharp:1982:PTS,
author = "A. L. Tharp and K.-C. Tai",
title = "The practicality of text signatures for accelerating
string searching",
journal = j-SPE,
volume = "12",
number = "1",
pages = "35--44",
month = jan,
year = "1982",
CODEN = "SPEXBL",
ISSN = "0038-0644 (print), 1097-024X (electronic)",
bibdate = "Tue Feb 06 05:30:19 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Expands Harrison's work \cite{Harrison:1971:IST}.",
acknowledgement = ack-nhfb,
}
@Article{Skovgaard:1975:RBF,
author = "Ove Skovgaard",
title = "Remark on ``{Algorithm 236: Bessel Functions of the
First Kind [S17]}''",
journal = j-TOMS,
volume = "1",
number = "3",
pages = "282--284",
month = sep,
year = "1975",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:43 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/elefunt.bib",
note = "See \cite{Gautschi:1964:AAB}.",
acknowledgement = ack-nhfb,
}
@Article{Misra:1975:RG,
author = "Jayadev Misra",
title = "Remark on ``{Algorithm 246: Graycode [Z]}''",
journal = j-TOMS,
volume = "1",
number = "3",
pages = "285--285",
month = sep,
year = "1975",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:25:57 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Boothroyd:1964:AAG,Er:1985:RG}.",
acknowledgement = ack-nhfb,
}
@Article{Feinstein:1975:RMT,
author = "Robert Feinstein",
title = "Remark on ``{Algorithm 483: Masked Three-Dimensional
Plot Program with Rotations [J6]}''",
journal = j-TOMS,
volume = "1",
number = "9",
pages = "285--285",
month = sep,
year = "1975",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:25:34 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Watkins:1974:AAM}.",
acknowledgement = ack-nhfb,
}
@Article{Boulton:1976:REP,
author = "D. M. Boulton",
title = "Remark on ``{Algorithm 434: Exact Probabilities for
$R\times{C}$ Contingency Tables [G2]}''",
journal = j-TOMS,
volume = "2",
number = "1",
pages = "108--108",
month = mar,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:29 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{March:1972:AAE}.",
acknowledgement = ack-nhfb,
}
@Article{Duta:1976:RVS,
author = "Lucian D. Duta",
title = "Remark on ``{Algorithm 475: Visible Surface Plotting
Program [J6]}''",
journal = j-TOMS,
volume = "2",
number = "1",
pages = "109--110",
month = mar,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:59 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Wright:1974:AAV}.",
acknowledgement = ack-nhfb,
}
@Article{White:1976:RMS,
author = "G. M. White and S. Goudreau and J. L. Legros",
title = "Remark on ``{Algorithm 479: A Minimal Spanning Tree
Clustering Method [Z]}''",
journal = j-TOMS,
volume = "2",
number = "1",
pages = "110--111",
month = mar,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:06 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Page:1974:AAM}.",
acknowledgement = ack-nhfb,
}
@Article{Pomeranz:1976:REC,
author = "J. Pomeranz",
title = "Remark on ``{Algorithm 487: Exact Cumulative
Distribution of the Kolmogorov--Smirnov Statistic for
Small Samples [S14]}''",
journal = j-TOMS,
volume = "2",
number = "1",
pages = "111--111",
month = mar,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:05 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Pomeranz:1974:AAE}.",
acknowledgement = ack-nhfb,
}
@Article{Morris:1976:RDF,
author = "Robert Morris",
title = "Remark on ``{Algorithm 490: The Dilogarithm Function
of a Real Argument [S22]}''",
journal = j-TOMS,
volume = "2",
number = "1",
pages = "112--112",
month = mar,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:02 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ginsberg:1975:AAD}.",
acknowledgement = ack-nhfb,
}
@Article{Pike:1976:RIB,
author = "Malcolm C. Pike and Jennie SooHoo",
title = "Remark on ``{Algorithm 179: Incomplete Beta Ratio
[S14]}''",
journal = j-TOMS,
volume = "2",
number = "2",
pages = "207--208",
month = jun,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:04 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Ludwig:1963:AAI}.",
acknowledgement = ack-nhfb,
}
@Article{Anderson:1976:RIS,
author = "Michael R. Anderson",
title = "Remark on ``{Algorithm 433: Interpolation and Smooth
Curve Fitting Based on Local Procedures [E2]}''",
journal = j-TOMS,
volume = "2",
number = "2",
pages = "208--208",
month = jun,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:36 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Akima:1972:AAI}.",
acknowledgement = ack-nhfb,
}
@Article{Davies:1976:RAR,
author = "Alan M. Davies",
title = "Remark on ``{Algorithm 450: Rosenbrock Function
Minimization [E4]}''",
journal = j-TOMS,
volume = "2",
number = "3",
pages = "300--301",
month = sep,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:54 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Machura:1973:AAR}.",
acknowledgement = ack-nhfb,
}
@Article{Brown:1976:RAS,
author = "Theodore Brown",
title = "Remark on ``{Algorithm 489: The Algorithm SELECT ---
for Finding the $i$th Smallest of $n$ Elements
[M1]}''",
journal = j-TOMS,
volume = "2",
number = "3",
pages = "301--304",
month = sep,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:26:24 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Floyd:1975:AAA}.",
acknowledgement = ack-nhfb,
}
@Article{Ito:1976:RIT,
author = "M. R. Ito",
title = "Remark on ``{Algorithm 284: Interchange of Two Blocks
of Data [K2]}''",
journal = j-TOMS,
volume = "2",
number = "4",
pages = "392--393",
month = dec,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:27:37 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Fletcher:1966:AAI}.",
acknowledgement = ack-nhfb,
}
@Article{Lozy:1976:RCS,
author = "Mohamed el Lozy",
title = "Remark on ``{Algorithm 299: Chi-Squared Integral
[S15]}''",
journal = j-TOMS,
volume = "2",
number = "4",
pages = "393--395",
month = dec,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:00 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Hill:1967:AAC,Hill:1985:RCS}.",
acknowledgement = ack-nhfb,
}
@Article{Koppelaar:1976:RNI,
author = "Henk Koppelaar and Peter Molenaar",
title = "Remark on ``{Algorithm 486: Numerical Inversion of
Laplace Transform [D5]}''",
journal = j-TOMS,
volume = "2",
number = "4",
pages = "395--396",
month = dec,
year = "1976",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:27:48 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Veillon:1974:AAN}.",
acknowledgement = ack-nhfb,
}
@Article{Cate:1977:AAS,
author = "Esko G. Cate and David W. Twigg",
title = "Algorithm 513: Analysis of In-Situ Transposition
[{F1}]",
journal = j-TOMS,
volume = "3",
number = "1",
pages = "104--110",
month = mar,
year = "1977",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Thu Apr 29 17:24:56 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See remark \cite{Leathers:1979:RAS}.",
acknowledgement = ack-nhfb,
}
@Article{Veillon:1977:RNI,
author = "Fran{\c{c}}oise Veillon",
title = "Remark on ``{Algorithm 486: Numerical Inversion of
Laplace Transform}''",
journal = j-TOMS,
volume = "3",
number = "1",
pages = "111--111",
month = mar,
year = "1977",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:10 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Veillon:1974:AAN}.",
acknowledgement = ack-nhfb,
}
@Article{Jansen:1977:RLF,
author = "J. K. M. Jansen",
title = "Remark on ``{Algorithm 259: Legendre Functions for
Arguments Larger than One}''",
journal = j-TOMS,
volume = "3",
number = "2",
pages = "204--250",
month = jun,
year = "1977",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:08 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gautschi:1965:AAL}.",
acknowledgement = ack-nhfb,
}
@Article{Sipala:1977:RAS,
author = "Paolo Sipala",
title = "Remark on ``{Algorithm 408: A Sparse Matrix Package
(Part I) [F4]}''",
journal = j-TOMS,
volume = "3",
number = "3",
pages = "303--303",
month = sep,
year = "1977",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:09 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McNamee:1971:AAS}.",
acknowledgement = ack-nhfb,
}
@Article{Tenney:1977:RAT,
author = "Dennis Tenney",
title = "Remark on ``{Algorithm 219: Topological Ordering for
PERT Networks}''",
journal = j-TOMS,
volume = "3",
number = "3",
pages = "303--303",
month = sep,
year = "1977",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:09 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Kase:1963:AAT}.",
acknowledgement = ack-nhfb,
}
@Article{Skovgaard:1978:RCE,
author = "Ove Skovgaard",
title = "Remark on ``{Algorithm 149: Complete Elliptic Integral
[S21]}''",
journal = j-TOMS,
volume = "4",
number = "1",
pages = "95--95",
month = mar,
year = "1978",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:13 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Merner:1962:AAC}.",
acknowledgement = ack-nhfb,
}
@Article{Coleman:1978:RAS,
author = "John P. Coleman",
title = "Remark on ``{Algorithm 49: Spherical Neumann
Function}''",
journal = j-TOMS,
volume = "4",
number = "3",
pages = "295--295",
month = sep,
year = "1978",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:11 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Herndon:1961:AASa}.",
acknowledgement = ack-nhfb,
}
@Article{Gustavson:1978:RAS,
author = "Fred G. Gustavson",
title = "Remark on ``{Algorithm 408: A Sparse Matrix Package
(Part I) [F4]}''",
journal = j-TOMS,
volume = "4",
number = "3",
pages = "295--295",
month = sep,
year = "1978",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:12 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McNamee:1971:AAS}.",
acknowledgement = ack-nhfb,
}
@Article{Schoene:1978:RMI,
author = "Andrew Y. Schoene",
title = "Remark on ``{Algorithm 435: Modified Incomplete Gamma
Function [S14]}''",
journal = j-TOMS,
volume = "4",
number = "3",
pages = "296--304",
month = sep,
year = "1978",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:12 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Fullerton:1972:AAM}.",
acknowledgement = ack-nhfb,
}
@Article{Lozy:1979:RSD,
author = "Mohamed el Lozy",
title = "Remark on ``{Algorithm 395: Student's
$t$-Distribution}'' and Remark on ``{Algorithm 396:
Student's Quantiles [S14]}''",
journal = j-TOMS,
volume = "5",
number = "2",
pages = "238--239",
month = jun,
year = "1979",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:16 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Hill:1970:AASa,Hill:1970:AASb,Hill:1981:RSD,Hill:1985:RCS}.",
acknowledgement = ack-nhfb,
}
@Article{Geddes:1979:RCC,
author = "K. O. Geddes",
title = "Remark on ``{Algorithm 424: Clenshaw--Curtis
Quadrature [O1]}''",
journal = j-TOMS,
volume = "5",
number = "2",
pages = "240--240",
month = jun,
year = "1979",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:14 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Gentleman:1972:AAC}.",
acknowledgement = ack-nhfb,
}
@Article{Anderson:1979:RBI,
author = "M. R. Anderson",
title = "Remark on ``{Algorithm 474: Bivariate Interpolation
and Smooth Surface Fitting Based on Local
Procedures}''",
journal = j-TOMS,
volume = "5",
number = "2",
pages = "241--241",
month = jun,
year = "1979",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:13 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Akima:1974:AAB}.",
acknowledgement = ack-nhfb,
}
@Article{Leathers:1979:RAS,
author = "Burton L. Leathers",
title = "Remark on ``{Algorithm 513: Analysis of In-Situ
Transposition [F1]}'' and Remark on ``{Algorithm 467:
Matrix Transposition in Place}''",
journal = j-TOMS,
volume = "5",
number = "4",
pages = "520--520",
month = dec,
year = "1979",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:15 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Cate:1977:AAS,Brenner:1973:AAM}.",
acknowledgement = ack-nhfb,
}
@Article{Swieten:1979:RVS,
author = "A. C. M. van Swieten and J. Th. M. de Hosson",
title = "Remark on ``{Algorithm 475: Visible Surface Plotting
Program}''",
journal = j-TOMS,
volume = "5",
number = "4",
pages = "521--523",
month = dec,
year = "1979",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:16 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Wright:1974:AAV}.",
acknowledgement = ack-nhfb,
}
@Article{Harms:1980:RSM,
author = "U. Harms and H. Kollakowski and G. M{\"{o}}ller",
title = "Remark on ``{Algorithm 408: A Sparse Matrix Package
(Part 1) [F4]}''",
journal = j-TOMS,
volume = "6",
number = "3",
pages = "456--457",
month = sep,
year = "1980",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:17 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{McNamee:1971:AAS}.",
acknowledgement = ack-nhfb,
}
@Article{Hill:1981:RSD,
author = "G. W. Hill",
title = "Remark on ``{Algorithm 395: Student's
$t$-Distribution}''",
journal = j-TOMS,
volume = "7",
number = "2",
pages = "247--249",
month = jun,
year = "1981",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:18 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Hill:1970:AASa,Hill:1970:AASb,Lozy:1979:RSD}.",
acknowledgement = ack-nhfb,
}
@Article{Hill:1981:RSQ,
author = "G. W. Hill",
title = "Remark on ``{Algorithm 396: Student's
$t$-Quantiles}''",
journal = j-TOMS,
volume = "7",
number = "2",
pages = "250--251",
month = jun,
year = "1981",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:19 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Hill:1970:AASb}.",
acknowledgement = ack-nhfb,
}
@Article{Peemoller:1983:CBM,
author = "J{\"{u}}rgen Peem{\"{o}}ller",
title = "A correction to {Br\'elaz}'s modification of {Brown}'s
coloring algorithm",
journal = j-CACM,
volume = "26",
number = "8",
pages = "595--597",
month = aug,
year = "1983",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Tue Jan 09 15:58:07 1996",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/clique.color.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
acknowledgement = ack-nhfb,
annote = "Corrects implicit enumeration algorithm in
\cite{Brelaz:1979:NMC}.",
journal-URL = "https://dl.acm.org/loi/cacm",
}
@Article{Er:1985:RG,
author = "M. C. Er",
title = "Remark on ``{Algorithm 246: Graycode [Z]}''",
journal = j-TOMS,
volume = "11",
number = "4",
pages = "441--443",
month = dec,
year = "1985",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:21 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Boothroyd:1964:AAG,Misra:1975:RG}.",
acknowledgement = ack-nhfb,
}
@Article{Hill:1985:RCS,
author = "I. D. Hill and M. C. Pike",
title = "Remark on ``{Algorithm 299: Chi-Squared Integral}''",
journal = j-TOMS,
volume = "11",
number = "2",
pages = "185--185",
month = jun,
year = "1985",
CODEN = "ACMSCU",
ISSN = "0098-3500 (print), 1557-7295 (electronic)",
bibdate = "Tue Feb 06 05:28:22 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See
\cite{Hill:1967:AAC,Lozy:1976:RCS,Lozy:1979:RSD}.",
acknowledgement = ack-nhfb,
}
@Article{Kubale:1985:GIE,
author = "Marek Kubale and Boguslaw Jackowski",
title = "A generalized implicit enumeration algorithm for graph
coloring",
journal = j-CACM,
volume = "28",
number = "4",
pages = "412--418",
month = apr,
year = "1985",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu May 30 09:41:10 MDT 1996",
bibsource = "ftp://ftp.ira.uka.de/pub/bibliography/Theory/clique.color.bib;
http://www.acm.org/pubs/toc/;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
URL = "http://www.acm.org/pubs/toc/Abstracts/0001-0782/3350.html",
acknowledgement = ack-nhfb,
annote = "Presents algorithm and gives experimental comparison
to approaches of
\cite{Brown:1972:CSC,Jones:1986:ECP,Brelaz:1979:NMC,Korman:1970:CO}.",
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; measurement; performance; theory",
subject = "{\bf G.2.2}: Mathematics of Computing, DISCRETE
MATHEMATICS, Graph Theory, Graph algorithms. {\bf
F.2.2}: Theory of Computation, ANALYSIS OF ALGORITHMS
AND PROBLEM COMPLEXITY, Nonnumerical Algorithms and
Problems, Computations on discrete structures. {\bf
I.2.8}: Computing Methodologies, ARTIFICIAL
INTELLIGENCE, Problem Solving, Control Methods, and
Search, Backtracking.",
}
@Article{Jones:1986:ECP,
author = "Douglas W. Jones",
title = "An empirical comparison of priority-queue and
event-set implementations",
journal = j-CACM,
volume = "29",
number = "4",
pages = "300--311",
month = apr,
year = "1986",
CODEN = "CACMA2",
ISSN = "0001-0782 (print), 1557-7317 (electronic)",
ISSN-L = "0001-0782",
bibdate = "Thu Apr 29 17:35:40 1999",
bibsource = "http://www.acm.org/pubs/toc/;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Kubale:1985:GIE}.",
URL = "http://www.acm.org/pubs/toc/Abstracts/0001-0782/5686.html",
acknowledgement = ack-nhfb,
journal-URL = "https://dl.acm.org/loi/cacm",
keywords = "algorithms; measurement; performance",
review = "ACM CR 8701-0018",
subject = "{\bf E.1}: Data, DATA STRUCTURES. {\bf E.2}: Data,
DATA STORAGE REPRESENTATIONS, Linked representations.
{\bf E.1}: Data, DATA STRUCTURES, Trees. {\bf I.6.1}:
Computing Methodologies, SIMULATION AND MODELING,
Simulation Theory, Types of simulation (continuous and
discrete)*.",
}
@Manual{ANSI:1966:AF,
title = "{ANSI Fortran X3.9-1966}",
organization = pub-ANSI,
address = pub-ANSI:adr,
pages = "??--??",
year = "1966",
bibdate = "Sat Jan 18 15:48:20 1997",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Approved March 7, 1966 (also known as Fortran 66). See
also subsequent clarifications \cite{ANSI:1969:CFS} and
\cite{ANSI:1971:CFS}.",
acknowledgement = ack-nhfb,
}
@PhdThesis{deBalbine:1969:CAR,
author = "Guy {de Balbine}",
title = "Computational Analysis of the Random Components
Induced by a Binary Equivalence Relation",
type = "Ph.D. thesis",
school = "California Institute of Technology",
address = "Pasadena, CA, USA",
pages = "168",
year = "1969",
bibdate = "Thu Apr 29 17:30:58 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "First use of second hash function for computing next
hash table location after a collision. See also
\cite{Bell:1970:LQH}.",
abstract = "The problem of partitioning into classes by means of a
binary equivalence relation is investigated. Several
algorithms for determining the number of components in
the graph associated with a particular set of elements
are constructed and compared. When the classification
process operates on independently-drawn samples of $n$
distinct elements from a population, the expected
number of components is shown to be obtainable
recursively for a class of problems called separable;
in all cases, estimates are available to reach any
desired level of accuracy. Clustering models in
Euclidean space are analyzed in detail and asymptotic
formulas obtained to complement experiments.
Conjectures concerning the general behavior of the
expected number of components are presented also.
Finally, several computational tools of general
interest are improved significantly.",
acknowledgement = ack-nhfb,
annote = "Abstract in Dissertation Abstracts, v30 n2 p645b
1969.",
}
@InProceedings{Korman:1970:CO,
author = "S. M. Korman",
editor = "N. Christofides and A. Mingozzi and P. Toth and C.
Sandi",
booktitle = "Combinatorial Optimization",
title = "The graph-colouring problem",
publisher = "Wiley",
address = "New York",
pages = "211--235",
year = "1970",
bibdate = "Thu Apr 29 18:39:27 1999",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "See \cite{Kubale:1985:GIE}.",
acknowledgement = ack-nhfb,
annote = "Implicit enumeration algorithm [not seen].",
}
@Book{Knuth:1973:ACP,
author = "D. E. Knuth",
title = "The Art of Computer Programming, Sorting and
Searching",
volume = "3",
publisher = pub-AW,
address = pub-AW:adr,
pages = "xi + 723",
year = "1973",
ISBN = "0-201-03803-X",
ISBN-13 = "978-0-201-03803-3",
LCCN = "QA76.5 .K74",
bibdate = "Wed Dec 15 15:47:47 1993",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib",
acknowledgement = ack-nhfb,
annote = "Standardwerk ueber Suchen und Sortieren 5. Sorting
5.1. Combinatorial Properties of Permutations 5.2.
Internal Sorting 5.3. Optimum Sorting 5.4. External
Sorting 5.5. Summary, History, and Bibliography 6.
Searching 6.1. Sequential Search 6.2. Searching By
Comparison of Keys 6.3. Digital Searching 6.4. Hashing
6.5. Retrieval on Secondary Keys Answers to Exercises
Appendix A: Tables of Numerical Quantities Appendix B:
Index to Notations Index and Glossary.",
annote2 = "A basic source for computational algorithms such as
hashing (pp.506--568), search tree
construction(pp.406--505), and some notes on disk
performance evaluation (pp.361--371).",
descriptor = "Algorithmus, B-baum, Baum, Binaer-baum, Gestreute
Speicherung, Hash-verfahren, Mischen, Sortieren,
Speicherung, Suchen, Zugriff",
}
@MastersThesis{Dittmer:1976:IEP,
author = "Ingo Dittmer",
title = "{Implementation eines Einschrittcompilers f{\"u}r die
Programmiersprache PASCAL auf der Rechenanlage
IBM\slash 360 der Universit{\"a}t M{\"u}nster}.
({English} title: Implementation of a One-Step Compiler
for the Programming Language {PASCAL} on the
{IBM}\slash 360 of the {University of Muenster})",
type = "Diplomearbeit",
school = "Universit{\"a}t M{\"u}nster",
address = "M{\"u}nster, Germany",
pages = "??",
month = "??",
year = "1976",
bibdate = "Sat Feb 17 13:24:29 1996",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
note = "Diplomearbeit M{\"u}nster 1976 und doert angegebene
Literatur (English: Muenster diploma work 1976 and the
literature cited therein). The hashing method was
rediscovered fourteen years later by Pearson
\cite{Pearson:1990:FHV}, and then commented on by
several authors
\cite{Dittmer:1991:NFH,Savoy:1991:NFH,Litsios:1991:NFH,Pearson:1991:NFH}.",
acknowledgement = ack-nhfb,
xxnote = "Cannot find in Dissertation Abstracts, European.",
}
@Book{Stonebraker:1988:RDS,
editor = "Michael Stonebraker",
booktitle = "Readings in Database Systems",
title = "Readings in Database Systems",
publisher = pub-MORGAN-KAUFMANN,
address = pub-MORGAN-KAUFMANN:adr,
pages = "xii + 644",
year = "1988",
ISBN = "0-934613-65-6",
ISBN-13 = "978-0-934613-65-1",
LCCN = "QA76.9.D3 R4 1988",
bibdate = "Tue Jul 19 00:53:02 1994",
bibsource = "https://www.math.utah.edu/pub/tex/bib/cacm1970.bib",
price = "US\$29.95",
abstract = "The purpose of this collection is to assemble
significant research contributions so they are easily
access-ible to anyone interested in database research.
It is appropriate for use as an introduction for
students or professionals from industry, and as a
reference volume to anyone active in database systems
\ldots. It is intended to serve as a core of material
that any DBMS professional should be familiar with.
Moreover, any industrial practitioner or graduate
student who wishes to be current on the important
research themes would be well advised to read these
papers.",
acknowledgement = ack-nhfb,
bookpages = "xii + 644",
xxnote = "Contains reprint of \cite{Litwin:1980:LHN}.",
}
@Book{Knuth:1992:LP,
author = "Donald E. Knuth",
title = "Literate Programming",
volume = "27",
publisher = pub-SUCSLI,
address = pub-SUCSLI:adr,
pages = "xv + 368",
year = "1992",
ISBN = "0-937073-80-6 (paperback), 0-937073-81-4 (hardcover)",
ISBN-13 = "978-0-937073-80-3 (paperback), 978-0-937073-81-0
(hardcover)",
LCCN = "QA76.6.K644",
bibdate = "Tue Mar 03 12:24:41 1998",
bibsource = "https://www.math.utah.edu/pub/bibnet/authors/d/dijkstra-edsger-w.bib;
https://www.math.utah.edu/pub/tex/bib/acm-turing-awards.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1970.bib;
https://www.math.utah.edu/pub/tex/bib/cacm1980.bib;
https://www.math.utah.edu/pub/tex/bib/css.bib;
https://www.math.utah.edu/pub/tex/bib/litprog.bib;
https://www.math.utah.edu/pub/tex/bib/master.bib;
https://www.math.utah.edu/pub/tex/bib/spell.bib;
https://www.math.utah.edu/pub/tex/bib/texbook3.bib",
series = "CSLI Lecture Notes",
URL = "http://csli-www.stanford.edu/publications/literate.html",
acknowledgement = ack-nhfb,
keywords = "electronic digital computers --- programming",
remark = "See translation \cite{Knuth:1994:BP}.",
tableofcontents = "1: Computer programming as an art / 1 \\
2: Structured programming with go to statements / 17
\\
3: A structured program to generate all topological
sorting arrangements / 91 \\
4: Literate programming / 99 \\
5: Programming pearls: Sampling / 137 \\
6: Programming pearls, continued: Common Words / 151
\\
7: How to read a WEB / 179 \\
8: Excerpts from the programs for \TeX{} and METAFONT /
185 \\
9: Mathematical writing / 235 \\
10: Errors of \TeX{} / 243 \\
11: Error log of \TeX{} / 293 \\
12: Example of CWEB / 341 \\
Further Reading / 349 \\
Index / 359",
}